changeset 0:b2e4605f20b2

beta version
author dwinter
date Thu, 30 Jun 2011 09:07:49 +0200
parents
children 95e1e37915c6
files .project .pydevproject .settings/org.eclipse.core.resources.prefs MPIWGThesaurus.py __init__.py jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png jquery-ui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png jquery-ui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png jquery-ui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png jquery-ui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png jquery-ui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png jquery-ui/css/ui-lightness/images/ui-icons_222222_256x240.png jquery-ui/css/ui-lightness/images/ui-icons_228ef1_256x240.png jquery-ui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png jquery-ui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png jquery-ui/css/ui-lightness/images/ui-icons_ffffff_256x240.png jquery-ui/css/ui-lightness/jquery-ui-1.8.11.custom.css jquery-ui/development-bundle/AUTHORS.txt jquery-ui/development-bundle/GPL-LICENSE.txt jquery-ui/development-bundle/MIT-LICENSE.txt jquery-ui/development-bundle/demos/accordion/collapsible.html jquery-ui/development-bundle/demos/accordion/custom-icons.html jquery-ui/development-bundle/demos/accordion/default.html jquery-ui/development-bundle/demos/accordion/fillspace.html jquery-ui/development-bundle/demos/accordion/hoverintent.html jquery-ui/development-bundle/demos/accordion/index.html jquery-ui/development-bundle/demos/accordion/mouseover.html jquery-ui/development-bundle/demos/accordion/no-auto-height.html jquery-ui/development-bundle/demos/accordion/sortable.html jquery-ui/development-bundle/demos/autocomplete/categories.html jquery-ui/development-bundle/demos/autocomplete/combobox.html jquery-ui/development-bundle/demos/autocomplete/custom-data.html jquery-ui/development-bundle/demos/autocomplete/default.html jquery-ui/development-bundle/demos/autocomplete/folding.html jquery-ui/development-bundle/demos/autocomplete/images/jquery_32x32.png jquery-ui/development-bundle/demos/autocomplete/images/jqueryui_32x32.png jquery-ui/development-bundle/demos/autocomplete/images/sizzlejs_32x32.png jquery-ui/development-bundle/demos/autocomplete/images/transparent_1x1.png jquery-ui/development-bundle/demos/autocomplete/images/ui-anim_basic_16x16.gif jquery-ui/development-bundle/demos/autocomplete/index.html jquery-ui/development-bundle/demos/autocomplete/london.xml jquery-ui/development-bundle/demos/autocomplete/maxheight.html jquery-ui/development-bundle/demos/autocomplete/multiple-remote.html jquery-ui/development-bundle/demos/autocomplete/multiple.html jquery-ui/development-bundle/demos/autocomplete/remote-jsonp.html jquery-ui/development-bundle/demos/autocomplete/remote-with-cache.html jquery-ui/development-bundle/demos/autocomplete/remote.html jquery-ui/development-bundle/demos/autocomplete/search.php jquery-ui/development-bundle/demos/autocomplete/xml.html jquery-ui/development-bundle/demos/button/checkbox.html jquery-ui/development-bundle/demos/button/default.html jquery-ui/development-bundle/demos/button/icons.html jquery-ui/development-bundle/demos/button/index.html jquery-ui/development-bundle/demos/button/radio.html jquery-ui/development-bundle/demos/button/splitbutton.html jquery-ui/development-bundle/demos/button/toolbar.html jquery-ui/development-bundle/demos/demos.css jquery-ui/development-bundle/demos/dialog/animated.html jquery-ui/development-bundle/demos/dialog/default.html jquery-ui/development-bundle/demos/dialog/index.html jquery-ui/development-bundle/demos/dialog/modal-confirmation.html jquery-ui/development-bundle/demos/dialog/modal-form.html jquery-ui/development-bundle/demos/dialog/modal-message.html jquery-ui/development-bundle/demos/dialog/modal.html jquery-ui/development-bundle/demos/draggable/constrain-movement.html jquery-ui/development-bundle/demos/draggable/cursor-style.html jquery-ui/development-bundle/demos/draggable/default.html jquery-ui/development-bundle/demos/draggable/delay-start.html jquery-ui/development-bundle/demos/draggable/events.html jquery-ui/development-bundle/demos/draggable/handle.html jquery-ui/development-bundle/demos/draggable/index.html jquery-ui/development-bundle/demos/draggable/revert.html jquery-ui/development-bundle/demos/draggable/scroll.html jquery-ui/development-bundle/demos/draggable/snap-to.html jquery-ui/development-bundle/demos/draggable/sortable.html jquery-ui/development-bundle/demos/draggable/visual-feedback.html jquery-ui/development-bundle/demos/droppable/accepted-elements.html jquery-ui/development-bundle/demos/droppable/default.html jquery-ui/development-bundle/demos/droppable/images/high_tatras.jpg jquery-ui/development-bundle/demos/droppable/images/high_tatras2.jpg jquery-ui/development-bundle/demos/droppable/images/high_tatras2_min.jpg jquery-ui/development-bundle/demos/droppable/images/high_tatras3.jpg jquery-ui/development-bundle/demos/droppable/images/high_tatras3_min.jpg jquery-ui/development-bundle/demos/droppable/images/high_tatras4.jpg jquery-ui/development-bundle/demos/droppable/images/high_tatras4_min.jpg jquery-ui/development-bundle/demos/droppable/images/high_tatras_min.jpg jquery-ui/development-bundle/demos/droppable/index.html jquery-ui/development-bundle/demos/droppable/photo-manager.html jquery-ui/development-bundle/demos/droppable/propagation.html jquery-ui/development-bundle/demos/droppable/revert.html jquery-ui/development-bundle/demos/droppable/shopping-cart.html jquery-ui/development-bundle/demos/droppable/visual-feedback.html jquery-ui/development-bundle/demos/images/calendar.gif jquery-ui/development-bundle/demos/images/demo-config-on-tile.gif jquery-ui/development-bundle/demos/images/demo-config-on.gif jquery-ui/development-bundle/demos/images/demo-spindown-closed.gif jquery-ui/development-bundle/demos/images/demo-spindown-open.gif jquery-ui/development-bundle/demos/images/icon-docs-info.gif jquery-ui/development-bundle/demos/images/pbar-ani.gif jquery-ui/development-bundle/demos/index.html jquery-ui/development-bundle/demos/position/cycler.html jquery-ui/development-bundle/demos/position/default.html jquery-ui/development-bundle/demos/position/images/earth.jpg jquery-ui/development-bundle/demos/position/images/flight.jpg jquery-ui/development-bundle/demos/position/images/rocket.jpg jquery-ui/development-bundle/demos/position/index.html jquery-ui/development-bundle/demos/resizable/animate.html jquery-ui/development-bundle/demos/resizable/aspect-ratio.html jquery-ui/development-bundle/demos/resizable/constrain-area.html jquery-ui/development-bundle/demos/resizable/default.html jquery-ui/development-bundle/demos/resizable/delay-start.html jquery-ui/development-bundle/demos/resizable/helper.html jquery-ui/development-bundle/demos/resizable/index.html jquery-ui/development-bundle/demos/resizable/max-min.html jquery-ui/development-bundle/demos/resizable/snap-to-grid.html jquery-ui/development-bundle/demos/resizable/synchronous-resize.html jquery-ui/development-bundle/demos/resizable/textarea.html jquery-ui/development-bundle/demos/resizable/visual-feedback.html jquery-ui/development-bundle/demos/selectable/default.html jquery-ui/development-bundle/demos/selectable/display-grid.html jquery-ui/development-bundle/demos/selectable/index.html jquery-ui/development-bundle/demos/selectable/serialize.html jquery-ui/development-bundle/demos/sortable/connect-lists-through-tabs.html jquery-ui/development-bundle/demos/sortable/connect-lists.html jquery-ui/development-bundle/demos/sortable/default.html jquery-ui/development-bundle/demos/sortable/delay-start.html jquery-ui/development-bundle/demos/sortable/display-grid.html jquery-ui/development-bundle/demos/sortable/empty-lists.html jquery-ui/development-bundle/demos/sortable/index.html jquery-ui/development-bundle/demos/sortable/items.html jquery-ui/development-bundle/demos/sortable/placeholder.html jquery-ui/development-bundle/demos/sortable/portlets.html jquery-ui/development-bundle/docs/accordion.html jquery-ui/development-bundle/docs/autocomplete.html jquery-ui/development-bundle/docs/button.html jquery-ui/development-bundle/docs/dialog.html jquery-ui/development-bundle/docs/draggable.html jquery-ui/development-bundle/docs/droppable.html jquery-ui/development-bundle/docs/position.html jquery-ui/development-bundle/docs/resizable.html jquery-ui/development-bundle/docs/selectable.html jquery-ui/development-bundle/docs/sortable.html jquery-ui/development-bundle/external/jquery.bgiframe-2.1.2.js jquery-ui/development-bundle/external/jquery.cookie.js jquery-ui/development-bundle/external/jquery.metadata.js jquery-ui/development-bundle/external/qunit.css jquery-ui/development-bundle/external/qunit.js jquery-ui/development-bundle/jquery-1.5.1.js jquery-ui/development-bundle/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png jquery-ui/development-bundle/themes/base/images/ui-bg_flat_75_ffffff_40x100.png jquery-ui/development-bundle/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png jquery-ui/development-bundle/themes/base/images/ui-bg_glass_65_ffffff_1x400.png jquery-ui/development-bundle/themes/base/images/ui-bg_glass_75_dadada_1x400.png jquery-ui/development-bundle/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png jquery-ui/development-bundle/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png jquery-ui/development-bundle/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png jquery-ui/development-bundle/themes/base/images/ui-icons_222222_256x240.png jquery-ui/development-bundle/themes/base/images/ui-icons_2e83ff_256x240.png jquery-ui/development-bundle/themes/base/images/ui-icons_454545_256x240.png jquery-ui/development-bundle/themes/base/images/ui-icons_888888_256x240.png jquery-ui/development-bundle/themes/base/images/ui-icons_cd0a0a_256x240.png jquery-ui/development-bundle/themes/base/jquery.ui.accordion.css jquery-ui/development-bundle/themes/base/jquery.ui.all.css jquery-ui/development-bundle/themes/base/jquery.ui.autocomplete.css jquery-ui/development-bundle/themes/base/jquery.ui.base.css jquery-ui/development-bundle/themes/base/jquery.ui.button.css jquery-ui/development-bundle/themes/base/jquery.ui.core.css jquery-ui/development-bundle/themes/base/jquery.ui.dialog.css jquery-ui/development-bundle/themes/base/jquery.ui.resizable.css jquery-ui/development-bundle/themes/base/jquery.ui.selectable.css jquery-ui/development-bundle/themes/base/jquery.ui.theme.css jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_flat_10_000000_40x100.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_222222_256x240.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_228ef1_256x240.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_ef8c08_256x240.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_ffd27a_256x240.png jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_ffffff_256x240.png jquery-ui/development-bundle/themes/ui-lightness/jquery-ui-1.8.11.custom.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.accordion.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.all.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.autocomplete.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.base.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.button.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.core.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.dialog.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.resizable.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.selectable.css jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.theme.css jquery-ui/development-bundle/ui/jquery-ui-1.8.11.custom.js jquery-ui/development-bundle/ui/jquery.ui.accordion.js jquery-ui/development-bundle/ui/jquery.ui.autocomplete.js jquery-ui/development-bundle/ui/jquery.ui.button.js jquery-ui/development-bundle/ui/jquery.ui.core.js jquery-ui/development-bundle/ui/jquery.ui.dialog.js jquery-ui/development-bundle/ui/jquery.ui.draggable.js jquery-ui/development-bundle/ui/jquery.ui.droppable.js jquery-ui/development-bundle/ui/jquery.ui.mouse.js jquery-ui/development-bundle/ui/jquery.ui.position.js jquery-ui/development-bundle/ui/jquery.ui.resizable.js jquery-ui/development-bundle/ui/jquery.ui.selectable.js jquery-ui/development-bundle/ui/jquery.ui.sortable.js jquery-ui/development-bundle/ui/jquery.ui.widget.js jquery-ui/development-bundle/ui/minified/jquery.ui.accordion.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.autocomplete.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.button.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.core.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.dialog.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.draggable.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.droppable.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.mouse.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.position.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.resizable.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.selectable.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.sortable.min.js jquery-ui/development-bundle/ui/minified/jquery.ui.widget.min.js jquery-ui/development-bundle/version.txt jquery-ui/index.html jquery-ui/js/jquery-1.5.1.min.js jquery-ui/js/jquery-ui-1.8.11.custom.min.js zpt/addMPIWGThesaurusForm.zpt zpt/changeMPIWGThesaurusForm.zpt zpt/index.html
diffstat 233 files changed, 45590 insertions(+), 0 deletions(-) [+]
line wrap: on
line diff
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/.project	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,17 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<projectDescription>
+	<name>MPIWGThesaurus</name>
+	<comment></comment>
+	<projects>
+	</projects>
+	<buildSpec>
+		<buildCommand>
+			<name>org.python.pydev.PyDevBuilder</name>
+			<arguments>
+			</arguments>
+		</buildCommand>
+	</buildSpec>
+	<natures>
+		<nature>org.python.pydev.pythonNature</nature>
+	</natures>
+</projectDescription>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/.pydevproject	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,10 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<?eclipse-pydev version="1.0"?>
+
+<pydev_project>
+<pydev_property name="org.python.pydev.PYTHON_PROJECT_INTERPRETER">python2.4</pydev_property>
+<pydev_property name="org.python.pydev.PYTHON_PROJECT_VERSION">python 2.4</pydev_property>
+<pydev_pathproperty name="org.python.pydev.PROJECT_SOURCE_PATH">
+<path>/MPIWGThesaurus</path>
+</pydev_pathproperty>
+</pydev_project>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/.settings/org.eclipse.core.resources.prefs	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,3 @@
+#Mon Apr 11 12:31:27 CEST 2011
+eclipse.preferences.version=1
+encoding/<project>=UTF-8
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/MPIWGThesaurus.py	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,943 @@
+# TODO: generell verwaltung der tags im triple store und nicht in zope.
+from OFS.Folder import Folder
+from Globals import package_home
+from Products.PageTemplates.PageTemplateFile import PageTemplateFile
+from BTrees.OOBTree import OOBTree
+from BTrees.OOBTree import OOSet
+   
+#import os
+import os.path
+import logging
+import time
+import email.Utils
+from types import ListType
+import transaction
+import random
+import urllib2
+import urllib
+
+class Entry:
+    """publicClass"""
+    def __init__(self,title,entries=[]):
+        self.title=title
+        self.entries=entries
+        
+    def getTitle(self):
+        """getTitle"""
+        return self.title
+    
+class SuggestedTag:
+    """publicClass"""
+    type=""
+    userName=""
+    def __init__(self,name,comment,type,userName):
+        self.name=name
+        self.comment=comment
+        self.type=type
+        self.userName=userName
+        
+
+class MPIWGThesaurus(Folder):
+    """MPIWGThesaurus main folder"""
+    meta_type="MPIWGThesaurus"
+   
+    TMP_PERSON_NS="http://ontologies.mpiwg-berlin.mpg.de/tempObjects/person/"
+    ONTOLOGY_NS="http://ontologies.mpiwg-berlin.mpg.de/authorities/namedIdentities/"
+    #personproviderURL="http://127.0.0.1:8280/MetaDataManagerRestlet/person/"
+    personproviderURL="http://virtuoso.mpiwg-berlin.mpg.de:8080/MetaDataManagerRestlet/person/"
+    additionalNamesGraphURL="file://newpersonsFromProjects"
+    
+    #virtuosoServer="http://ontologies.mpiwg-berlin.mpg.de"
+    virtuosoServer="http://virtuoso.mpiwg-berlin.mpg.de:8890"
+    virtuosoDAV="/DAV/home/websiteuser/"
+    virtuosoDAVUser="websiteuser"
+    virtuosoDAVPW="w3s45us3"
+    virtuosoGraph="file://newpersonsFromProjects"
+    
+    projectPersons= OOBTree()
+    projectObjects= OOBTree()
+    projectHistoricalPlaces= OOBTree()
+    projectSuggestedTags= OOBTree()
+    persons2Projects= OOBTree()
+    object2Projects=OOBTree()
+    historicalPlaces2Projects=OOBTree()
+    suggestedTags2Projects=OOBTree()
+    personIDtoNames=OOBTree()
+    suggestedPersons= OOBTree(); #TODO: das sollte die ueberfluessig werde und nur im triple store stehen.
+    
+    tagList=[]
+    approachesTxt="""A
+    ---
+    ent1
+    ---
+    B
+    ---
+    enta
+    entb
+    entc
+    """
+    
+    disciplines=[]
+    disciplinesTxt="""A
+   B
+   C
+    """
+    
+    periods=[]
+    periodsTxt="""PA
+   PB
+   PC
+    """
+    
+    spaces=[]
+    spacesTxt="""SPA
+    ---
+    sPent1
+    ---
+    SPB
+    ---
+    SPenta
+    SPentb
+    SPentc
+    """
+    technologies=[]
+    technologiesTxt="""TPA
+    ---
+    TPent1
+    ---
+    TPB
+    ---
+    TPenta
+    TPentb
+    TPentc
+    """
+    
+    knowledgeTransfers=[]
+    knowledgeTransfersTxt="""KTPA
+    ---
+    TPent1
+    ---
+    TPB
+    ---
+    TPenta
+    TPentb
+    TPentc
+    """
+    
+    
+    
+    
+    
+    
+    manage_options = Folder.manage_options+(
+        {'label':'Main Config','action':'changeMPIWGThesaurusForm'},
+        #{'label':'Change Publications Special','action':'changePublications_specialForm'},
+        )
+    
+    def __init__(self,id):
+        """init"""
+        self.id=id
+       
+        
+    def index_html(self):
+        """index file"""
+        
+#        if hasattr(self,"storedProjectPersons"):
+#            self.projectPersons= getattr(self,"storedProjectPersons");
+#        
+#        if hasattr(self,"storedProjectObjects"):
+#            self.projectPersons= getattr(self,"storedProjectObjects");
+#       
+#      
+   
+        pt=PageTemplateFile(os.path.join(package_home(globals()),'zpt','index.html')).__of__(self)
+        return pt()
+    
+    
+    def changeMPIWGThesaurusForm(self):
+        """form for changing the project"""
+        pt=PageTemplateFile(os.path.join(package_home(globals()),'zpt','changeMPIWGThesaurusForm.zpt')).__of__(self)
+        return pt()
+    
+    def changeMPIWGThesaurus(self,approachesTxt,disciplinesTxt,periodsTxt,spacesTxt,technologiesTxt,knowledgeTransfersTxt,RESPONSE=None):
+        """change it"""
+        self.approachesTxt=approachesTxt
+        self.disciplinesTxt=disciplinesTxt
+        self.periodsTxt=periodsTxt
+        self.spacesTxt=spacesTxt
+        self.technologiesTxt=technologiesTxt
+        self.knowledgeTransfersTxt=knowledgeTransfersTxt
+    
+        if RESPONSE is not None:
+            redirect(RESPONSE,'manage_main')
+     
+    #In der Anzeige soll der Name der zitierten Personen in Klartext angezeigt werden, ausserdem die Varianten, wie sie tatsaechlich
+    #in den Projekten benutzt werden
+    def collectPersonNamesToIds(self):
+        """finde Namen zu den personen ids"""
+        self.personIDtoNames=OOBTree() # loessche alle 
+        
+        for personID in self.persons2Projects:
+            mainName=self.getMainNameFromTripleStore(personID); # hole die hauptbezeichnung aus dem triplestore
+            
+            personNames=[]
+            for project in self.persons2Projects.get(personID):
+                #hole die personen aus dem projekte 
+                logging.debug("Found:project:"+project)
+                namesInProject = self.projectPersons.get(project)
+                
+                for nameInProjectTuple in namesInProject:
+                    logging.debug(repr(nameInProjectTuple))
+                    nameInProject=nameInProjectTuple[1]
+                    logging.debug(nameInProjectTuple[0]+"??"+personID)
+                    if nameInProjectTuple[0]==personID:
+                        logging.debug("changing")
+                        if mainName=="": # es gibt keinen Eintrag im Triplestore fuer name (sollte eigentlich nicht sein, ist dann ein Fehler dort)
+                            mainName=nameInProject #nimm dann aber den ersten aus den projekten
+                        if nameInProject!=mainName:
+                            personNames.append(nameInProject)
+            
+            logging.debug(str(mainName)+"- foundalso :"+",".join(personNames))
+            self.personIDtoNames.update({personID:(mainName,personNames)})
+                                         
+        self.personIDtoNames=self.personIDtoNames # make clear that it has changed #TODO: change this to variablen with names _p
+    
+    def getNamesFromID(self,personID):
+        retStr=""
+        retStr+=self.personIDtoNames.get(personID)[0] # hole die Hauptbezeichnung
+        additionalNames = self.personIDtoNames.get(personID)[1]
+        if len(additionalNames)>0:
+            retStr+=" ("+",".join(additionalNames)+","+")"
+        return retStr
+    
+        
+    def getMainNameFromTripleStore(self,personID):
+        
+        
+        cmdString ="""select * where { <%s> <http://xmlns.com/foaf/0.1/name> ?name}"""%personID
+    
+
+        auth_handler = urllib2.HTTPBasicAuthHandler()
+        auth_handler.add_password(realm='sparql',
+                          uri=self.virtuosoServer+"/sparql",
+                          user=self.virtuosoDAVUser,
+                          passwd=self.virtuosoDAVPW)
+                          
+        opener = urllib2.build_opener(auth_handler)
+        opener.addheaders = [('Content-Type','application/sparql-query')]
+        
+        logging.debug(cmdString)
+        try:
+            r= opener.open(self.virtuosoServer+"/sparql", urllib.urlencode({'query':cmdString,'default-graph-uri':self.virtuosoGraph,'named-graph-uri':None,'format':'text/csv'}))
+            namesTxt=r.read()
+        except urllib2.URLError, e:
+            logging.error(e.code)
+            logging.error(e.read())
+            return
+        
+        names=namesTxt.split("\n")
+        if len(names) < 2: #in der ersten Zeile stehen bei der Rückgabe die Spaltennamen, <2 heiss also es gibt keinen Eintrag
+            return
+         
+        return names[1].replace('"','') # wir nehmen nur den ersten treffer
+         
+            
+    def changeTags(self,projectID,approaches=[],disciplines=[],periods=[],spaces=[],technologies=[],transfers=[],RESPONSE=None):
+        """change tags"""
+        self.changeTagFromList(projectID,"approaches", approaches)
+        self.changeTagFromList(projectID,"disciplines", disciplines)
+        self.changeTagFromList(projectID,"periods", periods)
+        self.changeTagFromList(projectID,"spaces", spaces)
+        self.changeTagFromList(projectID,"technologies", technologies)
+        self.changeTagFromList(projectID,"transfers", transfers)
+        
+        self.projectObjects=self.projectObjects #necessesary to make the object persistent after the first call
+        self.projectHistoricalPlaces=self.projectHistoricalPlaces #necessesary to make the object persistent after the first call
+        self.projectPersons=self.projectPersons #necessesary to make the object persistent after the first call
+        self.projectSuggestedTags=self.projectSuggestedTags
+        
+        self.persons2Projects=self.persons2Projects
+        self.object2Projects=self.object2Projects
+        self.historicalPlaces2Projects=self.historicalPlaces2Projects
+        self.suggestedTags2Projects=self.suggestedTags2Projects;
+        
+        self.suggestedPersons=self.suggestedPersons;
+        
+    def deleteAllTags(self):
+        """deleteAllTags - TODO: take this out!!,"""
+        setattr(self,"tags",None)
+        
+        return "DONE!"
+    
+    def deleteAllPersons(self):
+        """deleteAllTags - TODO: take this out!!,"""
+        self.projectPersons= OOBTree()
+        self.persons2Projects= OOBTree()
+        self.personIDtoNames=OOBTree()
+        self.suggestedPersons= OOBTree(); #TODO: das sollte die ueberfluessig werde und nur im triple store stehen.
+    
+        
+        return "DONE!"
+    def changeTagFromList(self,projectID,tagType,tagList):
+        
+        logging.debug("changing:"+projectID)
+        logging.debug("asking tag::"+tagType)
+        if type(tagList) is not ListType:
+            tagList=[tagList]
+        
+    
+        tags = getattr(self,"tags",None)
+        if tags is None:
+            logging.debug("Create new tags")
+            tags=OOBTree()
+            setattr(self,"tags",tags)
+        
+    
+        tagsStored=tags.get(tagType,None)
+        if tagsStored is None:
+            tagsStored=OOBTree();
+        
+        
+        
+        for tag in tagsStored.keys(): #gehe durch alle gespeichteren tags
+            logging.debug("checking:"+tag)
+            currentApproach = tagsStored.get(tag,None)
+            logging.debug(currentApproach)
+            if currentApproach is None:
+                currentApproach=OOSet()
+            
+            if tag in tagList: #dieser ist getagged
+                currentApproach.update([projectID]);
+                tagList.remove(tag); 
+            else:
+                if currentApproach.has_key(projectID):
+                    currentApproach.remove(projectID);
+                
+            tagsStored.update({tag:currentApproach});
+        
+        for tag in tagList: # alle die nich nicht abearbeitet worden muessen noch angelegt werden
+            logging.debug("adding:"+tag)
+            newApproach=OOSet()
+            newApproach.update([projectID]);
+            tagsStored.insert(tag, newApproach);
+        
+        tags.update({tagType:tagsStored})
+        
+        transaction.commit()
+        
+    def getTitle(self,entry):
+        return entry.title
+    
+    def getEntries(self,entry):
+        return entry.entries
+    
+    def getEntriesFromTxt(self,txt):
+        apps=[]
+        lines=txt.split("\n");
+        level=False
+        for line in lines:
+            line=line.rstrip().lstrip()
+            if line=="":
+                continue
+            if line=="---":
+                
+                if level:
+                    level=False
+                else:
+                    level=True
+            else:
+                if not level:
+                    entry=Entry(line,[])
+                    apps.append(entry)
+                else:
+                    entry.entries.append(Entry(line))
+                
+        return apps[0:]
+    
+    def getApproaches(self):
+        
+        self.tagList=self.getEntriesFromTxt(self.approachesTxt)    
+        return self.tagList
+    
+    def getTagsJSON(self,projectID,tagType,RESPONSE=None):
+        """get all selected tagList"""
+        logging.debug("asking:"+projectID)
+        logging.debug("asking tag::"+tagType)
+        retList=[]
+        tags = getattr(self,"tags",None)
+        if tags is None:
+            return;
+        
+        tagsStored=tags.get(tagType,None)
+        if tagsStored is None:
+            return;
+        
+        for tag in tagsStored.keys(): #gehe durch alle gespeichteren approached
+            logging.debug("checking:"+tag)
+            currentTag = tagsStored.get(tag,None)
+            if currentTag is None:
+                continue
+            if currentTag.has_key(projectID):
+                retList.append(""" "%s" """%tag)
+        
+        if RESPONSE:
+            RESPONSE.setHeader('Content-Type', "application/json")
+        
+        logging.debug(retList)
+        return "["+",".join(retList)+"]"
+    
+    def getDisciplines(self):
+        
+        self.disciplines=self.getEntriesFromTxt(self.disciplinesTxt)    
+        return self.disciplines
+    
+    
+    def getObjectsJSON(self,term="",RESPONSE=None):
+        """ get all stored objects as json list starting with term"""
+        term=term.lower();
+        logging.debug("Asking:"+term)
+        #objectList=["baus","berg","lurg"]
+        objects = self.objects2Projects;
+
+        objectList= [x for x in objects.keys()]   
+       
+        logging.debug("Create:"+repr(objectList))    
+        retList=[]
+        for object in objectList:
+            if object.find(term)>-1:
+                retList.append(""" "%s" """%object)
+        ret="["
+        ret+=",".join(retList)
+        ret+="]"
+        logging.debug("Objects:"+ret)
+        if RESPONSE:
+            RESPONSE.setHeader('Content-Type', "application/json")
+        return ret
+        
+        
+    def getHistoricalPlacesJSON(self,term="",RESPONSE=None):
+        """ get all stored historicalPlaces as json list starting with term"""
+        term=term.lower();
+        logging.debug("Asking:"+term)
+        #historicalPlaceList=["baus","berg","lurg"]
+        historicalPlaces = self.historicalPlaces2Projects;
+
+        historicalPlaceList= [x for x in historicalPlaces.keys()]   
+       
+        logging.debug("Create:"+repr(historicalPlaceList))    
+        retList=[]
+        for historicalPlace in historicalPlaceList:
+            if historicalPlace.find(term)>-1:
+                retList.append(""" "%s" """%historicalPlace)
+        ret="["
+        ret+=",".join(retList)
+        ret+="]"
+        logging.debug("historicalPlaces:"+ret)
+        if RESPONSE:
+            RESPONSE.setHeader('Content-Type', "application/json")
+        return ret
+        
+        
+    def getPeriods(self):
+        
+        self.periodes=self.getEntriesFromTxt(self.periodsTxt)    
+        return self.periodes
+    
+    def getSpaces(self):
+        
+        self.spaces=self.getEntriesFromTxt(self.spacesTxt)    
+        return self.spaces
+    
+    def getTechnologies(self):
+        
+        self.technologies=self.getEntriesFromTxt(self.technologiesTxt)    
+        return self.technologies
+    
+    def getKnowledgeTransfers(self):
+        
+        self.knowledgeTransfers=self.getEntriesFromTxt(self.knowledgeTransfersTxt)    
+        return self.knowledgeTransfers
+    
+    
+    def getObjectsFromProject(self,projectID):
+        return self.getFromProject(self.projectObjects,projectID);
+    
+    def getHistoricalPlacesFromProject(self,projectID):
+        return self.getFromProject(self.projectHistoricalPlaces,projectID);
+    
+    def getSuggestedTagsFromProject(self,projectID):
+        return self.getFromProject(self.projectSuggestedTags,projectID);
+ 
+    
+    def getPersonsFromProject(self,projectID):
+        return self.getFromProject(self.projectPersons,projectID);
+    
+    def getFromProject(self,objects,projectID):  
+        if objects.has_key(projectID):
+            logging.debug("key exists:"+projectID)
+            persons=objects.get(projectID);
+        else:
+            persons=OOSet()
+            objects.update({projectID:persons})
+            logging.debug("key does not exists:"+projectID)
+            
+        
+        return persons
+    
+    def getHistoricalPlacesFromProjectAsHTML(self,projectID):
+        """gertobjects"""
+        return self.getFromProjectAsHTML(self.projectHistoricalPlaces, projectID, "HistoricalPlace");
+ 
+    def getObjectsFromProjectAsHTML(self,projectID):
+        """gertobjects"""
+        return self.getFromProjectAsHTML(self.projectObjects, projectID, "Object");
+    
+    def getPersonsFromProjectAsHTML(self,projectID):
+        """getpersons"""
+        return self.getFromProjectAsHTML(self.projectPersons, projectID, "Person");
+       
+        
+    def getFromProjectAsHTML(self,objects,projectID,type):
+        """getpersons"""
+        ret=""
+        if objects.has_key(projectID):
+            persons=objects.get(projectID);
+        else:
+            persons=OOSet()
+            
+        
+        for person in persons:
+            ret+="""<div class="removeButton">
+        <span>%s </span><div style="display:inline" class="remove%s"><span style="display:none" class="removeValue">%s</span>remove</div>
+        </div>"""%(person[1],type,person[0])
+            
+            
+#            ret+="""<div>
+#        <input type="checkbox" name="persons_remove"
+#         value="%s">
+#        <span>%s</span>
+#        </div>"""%(person[0],person[1])
+#        
+        logging.debug(type+":"+ret)
+        return ret
+    
+    
+    def removeHistoricalPlaceFromProject(self,projectID,value):
+        """remove"""
+        logging.debug("removeHP:"+projectID+":"+value);
+        
+        HistoricalPlaces = self.getHistoricalPlacesFromProject(projectID)
+        for HistoricalPlace in HistoricalPlaces.keys():
+           
+            logging.debug("trying:"+repr(HistoricalPlace[0])+"::"+repr(value)+"__")
+            if HistoricalPlace[0]==value:
+                logging.debug("---removed!")
+                HistoricalPlaces.remove(HistoricalPlace)
+        
+        self.projectHistoricalPlaces.update({projectID:HistoricalPlaces})
+        retstring = self.getHistoricalPlacesFromProjectAsHTML(projectID)
+        logging.debug(retstring)
+        return retstring
+    
+    def removeObjectFromProject(self,projectID,value):
+        """remove"""
+        logging.debug("remove:"+projectID+":"+value);
+        
+        objects = self.getObjectsFromProject(projectID)
+        for object in objects.keys():
+           
+            logging.debug("trying:"+repr(object[0])+"::"+repr(value)+"__")
+            if object[0]==value:
+                logging.debug("---removed!")
+                objects.remove(object)
+        
+        self.projectObjects.update({projectID:objects})
+        retstring = self.getObjectsFromProjectAsHTML(projectID)
+        logging.debug(retstring)
+        return retstring
+    
+    def removePersonFromProject(self,projectID,value):
+        """remove"""
+        logging.debug("remove:"+projectID+":"+value);
+        
+        persons = self.getPersonsFromProject(projectID)
+        for person in persons.keys():
+           
+            logging.debug("trying:"+repr(person[0])+"::"+repr(value)+"__")
+            if person[0]==value:
+                logging.debug("---removed!")
+                persons.remove(person)
+        
+        self.projectPersons.update({projectID:persons})
+        retstring = self.getPersonsFromProjectAsHTML(projectID)
+        logging.debug(retstring)
+        return retstring
+    
+    #fuegt die neue Person zur personIDtoNames hinzu, für die spätere Anzeige in der Personenliste
+    def addNameTOPersonIDNames(self,personID,label):
+        personName = self.personIDtoNames.get(personID)
+        if personName==None: # Anlegen falls noch nicht existent
+            personName=(label,[])
+        else:
+            if (not label in personName[1]) and (not label==personName[0]): # hinzufuegen falls der neuen name noch nicht als bezeichnugn fuer personID eingetragen ist
+                personName[1].append(label) 
+    
+        self.personIDtoNames.update({personID:personName})
+        
+        
+    def addPersonToProject(self,projectID,value,label):
+        """ add a person so the project"""
+        persons=self.getPersonsFromProject(projectID);
+        
+        logging.debug("adding:"+projectID+":"+value+":"+label);
+      
+        persons.insert([value,label])
+        self.projectPersons.update({projectID:persons})
+        
+        for personTuple in persons:
+            #hole die abgespeicherten Projekte zu einer Person
+            person=personTuple[0] #hole die ID
+            
+            
+            if getattr(self,"persons2Projects",None)==None:
+                setattr(self,"persons2Projects",OOBTree())
+         
+            projects = self.persons2Projects.get(person,None)
+                   
+            if projects==None:
+                projects=OOSet();
+            
+            projects.insert(projectID )
+            logging.debug("update:"+person)
+            self.persons2Projects.update({person:projects})
+        
+        self.addNameTOPersonIDNames(value,label)
+        retstring = self.getPersonsFromProjectAsHTML(projectID)
+        logging.debug(retstring)
+        transaction.commit()
+        return retstring
+    
+    def getPersonsWithProjectIDs(self):
+        """holt die getaggted Personen mit Projekten"""
+        persons = self.persons2Projects;
+        ret={}
+        logging.debug("Check Person:"+repr(persons.keys()))
+        for person in persons.keys():
+            logging.debug("Check:"+person)
+            #TODO: person muss duch den namen von provuder geholt werden
+            list=[]
+            for projectID in persons.get(person):
+                list.append(self.getProjectDetails(projectID))
+            
+            ret[person]=list[0:]
+        return ret
+    
+    def getHistoricalPlacesWithProjectIDs(self):
+        """holt die getaggted Personen mit Projekten"""
+        HistoricalPlaces = self.HistoricalPlaces2Projects;
+        ret={}
+        logging.debug("Check HistoricalPlace:"+repr(HistoricalPlaces.keys()))
+        for HistoricalPlace in HistoricalPlaces.keys():
+            logging.debug("Check:"+HistoricalPlace)
+            #TODO: HistoricalPlace muss duch den namen von provuder geholt werden
+            list=[]
+            for projectID in HistoricalPlaces.get(HistoricalPlace):
+                list.append(self.getProjectDetails(projectID))
+            
+            ret[HistoricalPlace]=list[0:]
+        return ret
+    
+    def getObjectsWithProjectIDs(self):
+        """holt die getaggted Personen mit Projekten"""
+        objects = self.objects2Projects;
+        ret={}
+        logging.debug("Check Object:"+repr(objects.keys()))
+        for object in objects.keys():
+            logging.debug("Check:"+object)
+            #TODO: object muss duch den namen von provuder geholt werden
+            list=[]
+            for projectID in objects.get(object):
+                list.append(self.getProjectDetails(projectID))
+            
+            ret[object]=list[0:]
+        return ret
+    
+    def listAllSuggestedTags(self):
+        """list all tags"""
+        ret="<html><body>"
+        for projectID in self.projectSuggestedTags:
+            ret+="<h3>"+projectID+"</h3><table>"
+            for tags in self.projectSuggestedTags.get(projectID):
+                ret+="<tr><td>"+tags[0]+"</td><td>"+tags[1].type+"</td><td>"+tags[1].comment+"</td><td>"+tags[1].userName+"</td></tr>"
+            ret+="</table>"
+        ret+="</body></html>"
+        logging.debug(ret);
+        return ret
+        
+    def suggestTag(self,projectID,tagName,tagComment,tagType,tagUserName):
+        """suggest a new tag"""
+        """ add a person so the project"""
+        SuggestedTags=self.getSuggestedTagsFromProject(projectID);
+        
+        logging.debug("suggested:"+projectID+":"+tagName);
+        
+     
+        #TODO: Im moment noch keine Zuordnung zu einer ID.
+        newTag = SuggestedTag(tagName,tagComment,tagType,tagUserName)
+        SuggestedTags.insert([tagName,newTag])
+        self.projectSuggestedTags.update({projectID:SuggestedTags})
+        
+       
+        
+        for SuggestedTagTuple in SuggestedTags:
+            #hole die abgespeicherten Projekte zu einer Person
+            person=SuggestedTagTuple[0] #hile die ID
+            
+            
+            if getattr(self,"SuggestedTags2Projects",None)==None:
+                setattr(self,"SuggestedTags2Projects",OOBTree())
+         
+            projects = self.SuggestedTags2Projects.get(person,None)
+                   
+            if projects==None:
+                projects=OOSet();
+            
+            projects.insert(projectID )
+            logging.debug("update:"+person)
+            self.SuggestedTags2Projects.update({person:projects})
+        
+        
+        
+        #retstring = self.getSuggestedTagsFromProjectAsHTML(projectID)
+        #logging.debug(retstring)
+        
+        
+        
+        #return retstring
+        
+    
+    def addHistoricalPlaceToProject(self,projectID,value):
+        """ add a person so the project"""
+        HistoricalPlaces=self.getHistoricalPlacesFromProject(projectID);
+        
+        logging.debug("adding:"+projectID+":"+value);
+        
+     
+        #TODO: Im moment noch keine Zuordnung zu einer ID.
+        HistoricalPlaces.insert([value,value])
+        self.projectHistoricalPlaces.update({projectID:HistoricalPlaces})
+        
+       
+        
+        for HistoricalPlaceTuple in HistoricalPlaces:
+            #hole die abgespeicherten Projekte zu einer Person
+            person=HistoricalPlaceTuple[0] #hile die ID
+            
+            
+            if getattr(self,"HistoricalPlaces2Projects",None)==None:
+                setattr(self,"HistoricalPlaces2Projects",OOBTree())
+         
+            projects = self.HistoricalPlaces2Projects.get(person,None)
+                   
+            if projects==None:
+                projects=OOSet();
+            
+            projects.insert(projectID )
+            logging.debug("update:"+person)
+            self.HistoricalPlaces2Projects.update({person:projects})
+        
+        
+        
+        retstring = self.getHistoricalPlacesFromProjectAsHTML(projectID)
+        logging.debug(retstring)
+        
+        
+        
+        return retstring
+    
+    def addObjectToProject(self,projectID,value):
+        """ add a person so the project"""
+        objects=self.getObjectsFromProject(projectID);
+        
+        logging.debug("adding:"+projectID+":"+value);
+        
+     
+        #TODO: Im moment noch keine Zuordnung zu einer ID.
+        objects.insert([value,value])
+        self.projectObjects.update({projectID:objects})
+        
+       
+        
+        for objectTuple in objects:
+            #hole die abgespeicherten Projekte zu einer Person
+            person=objectTuple[0] #hile die ID
+            
+            
+            if getattr(self,"objects2Projects",None)==None:
+                setattr(self,"objects2Projects",OOBTree())
+         
+            projects = self.objects2Projects.get(person,None)
+                   
+            if projects==None:
+                projects=OOSet();
+            
+            projects.insert(projectID )
+            logging.debug("update:"+person)
+            self.objects2Projects.update({person:projects})
+        
+        
+        
+        retstring = self.getObjectsFromProjectAsHTML(projectID)
+        logging.debug(retstring)
+        
+        
+        
+        return retstring
+    
+    
+    def getProjectsWithTag(self,tagType,tagName):
+        tags = getattr(self,"tags",None)
+        if tags is None:
+            logging.debug("can't find Tags")
+            return []
+            
+        
+    
+        tagsStored=tags.get(tagType,None)
+        if tagsStored is None:
+            logging.debug("can't find Tag:"+tagType)
+            return []
+        
+        projects = tagsStored.get(tagName,None)
+        if projects is None:
+            logging.debug("can't find any projects for Tag:"+tagName+"("+tagType+")")
+            return []
+        
+        ret=[]
+        for project in projects:
+            logging.debug("found:"+project)
+            ret.append(self.getProjectDetails(project))
+
+        return ret
+    
+    def getProjectDetails(self,getID):
+        project=getattr(self.www_neu.projects,getID,None)
+        if project is None:
+            logging.debug("no project!! " +getID)
+            return
+        
+        link="/en/research/projects/"+getID
+        
+        title=project.getContent("short_title")
+        #persons=project.getPersonKeyList()
+        persons=project.getContent('xdata_01')
+        logging.debug("%s %s %s"%(link,title,persons))
+        return link,title,persons
+    
+#        $.post("addNewPerson",{"projectID":
+#                     $('#projectID').val(),
+#                     "personName":$("#suggest_newPerson").val(),
+#                     "personComment":$("#suggest_newPerson_comment").val()}
+#               
+#              );         
+#    
+
+    def addAndCreateNewPerson(self,projectID,personName,personComment,personUserName):
+        """adds anew person to the project which is not in the authority file"""
+        
+        id = random.randint(0, 1000000); 
+        idstring="http://ontologies.mpiwg-berlin.mpg.de/tempObjects/person/"+str(id)
+        while self.suggestedPersons.has_key(idstring):
+            id = random.randint(0, 1000000); 
+            #idstring="http://ontologies.mpiwg-berlin.mpg.de/tempObjects/person/"+str(id);
+            idstring=self.TEMP_PERSON_NS+str(id);
+            
+            
+        self.suggestedPersons.update({idstring:(personName,personComment,projectID,personUserName)})
+        self.createTempPersonInVirtuoso(projectID, idstring, personName, personComment) #TODO: add suername to the triplestore
+        return self.addPersonToProject(projectID, idstring, personName);
+        
+    def createTempPersonInVirtuoso(self,projectID,personURI, personName,personComment):
+        """add a new person to the triple store of tempory persons"""
+        triples=[];
+        personID="<"+personURI+">"
+        triples.append((personID,"<http://www.w3.org/1999/02/22-rdf-syntax-ns#type>","<http://ontologies.mpiwg-berlin.mpg.de/authorities/namedIdentities/Person>"))
+        triples.append((personID,"<http://erlangen-crm.org/110404/P3_has_note>",'"'+personComment+'"'))
+        triples.append((personID,"<http://xmlns.com/foaf/0.1/name>",'"'+personName+'"'))
+        triples.append((personID,"<http://ontologies.mpiwg-berlin.mpg.de/general/isMentionedOn>","<http://www.mpiwg-berlin.mpg.de/en/research/projects/"+projectID+">"))
+        
+        cmdString ="insert in GRAPH <"+self.virtuosoGraph+">  {"
+        for triple in triples:
+            cmdString+=" ".join(triple)+"."
+        
+        cmdString+="}"
+
+        auth_handler = urllib2.HTTPBasicAuthHandler()
+        auth_handler.add_password(realm='sparql',
+                          uri=self.virtuosoServer+"/sparql",
+                          user=self.virtuosoDAVUser,
+                          passwd=self.virtuosoDAVPW)
+                          
+        opener = urllib2.build_opener(auth_handler)
+        opener.addheaders = [('Content-Type','application/sparql-query')]
+        
+        logging.debug(cmdString)
+        try:
+            r= opener.open(self.virtuosoServer+"/sparql", urllib.urlencode({'query':cmdString,'default-graph-uri':self.virtuosoGraph,'named-graph-uri':None}))
+            logging.debug(r.read())
+        except urllib2.URLError, e:
+            logging.error(e.code)
+            logging.error(e.read())
+            return
+        
+        opener2 = urllib2.build_opener()
+        
+       
+        personIDencoded=urllib.quote(personURI,safe="")
+        graphEncoded=urllib.quote(self.additionalNamesGraphURL,safe="")
+        url = self.personproviderURL+"id/"+personIDencoded+"/"+graphEncoded
+         
+        try:
+            request = urllib2.Request(url);
+            request.get_method = lambda : 'PUT'
+            r= opener2.open(request);
+            logging.debug(r.read())
+        except urllib2.URLError, e:
+            logging.error(e.code)
+            logging.error(e.read())
+            return
+        
+                    
+       
+        return
+        
+def redirect(RESPONSE,url):
+        """mache ein redirect mit einem angehaengten time stamp um ein reload zu erzwingen"""
+        
+        timeStamp=time.time()
+        
+        if url.find("?")>-1: #giebt es schon parameter
+            addStr="&time=%s"
+        else:
+            addStr="?time=%s"
+            
+        RESPONSE.setHeader('Last-Modified',email.Utils.formatdate().split("-")[0]+'GMT')
+        logging.error(email.Utils.formatdate()+' GMT')
+        RESPONSE.redirect(url+addStr%timeStamp)
+        
+def manage_addMPIWGThesaurusForm(self):
+    """form for adding the project"""
+    pt=PageTemplateFile(os.path.join(package_home(globals()),'zpt','addMPIWGThesaurusForm.zpt')).__of__(self)
+    return pt()
+
+
+
+def manage_addMPIWGThesaurus(self,id,RESPONSE=None):
+    """add it"""
+    newObj=MPIWGThesaurus(id)
+
+    self._setObject(id,newObj)
+
+
+    if RESPONSE is not None:
+        redirect(RESPONSE,'manage_main')
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/__init__.py	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,14 @@
+import MPIWGThesaurus
+
+def initialize(context):
+    """initialize MPIWGWeb"""
+    context.registerClass(
+        MPIWGThesaurus.MPIWGThesaurus,
+        constructors = (
+          MPIWGThesaurus.manage_addMPIWGThesaurusForm,
+          MPIWGThesaurus.manage_addMPIWGThesaurus
+          )
+        )
+
+  
+      
Binary file jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-icons_222222_256x240.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-icons_228ef1_256x240.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png has changed
Binary file jquery-ui/css/ui-lightness/images/ui-icons_ffffff_256x240.png has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/css/ui-lightness/jquery-ui-1.8.11.custom.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,454 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right {  -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }	
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.11
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+	list-style:none;
+	padding: 2px;
+	margin: 0;
+	display:block;
+	float: left;
+}
+.ui-menu .ui-menu {
+	margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+	margin:0;
+	padding: 0;
+	zoom: 1;
+	float: left;
+	clear: left;
+	width: 100%;
+}
+.ui-menu .ui-menu-item a {
+	text-decoration:none;
+	display:block;
+	padding:.2em .4em;
+	line-height:1.5;
+	zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+	font-weight: normal;
+	margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; } 
+button.ui-button-icons-only { width: 3.7em; } 
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4;  }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative;  }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } 
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/AUTHORS.txt	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,30 @@
+jQuery UI Authors (http://jqueryui.com/about)
+
+This software consists of voluntary contributions made by many
+individuals. For exact contribution history, see the revision history
+and logs, available at http://github.com/jquery/jquery-ui
+
+Brandon Aaron
+Paul Bakaus (paulbakaus.com)
+David Bolter
+Rich Caloggero
+Chi Cheng (cloudream@gmail.com)
+Colin Clark (http://colin.atrc.utoronto.ca/)
+Michelle D'Souza
+Aaron Eisenberger (aaronchi@gmail.com)
+Ariel Flesler
+Bohdan Ganicky
+Scott González
+Marc Grabanski (m@marcgrabanski.com)
+Klaus Hartl (stilbuero.de)
+Scott Jehl
+Cody Lindley
+Eduardo Lundgren (eduardolundgren@gmail.com)
+Todd Parker
+John Resig
+Patty Toland
+Ca-Phun Ung (yelotofu.com)
+Keith Wood (kbwood@virginbroadband.com.au)
+Maggie Costello Wachs
+Richard D. Worth (rdworth.org)
+Jörn Zaefferer (bassistance.de)
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/GPL-LICENSE.txt	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,278 @@
+        GNU GENERAL PUBLIC LICENSE
+           Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.
+ 51 Franklin Street, Fifth Floor, Boston, MA  02110-1301  USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+          Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.  This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it.  (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.)  You can apply it to
+your programs, too.
+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+  For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must show them these terms so they know their
+rights.
+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+  Finally, any free program is threatened constantly by software
+patents.  We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary.  To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+        GNU GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License.  The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language.  (Hereinafter, translation is included without limitation in
+the term "modification".)  Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+  1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+  2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) You must cause the modified files to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    b) You must cause any work that you distribute or publish, that in
+    whole or in part contains or is derived from the Program or any
+    part thereof, to be licensed as a whole at no charge to all third
+    parties under the terms of this License.
+
+    c) If the modified program normally reads commands interactively
+    when run, you must cause it, when started running for such
+    interactive use in the most ordinary way, to print or display an
+    announcement including an appropriate copyright notice and a
+    notice that there is no warranty (or else, saying that you provide
+    a warranty) and that users may redistribute the program under
+    these conditions, and telling the user how to view a copy of this
+    License.  (Exception: if the Program itself is interactive but
+    does not normally print such an announcement, your work based on
+    the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+    a) Accompany it with the complete corresponding machine-readable
+    source code, which must be distributed under the terms of Sections
+    1 and 2 above on a medium customarily used for software interchange; or,
+
+    b) Accompany it with a written offer, valid for at least three
+    years, to give any third party, for a charge no more than your
+    cost of physically performing source distribution, a complete
+    machine-readable copy of the corresponding source code, to be
+    distributed under the terms of Sections 1 and 2 above on a medium
+    customarily used for software interchange; or,
+
+    c) Accompany it with the information you received as to the offer
+    to distribute corresponding source code.  (This alternative is
+    allowed only for noncommercial distribution and only if you
+    received the program in object code or executable form with such
+    an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it.  For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable.  However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License.  Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+  5. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Program or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+  6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+  7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded.  In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+  9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+  10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.  For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+          NO WARRANTY
+
+  11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+  12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/MIT-LICENSE.txt	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,25 @@
+Copyright (c) 2011 Paul Bakaus, http://jqueryui.com/
+
+This software consists of voluntary contributions made by many
+individuals (AUTHORS.txt, http://jqueryui.com/about) For exact
+contribution history, see the revision history and logs, available
+at http://jquery-ui.googlecode.com/svn/
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/collapsible.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,57 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - Collapse content</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#accordion" ).accordion({
+			collapsible: true
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+	<h3><a href="#">Section 1</a></h3>
+	<div>
+		<p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+	</div>
+	<h3><a href="#">Section 2</a></h3>
+	<div>
+		<p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+	</div>
+	<h3><a href="#">Section 3</a></h3>
+	<div>
+		<p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+		<ul>
+			<li>List item one</li>
+			<li>List item two</li>
+			<li>List item three</li>
+		</ul>
+	</div>
+	<h3><a href="#">Section 4</a></h3>
+	<div>
+		<p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>By default, accordions always keep one section open. To allow for all sections to be be collapsible, set the <code>collapsible</code> option to true. Click on the currently open section to collapse its content pane.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/custom-icons.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - Customize icons</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		var icons = {
+			header: "ui-icon-circle-arrow-e",
+			headerSelected: "ui-icon-circle-arrow-s"
+		};
+		$( "#accordion" ).accordion({
+			icons: icons
+		});
+		$( "#toggle" ).button().toggle(function() {
+			$( "#accordion" ).accordion( "option", "icons", false );
+		}, function() {
+			$( "#accordion" ).accordion( "option", "icons", icons );
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+	<h3><a href="#">Section 1</a></h3>
+	<div>
+		<p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+	</div>
+	<h3><a href="#">Section 2</a></h3>
+	<div>
+		<p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+	</div>
+	<h3><a href="#">Section 3</a></h3>
+	<div>
+		<p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+		<ul>
+			<li>List item one</li>
+			<li>List item two</li>
+			<li>List item three</li>
+		</ul>
+	</div>
+	<h3><a href="#">Section 4</a></h3>
+	<div>
+		<p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+	</div>
+</div>
+
+<button id="toggle">Toggle icons</button>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Customize the header icons with the <code>icons</code> option, which accepts classes for the header's default and selected (open) state.  Use any class from the UI CSS framework, or create custom classes with background images.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,85 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#accordion" ).accordion();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+	<h3><a href="#">Section 1</a></h3>
+	<div>
+		<p>
+		Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer
+		ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit
+		amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut
+		odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.
+		</p>
+	</div>
+	<h3><a href="#">Section 2</a></h3>
+	<div>
+		<p>
+		Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet
+		purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor
+		velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In
+		suscipit faucibus urna.
+		</p>
+	</div>
+	<h3><a href="#">Section 3</a></h3>
+	<div>
+		<p>
+		Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis.
+		Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero
+		ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis
+		lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui.
+		</p>
+		<ul>
+			<li>List item one</li>
+			<li>List item two</li>
+			<li>List item three</li>
+		</ul>
+	</div>
+	<h3><a href="#">Section 4</a></h3>
+	<div>
+		<p>
+		Cras dictum. Pellentesque habitant morbi tristique senectus et netus
+		et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in
+		faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia
+		mauris vel est.
+		</p>
+		<p>
+		Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus.
+		Class aptent taciti sociosqu ad litora torquent per conubia nostra, per
+		inceptos himenaeos.
+		</p>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+Click headers to expand/collapse content that is broken into logical sections, much like tabs.
+Optionally, toggle sections open/closed on mouseover.
+</p>
+<p>
+The underlying HTML markup is a series of headers (H3 tags) and content divs so the content is
+usable without JavaScript.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/fillspace.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,76 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - Fill space</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#accordion" ).accordion({
+			fillSpace: true
+		});
+	});
+	$(function() {
+		$( "#accordionResizer" ).resizable({
+			minHeight: 140,
+			resize: function() {
+				$( "#accordion" ).accordion( "resize" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<h3 class="docs">Resize the outer container:</h3>
+ 
+<div id="accordionResizer" style="padding:10px; width:350px; height:220px;" class="ui-widget-content">
+
+<div id="accordion">
+	<h3><a href="#">Section 1</a></h3>
+	<div>
+		<p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+	</div>
+	<h3><a href="#">Section 2</a></h3>
+	<div>
+		<p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+	</div>
+	<h3><a href="#">Section 3</a></h3>
+	<div>
+		<p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+		<ul>
+			<li>List item one</li>
+			<li>List item two</li>
+			<li>List item three</li>
+		</ul>
+	</div>
+	<h3><a href="#">Section 4</a></h3>
+	<div>
+		<p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+	</div>
+</div>
+
+<span class="ui-icon ui-icon-grip-dotted-horizontal" style="margin:2px auto;"></span>
+</div><!-- End accordionResizer -->
+
+<div style="margin-top:7px; padding:10px; width:350px; height:50px;" class="ui-widget-content">I'm another panel</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Because the accordion is comprised of block-level elements, by default its width fills the available horizontal space. To fill the vertical space allocated by its container, set the boolean <code>fillSpace</code> option to true, and the script will automatically set the dimensions of the accordion to the height of its parent container.  The accordion will also resize with its container if the container is <code>resizable</code>.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/hoverintent.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,134 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - Open on hoverintent</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$("#accordion").accordion({
+			event: "click hoverintent"
+		});
+	});
+	
+	var cfg = ($.hoverintent = {
+		sensitivity: 7,
+		interval: 100
+	});
+
+	$.event.special.hoverintent = {
+		setup: function() {
+			$( this ).bind( "mouseover", jQuery.event.special.hoverintent.handler );
+		},
+		teardown: function() {
+			$( this ).unbind( "mouseover", jQuery.event.special.hoverintent.handler );
+		},
+		handler: function( event ) {
+			event.type = "hoverintent";
+			var self = this,
+				args = arguments,
+				target = $( event.target ),
+				cX, cY, pX, pY;
+			
+			function track( event ) {
+				cX = event.pageX;
+				cY = event.pageY;
+			};
+			pX = event.pageX;
+			pY = event.pageY;
+			function clear() {
+				target
+					.unbind( "mousemove", track )
+					.unbind( "mouseout", arguments.callee );
+				clearTimeout( timeout );
+			}
+			function handler() {
+				if ( ( Math.abs( pX - cX ) + Math.abs( pY - cY ) ) < cfg.sensitivity ) {
+					clear();
+					jQuery.event.handle.apply( self, args );
+				} else {
+					pX = cX;
+					pY = cY;
+					timeout = setTimeout( handler, cfg.interval );
+				}
+			}
+			var timeout = setTimeout( handler, cfg.interval );
+			target.mousemove( track ).mouseout( clear );
+			return true;
+		}
+	};
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+	<h3><a href="#">Section 1</a></h3>
+	<div>
+		<p>
+		Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer
+		ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit
+		amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut
+		odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.
+		</p>
+	</div>
+	<h3><a href="#">Section 2</a></h3>
+	<div>
+		<p>
+		Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet
+		purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor
+		velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In
+		suscipit faucibus urna.
+		</p>
+	</div>
+	<h3><a href="#">Section 3</a></h3>
+	<div>
+		<p>
+		Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis.
+		Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero
+		ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis
+		lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui.
+		</p>
+		<ul>
+			<li>List item one</li>
+			<li>List item two</li>
+			<li>List item three</li>
+		</ul>
+	</div>
+	<h3><a href="#">Section 4</a></h3>
+	<div>
+		<p>
+		Cras dictum. Pellentesque habitant morbi tristique senectus et netus
+		et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in
+		faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia
+		mauris vel est.
+		</p>
+		<p>
+		Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus.
+		Class aptent taciti sociosqu ad litora torquent per conubia nostra, per
+		inceptos himenaeos.
+		</p>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+Click headers to expand/collapse content that is broken into logical sections, much like tabs.
+Optionally, toggle sections open/closed on mouseover.
+</p>
+<p>
+The underlying HTML markup is a series of headers (H3 tags) and content divs so the content is
+usable without JavaScript.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,25 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="fillspace.html">Fill space</a></li>
+		<li><a href="no-auto-height.html">No auto height</a></li>
+		<li><a href="collapsible.html">Collapse content</a></li>
+		<li><a href="mouseover.html">Open on mouseover</a></li>
+		<li><a href="hoverintent.html">Open on hoverintent</a></li>
+		<li><a href="custom-icons.html">Customize icons</a></li>
+		<li><a href="sortable.html">Sortable</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/mouseover.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,57 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - Open on mouseover</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#accordion" ).accordion({
+			event: "mouseover"
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+	<h3><a href="#">Section 1</a></h3>
+	<div>
+		<p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+	</div>
+	<h3><a href="#">Section 2</a></h3>
+	<div>
+		<p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+	</div>
+	<h3><a href="#">Section 3</a></h3>
+	<div>
+		<p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+		<ul>
+			<li>List item one</li>
+			<li>List item two</li>
+			<li>List item three</li>
+		</ul>
+	</div>
+	<h3><a href="#">Section 4</a></h3>
+	<div>
+		<p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Toggle sections open/closed on mouseover with the <code>event</code> option. The default value for event is "click."</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/no-auto-height.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,60 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - No auto height</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#accordion" ).accordion({
+			autoHeight: false,
+			navigation: true
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+	<h3><a href="#section1">Section 1</a></h3>
+	<div>
+		<p>Mauris mauris ante, blandit et, ultrices a, susceros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+	</div>
+	<h3><a href="#section2">Section 2</a></h3>
+	<div>
+		<p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+	</div>
+	<h3><a href="#section3">Section 3</a></h3>
+	<div>
+		<p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+		<ul>
+			<li>List item</li>
+			<li>List item</li>
+			<li>List item</li>
+			<li>List item</li>
+			<li>List item</li>
+			<li>List item</li>
+			<li>List item</li>
+		</ul>
+		<a href="#othercontent">Link to other content</a>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Setting <code>autoHeight: false</code> allows to accordion panels to keep their native height.</p>
+<p>In addition, the <code>navigation</code> option is enabled, opening the panel based on the current location, eg. no-auto-height.html#panel2 would open the second panel on page load. It also finds anchors within the content, so #othercontent will open the third section, as it contains a link with that href.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/accordion/sortable.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,83 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Accordion - Sortable</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		var stop = false;
+		$( "#accordion h3" ).click(function( event ) {
+			if ( stop ) {
+				event.stopImmediatePropagation();
+				event.preventDefault();
+				stop = false;
+			}
+		});
+		$( "#accordion" )
+			.accordion({
+				header: "> div > h3"
+			})
+			.sortable({
+				axis: "y",
+				handle: "h3",
+				stop: function() {
+					stop = true;
+				}
+			});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+	<div>
+		<h3><a href="#">Section 1</a></h3>
+		<div>
+			<p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+		</div>
+	</div>
+	<div>
+		<h3><a href="#">Section 2</a></h3>
+		<div>
+			<p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+		</div>
+	</div>
+	<div>
+		<h3><a href="#">Section 3</a></h3>
+		<div>
+			<p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+			<ul>
+				<li>List item one</li>
+				<li>List item two</li>
+				<li>List item three</li>
+			</ul>
+		</div>
+	</div>
+	<div>
+		<h3><a href="#">Section 4</a></h3>
+		<div>
+			<p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+		</div>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Drag the header to re-order panels.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/categories.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,71 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Categories</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-autocomplete-category {
+		font-weight: bold;
+		padding: .2em .4em;
+		margin: .8em 0 .2em;
+		line-height: 1.5;
+	}
+	</style>
+	<script>
+	$.widget( "custom.catcomplete", $.ui.autocomplete, {
+		_renderMenu: function( ul, items ) {
+			var self = this,
+				currentCategory = "";
+			$.each( items, function( index, item ) {
+				if ( item.category != currentCategory ) {
+					ul.append( "<li class='ui-autocomplete-category'>" + item.category + "</li>" );
+					currentCategory = item.category;
+				}
+				self._renderItem( ul, item );
+			});
+		}
+	});
+	</script>
+	<script>
+	$(function() {
+		var data = [
+			{ label: "anders", category: "" },
+			{ label: "andreas", category: "" },
+			{ label: "antal", category: "" },
+			{ label: "annhhx10", category: "Products" },
+			{ label: "annk K12", category: "Products" },
+			{ label: "annttop C13", category: "Products" },
+			{ label: "anders andersson", category: "People" },
+			{ label: "andreas andersson", category: "People" },
+			{ label: "andreas johnson", category: "People" }
+		];
+		
+		$( "#search" ).catcomplete({
+			delay: 0,
+			source: data
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	<label for="search">Search: </label>
+	<input id="search" />
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>A categorized search result. Try typing "a" or "n".</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/combobox.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,171 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Combobox</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-button { margin-left: -1px; }
+	.ui-button-icon-only .ui-button-text { padding: 0.35em; } 
+	.ui-autocomplete-input { margin: 0; padding: 0.48em 0 0.47em 0.45em; }
+	</style>
+	<script>
+	(function( $ ) {
+		$.widget( "ui.combobox", {
+			_create: function() {
+				var self = this,
+					select = this.element.hide(),
+					selected = select.children( ":selected" ),
+					value = selected.val() ? selected.text() : "";
+				var input = this.input = $( "<input>" )
+					.insertAfter( select )
+					.val( value )
+					.autocomplete({
+						delay: 0,
+						minLength: 0,
+						source: function( request, response ) {
+							var matcher = new RegExp( $.ui.autocomplete.escapeRegex(request.term), "i" );
+							response( select.children( "option" ).map(function() {
+								var text = $( this ).text();
+								if ( this.value && ( !request.term || matcher.test(text) ) )
+									return {
+										label: text.replace(
+											new RegExp(
+												"(?![^&;]+;)(?!<[^<>]*)(" +
+												$.ui.autocomplete.escapeRegex(request.term) +
+												")(?![^<>]*>)(?![^&;]+;)", "gi"
+											), "<strong>$1</strong>" ),
+										value: text,
+										option: this
+									};
+							}) );
+						},
+						select: function( event, ui ) {
+							ui.item.option.selected = true;
+							self._trigger( "selected", event, {
+								item: ui.item.option
+							});
+						},
+						change: function( event, ui ) {
+							if ( !ui.item ) {
+								var matcher = new RegExp( "^" + $.ui.autocomplete.escapeRegex( $(this).val() ) + "$", "i" ),
+									valid = false;
+								select.children( "option" ).each(function() {
+									if ( $( this ).text().match( matcher ) ) {
+										this.selected = valid = true;
+										return false;
+									}
+								});
+								if ( !valid ) {
+									// remove invalid value, as it didn't match anything
+									$( this ).val( "" );
+									select.val( "" );
+									input.data( "autocomplete" ).term = "";
+									return false;
+								}
+							}
+						}
+					})
+					.addClass( "ui-widget ui-widget-content ui-corner-left" );
+
+				input.data( "autocomplete" )._renderItem = function( ul, item ) {
+					return $( "<li></li>" )
+						.data( "item.autocomplete", item )
+						.append( "<a>" + item.label + "</a>" )
+						.appendTo( ul );
+				};
+
+				this.button = $( "<button type='button'>&nbsp;</button>" )
+					.attr( "tabIndex", -1 )
+					.attr( "title", "Show All Items" )
+					.insertAfter( input )
+					.button({
+						icons: {
+							primary: "ui-icon-triangle-1-s"
+						},
+						text: false
+					})
+					.removeClass( "ui-corner-all" )
+					.addClass( "ui-corner-right ui-button-icon" )
+					.click(function() {
+						// close if already visible
+						if ( input.autocomplete( "widget" ).is( ":visible" ) ) {
+							input.autocomplete( "close" );
+							return;
+						}
+
+						// pass empty string as value to search for, displaying all results
+						input.autocomplete( "search", "" );
+						input.focus();
+					});
+			},
+
+			destroy: function() {
+				this.input.remove();
+				this.button.remove();
+				this.element.show();
+				$.Widget.prototype.destroy.call( this );
+			}
+		});
+	})( jQuery );
+
+	$(function() {
+		$( "#combobox" ).combobox();
+		$( "#toggle" ).click(function() {
+			$( "#combobox" ).toggle();
+		});
+	});
+	</script>
+</head>
+<body>
+	
+<div class="demo">
+
+<div class="ui-widget">
+	<label>Your preferred programming language: </label>
+	<select id="combobox">
+		<option value="">Select one...</option>
+		<option value="ActionScript">ActionScript</option>
+		<option value="AppleScript">AppleScript</option>
+		<option value="Asp">Asp</option>
+		<option value="BASIC">BASIC</option>
+		<option value="C">C</option>
+		<option value="C++">C++</option>
+		<option value="Clojure">Clojure</option>
+		<option value="COBOL">COBOL</option>
+		<option value="ColdFusion">ColdFusion</option>
+		<option value="Erlang">Erlang</option>
+		<option value="Fortran">Fortran</option>
+		<option value="Groovy">Groovy</option>
+		<option value="Haskell">Haskell</option>
+		<option value="Java">Java</option>
+		<option value="JavaScript">JavaScript</option>
+		<option value="Lisp">Lisp</option>
+		<option value="Perl">Perl</option>
+		<option value="PHP">PHP</option>
+		<option value="Python">Python</option>
+		<option value="Ruby">Ruby</option>
+		<option value="Scala">Scala</option>
+		<option value="Scheme">Scheme</option>
+	</select>
+</div>
+<button id="toggle">Show underlying select</button>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>A custom widget built by composition of Autocomplete and Button. You can either type something into the field to get filtered suggestions based on your input, or use the button to get the full list of selections.</p>
+<p>The input is read from an existing select-element for progressive enhancement, passed to Autocomplete with a customized source-option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/custom-data.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,95 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Custom data and display</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#project-label {
+		display: block;
+		font-weight: bold;
+		margin-bottom: 1em;
+	}
+	#project-icon {
+		float: left;
+		height: 32px;
+		width: 32px;
+	}
+	#project-description {
+		margin: 0;
+		padding: 0;
+	}
+	</style>
+	<script>
+	$(function() {
+		var projects = [
+			{
+				value: "jquery",
+				label: "jQuery",
+				desc: "the write less, do more, JavaScript library",
+				icon: "jquery_32x32.png"
+			},
+			{
+				value: "jquery-ui",
+				label: "jQuery UI",
+				desc: "the official user interface library for jQuery",
+				icon: "jqueryui_32x32.png"
+			},
+			{
+				value: "sizzlejs",
+				label: "Sizzle JS",
+				desc: "a pure-JavaScript CSS selector engine",
+				icon: "sizzlejs_32x32.png"
+			}
+		];
+
+		$( "#project" ).autocomplete({
+			minLength: 0,
+			source: projects,
+			focus: function( event, ui ) {
+				$( "#project" ).val( ui.item.label );
+				return false;
+			},
+			select: function( event, ui ) {
+				$( "#project" ).val( ui.item.label );
+				$( "#project-id" ).val( ui.item.value );
+				$( "#project-description" ).html( ui.item.desc );
+				$( "#project-icon" ).attr( "src", "images/" + ui.item.icon );
+
+				return false;
+			}
+		})
+		.data( "autocomplete" )._renderItem = function( ul, item ) {
+			return $( "<li></li>" )
+				.data( "item.autocomplete", item )
+				.append( "<a>" + item.label + "<br>" + item.desc + "</a>" )
+				.appendTo( ul );
+		};
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	<div id="project-label">Select a project (type "j" for a start):</div>
+	<img id="project-icon" src="images/transparent_1x1.png" class="ui-state-default"/>
+	<input id="project"/>
+	<input type="hidden" id="project-id"/>
+	<p id="project-description"></p>
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>You can use your own custom data formats and displays by simply overriding the default focus and select actions.</p>
+<p>Try typing "j" to get a list of projects or just press the down arrow.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,64 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		var availableTags = [
+			"ActionScript",
+			"AppleScript",
+			"Asp",
+			"BASIC",
+			"C",
+			"C++",
+			"Clojure",
+			"COBOL",
+			"ColdFusion",
+			"Erlang",
+			"Fortran",
+			"Groovy",
+			"Haskell",
+			"Java",
+			"JavaScript",
+			"Lisp",
+			"Perl",
+			"PHP",
+			"Python",
+			"Ruby",
+			"Scala",
+			"Scheme"
+		];
+		$( "#tags" ).autocomplete({
+			source: availableTags
+		});
+	});
+	</script>
+</head>
+<body>
+	
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="tags">Tags: </label>
+	<input id="tags" />
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are tags for programming languages, give "ja" (for Java or JavaScript) a try.</p>
+<p>The datasource is a simple JavaScript array, provided to the widget using the source-option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/folding.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,62 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Accent folding</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		var names = [ "Jörn Zaefferer", "Scott González", "John Resig" ];
+
+		var accentMap = {
+			"á": "a",
+			"ö": "o"
+		};
+		var normalize = function( term ) {
+			var ret = "";
+			for ( var i = 0; i < term.length; i++ ) {
+				ret += accentMap[ term.charAt(i) ] || term.charAt(i);
+			}
+			return ret;
+		};
+
+		$( "#developer" ).autocomplete({
+			source: function( request, response ) {
+				var matcher = new RegExp( $.ui.autocomplete.escapeRegex( request.term ), "i" );
+				response( $.grep( names, function( value ) {
+					value = value.label || value.value || value;
+					return matcher.test( value ) || matcher.test( normalize( value ) );
+				}) );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+	<form>
+	<label for="developer">Developer: </label>
+	<input id="developer" />
+	</form>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>The autocomplete field uses a custom source option which will match results that have accented characters even when the text field doesn't contain accented characters. However if the you type in accented characters in the text field it is smart enough not to show results that aren't accented.</p>
+<p>Try typing "Jo" to see "John" and "Jörn", then type "Jö" to see only "Jörn".</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
Binary file jquery-ui/development-bundle/demos/autocomplete/images/jquery_32x32.png has changed
Binary file jquery-ui/development-bundle/demos/autocomplete/images/jqueryui_32x32.png has changed
Binary file jquery-ui/development-bundle/demos/autocomplete/images/sizzlejs_32x32.png has changed
Binary file jquery-ui/development-bundle/demos/autocomplete/images/transparent_1x1.png has changed
Binary file jquery-ui/development-bundle/demos/autocomplete/images/ui-anim_basic_16x16.gif has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,27 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+	<div class="demos-nav">
+		<h4>Examples</h4>
+		<ul>
+			<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+			<li><a href="remote.html">Remote datasource</a></li>
+			<li><a href="remote-with-cache.html">Remote with caching</a></li>
+			<li><a href="remote-jsonp.html">Remote JSONP datasource</a></li>
+			<li><a href="maxheight.html">Scrollable results</a></li>
+			<li><a href="combobox.html">Combobox</a></li>
+			<li><a href="custom-data.html">Custom data and display</a></li>
+			<li><a href="xml.html">XML data parsed once</a></li>
+			<li><a href="categories.html">Categories</a></li>
+			<li><a href="folding.html">Accent folding</a></li>
+			<li><a href="multiple.html">Multiple values</a></li>
+			<li><a href="multiple-remote.html">Multiple, remote</a></li>
+		</ul>
+	</div>
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/london.xml	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,114 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<geonames style="MEDIUM">
+<totalResultsCount>6987</totalResultsCount>
+<geoname>
+<name>London</name>
+<lat>51.5084152563931</lat>
+<lng>-0.125532746315002</lng>
+<geonameId>2643743</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>P</fcl>
+<fcode>PPLC</fcode>
+</geoname>
+<geoname>
+<name>London</name>
+<lat>42.983389283</lat>
+<lng>-81.233042387</lng>
+<geonameId>6058560</geonameId>
+<countryCode>CA</countryCode>
+<countryName>Canada</countryName>
+
+<fcl>P</fcl>
+<fcode>PPL</fcode>
+</geoname>
+<geoname>
+<name>East London</name>
+<lat>-33.0152850934643</lat>
+<lng>27.9116249084473</lng>
+<geonameId>1006984</geonameId>
+<countryCode>ZA</countryCode>
+<countryName>South Africa</countryName>
+
+<fcl>P</fcl>
+<fcode>PPL</fcode>
+</geoname>
+<geoname>
+<name>City</name>
+<lat>51.5133363996235</lat>
+<lng>-0.0890064239501953</lng>
+<geonameId>2643744</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>A</fcl>
+<fcode>ADM2</fcode>
+</geoname>
+<geoname>
+<name>London</name>
+<lat>37.1289771</lat>
+<lng>-84.0832646</lng>
+<geonameId>4298960</geonameId>
+<countryCode>US</countryCode>
+<countryName>United States</countryName>
+
+<fcl>P</fcl>
+<fcode>PPL</fcode>
+</geoname>
+<geoname>
+<name>The Tower of London</name>
+<lat>51.5082349601834</lat>
+<lng>-0.0763034820556641</lng>
+<geonameId>6286786</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>S</fcl>
+<fcode>CSTL</fcode>
+</geoname>
+<geoname>
+<name>London Reefs</name>
+<lat>8.85</lat>
+<lng>112.5333333</lng>
+<geonameId>1879967</geonameId>
+<countryCode>  </countryCode>
+<countryName>  </countryName>
+
+<fcl>U</fcl>
+<fcode>RFSU</fcode>
+</geoname>
+<geoname>
+<name>Greater London</name>
+<lat>51.5</lat>
+<lng>-0.1666667</lng>
+<geonameId>2648110</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>A</fcl>
+<fcode>ADM2</fcode>
+</geoname>
+<geoname>
+<name>London</name>
+<lat>46.1666667</lat>
+<lng>6.0166667</lng>
+<geonameId>2661811</geonameId>
+<countryCode>CH</countryCode>
+<countryName>Switzerland</countryName>
+
+<fcl>H</fcl>
+<fcode>STM</fcode>
+</geoname>
+<geoname>
+<name>London Borough of Islington</name>
+<lat>51.5333333</lat>
+<lng>-0.1333333</lng>
+<geonameId>3333156</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>A</fcl>
+<fcode>ADM2</fcode>
+</geoname>
+</geonames>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/maxheight.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,79 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Scrollable results</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-autocomplete {
+		max-height: 100px;
+		overflow-y: auto;
+		/* prevent horizontal scrollbar */
+		overflow-x: hidden;
+		/* add padding to account for vertical scrollbar */
+		padding-right: 20px;
+	}
+	/* IE 6 doesn't support max-height
+	 * we use height instead, but this forces the menu to always be this tall
+	 */
+	* html .ui-autocomplete {
+		height: 100px;
+	}
+	</style>
+	<script>
+	$(function() {
+		var availableTags = [
+			"ActionScript",
+			"AppleScript",
+			"Asp",
+			"BASIC",
+			"C",
+			"C++",
+			"Clojure",
+			"COBOL",
+			"ColdFusion",
+			"Erlang",
+			"Fortran",
+			"Groovy",
+			"Haskell",
+			"Java",
+			"JavaScript",
+			"Lisp",
+			"Perl",
+			"PHP",
+			"Python",
+			"Ruby",
+			"Scala",
+			"Scheme"
+		];
+		$( "#tags" ).autocomplete({
+			source: availableTags
+		});
+	});
+	</script>
+</head>
+<body>
+	
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="tags">Tags: </label>
+	<input id="tags" />
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>When displaying a long list of options, you can simply set the max-height for the autocomplete menu to prevent the menu from growing too large. Try typing "a" or "s" above to get a long list of results that you can scroll through.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/multiple-remote.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,84 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Multiple, remote</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+	</style>
+	<script>
+	$(function() {
+		function split( val ) {
+			return val.split( /,\s*/ );
+		}
+		function extractLast( term ) {
+			return split( term ).pop();
+		}
+
+		$( "#birds" )
+			// don't navigate away from the field on tab when selecting an item
+			.bind( "keydown", function( event ) {
+				if ( event.keyCode === $.ui.keyCode.TAB &&
+						$( this ).data( "autocomplete" ).menu.active ) {
+					event.preventDefault();
+				}
+			})
+			.autocomplete({
+				source: function( request, response ) {
+					$.getJSON( "search.php", {
+						term: extractLast( request.term )
+					}, response );
+				},
+				search: function() {
+					// custom minLength
+					var term = extractLast( this.value );
+					if ( term.length < 2 ) {
+						return false;
+					}
+				},
+				focus: function() {
+					// prevent value inserted on focus
+					return false;
+				},
+				select: function( event, ui ) {
+					var terms = split( this.value );
+					// remove the current input
+					terms.pop();
+					// add the selected item
+					terms.push( ui.item.value );
+					// add placeholder to get the comma-and-space at the end
+					terms.push( "" );
+					this.value = terms.join( ", " );
+					return false;
+				}
+			});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="birds">Birds: </label>
+	<input id="birds" size="50" />
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Usage: Enter at least two characters to get bird name suggestions. Select a value to continue adding more names.</p>
+<p>This is an example showing how to use the source-option along with some events to enable autocompleting multiple values into a single field.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/multiple.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,99 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Multiple values</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		var availableTags = [
+			"ActionScript",
+			"AppleScript",
+			"Asp",
+			"BASIC",
+			"C",
+			"C++",
+			"Clojure",
+			"COBOL",
+			"ColdFusion",
+			"Erlang",
+			"Fortran",
+			"Groovy",
+			"Haskell",
+			"Java",
+			"JavaScript",
+			"Lisp",
+			"Perl",
+			"PHP",
+			"Python",
+			"Ruby",
+			"Scala",
+			"Scheme"
+		];
+		function split( val ) {
+			return val.split( /,\s*/ );
+		}
+		function extractLast( term ) {
+			return split( term ).pop();
+		}
+
+		$( "#tags" )
+			// don't navigate away from the field on tab when selecting an item
+			.bind( "keydown", function( event ) {
+				if ( event.keyCode === $.ui.keyCode.TAB &&
+						$( this ).data( "autocomplete" ).menu.active ) {
+					event.preventDefault();
+				}
+			})
+			.autocomplete({
+				minLength: 0,
+				source: function( request, response ) {
+					// delegate back to autocomplete, but extract the last term
+					response( $.ui.autocomplete.filter(
+						availableTags, extractLast( request.term ) ) );
+				},
+				focus: function() {
+					// prevent value inserted on focus
+					return false;
+				},
+				select: function( event, ui ) {
+					var terms = split( this.value );
+					// remove the current input
+					terms.pop();
+					// add the selected item
+					terms.push( ui.item.value );
+					// add placeholder to get the comma-and-space at the end
+					terms.push( "" );
+					this.value = terms.join( ", " );
+					return false;
+				}
+			});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="tags">Tag programming languages: </label>
+	<input id="tags" size="50" />
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Usage: Type something, eg. "j" to see suggestions for tagging with programming languages. Select a value, then continue typing to add more.</p>
+<p>This is an example showing how to use the source-option along with some events to enable autocompleting multiple values into a single field.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/remote-jsonp.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,86 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Remote JSONP datasource</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+	#city { width: 25em; }
+	</style>
+	<script>
+	$(function() {
+		function log( message ) {
+			$( "<div/>" ).text( message ).prependTo( "#log" );
+			$( "#log" ).attr( "scrollTop", 0 );
+		}
+
+		$( "#city" ).autocomplete({
+			source: function( request, response ) {
+				$.ajax({
+					url: "http://ws.geonames.org/searchJSON",
+					dataType: "jsonp",
+					data: {
+						featureClass: "P",
+						style: "full",
+						maxRows: 12,
+						name_startsWith: request.term
+					},
+					success: function( data ) {
+						response( $.map( data.geonames, function( item ) {
+							return {
+								label: item.name + (item.adminName1 ? ", " + item.adminName1 : "") + ", " + item.countryName,
+								value: item.name
+							}
+						}));
+					}
+				});
+			},
+			minLength: 2,
+			select: function( event, ui ) {
+				log( ui.item ?
+					"Selected: " + ui.item.label :
+					"Nothing selected, input was " + this.value);
+			},
+			open: function() {
+				$( this ).removeClass( "ui-corner-all" ).addClass( "ui-corner-top" );
+			},
+			close: function() {
+				$( this ).removeClass( "ui-corner-top" ).addClass( "ui-corner-all" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="city">Your city: </label>
+	<input id="city" />
+	Powered by <a href="http://geonames.org">geonames.org</a>
+</div>
+
+<div class="ui-widget" style="margin-top:2em; font-family:Arial">
+	Result:
+	<div id="log" style="height: 200px; width: 300px; overflow: auto;" class="ui-widget-content"></div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are cities, displayed when at least two characters are entered into the field.</p>
+<p>In this case, the datasource is the <a href="http://geonames.org">geonames.org webservice</a>. While only the city name itself ends up in the input after selecting an element, more info is displayed in the suggestions to help find the right entry. That data is also available in callbacks, as illustrated by the Result area below the input.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/remote-with-cache.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,59 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Remote with caching</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+	</style>
+	<script>
+	$(function() {
+		var cache = {},
+			lastXhr;
+		$( "#birds" ).autocomplete({
+			minLength: 2,
+			source: function( request, response ) {
+				var term = request.term;
+				if ( term in cache ) {
+					response( cache[ term ] );
+					return;
+				}
+
+				lastXhr = $.getJSON( "search.php", request, function( data, status, xhr ) {
+					cache[ term ] = data;
+					if ( xhr === lastXhr ) {
+						response( data );
+					}
+				});
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="birds">Birds: </label>
+	<input id="birds" />
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are bird names, displayed when at least two characters are entered into the field.</p>
+<p>Similar to the remote datasource demo, though this adds some local caching to improve performance. The cache here saves just one query, and could be extended to cache multiple values, one for each term.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/remote.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,59 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - Remote datasource</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+	</style>
+	<script>
+	$(function() {
+		function log( message ) {
+			$( "<div/>" ).text( message ).prependTo( "#log" );
+			$( "#log" ).attr( "scrollTop", 0 );
+		}
+
+		$( "#birds" ).autocomplete({
+			source: "search.php",
+			minLength: 2,
+			select: function( event, ui ) {
+				log( ui.item ?
+					"Selected: " + ui.item.value + " aka " + ui.item.id :
+					"Nothing selected, input was " + this.value );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="birds">Birds: </label>
+	<input id="birds" />
+</div>
+
+<div class="ui-widget" style="margin-top:2em; font-family:Arial">
+	Result:
+	<div id="log" style="height: 200px; width: 300px; overflow: auto;" class="ui-widget-content"></div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are bird names, displayed when at least two characters are entered into the field.</p>
+<p>The datasource is a server-side script which returns JSON data, specified via a simple URL for the source-option. In addition, the minLength-option is set to 2 to avoid queries that would return too many results and the select-event is used to display some feedback.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/search.php	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,640 @@
+<?php
+
+$q = strtolower($_GET["term"]);
+if (!$q) return;
+$items = array(
+"Great Bittern"=>"Botaurus stellaris",
+"Little Grebe"=>"Tachybaptus ruficollis",
+"Black-necked Grebe"=>"Podiceps nigricollis",
+"Little Bittern"=>"Ixobrychus minutus",
+"Black-crowned Night Heron"=>"Nycticorax nycticorax",
+"Purple Heron"=>"Ardea purpurea",
+"White Stork"=>"Ciconia ciconia",
+"Spoonbill"=>"Platalea leucorodia",
+"Red-crested Pochard"=>"Netta rufina",
+"Common Eider"=>"Somateria mollissima",
+"Red Kite"=>"Milvus milvus",
+"Hen Harrier"=>"Circus cyaneus",
+"Montagu`s Harrier"=>"Circus pygargus",
+"Black Grouse"=>"Tetrao tetrix",
+"Grey Partridge"=>"Perdix perdix",
+"Spotted Crake"=>"Porzana porzana",
+"Corncrake"=>"Crex crex",
+"Common Crane"=>"Grus grus",
+"Avocet"=>"Recurvirostra avosetta",
+"Stone Curlew"=>"Burhinus oedicnemus",
+"Common Ringed Plover"=>"Charadrius hiaticula",
+"Kentish Plover"=>"Charadrius alexandrinus",
+"Ruff"=>"Philomachus pugnax",
+"Common Snipe"=>"Gallinago gallinago",
+"Black-tailed Godwit"=>"Limosa limosa",
+"Common Redshank"=>"Tringa totanus",
+"Sandwich Tern"=>"Sterna sandvicensis",
+"Common Tern"=>"Sterna hirundo",
+"Arctic Tern"=>"Sterna paradisaea",
+"Little Tern"=>"Sternula albifrons",
+"Black Tern"=>"Chlidonias niger",
+"Barn Owl"=>"Tyto alba",
+"Little Owl"=>"Athene noctua",
+"Short-eared Owl"=>"Asio flammeus",
+"European Nightjar"=>"Caprimulgus europaeus",
+"Common Kingfisher"=>"Alcedo atthis",
+"Eurasian Hoopoe"=>"Upupa epops",
+"Eurasian Wryneck"=>"Jynx torquilla",
+"European Green Woodpecker"=>"Picus viridis",
+"Crested Lark"=>"Galerida cristata",
+"White-headed Duck"=>"Oxyura leucocephala",
+"Pale-bellied Brent Goose"=>"Branta hrota",
+"Tawny Pipit"=>"Anthus campestris",
+"Whinchat"=>"Saxicola rubetra",
+"European Stonechat"=>"Saxicola rubicola",
+"Northern Wheatear"=>"Oenanthe oenanthe",
+"Savi`s Warbler"=>"Locustella luscinioides",
+"Sedge Warbler"=>"Acrocephalus schoenobaenus",
+"Great Reed Warbler"=>"Acrocephalus arundinaceus",
+"Bearded Reedling"=>"Panurus biarmicus",
+"Red-backed Shrike"=>"Lanius collurio",
+"Great Grey Shrike"=>"Lanius excubitor",
+"Woodchat Shrike"=>"Lanius senator",
+"Common Raven"=>"Corvus corax",
+"Yellowhammer"=>"Emberiza citrinella",
+"Ortolan Bunting"=>"Emberiza hortulana",
+"Corn Bunting"=>"Emberiza calandra",
+"Great Cormorant"=>"Phalacrocorax carbo",
+"Hawfinch"=>"Coccothraustes coccothraustes",
+"Common Shelduck"=>"Tadorna tadorna",
+"Bluethroat"=>"Luscinia svecica",
+"Grey Heron"=>"Ardea cinerea",
+"Barn Swallow"=>"Hirundo rustica",
+"Hooded Crow"=>"Corvus cornix",
+"Dunlin"=>"Calidris alpina",
+"Eurasian Pied Flycatcher"=>"Ficedula hypoleuca",
+"Eurasian Nuthatch"=>"Sitta europaea",
+"Short-toed Tree Creeper"=>"Certhia brachydactyla",
+"Wood Lark"=>"Lullula arborea",
+"Tree Pipit"=>"Anthus trivialis",
+"Eurasian Hobby"=>"Falco subbuteo",
+"Marsh Warbler"=>"Acrocephalus palustris",
+"Wood Sandpiper"=>"Tringa glareola",
+"Tawny Owl"=>"Strix aluco",
+"Lesser Whitethroat"=>"Sylvia curruca",
+"Barnacle Goose"=>"Branta leucopsis",
+"Common Goldeneye"=>"Bucephala clangula",
+"Western Marsh Harrier"=>"Circus aeruginosus",
+"Common Buzzard"=>"Buteo buteo",
+"Sanderling"=>"Calidris alba",
+"Little Gull"=>"Larus minutus",
+"Eurasian Magpie"=>"Pica pica",
+"Willow Warbler"=>"Phylloscopus trochilus",
+"Wood Warbler"=>"Phylloscopus sibilatrix",
+"Great Crested Grebe"=>"Podiceps cristatus",
+"Eurasian Jay"=>"Garrulus glandarius",
+"Common Redstart"=>"Phoenicurus phoenicurus",
+"Blue-headed Wagtail"=>"Motacilla flava",
+"Common Swift"=>"Apus apus",
+"Marsh Tit"=>"Poecile palustris",
+"Goldcrest"=>"Regulus regulus",
+"European Golden Plover"=>"Pluvialis apricaria",
+"Eurasian Bullfinch"=>"Pyrrhula pyrrhula",
+"Common Whitethroat"=>"Sylvia communis",
+"Meadow Pipit"=>"Anthus pratensis",
+"Greylag Goose"=>"Anser anser",
+"Spotted Flycatcher"=>"Muscicapa striata",
+"European Greenfinch"=>"Carduelis chloris",
+"Common Greenshank"=>"Tringa nebularia",
+"Great Spotted Woodpecker"=>"Dendrocopos major",
+"Greater Canada Goose"=>"Branta canadensis",
+"Mistle Thrush"=>"Turdus viscivorus",
+"Great Black-backed Gull"=>"Larus marinus",
+"Goosander"=>"Mergus merganser",
+"Great Egret"=>"Casmerodius albus",
+"Northern Goshawk"=>"Accipiter gentilis",
+"Dunnock"=>"Prunella modularis",
+"Stock Dove"=>"Columba oenas",
+"Common Wood Pigeon"=>"Columba palumbus",
+"Eurasian Woodcock"=>"Scolopax rusticola",
+"House Sparrow"=>"Passer domesticus",
+"Common House Martin"=>"Delichon urbicum",
+"Red Knot"=>"Calidris canutus",
+"Western Jackdaw"=>"Corvus monedula",
+"Brambling"=>"Fringilla montifringilla",
+"Northern Lapwing"=>"Vanellus vanellus",
+"European Reed Warbler"=>"Acrocephalus scirpaceus",
+"Lesser Black-backed Gull"=>"Larus fuscus",
+"Little Egret"=>"Egretta garzetta",
+"Little Stint"=>"Calidris minuta",
+"Common Linnet"=>"Carduelis cannabina",
+"Mute Swan"=>"Cygnus olor",
+"Common Cuckoo"=>"Cuculus canorus",
+"Black-headed Gull"=>"Larus ridibundus",
+"Greater White-fronted Goose"=>"Anser albifrons",
+"Great Tit"=>"Parus major",
+"Redwing"=>"Turdus iliacus",
+"Gadwall"=>"Anas strepera",
+"Fieldfare"=>"Turdus pilaris",
+"Tufted Duck"=>"Aythya fuligula",
+"Crested Tit"=>"Lophophanes cristatus",
+"Willow Tit"=>"Poecile montanus",
+"Eurasian Coot"=>"Fulica atra",
+"Common Blackbird"=>"Turdus merula",
+"Smew"=>"Mergus albellus",
+"Common Sandpiper"=>"Actitis hypoleucos",
+"Sand Martin"=>"Riparia riparia",
+"Purple Sandpiper"=>"Calidris maritima",
+"Northern Pintail"=>"Anas acuta",
+"Blue Tit"=>"Cyanistes caeruleus",
+"European Goldfinch"=>"Carduelis carduelis",
+"Eurasian Whimbrel"=>"Numenius phaeopus",
+"Common Reed Bunting"=>"Emberiza schoeniclus",
+"Eurasian Tree Sparrow"=>"Passer montanus",
+"Rook"=>"Corvus frugilegus",
+"European Robin"=>"Erithacus rubecula",
+"Bar-tailed Godwit"=>"Limosa lapponica",
+"Dark-bellied Brent Goose"=>"Branta bernicla",
+"Eurasian Oystercatcher"=>"Haematopus ostralegus",
+"Eurasian Siskin"=>"Carduelis spinus",
+"Northern Shoveler"=>"Anas clypeata",
+"Eurasian Wigeon"=>"Anas penelope",
+"Eurasian Sparrow Hawk"=>"Accipiter nisus",
+"Icterine Warbler"=>"Hippolais icterina",
+"Common Starling"=>"Sturnus vulgaris",
+"Long-tailed Tit"=>"Aegithalos caudatus",
+"Ruddy Turnstone"=>"Arenaria interpres",
+"Mew Gull"=>"Larus canus",
+"Common Pochard"=>"Aythya ferina",
+"Common Chiffchaff"=>"Phylloscopus collybita",
+"Greater Scaup"=>"Aythya marila",
+"Common Kestrel"=>"Falco tinnunculus",
+"Garden Warbler"=>"Sylvia borin",
+"Eurasian Collared Dove"=>"Streptopelia decaocto",
+"Eurasian Skylark"=>"Alauda arvensis",
+"Common Chaffinch"=>"Fringilla coelebs",
+"Common Moorhen"=>"Gallinula chloropus",
+"Water Pipit"=>"Anthus spinoletta",
+"Mallard"=>"Anas platyrhynchos",
+"Winter Wren"=>"Troglodytes troglodytes",
+"Common Teal"=>"Anas crecca",
+"Green Sandpiper"=>"Tringa ochropus",
+"White Wagtail"=>"Motacilla alba",
+"Eurasian Curlew"=>"Numenius arquata",
+"Song Thrush"=>"Turdus philomelos",
+"European Herring Gull"=>"Larus argentatus",
+"Grey Plover"=>"Pluvialis squatarola",
+"Carrion Crow"=>"Corvus corone",
+"Coal Tit"=>"Periparus ater",
+"Spotted Redshank"=>"Tringa erythropus",
+"Blackcap"=>"Sylvia atricapilla",
+"Egyptian Vulture"=>"Neophron percnopterus",
+"Razorbill"=>"Alca torda",
+"Alpine Swift"=>"Apus melba",
+"Long-legged Buzzard"=>"Buteo rufinus",
+"Audouin`s Gull"=>"Larus audouinii",
+"Balearic Shearwater"=>"Puffinus mauretanicus",
+"Upland Sandpiper"=>"Bartramia longicauda",
+"Greater Spotted Eagle"=>"Aquila clanga",
+"Ring Ouzel"=>"Turdus torquatus",
+"Yellow-browed Warbler"=>"Phylloscopus inornatus",
+"Blue Rock Thrush"=>"Monticola solitarius",
+"Buff-breasted Sandpiper"=>"Tryngites subruficollis",
+"Jack Snipe"=>"Lymnocryptes minimus",
+"White-rumped Sandpiper"=>"Calidris fuscicollis",
+"Ruddy Shelduck"=>"Tadorna ferruginea",
+"Cetti's Warbler"=>"Cettia cetti",
+"Citrine Wagtail"=>"Motacilla citreola",
+"Roseate Tern"=>"Sterna dougallii",
+"Black-legged Kittiwake"=>"Rissa tridactyla",
+"Pygmy Cormorant"=>"Phalacrocorax pygmeus",
+"Booted Eagle"=>"Aquila pennata",
+"Lesser White-fronted Goose"=>"Anser erythropus",
+"Little Bunting"=>"Emberiza pusilla",
+"Eleonora's Falcon"=>"Falco eleonorae",
+"European Serin"=>"Serinus serinus",
+"Twite"=>"Carduelis flavirostris",
+"Yellow-legged Gull"=>"Larus michahellis",
+"Gyr Falcon"=>"Falco rusticolus",
+"Greenish Warbler"=>"Phylloscopus trochiloides",
+"Red-necked Phalarope"=>"Phalaropus lobatus",
+"Mealy Redpoll"=>"Carduelis flammea",
+"Glaucous Gull"=>"Larus hyperboreus",
+"Great Skua"=>"Stercorarius skua",
+"Great Bustard"=>"Otis tarda",
+"Velvet Scoter"=>"Melanitta fusca",
+"Pine Grosbeak"=>"Pinicola enucleator",
+"House Crow"=>"Corvus splendens",
+"Hume`s Leaf Warbler"=>"Phylloscopus humei",
+"Great Northern Loon"=>"Gavia immer",
+"Long-tailed Duck"=>"Clangula hyemalis",
+"Lapland Longspur"=>"Calcarius lapponicus",
+"Northern Gannet"=>"Morus bassanus",
+"Eastern Imperial Eagle"=>"Aquila heliaca",
+"Little Auk"=>"Alle alle",
+"Lesser Spotted Woodpecker"=>"Dendrocopos minor",
+"Iceland Gull"=>"Larus glaucoides",
+"Parasitic Jaeger"=>"Stercorarius parasiticus",
+"Bewick`s Swan"=>"Cygnus bewickii",
+"Little Bustard"=>"Tetrax tetrax",
+"Little Crake"=>"Porzana parva",
+"Baillon`s Crake"=>"Porzana pusilla",
+"Long-tailed Jaeger"=>"Stercorarius longicaudus",
+"King Eider"=>"Somateria spectabilis",
+"Greater Short-toed Lark"=>"Calandrella brachydactyla",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Curlew Sandpiper"=>"Calidris ferruginea",
+"Common Crossbill"=>"Loxia curvirostra",
+"European Shag"=>"Phalacrocorax aristotelis",
+"Horned Grebe"=>"Podiceps auritus",
+"Common Quail"=>"Coturnix coturnix",
+"Bearded Vulture"=>"Gypaetus barbatus",
+"Lanner Falcon"=>"Falco biarmicus",
+"Middle Spotted Woodpecker"=>"Dendrocopos medius",
+"Pomarine Jaeger"=>"Stercorarius pomarinus",
+"Red-breasted Merganser"=>"Mergus serrator",
+"Eurasian Black Vulture"=>"Aegypius monachus",
+"Eurasian Dotterel"=>"Charadrius morinellus",
+"Common Nightingale"=>"Luscinia megarhynchos",
+"Northern willow warbler"=>"Phylloscopus trochilus acredula",
+"Manx Shearwater"=>"Puffinus puffinus",
+"Northern Fulmar"=>"Fulmarus glacialis",
+"Eurasian Eagle Owl"=>"Bubo bubo",
+"Orphean Warbler"=>"Sylvia hortensis",
+"Melodious Warbler"=>"Hippolais polyglotta",
+"Pallas's Leaf Warbler"=>"Phylloscopus proregulus",
+"Atlantic Puffin"=>"Fratercula arctica",
+"Black-throated Loon"=>"Gavia arctica",
+"Bohemian Waxwing"=>"Bombycilla garrulus",
+"Marsh Sandpiper"=>"Tringa stagnatilis",
+"Great Snipe"=>"Gallinago media",
+"Squacco Heron"=>"Ardeola ralloides",
+"Long-eared Owl"=>"Asio otus",
+"Caspian Tern"=>"Hydroprogne caspia",
+"Red-breasted Goose"=>"Branta ruficollis",
+"Red-throated Loon"=>"Gavia stellata",
+"Common Rosefinch"=>"Carpodacus erythrinus",
+"Red-footed Falcon"=>"Falco vespertinus",
+"Ross's Goose"=>"Anser rossii",
+"Red Phalarope"=>"Phalaropus fulicarius",
+"Pied Wagtail"=>"Motacilla yarrellii",
+"Rose-coloured Starling"=>"Sturnus roseus",
+"Rough-legged Buzzard"=>"Buteo lagopus",
+"Saker Falcon"=>"Falco cherrug",
+"European Roller"=>"Coracias garrulus",
+"Short-toed Eagle"=>"Circaetus gallicus",
+"Peregrine Falcon"=>"Falco peregrinus",
+"Merlin"=>"Falco columbarius",
+"Snow Goose"=>"Anser caerulescens",
+"Snowy Owl"=>"Bubo scandiacus",
+"Snow Bunting"=>"Plectrophenax nivalis",
+"Common Grasshopper Warbler"=>"Locustella naevia",
+"Golden Eagle"=>"Aquila chrysaetos",
+"Black-winged Stilt"=>"Himantopus himantopus",
+"Steppe Eagle"=>"Aquila nipalensis",
+"Pallid Harrier"=>"Circus macrourus",
+"European Storm-petrel"=>"Hydrobates pelagicus",
+"Horned Lark"=>"Eremophila alpestris",
+"Eurasian Treecreeper"=>"Certhia familiaris",
+"Taiga Bean Goose"=>"Anser fabalis",
+"Temminck`s Stint"=>"Calidris temminckii",
+"Terek Sandpiper"=>"Xenus cinereus",
+"Tundra Bean Goose"=>"Anser serrirostris",
+"European Turtle Dove"=>"Streptopelia turtur",
+"Leach`s Storm-petrel"=>"Oceanodroma leucorhoa",
+"Eurasian Griffon Vulture"=>"Gyps fulvus",
+"Paddyfield Warbler"=>"Acrocephalus agricola",
+"Osprey"=>"Pandion haliaetus",
+"Firecrest"=>"Regulus ignicapilla",
+"Water Rail"=>"Rallus aquaticus",
+"European Honey Buzzard"=>"Pernis apivorus",
+"Eurasian Golden Oriole"=>"Oriolus oriolus",
+"Whooper Swan"=>"Cygnus cygnus",
+"Two-barred Crossbill"=>"Loxia leucoptera",
+"White-tailed Eagle"=>"Haliaeetus albicilla",
+"Atlantic Murre"=>"Uria aalge",
+"Garganey"=>"Anas querquedula",
+"Black Redstart"=>"Phoenicurus ochruros",
+"Common Scoter"=>"Melanitta nigra",
+"Rock Pipit"=>"Anthus petrosus",
+"Lesser Spotted Eagle"=>"Aquila pomarina",
+"Cattle Egret"=>"Bubulcus ibis",
+"White-winged Black Tern"=>"Chlidonias leucopterus",
+"Black Stork"=>"Ciconia nigra",
+"Mediterranean Gull"=>"Larus melanocephalus",
+"Black Kite"=>"Milvus migrans",
+"Yellow Wagtail"=>"Motacilla flavissima",
+"Red-necked Grebe"=>"Podiceps grisegena",
+"Gull-billed Tern"=>"Gelochelidon nilotica",
+"Pectoral Sandpiper"=>"Calidris melanotos",
+"Barred Warbler"=>"Sylvia nisoria",
+"Red-throated Pipit"=>"Anthus cervinus",
+"Grey Wagtail"=>"Motacilla cinerea",
+"Richard`s Pipit"=>"Anthus richardi",
+"Black Woodpecker"=>"Dryocopus martius",
+"Little Ringed Plover"=>"Charadrius dubius",
+"Whiskered Tern"=>"Chlidonias hybrida",
+"Lesser Redpoll"=>"Carduelis cabaret",
+"Pallas' Bunting"=>"Emberiza pallasi",
+"Ferruginous Duck"=>"Aythya nyroca",
+"Whistling Swan"=>"Cygnus columbianus",
+"Black Brant"=>"Branta nigricans",
+"Marbled Teal"=>"Marmaronetta angustirostris",
+"Canvasback"=>"Aythya valisineria",
+"Redhead"=>"Aythya americana",
+"Lesser Scaup"=>"Aythya affinis",
+"Steller`s Eider"=>"Polysticta stelleri",
+"Spectacled Eider"=>"Somateria fischeri",
+"Harlequin Duck"=>"Histronicus histrionicus",
+"Black Scoter"=>"Melanitta americana",
+"Surf Scoter"=>"Melanitta perspicillata",
+"Barrow`s Goldeneye"=>"Bucephala islandica",
+"Falcated Duck"=>"Anas falcata",
+"American Wigeon"=>"Anas americana",
+"Blue-winged Teal"=>"Anas discors",
+"American Black Duck"=>"Anas rubripes",
+"Baikal Teal"=>"Anas formosa",
+"Green-Winged Teal"=>"Anas carolinensis",
+"Hazel Grouse"=>"Bonasa bonasia",
+"Rock Partridge"=>"Alectoris graeca",
+"Red-legged Partridge"=>"Alectoris rufa",
+"Yellow-billed Loon"=>"Gavia adamsii",
+"Cory`s Shearwater"=>"Calonectris borealis",
+"Madeiran Storm-Petrel"=>"Oceanodroma castro",
+"Great White Pelican"=>"Pelecanus onocrotalus",
+"Dalmatian Pelican"=>"Pelecanus crispus",
+"American Bittern"=>"Botaurus lentiginosus",
+"Glossy Ibis"=>"Plegadis falcinellus",
+"Spanish Imperial Eagle"=>"Aquila adalberti",
+"Lesser Kestrel"=>"Falco naumanni",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Crab-Plover"=>"Dromas ardeola",
+"Cream-coloured Courser"=>"Cursorius cursor",
+"Collared Pratincole"=>"Glareola pratincola",
+"Black-winged Pratincole"=>"Glareola nordmanni",
+"Killdeer"=>"Charadrius vociferus",
+"Lesser Sand Plover"=>"Charadrius mongolus",
+"Greater Sand Plover"=>"Charadrius leschenaultii",
+"Caspian Plover"=>"Charadrius asiaticus",
+"American Golden Plover"=>"Pluvialis dominica",
+"Pacific Golden Plover"=>"Pluvialis fulva",
+"Sharp-tailed Sandpiper"=>"Calidris acuminata",
+"Broad-billed Sandpiper"=>"Limicola falcinellus",
+"Spoon-Billed Sandpiper"=>"Eurynorhynchus pygmaeus",
+"Short-Billed Dowitcher"=>"Limnodromus griseus",
+"Long-billed Dowitcher"=>"Limnodromus scolopaceus",
+"Hudsonian Godwit"=>"Limosa haemastica",
+"Little Curlew"=>"Numenius minutus",
+"Lesser Yellowlegs"=>"Tringa flavipes",
+"Wilson`s Phalarope"=>"Phalaropus tricolor",
+"Pallas`s Gull"=>"Larus ichthyaetus",
+"Laughing Gull"=>"Larus atricilla",
+"Franklin`s Gull"=>"Larus pipixcan",
+"Bonaparte`s Gull"=>"Larus philadelphia",
+"Ring-billed Gull"=>"Larus delawarensis",
+"American Herring Gull"=>"Larus smithsonianus",
+"Caspian Gull"=>"Larus cachinnans",
+"Ivory Gull"=>"Pagophila eburnea",
+"Royal Tern"=>"Sterna maxima",
+"Brünnich`s Murre"=>"Uria lomvia",
+"Crested Auklet"=>"Aethia cristatella",
+"Parakeet Auklet"=>"Cyclorrhynchus psittacula",
+"Tufted Puffin"=>"Lunda cirrhata",
+"Laughing Dove"=>"Streptopelia senegalensis",
+"Great Spotted Cuckoo"=>"Clamator glandarius",
+"Great Grey Owl"=>"Strix nebulosa",
+"Tengmalm`s Owl"=>"Aegolius funereus",
+"Red-Necked Nightjar"=>"Caprimulgus ruficollis",
+"Chimney Swift"=>"Chaetura pelagica",
+"Green Bea-Eater"=>"Merops orientalis",
+"Grey-headed Woodpecker"=>"Picus canus",
+"Lesser Short-Toed Lark"=>"Calandrella rufescens",
+"Eurasian Crag Martin"=>"Hirundo rupestris",
+"Red-rumped Swallow"=>"Cecropis daurica",
+"Blyth`s Pipit"=>"Anthus godlewskii",
+"Pechora Pipit"=>"Anthus gustavi",
+"Grey-headed Wagtail"=>"Motacilla thunbergi",
+"Yellow-Headed Wagtail"=>"Motacilla lutea",
+"White-throated Dipper"=>"Cinclus cinclus",
+"Rufous-Tailed Scrub Robin"=>"Cercotrichas galactotes",
+"Thrush Nightingale"=>"Luscinia luscinia",
+"White-throated Robin"=>"Irania gutturalis",
+"Caspian Stonechat"=>"Saxicola maura variegata",
+"Western Black-eared Wheatear"=>"Oenanthe hispanica",
+"Rufous-tailed Rock Thrush"=>"Monticola saxatilis",
+"Red-throated Thrush/Black-throated"=>"Turdus ruficollis",
+"American Robin"=>"Turdus migratorius",
+"Zitting Cisticola"=>"Cisticola juncidis",
+"Lanceolated Warbler"=>"Locustella lanceolata",
+"River Warbler"=>"Locustella fluviatilis",
+"Blyth`s Reed Warbler"=>"Acrocephalus dumetorum",
+"Caspian Reed Warbler"=>"Acrocephalus fuscus",
+"Aquatic Warbler"=>"Acrocephalus paludicola",
+"Booted Warbler"=>"Acrocephalus caligatus",
+"Marmora's Warbler"=>"Sylvia sarda",
+"Dartford Warbler"=>"Sylvia undata",
+"Subalpine Warbler"=>"Sylvia cantillans",
+"Ménétries's Warbler"=>"Sylvia mystacea",
+"Rüppel's Warbler"=>"Sylvia rueppelli",
+"Asian Desert Warbler"=>"Sylvia nana",
+"Western Orphean Warbler"=>"Sylvia hortensis hortensis",
+"Arctic Warbler"=>"Phylloscopus borealis",
+"Radde`s Warbler"=>"Phylloscopus schwarzi",
+"Western Bonelli`s Warbler"=>"Phylloscopus bonelli",
+"Red-breasted Flycatcher"=>"Ficedula parva",
+"Eurasian Penduline Tit"=>"Remiz pendulinus",
+"Daurian Shrike"=>"Lanius isabellinus",
+"Long-Tailed Shrike"=>"Lanius schach",
+"Lesser Grey Shrike"=>"Lanius minor",
+"Southern Grey Shrike"=>"Lanius meridionalis",
+"Masked Shrike"=>"Lanius nubicus",
+"Spotted Nutcracker"=>"Nucifraga caryocatactes",
+"Daurian Jackdaw"=>"Corvus dauuricus",
+"Purple-Backed Starling"=>"Sturnus sturninus",
+"Red-Fronted Serin"=>"Serinus pusillus",
+"Arctic Redpoll"=>"Carduelis hornemanni",
+"Scottish Crossbill"=>"Loxia scotica",
+"Parrot Crossbill"=>"Loxia pytyopsittacus",
+"Black-faced Bunting"=>"Emberiza spodocephala",
+"Pink-footed Goose"=>"Anser brachyrhynchus",
+"Black-winged Kite"=>"Elanus caeruleus",
+"European Bee-eater"=>"Merops apiaster",
+"Sabine`s Gull"=>"Larus sabini",
+"Sooty Shearwater"=>"Puffinus griseus",
+"Lesser Canada Goose"=>"Branta hutchinsii",
+"Ring-necked Duck"=>"Aythya collaris",
+"Greater Flamingo"=>"Phoenicopterus roseus",
+"Iberian Chiffchaff"=>"Phylloscopus ibericus",
+"Ashy-headed Wagtail"=>"Motacilla cinereocapilla",
+"Stilt Sandpiper"=>"Calidris himantopus",
+"Siberian Stonechat"=>"Saxicola maurus",
+"Greater Yellowlegs"=>"Tringa melanoleuca",
+"Forster`s Tern"=>"Sterna forsteri",
+"Dusky Warbler"=>"Phylloscopus fuscatus",
+"Cirl Bunting"=>"Emberiza cirlus",
+"Olive-backed Pipit"=>"Anthus hodgsoni",
+"Sociable Lapwing"=>"Vanellus gregarius",
+"Spotted Sandpiper"=>"Actitis macularius",
+"Baird`s Sandpiper"=>"Calidris bairdii",
+"Rustic Bunting"=>"Emberiza rustica",
+"Yellow-browed Bunting"=>"Emberiza chrysophrys",
+"Great Shearwater"=>"Puffinus gravis",
+"Bonelli`s Eagle"=>"Aquila fasciata",
+"Calandra Lark"=>"Melanocorypha calandra",
+"Sardinian Warbler"=>"Sylvia melanocephala",
+"Ross's Gull"=>"Larus roseus",
+"Yellow-Breasted Bunting"=>"Emberiza aureola",
+"Pine Bunting"=>"Emberiza leucocephalos",
+"Black Guillemot"=>"Cepphus grylle",
+"Pied-billed Grebe"=>"Podilymbus podiceps",
+"Soft-plumaged Petrel"=>"Pterodroma mollis",
+"Bulwer's Petrel"=>"Bulweria bulwerii",
+"White-Faced Storm-Petrel"=>"Pelagodroma marina",
+"Pallas’s Fish Eagle"=>"Haliaeetus leucoryphus",
+"Sandhill Crane"=>"Grus canadensis",
+"Macqueen’s Bustard"=>"Chlamydotis macqueenii",
+"White-tailed Lapwing"=>"Vanellus leucurus",
+"Great Knot"=>"Calidris tenuirostris",
+"Semipalmated Sandpiper"=>"Calidris pusilla",
+"Red-necked Stint"=>"Calidris ruficollis",
+"Slender-billed Curlew"=>"Numenius tenuirostris",
+"Bridled Tern"=>"Onychoprion anaethetus",
+"Pallas’s Sandgrouse"=>"Syrrhaptes paradoxus",
+"European Scops Owl"=>"Otus scops",
+"Northern Hawk Owl"=>"Surnia ulula",
+"White-Throated Needletail"=>"Hirundapus caudacutus",
+"Belted Kingfisher"=>"Ceryle alcyon",
+"Blue-cheeked Bee-eater"=>"Merops persicus",
+"Black-headed Wagtail"=>"Motacilla feldegg",
+"Northern Mockingbird"=>"Mimus polyglottos",
+"Alpine Accentor"=>"Prunella collaris",
+"Red-flanked Bluetail"=>"Tarsiger cyanurus",
+"Isabelline Wheatear"=>"Oenanthe isabellina",
+"Pied Wheatear"=>"Oenanthe pleschanka",
+"Eastern Black-eared Wheatear"=>"Oenanthe melanoleuca",
+"Desert Wheatear"=>"Oenanthe deserti",
+"White`s Thrush"=>"Zoothera aurea",
+"Siberian Thrush"=>"Zoothera sibirica",
+"Eyebrowed Thrush"=>"Turdus obscurus",
+"Dusky Thrush"=>"Turdus eunomus",
+"Black-throated Thrush"=>"Turdus atrogularis",
+"Pallas`s Grasshopper Warbler"=>"Locustella certhiola",
+"Spectacled Warbler"=>"Sylvia conspicillata",
+"Two-barred Warbler"=>"Phylloscopus plumbeitarsus",
+"Eastern Bonelli’s Warbler"=>"Phylloscopus orientalis",
+"Collared Flycatcher"=>"Ficedula albicollis",
+"Wallcreeper"=>"Tichodroma muraria",
+"Turkestan Shrike"=>"Lanius phoenicuroides",
+"Steppe Grey Shrike"=>"Lanius pallidirostris",
+"Spanish Sparrow"=>"Passer hispaniolensis",
+"Red-eyed Vireo"=>"Vireo olivaceus",
+"Myrtle Warbler"=>"Dendroica coronata",
+"White-crowned Sparrow"=>"Zonotrichia leucophrys",
+"White-throated Sparrow"=>"Zonotrichia albicollis",
+"Cretzschmar`s Bunting"=>"Emberiza caesia",
+"Chestnut Bunting"=>"Emberiza rutila",
+"Red-headed Bunting"=>"Emberiza bruniceps",
+"Black-headed Bunting"=>"Emberiza melanocephala",
+"Indigo Bunting"=>"Passerina cyanea",
+"Balearic Woodchat Shrike"=>"Lanius senator badius",
+"Demoiselle Crane"=>"Grus virgo",
+"Chough"=>"Pyrrhocorax pyrrhocorax",
+"Red-Billed Chough"=>"Pyrrhocorax graculus",
+"Elegant Tern"=>"Sterna elegans",
+"Chukar"=>"Alectoris chukar",
+"Yellow-Billed Cuckoo"=>"Coccyzus americanus",
+"American Sandwich Tern"=>"Sterna sandvicensis acuflavida",
+"Olive-Tree Warbler"=>"Hippolais olivetorum",
+"Eastern Olivaceous Warbler"=>"Acrocephalus pallidus",
+"Indian Cormorant"=>"Phalacrocorax fuscicollis",
+"Spur-Winged Lapwing"=>"Vanellus spinosus",
+"Yelkouan Shearwater"=>"Puffinus yelkouan",
+"Trumpeter Finch"=>"Bucanetes githagineus",
+"Red Grouse"=>"Lagopus scoticus",
+"Rock Ptarmigan"=>"Lagopus mutus",
+"Long-Tailed Cormorant"=>"Phalacrocorax africanus",
+"Double-crested Cormorant"=>"Phalacrocorax auritus",
+"Magnificent Frigatebird"=>"Fregata magnificens",
+"Naumann's Thrush"=>"Turdus naumanni",
+"Oriental Pratincole"=>"Glareola maldivarum",
+"Bufflehead"=>"Bucephala albeola",
+"Snowfinch"=>"Montifrigilla nivalis",
+"Ural owl"=>"Strix uralensis",
+"Spanish Wagtail"=>"Motacilla iberiae",
+"Song Sparrow"=>"Melospiza melodia",
+"Rock Bunting"=>"Emberiza cia",
+"Siberian Rubythroat"=>"Luscinia calliope",
+"Pallid Swift"=>"Apus pallidus",
+"Eurasian Pygmy Owl"=>"Glaucidium passerinum",
+"Madeira Little Shearwater"=>"Puffinus baroli",
+"House Finch"=>"Carpodacus mexicanus",
+"Green Heron"=>"Butorides virescens",
+"Solitary Sandpiper"=>"Tringa solitaria",
+"Heuglin's Gull"=>"Larus heuglini"
+);
+
+function array_to_json( $array ){
+
+    if( !is_array( $array ) ){
+        return false;
+    }
+
+    $associative = count( array_diff( array_keys($array), array_keys( array_keys( $array )) ));
+    if( $associative ){
+
+        $construct = array();
+        foreach( $array as $key => $value ){
+
+            // We first copy each key/value pair into a staging array,
+            // formatting each key and value properly as we go.
+
+            // Format the key:
+            if( is_numeric($key) ){
+                $key = "key_$key";
+            }
+            $key = "\"".addslashes($key)."\"";
+
+            // Format the value:
+            if( is_array( $value )){
+                $value = array_to_json( $value );
+            } else if( !is_numeric( $value ) || is_string( $value ) ){
+                $value = "\"".addslashes($value)."\"";
+            }
+
+            // Add to staging array:
+            $construct[] = "$key: $value";
+        }
+
+        // Then we collapse the staging array into the JSON form:
+        $result = "{ " . implode( ", ", $construct ) . " }";
+
+    } else { // If the array is a vector (not associative):
+
+        $construct = array();
+        foreach( $array as $value ){
+
+            // Format the value:
+            if( is_array( $value )){
+                $value = array_to_json( $value );
+            } else if( !is_numeric( $value ) || is_string( $value ) ){
+                $value = "'".addslashes($value)."'";
+            }
+
+            // Add to staging array:
+            $construct[] = $value;
+        }
+
+        // Then we collapse the staging array into the JSON form:
+        $result = "[ " . implode( ", ", $construct ) . " ]";
+    }
+
+    return $result;
+}
+
+$result = array();
+foreach ($items as $key=>$value) {
+	if (strpos(strtolower($key), $q) !== false) {
+		array_push($result, array("id"=>$value, "label"=>$key, "value" => strip_tags($key)));
+	}
+	if (count($result) > 11)
+		break;
+}
+echo array_to_json($result);
+
+?>
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/autocomplete/xml.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,72 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Autocomplete - XML data parsed once</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.autocomplete.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+	</style>
+	<script>
+	$(function() {
+		function log( message ) {
+			$( "<div/>" ).text( message ).prependTo( "#log" );
+			$( "#log" ).attr( "scrollTop", 0 );
+		}
+
+		$.ajax({
+			url: "london.xml",
+			dataType: "xml",
+			success: function( xmlResponse ) {
+				var data = $( "geoname", xmlResponse ).map(function() {
+					return {
+						value: $( "name", this ).text() + ", " +
+							( $.trim( $( "countryName", this ).text() ) || "(unknown country)" ),
+						id: $( "geonameId", this ).text()
+					};
+				}).get();
+				$( "#birds" ).autocomplete({
+					source: data,
+					minLength: 0,
+					select: function( event, ui ) {
+						log( ui.item ?
+							"Selected: " + ui.item.value + ", geonameId: " + ui.item.id :
+							"Nothing selected, input was " + this.value );
+					}
+				});
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+	<label for="birds">London matches: </label>
+	<input id="birds" />
+</div>
+
+<div class="ui-widget" style="margin-top:2em; font-family:Arial">
+	Result:
+	<div id="log" style="height: 200px; width: 300px; overflow: auto;" class="ui-widget-content"></div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>This demo shows how to retrieve some XML data, parse it using jQuery's methods, then provide it to the autocomplete as the datasource.</p>
+<p>This should also serve as a reference on how to parse a remote XML datasource - the parsing would just happen for each request within the source-callback.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/button/checkbox.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,44 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Button - Checkboxes</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#check" ).button();
+		$( "#format" ).buttonset();
+	});
+	</script>
+	<style>
+	#format { margin-top: 2em; }
+	</style>
+</head>
+<body>
+
+<div class="demo">
+
+<input type="checkbox" id="check" /><label for="check">Toggle</label>
+
+<div id="format">
+	<input type="checkbox" id="check1" /><label for="check1">B</label>
+	<input type="checkbox" id="check2" /><label for="check2">I</label>
+	<input type="checkbox" id="check3" /><label for="check3">U</label>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>A checkbox is styled as a toggle button with the button widget. The label element associated with the checkbox is used for the button text.</p>
+<p>This demo also demonstrates three checkboxes styled as a button set by calling <code>.buttonset()</code> on a common container.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/button/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,38 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Button - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "button, input:submit, a", ".demo" ).button();
+		$( "a", ".demo" ).click(function() { return false; });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<button>A button element</button>
+
+<input type="submit" value="A submit button"/>
+
+<a href="#">An anchor</a>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Examples of the markup that can be used for buttons: A button element, an input of type submit and an anchor.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/button/icons.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Button - Icons</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( ".demo button:first" ).button({
+            icons: {
+                primary: "ui-icon-locked"
+            },
+            text: false
+        }).next().button({
+            icons: {
+                primary: "ui-icon-locked"
+            }
+        }).next().button({
+            icons: {
+                primary: "ui-icon-gear",
+                secondary: "ui-icon-triangle-1-s"
+            }
+        }).next().button({
+            icons: {
+                primary: "ui-icon-gear",
+                secondary: "ui-icon-triangle-1-s"
+            },
+            text: false
+        });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<button>Button with icon only</button>
+<button>Button with icon on the left</button>
+<button>Button with two icons</button>
+<button>Button with two icons and no text</button>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Some buttons with various combinations of text and icons, here specified via metadata.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/button/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,23 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Button Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="radio.html">Radios</a></li>
+		<li><a href="checkbox.html">Checkboxes</a></li>
+		<li><a href="icons.html">Icons</a></li>
+		<li><a href="toolbar.html">Toolbar</a></li>
+		<li><a href="splitbutton.html">Split Button</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/button/radio.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,39 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Button - Radios</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#radio" ).buttonset();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<form>
+	<div id="radio">
+		<input type="radio" id="radio1" name="radio" /><label for="radio1">Choice 1</label>
+		<input type="radio" id="radio2" name="radio" checked="checked" /><label for="radio2">Choice 2</label>
+		<input type="radio" id="radio3" name="radio" /><label for="radio3">Choice 3</label>
+	</div>
+</form>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>A set of three radio buttons transformed into a button set.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/button/splitbutton.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,55 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Button - Split button</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#rerun" )
+			.button()
+			.click(function() {
+				alert( "Running the last action" );
+			})
+			.next()
+				.button( {
+					text: false,
+					icons: {
+						primary: "ui-icon-triangle-1-s"
+					}
+				})
+				.click(function() {
+					alert( "Could display a menu to select an action" );
+				})
+				.parent()
+					.buttonset();
+	});
+	</script>
+	<style>
+		
+	</style>
+</head>
+<body>
+
+<div class="demo">
+
+<div>
+	<button id="rerun">Run last action</button>
+	<button id="select">Select an action</button>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>An example of a split button built with two buttons: A plan button with just text, one with only a primary icon and no text. Both are grouped together in a set.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/button/toolbar.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,120 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Button - Toolbar</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#toolbar {
+		padding: 10px 4px;
+	}
+	</style>
+	<script>
+	$(function() {
+		$( "#beginning" ).button({
+			text: false,
+			icons: {
+				primary: "ui-icon-seek-start"
+			}
+		});
+		$( "#rewind" ).button({
+			text: false,
+			icons: {
+				primary: "ui-icon-seek-prev"
+			}
+		});
+		$( "#play" ).button({
+			text: false,
+			icons: {
+				primary: "ui-icon-play"
+			}
+		})
+		.click(function() {
+			var options;
+			if ( $( this ).text() === "play" ) {
+				options = {
+					label: "pause",
+					icons: {
+						primary: "ui-icon-pause"
+					}
+				};
+			} else {
+				options = {
+					label: "play",
+					icons: {
+						primary: "ui-icon-play"
+					}
+				};
+			}
+			$( this ).button( "option", options );
+		});
+		$( "#stop" ).button({
+			text: false,
+			icons: {
+				primary: "ui-icon-stop"
+			}
+		})
+		.click(function() {
+			$( "#play" ).button( "option", {
+				label: "play",
+				icons: {
+					primary: "ui-icon-play"
+				}
+			});
+		});
+		$( "#forward" ).button({
+			text: false,
+			icons: {
+				primary: "ui-icon-seek-next"
+			}
+		});
+		$( "#end" ).button({
+			text: false,
+			icons: {
+				primary: "ui-icon-seek-end"
+			}
+		});
+		$( "#shuffle" ).button();
+		$( "#repeat" ).buttonset();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<span id="toolbar" class="ui-widget-header ui-corner-all">
+	<button id="beginning">go to beginning</button>
+	<button id="rewind">rewind</button>
+	<button id="play">play</button>
+	<button id="stop">stop</button>
+	<button id="forward">fast forward</button>
+	<button id="end">go to end</button>
+	
+	<input type="checkbox" id="shuffle" /><label for="shuffle">Shuffle</label>
+	
+	<span id="repeat">
+		<input type="radio" id="repeat0" name="repeat" checked="checked" /><label for="repeat0">No Repeat</label>
+		<input type="radio" id="repeat1" name="repeat" /><label for="repeat1">Once</label>
+		<input type="radio" id="repeatall" name="repeat" /><label for="repeatall">All</label>
+	</span>
+</span>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	A mediaplayer toolbar. Take a look at the underlying markup: A few button elements,
+	an input of type checkbox for the Shuffle button, and three inputs of type radio for the Repeat options. 
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/demos.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,334 @@
+body {
+	font-size: 62.5%;
+}
+
+table {
+	font-size: 1em;
+}
+
+/* Site
+   -------------------------------- */
+
+body {
+	font-family: "Trebuchet MS", "Helvetica", "Arial",  "Verdana", "sans-serif";
+}
+
+/* Layout
+   -------------------------------- */
+
+.layout-grid {
+	width: 960px;
+}
+
+.layout-grid td {
+	vertical-align: top;
+}
+
+.layout-grid td.left-nav {
+	width: 140px;
+}
+
+.layout-grid td.normal {
+	border-left: 1px solid #eee;
+	padding: 20px 24px;
+	font-family: "Trebuchet MS", "Helvetica", "Arial",  "Verdana", "sans-serif";
+}
+
+.layout-grid td.demos {
+	background: url('/images/demos_bg.jpg') no-repeat;
+	height: 337px;
+	overflow: hidden;
+}
+
+/* Normal
+   -------------------------------- */
+
+.normal h3,
+.normal h4 {
+	margin: 0;
+	font-weight: normal;
+}
+
+.normal h3 {
+	padding: 0 0 9px;
+	font-size: 1.8em;
+}
+
+.normal h4 {
+	padding-bottom: 21px;
+	border-bottom: 1px dashed #999;
+	font-size: 1.2em;
+	font-weight: bold;
+}
+
+.normal p {
+	font-size: 1.2em;
+}
+
+/* Demos */
+
+.demos-nav, .demos-nav dt, .demos-nav dd, .demos-nav ul, .demos-nav li {
+	margin: 0;
+	padding: 0
+}
+
+.demos-nav {
+	float: left;
+	width: 170px;
+	font-size: 1.3em;
+}
+
+.demos-nav dt,
+.demos-nav h4 {
+	margin: 0;
+	padding: 0;
+	font: normal 1.1em "Trebuchet MS", "Helvetica", "Arial",  "Verdana", "sans-serif";
+	color: #e87b10;
+}
+
+.demos-nav dt,
+.demos-nav h4 {
+	margin-top: 1.5em;
+	margin-bottom: 0;
+	padding-left: 8px;
+	padding-bottom:5px;
+	line-height: 1.2em;
+	border-bottom: 1px solid #F4F4F4;
+}
+
+.demos-nav dd a,
+.demos-nav li a {
+	border-bottom: 1px solid #F4F4F4;
+	display:block;
+	padding: 4px 3px 4px 8px;
+	font-size: 90%;
+	text-decoration: none;
+	color: #555 ;
+	margin:2px 0;
+	height:13px;
+}
+
+.demos-nav dd a:hover,
+.demos-nav dd a:focus,
+.demos-nav dd a:hover,
+.demos-nav dd a:focus {
+	background: #f3f3f3;
+	color:#000;
+	-moz-border-radius: 5px; -webkit-border-radius: 5px;
+}
+ .demos-nav dd a.selected {
+	background: #555;
+	color:#ffffff;
+	-moz-border-radius: 5px; -webkit-border-radius: 5px;
+}
+
+
+/* new styles for demo pages, added by Filament 12.29.08
+eventually we should convert the font sizes to ems -- using px for now to minimize style conflicts
+*/
+
+.normal h3.demo-header { font-size:32px; padding:0 0 5px; border-bottom:1px solid #eee; text-transform: capitalize; }
+.normal h4.demo-subheader { font-size:10px; text-transform: uppercase; color:#999; padding:8px 0 3px; border:0; margin:0; }
+.normal a:link,
+.normal a:visited { color:#1b75bb; text-decoration:none; }
+.normal a:hover,
+.normal a:active { color:#0b559b; }
+
+#demo-config { padding:20px 0 0; }
+
+#demo-frame { float:left; width:540px; height:380px; border:1px solid #ddd; overflow: auto; position: relative; }
+#demo-frame h3, #demo-frame h4 { padding: 0; font-weight: bold; font-size: 1em; }
+
+#demo-config-menu { float:right; width:180px;  }
+#demo-config-menu h4 { font-size:13px; color:#666; font-weight:normal; border:0; padding-left:18px; }
+
+#demo-config-menu ul { list-style: none; padding: 0; margin: 0; }
+
+#demo-config-menu li { font-size:12px; padding:0 0 0 10px; margin:3px 0; zoom: 1; }
+
+#demo-config-menu li a:link,
+#demo-config-menu li a:visited { display:block; padding:1px 8px 4px; border-bottom:1px dotted #b3b3b3; }
+* html #demo-config-menu li a:link,
+* html #demo-config-menu li a:visited { padding:1px 8px 2px; }
+#demo-config-menu li a:hover,
+#demo-config-menu li a:active { background-color:#f6f6f6; }
+
+#demo-config-menu li.demo-config-on { background: url(images/demo-config-on-tile.gif) repeat-x left center; }
+
+#demo-config-menu li.demo-config-on a:link,
+#demo-config-menu li.demo-config-on a:visited,
+#demo-config-menu li.demo-config-on a:hover,
+#demo-config-menu li.demo-config-on a:active { background: url(images/demo-config-on.gif) no-repeat left; padding-left:18px; color:#fff; border:0; margin-left:-10px; margin-top: 0px; margin-bottom: 0px; }
+
+#demo-source, #demo-notes {
+	clear: both;
+	padding: 20px 0 0;
+	font-size: 1.3em;
+}
+
+#demo-notes { width:520px; color:#333; font-size: 1em; }
+#demo-notes p code, .demo-description p code { padding: 0; font-weight: bold; }
+#demo-source pre, #demo-source code { padding: 0; }
+code, pre { padding:8px 0 8px 20px ; font-size: 1.2em; line-height:130%;  }
+
+#demo-source a:link,
+#demo-source a:visited,
+#demo-source a:hover,
+#demo-source a:active { font-size:12px; padding-left:13px; background-position: left center; background-repeat: no-repeat; }
+
+#demo-source a.source-open:link,
+#demo-source a.source-open:visited,
+#demo-source a.source-open:hover,
+#demo-source a.source-open:active { background-image: url(images/demo-spindown-open.gif); }
+
+#demo-source a.source-closed:link,
+#demo-source a.source-closed:visited,
+#demo-source a.source-closed:hover,
+#demo-source a.source-closed:active { background-image: url(images/demo-spindown-closed.gif); }
+
+div.demo {
+	padding:12px;
+	font-family: "Trebuchet MS", "Arial", "Helvetica", "Verdana", "sans-serif";
+}
+
+div.demo h3.docs { clear:left; font-size:12px; font-weight:normal; padding:0 0 1em; margin:0; }
+
+div.demo-description {
+	clear:both;
+	padding:12px;
+	font-family: "Trebuchet MS", "Arial", "Helvetica", "Verdana", "sans-serif";
+	font-size: 1.3em;
+	line-height: 1.4em;
+}
+
+.ui-draggable, .ui-droppable {
+	background-position: top left;
+}
+
+.left-nav .demos-nav {
+	padding-right: 10px;
+}
+
+#demo-link { font-size:11px;  padding-top: 6px; clear: both; overflow: hidden; }
+#demo-link a span.ui-icon { float:left; margin-right:3px; }
+
+/* Component containers
+----------------------------------*/
+#widget-docs .ui-widget { font-family: Trebuchet MS,Verdana,Arial,sans-serif; font-size: 1em; }
+#widget-docs .ui-widget input, #widget-docs .ui-widget select, #widget-docs .ui-widget textarea, #widget-docs .ui-widget button { font-family: Trebuchet MS,Verdana,Arial,sans-serif; font-size: 1em; }
+#widget-docs .ui-widget-header { border: 1px solid #ffffff; background: #464646 url(images/464646_40x100_textures_01_flat_100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+#widget-docs .ui-widget-header a { color: #ffffff; }
+#widget-docs .ui-widget-content { border: 1px solid #ffffff; background: #ffffff url(images/ffffff_40x100_textures_01_flat_75.png) 50% 50% repeat-x; color: #222222; }
+#widget-docs .ui-widget-content a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+#widget-docs .ui-state-default, #widget-docs .ui-widget-content #widget-docs .ui-state-default { border: 1px solid #666666; background: #555555 url(images/555555_40x100_textures_03_highlight_soft_75.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; }
+#widget-docs .ui-state-default a { color: #ffffff; text-decoration: none; outline: none; }
+#widget-docs .ui-state-hover, #widget-docs .ui-widget-content #widget-docs .ui-state-hover, #widget-docs .ui-state-focus, #widget-docs .ui-widget-content #widget-docs .ui-state-focus { border: 1px solid #666666; background: #444444 url(images/444444_40x100_textures_03_highlight_soft_60.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; }
+#widget-docs .ui-state-hover a { color: #ffffff; text-decoration: none; outline: none; }
+#widget-docs .ui-state-active, #widget-docs .ui-widget-content #widget-docs .ui-state-active { border: 1px solid #666666; background: #ffffff url(images/ffffff_40x100_textures_01_flat_65.png) 50% 50% repeat-x; font-weight: normal; color: #F6921E; outline: none; }
+#widget-docs .ui-state-active a { color: #F6921E; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+#widget-docs .ui-state-highlight, #widget-docs .ui-widget-content #widget-docs .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/fbf9ee_40x100_textures_02_glass_55.png) 50% 50% repeat-x; color: #363636; }
+#widget-docs .ui-state-error, #widget-docs .ui-widget-content #widget-docs .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/fef1ec_40x100_textures_05_inset_soft_95.png) 50% bottom repeat-x; color: #cd0a0a; }
+#widget-docs .ui-state-error-text, #widget-docs .ui-widget-content #widget-docs .ui-state-error-text { color: #cd0a0a; }
+#widget-docs .ui-state-disabled, #widget-docs .ui-widget-content #widget-docs .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+#widget-docs .ui-priority-primary, #widget-docs .ui-widget-content #widget-docs .ui-priority-primary { font-weight: bold; }
+#widget-docs .ui-priority-secondary, #widget-docs .ui-widget-content #widget-docs .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+#demo-frame-wrapper .ui-icon, #widget-docs .ui-icon { width: 16px; height: 16px; background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-widget-content .ui-icon {background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-widget-header .ui-icon {background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-state-default .ui-icon { background-image: url(images/888888_256x240_icons_icons.png); }
+#widget-docs .ui-state-hover .ui-icon, #widget-docs .ui-state-focus .ui-icon {background-image: url(images/454545_256x240_icons_icons.png); }
+#widget-docs .ui-state-active .ui-icon {background-image: url(images/454545_256x240_icons_icons.png); }
+#widget-docs .ui-state-highlight .ui-icon {background-image: url(images/2e83ff_256x240_icons_icons.png); }
+#widget-docs .ui-state-error .ui-icon, #widget-docs .ui-state-error-text .ui-icon {background-image: url(images/cd0a0a_256x240_icons_icons.png); }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+#widget-docs .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; }
+#widget-docs .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+#widget-docs .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+#widget-docs .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+#widget-docs .ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-right {  -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+#widget-docs .ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; }
+
+/* Overlays */
+#widget-docs .ui-widget-overlay { background: #aaaaaa url(images/aaaaaa_40x100_textures_01_flat_0.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+#widget-docs .ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/aaaaaa_40x100_textures_01_flat_0.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }
+
+/*
+----------------------------------*/
+
+#widget-docs { margin:20px 0 0; border: none; }
+
+#widget-docs h2, #widget-docs h3, #widget-docs h4, #widget-docs p, #widget-docs ul, #widget-docs code { margin:0; padding:0; }
+#widget-docs code { display:block; color:#444; font-size:.9em; margin:0 0 1em; }
+#widget-docs code strong { color:#000; }
+#widget-docs p { margin:0 3em 1.2em 0; }
+#widget-docs p.intro { font-size:13px; color:#666; line-height:1.3; }
+#widget-docs ul { list-style-type: none; }
+
+#widget-docs h2 { font-size:16px; margin:1.2em 0 .5em; }
+#widget-docs h3 { font-size:14px; color:#e6820E; margin:1.5em 0 .5em; }
+.normal #widget-docs h4 { font-size:12px; color:#000; border:0; margin:0 0 .5em; }
+
+#docs-overview-main { width:400px; }
+#docs-overview-sidebar { float:right; width:200px; }
+#docs-overview-sidebar a span { color:#666; }
+#widget-docs #docs-overview-main p { margin-right:0; }
+#widget-docs #docs-overview-sidebar h4 { padding-left:0; }
+
+.docs-list-header { float:left; width:100%; margin:10px 0 0; border-bottom:1px solid #eee; }
+#widget-docs .docs-list-header h2 { float:left; margin:0; }
+#widget-docs .docs-list-header p { float:right; margin:5px 0; font-size:11px; }
+
+.docs-list { float:left; width:100%; padding:0 0 10px; }
+.docs-list .param-header { float:left; clear:left; width:100%; padding:8px 0; border-top:1px solid #eee; }
+#widget-docs .param-header h3, #widget-docs .param-header p { margin:0; float:left; }
+#widget-docs .param-header h3 { width:50%; }
+#widget-docs .param-header h3 span { background: url(images/demo-spindown-closed.gif) no-repeat left; padding-left:13px; }
+#widget-docs .param-open .param-header h3 span { background: url(images/demo-spindown-open.gif) no-repeat left; }
+#widget-docs .param-header p { width:24%; }
+#widget-docs .param-header p.param-type span { background: url(images/icon-docs-info.gif) no-repeat left; cursor:pointer; border-bottom:1px dashed #ccc; padding-left:15px; }
+
+.param-details { padding-left:13px; }
+.param-args { margin:0 0 1.5em; border-top:1px dotted #ccc;}
+.param-args td { padding:3px 30px 3px 5px; border-bottom:1px dotted #ccc;  }
+
+
+/* overrides for ui-tab styles */
+#widget-docs ul.ui-tabs-nav { padding:0 0 0 8px; }
+#widget-docs .ui-tabs-nav li { margin:5px 5px 0 0; }
+
+#widget-docs .ui-tabs-nav li a:link,
+#widget-docs .ui-tabs-nav li a:visited,
+#widget-docs .ui-tabs-nav li a:hover,
+#widget-docs .ui-tabs-nav li a:active { font-size:14px; padding:4px 1.2em 3px; color:#fff; }
+
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:link,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:visited,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:hover,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:active { color:#e6820E; }
+
+#widget-docs .ui-tabs-panel { padding:20px 9px; font-size:12px; line-height:1.4; color:#000; }
+
+#widget-docs .ui-widget-content a:link,
+#widget-docs .ui-widget-content a:visited { color:#1b75bb; text-decoration:none; }
+#widget-docs .ui-widget-content a:hover,
+#widget-docs .ui-widget-content a:active { color:#0b559b; }
+
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/dialog/animated.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Dialog - Animation</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../external/jquery.bgiframe-2.1.2.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<script src="../../ui/jquery.ui.dialog.js"></script>
+	<script src="../../ui/jquery.effects.core.js"></script>
+	<script src="../../ui/jquery.effects.blind.js"></script>
+	<script src="../../ui/jquery.effects.explode.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	// increase the default animation speed to exaggerate the effect
+	$.fx.speeds._default = 1000;
+	$(function() {
+		$( "#dialog" ).dialog({
+			autoOpen: false,
+			show: "blind",
+			hide: "explode"
+		});
+
+		$( "#opener" ).click(function() {
+			$( "#dialog" ).dialog( "open" );
+			return false;
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog" title="Basic dialog">
+	<p>This is an animated dialog which is useful for displaying information. The dialog window can be moved, resized and closed with the 'x' icon.</p>
+</div>
+
+<button id="opener">Open Dialog</button>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Dialogs may be animated by specifying an effect for the show and/or hide properties.  You must include the individual effects file for any effects you would like to use.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/dialog/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,54 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Dialog - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../external/jquery.bgiframe-2.1.2.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<script src="../../ui/jquery.ui.dialog.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		$( "#dialog" ).dialog();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog" title="Basic dialog">
+	<p>This is the default dialog which is useful for displaying information. The dialog window can be moved, resized and closed with the 'x' icon.</p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+<p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+<form>
+	<input value="text input" /><br />
+	<input type="checkbox" />checkbox<br />
+	<input type="radio" />radio<br />
+	<select>
+		<option>select</option>
+	</select><br /><br />
+	<textarea>textarea</textarea><br />
+</form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>The basic dialog window is an overlay positioned within the viewport and is protected from page content (like select elements) shining through with an iframe.  It has a title bar and a content area, and can be moved, resized and closed with the 'x' icon by default.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/dialog/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,23 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Dialog Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="animated.html">Animated dialog</a></li>
+		<li><a href="modal.html">Modal dialog</a></li>
+		<li><a href="modal-message.html">Modal message</a></li>
+		<li><a href="modal-confirmation.html">Modal confirmation</a></li>
+		<li><a href="modal-form.html">Modal form</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/dialog/modal-confirmation.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Dialog - Modal confirmation</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../external/jquery.bgiframe-2.1.2.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.dialog.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		// a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+		$( "#dialog:ui-dialog" ).dialog( "destroy" );
+	
+		$( "#dialog-confirm" ).dialog({
+			resizable: false,
+			height:140,
+			modal: true,
+			buttons: {
+				"Delete all items": function() {
+					$( this ).dialog( "close" );
+				},
+				Cancel: function() {
+					$( this ).dialog( "close" );
+				}
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog-confirm" title="Empty the recycle bin?">
+	<p><span class="ui-icon ui-icon-alert" style="float:left; margin:0 7px 20px 0;"></span>These items will be permanently deleted and cannot be recovered. Are you sure?</p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+	<p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+	<form>
+		<input value="text input" /><br />
+		<input type="checkbox" />checkbox<br />
+		<input type="radio" />radio<br />
+		<select>
+			<option>select</option>
+		</select><br /><br />
+		<textarea>textarea</textarea><br />
+	</form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Confirm an action that may be destructive or important.  Set the <code>modal</code> option to true, and specify primary and secondary user actions with the <code>buttons</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/dialog/modal-form.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,167 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Dialog - Modal form</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../external/jquery.bgiframe-2.1.2.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<script src="../../ui/jquery.ui.dialog.js"></script>
+	<script src="../../ui/jquery.effects.core.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+		body { font-size: 62.5%; }
+		label, input { display:block; }
+		input.text { margin-bottom:12px; width:95%; padding: .4em; }
+		fieldset { padding:0; border:0; margin-top:25px; }
+		h1 { font-size: 1.2em; margin: .6em 0; }
+		div#users-contain { width: 350px; margin: 20px 0; }
+		div#users-contain table { margin: 1em 0; border-collapse: collapse; width: 100%; }
+		div#users-contain table td, div#users-contain table th { border: 1px solid #eee; padding: .6em 10px; text-align: left; }
+		.ui-dialog .ui-state-error { padding: .3em; }
+		.validateTips { border: 1px solid transparent; padding: 0.3em; }
+	</style>
+	<script>
+	$(function() {
+		// a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+		$( "#dialog:ui-dialog" ).dialog( "destroy" );
+		
+		var name = $( "#name" ),
+			email = $( "#email" ),
+			password = $( "#password" ),
+			allFields = $( [] ).add( name ).add( email ).add( password ),
+			tips = $( ".validateTips" );
+
+		function updateTips( t ) {
+			tips
+				.text( t )
+				.addClass( "ui-state-highlight" );
+			setTimeout(function() {
+				tips.removeClass( "ui-state-highlight", 1500 );
+			}, 500 );
+		}
+
+		function checkLength( o, n, min, max ) {
+			if ( o.val().length > max || o.val().length < min ) {
+				o.addClass( "ui-state-error" );
+				updateTips( "Length of " + n + " must be between " +
+					min + " and " + max + "." );
+				return false;
+			} else {
+				return true;
+			}
+		}
+
+		function checkRegexp( o, regexp, n ) {
+			if ( !( regexp.test( o.val() ) ) ) {
+				o.addClass( "ui-state-error" );
+				updateTips( n );
+				return false;
+			} else {
+				return true;
+			}
+		}
+		
+		$( "#dialog-form" ).dialog({
+			autoOpen: false,
+			height: 300,
+			width: 350,
+			modal: true,
+			buttons: {
+				"Create an account": function() {
+					var bValid = true;
+					allFields.removeClass( "ui-state-error" );
+
+					bValid = bValid && checkLength( name, "username", 3, 16 );
+					bValid = bValid && checkLength( email, "email", 6, 80 );
+					bValid = bValid && checkLength( password, "password", 5, 16 );
+
+					bValid = bValid && checkRegexp( name, /^[a-z]([0-9a-z_])+$/i, "Username may consist of a-z, 0-9, underscores, begin with a letter." );
+					// From jquery.validate.js (by joern), contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/
+					bValid = bValid && checkRegexp( email, /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i, "eg. ui@jquery.com" );
+					bValid = bValid && checkRegexp( password, /^([0-9a-zA-Z])+$/, "Password field only allow : a-z 0-9" );
+
+					if ( bValid ) {
+						$( "#users tbody" ).append( "<tr>" +
+							"<td>" + name.val() + "</td>" + 
+							"<td>" + email.val() + "</td>" + 
+							"<td>" + password.val() + "</td>" +
+						"</tr>" ); 
+						$( this ).dialog( "close" );
+					}
+				},
+				Cancel: function() {
+					$( this ).dialog( "close" );
+				}
+			},
+			close: function() {
+				allFields.val( "" ).removeClass( "ui-state-error" );
+			}
+		});
+
+		$( "#create-user" )
+			.button()
+			.click(function() {
+				$( "#dialog-form" ).dialog( "open" );
+			});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog-form" title="Create new user">
+	<p class="validateTips">All form fields are required.</p>
+
+	<form>
+	<fieldset>
+		<label for="name">Name</label>
+		<input type="text" name="name" id="name" class="text ui-widget-content ui-corner-all" />
+		<label for="email">Email</label>
+		<input type="text" name="email" id="email" value="" class="text ui-widget-content ui-corner-all" />
+		<label for="password">Password</label>
+		<input type="password" name="password" id="password" value="" class="text ui-widget-content ui-corner-all" />
+	</fieldset>
+	</form>
+</div>
+
+
+<div id="users-contain" class="ui-widget">
+	<h1>Existing Users:</h1>
+	<table id="users" class="ui-widget ui-widget-content">
+		<thead>
+			<tr class="ui-widget-header ">
+				<th>Name</th>
+				<th>Email</th>
+				<th>Password</th>
+			</tr>
+		</thead>
+		<tbody>
+			<tr>
+				<td>John Doe</td>
+				<td>john.doe@example.com</td>
+				<td>johndoe1</td>
+			</tr>
+		</tbody>
+	</table>
+</div>
+<button id="create-user">Create new user</button>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Use a modal dialog to require that the user enter data during a multi-step process.  Embed form markup in the content area, set the <code>modal</code> option to true, and specify primary and secondary user actions with the <code>buttons</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/dialog/modal-message.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,71 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Dialog - Modal message</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../external/jquery.bgiframe-2.1.2.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.button.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<script src="../../ui/jquery.ui.dialog.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		// a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+		$( "#dialog:ui-dialog" ).dialog( "destroy" );
+	
+		$( "#dialog-message" ).dialog({
+			modal: true,
+			buttons: {
+				Ok: function() {
+					$( this ).dialog( "close" );
+				}
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog-message" title="Download complete">
+	<p>
+		<span class="ui-icon ui-icon-circle-check" style="float:left; margin:0 7px 50px 0;"></span>
+		Your files have downloaded successfully into the My Downloads folder.
+	</p>
+	<p>
+		Currently using <b>36% of your storage space</b>.
+	</p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+	<p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+	<form>
+		<input value="text input" /><br />
+		<input type="checkbox" />checkbox<br />
+		<input type="radio" />radio<br />
+		<select>
+			<option>select</option>
+		</select><br /><br />
+		<textarea>textarea</textarea><br />
+	</form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Use a modal dialog to explicitly acknowledge information or an action before continuing their work.  Set the <code>modal</code> option to true, and specify a primary action (Ok) with the <code>buttons</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/dialog/modal.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,60 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Dialog - Basic modal</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../external/jquery.bgiframe-2.1.2.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<script src="../../ui/jquery.ui.dialog.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<script>
+	$(function() {
+		// a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+		$( "#dialog:ui-dialog" ).dialog( "destroy" );
+	
+		$( "#dialog-modal" ).dialog({
+			height: 140,
+			modal: true
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog-modal" title="Basic modal dialog">
+	<p>Adding the modal overlay screen makes the dialog look more prominent because it dims out the page content.</p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+	<p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+	<form>
+		<input value="text input" /><br />
+		<input type="checkbox" />checkbox<br />
+		<input type="radio" />radio<br />
+		<select>
+			<option>select</option>
+		</select><br /><br />
+		<textarea>textarea</textarea><br />
+	</form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>A modal dialog prevents the user from interacting with the rest of the page until it is closed.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/constrain-movement.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Constrain movement</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.draggable { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+	#draggable, #draggable2 { margin-bottom:20px; }
+	#draggable { cursor: n-resize; }
+	#draggable2 { cursor: e-resize; }
+	#containment-wrapper { width: 95%; height:150px; border:2px solid #ccc; padding: 10px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ axis: "y" });
+		$( "#draggable2" ).draggable({ axis: "x" });
+
+		$( "#draggable3" ).draggable({ containment: "#containment-wrapper", scroll: false });
+		$( "#draggable4" ).draggable({ containment: "#demo-frame" });
+		$( "#draggable5" ).draggable({ containment: "parent" });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<h3 class="docs">Constrain movement along an axis:</h3>
+	
+<div id="draggable" class="draggable ui-widget-content">
+	<p>I can be dragged only vertically</p>
+</div>
+
+<div id="draggable2" class="draggable ui-widget-content">
+	<p>I can be dragged only horizontally</p>
+</div>
+
+<h3 class="docs">Or to within another DOM element:</h3>
+<div id="containment-wrapper">
+<div id="draggable3" class="draggable ui-widget-content">
+	<p>I'm contained within the box</p>
+</div>
+
+<div id="draggable4" class="draggable ui-widget-content">
+	<p>I'm contained within the box's parent</p>
+</div>
+
+<div class="draggable ui-widget-content">
+	<p id="draggable5" class="ui-widget-header">I'm contained within my parent</p>
+</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Constrain the movement of each draggable by defining the boundaries of the draggable area. Set the <code>axis</code> option to limit the draggable's path to the x- or y-axis, or use the <code>containment</code> option to specify a parent DOM element or a jQuery selector, like 'document.'</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/cursor-style.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,49 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Cursor style</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2, #draggable3 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ cursorAt: { cursor: "move", top: 56, left: 56 } });
+		$( "#draggable2" ).draggable({ cursorAt: { cursor: "crosshair", top: -5, left: -5 } });
+		$( "#draggable3" ).draggable({ cursorAt: { bottom: 0 } });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p>I will always stick to the center (relative to the mouse)</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>My cursor is at left -5 and top -5</p>
+</div>
+
+<div id="draggable3" class="ui-widget-content">
+	<p>My cursor position is only controlled for the 'bottom' value</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Position the cursor while dragging the object. By default the cursor appears in the center of the dragged object; use the <code>cursorAt</code> option to specify another location relative to the draggable (specify a pixel value from the top, right, bottom, and/or left).  Customize the cursor's appearance by supplying the <code>cursor</code> option with a valid CSS cursor value: default, move, pointer, crosshair, etc.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,39 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable { width: 150px; height: 150px; padding: 0.5em; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+	<p>Drag me around</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Enable draggable functionality on any DOM element. Move the draggable object by clicking on it with the mouse and dragging it anywhere within the viewport.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/delay-start.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,45 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Delay start</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2 { width: 120px; height: 120px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ distance: 20 });
+		$( "#draggable2" ).draggable({ delay: 1000 });
+		$( ".ui-draggable" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p>Only if you drag me by 20 pixels, the dragging will start</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>Regardless of the distance, you have to drag and wait for 1000ms before dragging starts</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Delay the start of dragging for a number of milliseconds with the <code>delay</code> option; prevent dragging until the cursor is held down and dragged a specifed number of pixels with the <code>distance</code> option. </p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/events.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,77 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Events</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable { width: 16em; padding: 0 1em; }
+	#draggable ul li { margin: 1em 0; padding: 0.5em 0; } * html #draggable ul li { height: 1%; }
+	#draggable ul li span.ui-icon { float: left; }
+	#draggable ul li span.count { font-weight: bold; }
+	</style>
+	<script>
+	$(function() {
+		var $start_counter = $( "#event-start" ),
+			$drag_counter = $( "#event-drag" ),
+			$stop_counter = $( "#event-stop" ),
+			counts = [ 0, 0, 0 ];
+
+		$( "#draggable" ).draggable({
+			start: function() {
+				counts[ 0 ]++;
+				updateCounterStatus( $start_counter, counts[ 0 ] );
+			},
+			drag: function() {
+				counts[ 1 ]++;
+				updateCounterStatus( $drag_counter, counts[ 1 ] );
+			},
+			stop: function() {
+				counts[ 2 ]++;
+				updateCounterStatus( $stop_counter, counts[ 2 ] );
+			}
+		});
+
+		function updateCounterStatus( $event_counter, new_count ) {
+			// first update the status visually...
+			if ( !$event_counter.hasClass( "ui-state-hover" ) ) {
+				$event_counter.addClass( "ui-state-hover" )
+					.siblings().removeClass( "ui-state-hover" );
+			}
+			// ...then update the numbers
+			$( "span.count", $event_counter ).text( new_count );
+		}
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="draggable" class="ui-widget ui-widget-content">
+
+	<p>Drag me to trigger the chain of events.</p>
+
+	<ul class="ui-helper-reset">
+		<li id="event-start" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-play"></span>"start" invoked <span class="count">0</span>x</li>
+		<li id="event-drag" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-arrow-4"></span>"drag" invoked <span class="count">0</span>x</li>
+		<li id="event-stop" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-stop"></span>"stop" invoked <span class="count">0</span>x</li>
+	</ul>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Layer functionality onto the draggable using the <code>start</code>, <code>drag</code>, and <code>stop</code> events.  Start is fired at the start of the drag; drag during the drag; and stop when dragging stops.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/handle.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,50 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Handles</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+	#draggable p { cursor: move; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ handle: "p" });
+		$( "#draggable2" ).draggable({ cancel: "p.ui-widget-header" });
+		$( "div, p" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p class="ui-widget-header">I can be dragged only by this handle</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>You can drag me around&hellip;</p>
+	<p class="ui-widget-header">&hellip;but you can't drag me by this handle.</p>
+</div>
+
+<!-- ADD CANCEL DEMO -->
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Allow dragging only when the cursor is over a specific part of the draggable.  Use the <code>handle</code> option to specify the jQuery selector of an element (or group of elements) used to drag the object.</p>
+<p>Or prevent dragging when the cursor is over a specific element (or group of elements) within the draggable.  Use the <code>cancel</code> option to specify a jQuery selector over which to "cancel" draggable functionality.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,28 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="events.html">Events</a></li>
+		<li><a href="constrain-movement.html">Constrain movement</a></li>
+		<li><a href="delay-start.html">Delay start</a></li>
+		<li><a href="snap-to.html">Snap to element or&#160;grid</a></li>
+		<li><a href="scroll.html">Auto-scroll</a></li>
+		<li><a href="revert.html">Revert position</a></li>
+		<li><a href="visual-feedback.html">Visual feedback</a></li>
+		<li><a href="handle.html">Drag handle</a></li>
+		<li><a href="cursor-style.html">Cursor style</a></li>
+		<li><a href="sortable.html">Draggable + Sortable</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/revert.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,44 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Revert position</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ revert: true });
+		$( "#draggable2" ).draggable({ revert: true, helper: "clone" });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p>Revert the original</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>Revert the helper</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Return the draggable (or it's helper) to its original location when dragging stops with the boolean <code>revert</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/scroll.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Auto-scroll</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2, #draggable3 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ scroll: true });
+		$( "#draggable2" ).draggable({ scroll: true, scrollSensitivity: 100 });
+		$( "#draggable3" ).draggable({ scroll: true, scrollSpeed: 100 });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p>Scroll set to true, default settings</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>scrollSensitivity set to 100</p>
+</div>
+
+<div id="draggable3" class="ui-widget-content">
+	<p>scrollSpeed set to 100</p>
+</div>
+
+<div style='height: 5000px; width: 1px;'></div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Automatically scroll the document when the draggable is moved beyond the viewport. Set the <code>scroll</code> option to true to enable auto-scrolling, and fine-tune when scrolling is triggered and its speed with the <code>scrollSensitivity</code> and <code>scrollSpeed</code> options.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/snap-to.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,68 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Snap to element or grid</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.draggable { width: 90px; height: 80px; padding: 5px; float: left; margin: 0 10px 10px 0; font-size: .9em; }
+	.ui-widget-header p, .ui-widget-content p { margin: 0; }
+	#snaptarget { height: 140px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ snap: true });
+		$( "#draggable2" ).draggable({ snap: ".ui-widget-header" });
+		$( "#draggable3" ).draggable({ snap: ".ui-widget-header", snapMode: "outer" });
+		$( "#draggable4" ).draggable({ grid: [ 20,20 ] });
+		$( "#draggable5" ).draggable({ grid: [ 80, 80 ] });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="snaptarget" class="ui-widget-header">
+	<p>I'm a snap target</p>
+</div>
+
+<br clear="both" />
+
+<div id="draggable" class="draggable ui-widget-content">
+	<p>Default (snap: true), snaps to all other draggable elements</p>
+</div>
+
+<div id="draggable2" class="draggable ui-widget-content">
+	<p>I only snap to the big box</p>
+</div>
+
+<div id="draggable3" class="draggable ui-widget-content">
+	<p>I only snap to the outer edges of the big box</p>
+</div>
+
+<div id="draggable4" class="draggable ui-widget-content">
+	<p>I snap to a 20 x 20 grid</p>
+</div>
+
+<div id="draggable5" class="draggable ui-widget-content">
+	<p>I snap to a 80 x 80 grid</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Snap the draggable to the inner or outer boundaries of a DOM element.  Use the <code>snap</code>, <code>snapMode</code> (inner, outer, both), and <code>snapTolerance</code> (distance in pixels the draggable must be from the element when snapping is invoked) options. </p>
+<p>Or snap the draggable to a grid.  Set the dimensions of grid cells (height and width in pixels) with the <code>grid</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/sortable.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,57 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable + Sortable</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.demo ul { list-style-type: none; margin: 0; padding: 0; margin-bottom: 10px; }
+	.demo li { margin: 5px; padding: 5px; width: 150px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable" ).sortable({
+			revert: true
+		});
+		$( "#draggable" ).draggable({
+			connectToSortable: "#sortable",
+			helper: "clone",
+			revert: "invalid"
+		});
+		$( "ul, li" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<ul>
+	<li id="draggable" class="ui-state-highlight">Drag me down</li>
+</ul>
+
+<ul id="sortable">
+	<li class="ui-state-default">Item 1</li>
+	<li class="ui-state-default">Item 2</li>
+	<li class="ui-state-default">Item 3</li>
+	<li class="ui-state-default">Item 4</li>
+	<li class="ui-state-default">Item 5</li>
+</ul>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Draggables are built to interact seamlessly with <a href="#">sortables</a>.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/draggable/visual-feedback.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,77 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Draggable - Visual feedback</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2, #draggable3, #set div { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+	#draggable, #draggable2, #draggable3 { margin-bottom:20px; }
+	#set { clear:both; float:left; width: 368px; height: 120px; }
+	p { clear:both; margin:0; padding:1em 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ helper: "original" });
+		$( "#draggable2" ).draggable({ opacity: 0.7, helper: "clone" });
+		$( "#draggable3" ).draggable({
+			cursor: "move",
+			cursorAt: { top: -12, left: -20 },
+			helper: function( event ) {
+				return $( "<div class='ui-widget-header'>I'm a custom helper</div>" );
+			}
+		});
+		$( "#set div" ).draggable({ stack: "#set div" });
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<h3 class="docs">With helpers:</h3>
+
+<div id="draggable" class="ui-widget-content">
+	<p>Original</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>Semi-transparent clone</p>
+</div>
+
+<div id="draggable3" class="ui-widget-content">
+	<p>Custom helper (in combination with cursorAt)</p>
+</div>
+
+<h3 class="docs">Stacked:</h3>
+<div id="set">
+	<div class="ui-widget-content">
+		<p>We are draggables..</p>
+	</div>
+
+	<div class="ui-widget-content">
+		<p>..whose z-indexes are controlled automatically..</p>
+	</div>
+
+	<div class="ui-widget-content">
+		<p>..with the stack option.</p>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Provide feedback to users as they drag an object in the form of a helper. The <code>helper</code> option accepts the values 'original' (the draggable object moves with the cursor), 'clone' (a duplicate of the draggable moves with the cursor), or a function that returns a DOM element (that element is shown near the cursor during drag). Control the helper's transparency with the <code>opacity</code> option.</p>
+<p>To clarify which draggable is in play, bring the draggable in motion to front. Use the <code>zIndex</code> option to set a higher z-index for the helper, if in play, or use the <code>stack</code> option to ensure that the last item dragged will appear on top of others in the same group on drag stop.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/accepted-elements.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,60 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable - Accept</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; }
+	#draggable, #draggable-nonvalid { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable, #draggable-nonvalid" ).draggable();
+		$( "#droppable" ).droppable({
+			accept: "#draggable",
+			activeClass: "ui-state-hover",
+			hoverClass: "ui-state-active",
+			drop: function( event, ui ) {
+				$( this )
+					.addClass( "ui-state-highlight" )
+					.find( "p" )
+						.html( "Dropped!" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable-nonvalid" class="ui-widget-content">
+	<p>I'm draggable but can't be dropped</p>
+</div>
+
+<div id="draggable" class="ui-widget-content">
+	<p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+	<p>accept: '#draggable'</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Specify using the <code>accept</code> option which element (or group of elements) is accepted by the target droppable.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,53 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+	#droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable();
+		$( "#droppable" ).droppable({
+			drop: function( event, ui ) {
+				$( this )
+					.addClass( "ui-state-highlight" )
+					.find( "p" )
+						.html( "Dropped!" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+	<p>Drop here</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Enable any DOM element to be droppable, a target for draggable elements.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras.jpg has changed
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras2.jpg has changed
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras2_min.jpg has changed
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras3.jpg has changed
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras3_min.jpg has changed
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras4.jpg has changed
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras4_min.jpg has changed
Binary file jquery-ui/development-bundle/demos/droppable/images/high_tatras_min.jpg has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,24 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="accepted-elements.html">Accepted elements</a></li>
+		<li><a href="propagation.html">Prevent propagation</a></li>
+		<li><a href="visual-feedback.html">Visual feedback</a></li>
+		<li><a href="revert.html">Revert draggable position</a></li>
+		<li><a href="shopping-cart.html">Shopping Cart</a></li>
+		<li><a href="photo-manager.html">Simple photo manager</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/photo-manager.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,184 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable - Simple photo manager</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<script src="../../ui/jquery.ui.dialog.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#gallery { float: left; width: 65%; min-height: 12em; } * html #gallery { height: 12em; } /* IE6 */
+	.gallery.custom-state-active { background: #eee; }
+	.gallery li { float: left; width: 96px; padding: 0.4em; margin: 0 0.4em 0.4em 0; text-align: center; }
+	.gallery li h5 { margin: 0 0 0.4em; cursor: move; }
+	.gallery li a { float: right; }
+	.gallery li a.ui-icon-zoomin { float: left; }
+	.gallery li img { width: 100%; cursor: move; }
+
+	#trash { float: right; width: 32%; min-height: 18em; padding: 1%;} * html #trash { height: 18em; } /* IE6 */
+	#trash h4 { line-height: 16px; margin: 0 0 0.4em; }
+	#trash h4 .ui-icon { float: left; }
+	#trash .gallery h5 { display: none; }
+	</style>
+	<script>
+	$(function() {
+		// there's the gallery and the trash
+		var $gallery = $( "#gallery" ),
+			$trash = $( "#trash" );
+
+		// let the gallery items be draggable
+		$( "li", $gallery ).draggable({
+			cancel: "a.ui-icon", // clicking an icon won't initiate dragging
+			revert: "invalid", // when not dropped, the item will revert back to its initial position
+			containment: $( "#demo-frame" ).length ? "#demo-frame" : "document", // stick to demo-frame if present
+			helper: "clone",
+			cursor: "move"
+		});
+
+		// let the trash be droppable, accepting the gallery items
+		$trash.droppable({
+			accept: "#gallery > li",
+			activeClass: "ui-state-highlight",
+			drop: function( event, ui ) {
+				deleteImage( ui.draggable );
+			}
+		});
+
+		// let the gallery be droppable as well, accepting items from the trash
+		$gallery.droppable({
+			accept: "#trash li",
+			activeClass: "custom-state-active",
+			drop: function( event, ui ) {
+				recycleImage( ui.draggable );
+			}
+		});
+
+		// image deletion function
+		var recycle_icon = "<a href='link/to/recycle/script/when/we/have/js/off' title='Recycle this image' class='ui-icon ui-icon-refresh'>Recycle image</a>";
+		function deleteImage( $item ) {
+			$item.fadeOut(function() {
+				var $list = $( "ul", $trash ).length ?
+					$( "ul", $trash ) :
+					$( "<ul class='gallery ui-helper-reset'/>" ).appendTo( $trash );
+
+				$item.find( "a.ui-icon-trash" ).remove();
+				$item.append( recycle_icon ).appendTo( $list ).fadeIn(function() {
+					$item
+						.animate({ width: "48px" })
+						.find( "img" )
+							.animate({ height: "36px" });
+				});
+			});
+		}
+
+		// image recycle function
+		var trash_icon = "<a href='link/to/trash/script/when/we/have/js/off' title='Delete this image' class='ui-icon ui-icon-trash'>Delete image</a>";
+		function recycleImage( $item ) {
+			$item.fadeOut(function() {
+				$item
+					.find( "a.ui-icon-refresh" )
+						.remove()
+					.end()
+					.css( "width", "96px")
+					.append( trash_icon )
+					.find( "img" )
+						.css( "height", "72px" )
+					.end()
+					.appendTo( $gallery )
+					.fadeIn();
+			});
+		}
+
+		// image preview function, demonstrating the ui.dialog used as a modal window
+		function viewLargerImage( $link ) {
+			var src = $link.attr( "href" ),
+				title = $link.siblings( "img" ).attr( "alt" ),
+				$modal = $( "img[src$='" + src + "']" );
+
+			if ( $modal.length ) {
+				$modal.dialog( "open" );
+			} else {
+				var img = $( "<img alt='" + title + "' width='384' height='288' style='display: none; padding: 8px;' />" )
+					.attr( "src", src ).appendTo( "body" );
+				setTimeout(function() {
+					img.dialog({
+						title: title,
+						width: 400,
+						modal: true
+					});
+				}, 1 );
+			}
+		}
+
+		// resolve the icons behavior with event delegation
+		$( "ul.gallery > li" ).click(function( event ) {
+			var $item = $( this ),
+				$target = $( event.target );
+
+			if ( $target.is( "a.ui-icon-trash" ) ) {
+				deleteImage( $item );
+			} else if ( $target.is( "a.ui-icon-zoomin" ) ) {
+				viewLargerImage( $target );
+			} else if ( $target.is( "a.ui-icon-refresh" ) ) {
+				recycleImage( $item );
+			}
+
+			return false;
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo ui-widget ui-helper-clearfix">
+
+<ul id="gallery" class="gallery ui-helper-reset ui-helper-clearfix">
+	<li class="ui-widget-content ui-corner-tr">
+		<h5 class="ui-widget-header">High Tatras</h5>
+		<img src="images/high_tatras_min.jpg" alt="The peaks of High Tatras" width="96" height="72" />
+		<a href="images/high_tatras.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+		<a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+	</li>
+	<li class="ui-widget-content ui-corner-tr">
+		<h5 class="ui-widget-header">High Tatras 2</h5>
+		<img src="images/high_tatras2_min.jpg" alt="The chalet at the Green mountain lake" width="96" height="72" />
+		<a href="images/high_tatras2.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+		<a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+	</li>
+	<li class="ui-widget-content ui-corner-tr">
+		<h5 class="ui-widget-header">High Tatras 3</h5>
+		<img src="images/high_tatras3_min.jpg" alt="Planning the ascent" width="96" height="72" />
+		<a href="images/high_tatras3.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+		<a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+	</li>
+	<li class="ui-widget-content ui-corner-tr">
+		<h5 class="ui-widget-header">High Tatras 4</h5>
+		<img src="images/high_tatras4_min.jpg" alt="On top of Kozi kopka" width="96" height="72" />
+		<a href="images/high_tatras4.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+		<a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+	</li>
+</ul>
+
+<div id="trash" class="ui-widget-content ui-state-default">
+	<h4 class="ui-widget-header"><span class="ui-icon ui-icon-trash">Trash</span> Trash</h4>
+</div>
+
+</div><!-- End demo -->
+
+
+<div class="demo-description">
+<p>You can delete an image either by dragging it to the Trash or by clicking the trash icon.</p>
+<p>You can "recycle" an image by dragging it back to the gallery or by clicking the recycle icon.</p>
+<p>You can view larger image by clicking the zoom icon. jQuery UI dialog widget is used for the modal window.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/propagation.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,80 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable - Prevent propagation</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable { width: 100px; height: 40px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+	#droppable, #droppable2 { width: 230px; height: 120px; padding: 0.5em; float: left; margin: 10px; }
+	#droppable-inner, #droppable2-inner { width: 170px; height: 60px; padding: 0.5em; float: left; margin: 10px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable();
+
+		$( "#droppable, #droppable-inner" ).droppable({
+			activeClass: "ui-state-hover",
+			hoverClass: "ui-state-active",
+			drop: function( event, ui ) {
+				$( this )
+					.addClass( "ui-state-highlight" )
+					.find( "> p" )
+						.html( "Dropped!" );
+				return false;
+			}
+		});
+
+		$( "#droppable2, #droppable2-inner" ).droppable({
+			greedy: true,
+			activeClass: "ui-state-hover",
+			hoverClass: "ui-state-active",
+			drop: function( event, ui ) {
+				$( this )
+					.addClass( "ui-state-highlight" )
+					.find( "> p" )
+						.html( "Dropped!" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+	<p>Outer droppable</p>
+	<div id="droppable-inner" class="ui-widget-header">
+		<p>Inner droppable (not greedy)</p>
+	</div>
+</div>
+
+<div id="droppable2" class="ui-widget-header">
+	<p>Outer droppable</p>
+	<div id="droppable2-inner" class="ui-widget-header">
+		<p>Inner droppable (greedy)</p>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>When working with nested droppables &#8212; for example, you may have an editable directory structure displayed as a tree, with folder and document nodes &#8212; the <code>greedy</code> option set to true prevents event propagation when a draggable is dropped on a child node (droppable).</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/revert.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,61 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable - Revert draggable position</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+	#droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable({ revert: "valid" });
+		$( "#draggable2" ).draggable({ revert: "invalid" });
+
+		$( "#droppable" ).droppable({
+			activeClass: "ui-state-hover",
+			hoverClass: "ui-state-active",
+			drop: function( event, ui ) {
+				$( this )
+					.addClass( "ui-state-highlight" )
+					.find( "p" )
+						.html( "Dropped!" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="draggable" class="ui-widget-content">
+	<p>I revert when I'm dropped</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>I revert when I'm not dropped</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+	<p>Drop me here</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Return the draggable (or it's helper) to its original location when dragging stops with the boolean <code>revert</code> option set on the draggable.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/shopping-cart.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,101 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable - Shopping Cart Demo</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<script src="../../ui/jquery.ui.accordion.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	h1 { padding: .2em; margin: 0; }
+	#products { float:left; width: 500px; margin-right: 2em; }
+	#cart { width: 200px; float: left; }
+	/* style the list to maximize the droppable hitarea */
+	#cart ol { margin: 0; padding: 1em 0 1em 3em; }
+	</style>
+	<script>
+	$(function() {
+		$( "#catalog" ).accordion();
+		$( "#catalog li" ).draggable({
+			appendTo: "body",
+			helper: "clone"
+		});
+		$( "#cart ol" ).droppable({
+			activeClass: "ui-state-default",
+			hoverClass: "ui-state-hover",
+			accept: ":not(.ui-sortable-helper)",
+			drop: function( event, ui ) {
+				$( this ).find( ".placeholder" ).remove();
+				$( "<li></li>" ).text( ui.draggable.text() ).appendTo( this );
+			}
+		}).sortable({
+			items: "li:not(.placeholder)",
+			sort: function() {
+				// gets added unintentionally by droppable interacting with sortable
+				// using connectWithSortable fixes this, but doesn't allow you to customize active/hoverClass options
+				$( this ).removeClass( "ui-state-default" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="products">
+	<h1 class="ui-widget-header">Products</h1>	
+	<div id="catalog">
+		<h3><a href="#">T-Shirts</a></h3>
+		<div>
+			<ul>
+				<li>Lolcat Shirt</li>
+				<li>Cheezeburger Shirt</li>
+				<li>Buckit Shirt</li>
+			</ul>
+		</div>
+		<h3><a href="#">Bags</a></h3>
+		<div>
+			<ul>
+				<li>Zebra Striped</li>
+				<li>Black Leather</li>
+				<li>Alligator Leather</li>
+			</ul>
+		</div>
+		<h3><a href="#">Gadgets</a></h3>
+		<div>
+			<ul>
+				<li>iPhone</li>
+				<li>iPod</li>
+				<li>iPad</li>
+			</ul>
+		</div>
+	</div>
+</div>
+
+<div id="cart">
+	<h1 class="ui-widget-header">Shopping Cart</h1>
+	<div class="ui-widget-content">
+		<ol>
+			<li class="placeholder">Add your items here</li>
+		</ol>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Demonstrate how to use an accordion to structure products into a catalog and make use drag and drop for adding them to a shopping cart, where they are sortable.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/droppable/visual-feedback.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,78 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Droppable - Visual feedback</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#draggable, #draggable2 { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+	#droppable, #droppable2 { width: 120px; height: 120px; padding: 0.5em; float: left; margin: 10px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#draggable" ).draggable();
+		$( "#droppable" ).droppable({
+			hoverClass: "ui-state-active",
+			drop: function( event, ui ) {
+				$( this )
+					.addClass( "ui-state-highlight" )
+					.find( "p" )
+						.html( "Dropped!" );
+			}
+		});
+
+		$( "#draggable2" ).draggable();
+		$( "#droppable2" ).droppable({
+			accept: "#draggable2",
+			activeClass: "ui-state-hover",
+			drop: function( event, ui ) {
+				$( this )
+					.addClass( "ui-state-highlight" )
+					.find( "p" )
+						.html( "Dropped!" );
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<h3 class="docs">Feedback on hover:</h3>
+	
+<div id="draggable" class="ui-widget-content">
+	<p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+	<p>Drop here</p>
+</div>
+
+<h3 class="docs">Feedback on activating draggable:</h3>
+
+<div id="draggable2" class="ui-widget-content">
+	<p>Drag me to my target</p>
+</div>
+
+<div id="droppable2" class="ui-widget-header">
+	<p>Drop here</p>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Change the droppable's appearance on hover, or when the droppable is active (an acceptable draggable is dropped on it).  Use the <code>hoverClass</code> or <code>activeClass</code> options to specify respective classes.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
Binary file jquery-ui/development-bundle/demos/images/calendar.gif has changed
Binary file jquery-ui/development-bundle/demos/images/demo-config-on-tile.gif has changed
Binary file jquery-ui/development-bundle/demos/images/demo-config-on.gif has changed
Binary file jquery-ui/development-bundle/demos/images/demo-spindown-closed.gif has changed
Binary file jquery-ui/development-bundle/demos/images/demo-spindown-open.gif has changed
Binary file jquery-ui/development-bundle/demos/images/icon-docs-info.gif has changed
Binary file jquery-ui/development-bundle/demos/images/pbar-ani.gif has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,321 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Demos</title>
+	<link rel="stylesheet" href="../themes/base/jquery.ui.all.css">
+	<link rel="stylesheet" href="demos.css">
+	<script src="../jquery-1.5.1.js"></script>
+	<script src="../external/jquery.bgiframe-2.1.2.js"></script>
+	<script src="../ui/jquery.ui.core.js"></script>
+	<script src="../ui/jquery.ui.widget.js"></script>
+	<script src="../ui/jquery.ui.mouse.js"></script>
+	<script src="../ui/jquery.ui.accordion.js"></script>
+	<script src="../ui/jquery.ui.autocomplete.js"></script>
+	<script src="../ui/jquery.ui.button.js"></script>
+	<script src="../ui/jquery.ui.datepicker.js"></script>
+	<script src="../ui/jquery.ui.dialog.js"></script>
+	<script src="../ui/jquery.ui.draggable.js"></script>
+	<script src="../ui/jquery.ui.droppable.js"></script>
+	<script src="../ui/jquery.ui.position.js"></script>
+	<script src="../ui/jquery.ui.progressbar.js"></script>
+	<script src="../ui/jquery.ui.resizable.js"></script>
+	<script src="../ui/jquery.ui.selectable.js"></script>
+	<script src="../ui/jquery.ui.slider.js"></script>
+	<script src="../ui/jquery.ui.sortable.js"></script>
+	<script src="../ui/jquery.ui.tabs.js"></script>
+	<script src="../ui/jquery.effects.core.js"></script>
+	<script src="../ui/jquery.effects.blind.js"></script>
+	<script src="../ui/jquery.effects.bounce.js"></script>
+	<script src="../ui/jquery.effects.clip.js"></script>
+	<script src="../ui/jquery.effects.drop.js"></script>
+	<script src="../ui/jquery.effects.explode.js"></script>
+	<script src="../ui/jquery.effects.fold.js"></script>
+	<script src="../ui/jquery.effects.highlight.js"></script>
+	<script src="../ui/jquery.effects.pulsate.js"></script>
+	<script src="../ui/jquery.effects.scale.js"></script>
+	<script src="../ui/jquery.effects.shake.js"></script>
+	<script src="../ui/jquery.effects.slide.js"></script>
+	<script src="../ui/jquery.effects.transfer.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-af.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ar.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ar-DZ.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-az.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-bs.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-bg.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ca.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-cs.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-da.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-de.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-el.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-en-AU.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-en-GB.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-en-NZ.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-eo.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-es.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-et.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-eu.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-fa.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-fi.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-fo.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-fr.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-fr-CH.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-gl.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-he.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-hr.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-hu.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-hy.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-id.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-is.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-it.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ja.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ko.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-kz.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-lt.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-lv.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ml.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ms.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-nl.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-no.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-pl.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-pt.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-pt-BR.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-rm.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ro.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ru.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-sk.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-sl.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-sq.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-sr.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-sr-SR.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-sv.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-ta.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-th.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-tj.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-tr.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-uk.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-vi.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-zh-CN.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-zh-HK.js"></script>
+	<script src="../ui/i18n/jquery.ui.datepicker-zh-TW.js"></script>
+	<script>
+	$(function() {
+		
+		$('.left-nav a').click(function(ev) {
+			window.location.hash = this.href.replace(/.+\/([^\/]+)\/index\.html/,'$1') + '|default';
+			loadPage(this.href);
+			$('.left-nav a.selected').removeClass('selected');
+			$(this).addClass('selected');
+			ev.preventDefault();
+		});
+		
+		if (window.location.hash) {
+			if (window.location.hash.indexOf('|') === -1) {
+				window.location.hash += '|default';	
+			}			
+			var path = window.location.href.replace(/(index\.html)?#/,'');
+			path = path.replace('\|','/') + '.html';
+			loadPage(path);
+		}		
+
+		function loadPage(path) {			
+			var section = path.replace(/\/[^\/]+\.html/,'');
+			var header = section.replace(/.+\/([^\/]+)/,'$1').replace(/_/, ' ');
+			
+			$('td.normal div.normal')
+				.empty()
+				.append('<h4 class="demo-subheader">Functional demo:</h4>')
+				.append('<h3 class="demo-header">'+ header +'</h3>')
+				.append('<div id="demo-config"></div>')
+				.find('#demo-config')
+					.append('<div id="demo-frame"></div><div id="demo-config-menu"></div><div id="demo-link"><a class="demoWindowLink" href="#"><span class="ui-icon ui-icon-newwin"></span>Open demo in a new window</a></div>')
+					.find('#demo-config-menu')
+						.load(section + '/index.html .demos-nav', function() {
+							$('#demo-config-menu a').each(function() {
+								this.setAttribute('href', section + '/' + this.getAttribute('href').replace(/.+\/([^\/]+)/,'$1'));
+								$(this).attr('target', 'demo-frame');
+								$(this).click(function() {
+
+									resetDemos();
+									
+									$(this).parents('ul').find('li').removeClass('demo-config-on');
+									$(this).parent().addClass('demo-config-on');
+									$('#demo-notes').fadeOut();
+
+									//Set the hash to the actual page without ".html"
+									window.location.hash = header + '|' + this.getAttribute('href').match((/\/([^\/\\]+)\.html/))[1];
+
+									loadDemo(this.getAttribute('href'));
+
+									return false;
+								});
+							});
+
+							if (window.location.hash) {
+								var demo = window.location.hash.split('|')[1];
+								$('#demo-config-menu a').each(function(){
+									if (this.href.indexOf(demo + '.html') !== -1) {
+										$(this).parents('ul').find('li').removeClass('demo-config-on');
+										$(this).parent().addClass('demo-config-on');									
+										loadDemo(this.href);										
+									}
+								});
+							}
+
+							updateDemoNotes();
+						})
+					.end()
+					.find('#demo-link a')
+						.bind('click', function(ev){
+							window.open(this.href);
+							ev.preventDefault();
+						})
+					.end()
+				.end()
+			;
+			
+			resetDemos();
+		}
+				
+		function loadDemo(path) {
+			var directory = path.match(/([^\/]+)\/[^\/\.]+\.html$/)[1];
+			$.get(path, function(data) {
+				var source = data;
+				data = data.replace(/<script.*>.*<\/script>/ig,""); // Remove script tags
+				data = data.replace(/<\/?link.*>/ig,""); //Remove link tags
+				data = data.replace(/<\/?html.*>/ig,""); //Remove html tag
+				data = data.replace(/<\/?body.*>/ig,""); //Remove body tag
+				data = data.replace(/<\/?head.*>/ig,""); //Remove head tag
+				data = data.replace(/<\/?!doctype.*>/ig,""); //Remove doctype
+				data = data.replace(/<title.*>.*<\/title>/ig,""); // Remove title tags
+				data = data.replace(/((href|src)=["'])(?!(http|#))/ig, "$1" + directory + "/");
+
+				$('#demo-style').remove();
+				$('#demo-frame').empty().html(data);
+				$('#demo-frame style').clone().appendTo('head').attr('id','demo-style');
+				$('#demo-link a').attr('href', path);
+				updateDemoNotes();
+				updateDemoSource(source);
+				
+				if (/default.html$/.test(path)) {
+					$.get("documentation/docs-" + path.match(/demos\/(.+)\//)[1] + ".html", function(html) {
+						$("#demo-source").after(html);
+						$("#widget-docs").tabs();
+						$(".param-header").click(function() {
+							$(this).parent().toggleClass("param-open").end().next().toggle();
+						});
+						$(".docs-list-header").each(function() {
+							var header = $(this);
+							var details = header.next().find(".param-details").hide();
+							$("a:first", header).click(function() {
+								details.show().parent().addClass("param-open");
+								return false;
+							});
+							$("a:last", header).click(function() {
+								details.hide().parent().removeClass("param-open");
+								return false;
+							});
+						});
+					});
+				}
+			});
+		}
+
+		function updateDemoNotes() {
+			var notes = $('#demo-frame .demo-description');
+			if ($('#demo-notes').length == 0) {
+				$('<div id="demo-notes"></div>').insertAfter('#demo-config');
+			}
+			$('#demo-notes').hide().empty().html(notes.html());
+			$('#demo-notes').show();
+			notes.hide();
+		}
+		
+		function updateDemoSource(source) {
+			if ($('#demo-source').length == 0) {
+				$('<div id="demo-source"><a href="#" class="source-closed">View Source</a><div><pre><code></code></pre></div></div>').insertAfter('#demo-notes');
+				$('#demo-source').find(">a").click(function() {
+					$(this).toggleClass("source-closed").toggleClass("source-open").next().toggle();
+					return false;
+				}).end().find(">div").hide();
+			}
+			var cleanedSource = source
+				.replace('themes/base/jquery.ui.all.css', 'theme/jquery.ui.all.css')
+				.replace(/\s*\x3Clink.*demos\x2Ecss.*\x3E\s*/, '\r\n\t')
+				.replace(/\x2E\x2E\x2F\x2E\x2E\x2F/g, '');
+
+			$('#demo-source code').empty().text(cleanedSource);
+		}
+		
+		function resetDemos() {
+			$.datepicker.setDefaults($.extend({showMonthAfterYear: false}, $.datepicker.regional['']));
+			$(".ui-dialog-content").remove();			
+		}
+				
+	});
+	</script>
+</head>
+<body>
+
+<table class="layout-grid" cellspacing="0" cellpadding="0">
+	<tr>
+		<td class="left-nav">
+			<dl class="demos-nav">
+				<dt>Interactions</dt>
+					<dd><a href="draggable/index.html">Draggable</a></dd>
+					<dd><a href="droppable/index.html">Droppable</a></dd>
+					<dd><a href="resizable/index.html">Resizable</a></dd>
+					<dd><a href="selectable/index.html">Selectable</a></dd>
+					<dd><a href="sortable/index.html">Sortable</a></dd>
+				<dt>Widgets</dt>
+					<dd><a href="accordion/index.html">Accordion</a></dd>
+					<dd><a href="autocomplete/index.html">Autocomplete</a></dd>
+					<dd><a href="button/index.html">Button</a></dd>
+					
+					<dd><a href="dialog/index.html">Dialog</a></dd>
+					
+					
+					
+				<dt>Effects</dt>
+					<dd><a href="animate/index.html">Color Animation</a></dd>
+					<dd><a href="toggleClass/index.html">Toggle Class</a></dd>
+					<dd><a href="addClass/index.html">Add Class</a></dd>
+					<dd><a href="removeClass/index.html">Remove Class</a></dd>
+					<dd><a href="switchClass/index.html">Switch Class</a></dd>
+					<dd><a href="effect/index.html">Effect</a></dd>
+					<dd><a href="toggle/index.html">Toggle</a></dd>
+					<dd><a href="hide/index.html">Hide</a></dd>
+					<dd><a href="show/index.html">Show</a></dd>
+				<dt>Utilities</dt>
+                    <dd><a href="position/index.html">Position</a></dd>
+				<dt>About jQuery UI</dt>
+					<dd><a href="http://jqueryui.com/docs/Getting_Started">Getting Started</a></dd>
+					<dd><a href="http://jqueryui.com/docs/Upgrade_Guide">Upgrade Guide</a></dd>					
+					<dd><a href="http://jqueryui.com/docs/Changelog">Changelog</a></dd>
+					<dd><a href="http://jqueryui.com/docs/Roadmap">Roadmap</a></dd>
+					<dd><a href="http://jqueryui.com/docs/Subversion">Subversion Access</a></dd>
+					<dd><a href="http://jqueryui.com/docs/Developer_Guide">UI Developer Guidelines</a></dd>
+				<dt>Theming</dt>
+					<dd><a href="http://jqueryui.com/docs/Theming">Theming jQuery UI</a></dd>
+					<dd><a href="http://jqueryui.com/docs/Theming/API">jQuery UI CSS Framework</a></dd>
+					<dd><a href="http://jqueryui.com/docs/Theming/Themeroller">ThemeRoller application</a></dd>
+					<dd><a href="http://jqueryui.com/docs/Theming/ThemeSwitcher">Theme Switcher Widget</a></dd>
+
+			</dl>
+		</td>
+		<td class="normal">
+
+			<div class="normal">
+
+					<h3>Instructions</h3>
+					<p>
+						These demos showcase some common uses of each jQuery UI plugin. Simply copy and paste code from the demos to get started. Have fun playing with them.
+					</p>
+				
+			</div>
+
+		</td>
+	</tr>
+</table>
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/position/cycler.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,122 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Position - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+    <style>
+   	html, body {
+   		margin: 0;
+		padding: 0
+   	}
+    </style>
+	<script>
+	$(function() {
+		$.fn.position2 = function( options ) {
+			return this.position( $.extend({
+				of: window,
+				using: function( to ) {
+					$( this ).css({
+						top: to.top,
+						left: to.left
+					})
+				},
+				collision: "none"
+			}, options));
+		}
+
+		$.fn.left = function( using ) {
+			return this.position2({
+				my: "right middle",
+				at: "left middle",
+				offset: "25 0",
+				using: using
+			});
+		}
+		$.fn.right = function( using ) {
+			return this.position2({
+				my: "left middle",
+				at: "right middle",
+				offset: "-25 0",
+				using: using
+			});
+		}
+		$.fn.center = function( using ) {
+			return this.position2({
+				my: "center middle",
+				at: "center middle",
+				using: using
+			});
+		};
+
+		$( "img:eq(0)" ).left();
+		$( "img:eq(1)" ).center();
+		$( "img:eq(2)" ).right();
+
+		$( "body" ).css({
+			overflow: "hidden"
+		})
+		$( ".demo" ).css({
+			position: "relative",
+		});
+		$( ".demo img" ).css({
+			position: "absolute",
+		});
+
+		function animate( to ) {
+			$(this).animate( to );
+		}
+		function next() {
+			$( "img:eq(2)" ).center( animate );
+			$( "img:eq(1)" ).left( animate )
+			$( "img:eq(0)" ).right().appendTo( ".demo" );
+		}
+		function previous() {
+			$( "img:eq(0)" ).center( animate );
+			$( "img:eq(1)" ).right( animate );
+			$( "img:eq(2)" ).left().prependTo( ".demo" );
+		}
+		$( "#previous" ).click( previous );
+		$( "#next" ).click( next );
+
+		$( ".demo img" ).click(function() {
+			$( ".demo img" ).index( this ) === 0 ? previous() : next();
+		});
+
+		$( window ).resize(function() {
+			$( "img:eq(0)" ).left( animate );
+			$( "img:eq(1)" ).center( animate );
+			$( "img:eq(2)" ).right( animate );
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<img src="images/earth.jpg" />
+<img src="images/flight.jpg" />
+<img src="images/rocket.jpg" />
+
+<a id="previous" href="#">Previous</a>
+<a id="next" href="#">Next</a>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>A prototype for the <a href="http://wiki.jqueryui.com/Photoviewer">Photoviewer</a> using Position to place images at the center, left and right and cycle them.
+<br/>Use the links at the top to cycle, or click on the images on the left and right.
+<br/>Note how the images are repositioned when resizing the window.
+<br/>Warning: Doesn't currently work inside the demo viewer; open in a new window instead!</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/position/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,153 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Position - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.draggable.js"></script>
+	<script src="../../ui/jquery.ui.position.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	div#parent {
+		width: 60%;
+		margin: 10px auto;
+		padding: 5px;
+		border: 1px solid #777;
+		background-color: #fbca93;
+		text-align: center;
+	}
+	div.positionable {
+		width: 75px;
+		height: 75px;
+		position: absolute;
+		display: block;
+		right: 0;
+		bottom: 0;
+		background-color: #bcd5e6;
+		text-align: center;
+	}
+	select, input {
+		margin-left: 15px;
+	}
+	</style>
+	<script>
+	$(function() {
+		function position( using ) {
+			$( ".positionable" ).position({
+				of: $( "#parent" ),
+				my: $( "#my_horizontal" ).val() + " " + $( "#my_vertical" ).val(),
+				at: $( "#at_horizontal" ).val() + " " + $( "#at_vertical" ).val(),
+				offset: $( "#offset" ).val(),
+				using: using,
+				collision: $( "#collision_horizontal" ).val() + ' ' + $( "#collision_vertical" ).val()
+			});
+		}
+
+		$( ".positionable" ).css( "opacity", 0.5 );
+
+		$( ":input" ).bind( "click keyup change", function() { position(); });
+
+		$( "#parent" ).draggable({
+			drag: function() { position(); }
+		});
+
+		$( ".positionable" ).draggable({
+			drag: function( event, ui ) {
+				// reset offset before calculating it
+				$( "#offset" ).val( "0" );
+				position(function( result ) {
+					$( "#offset" ).val( "" + ( ui.offset.left - result.left ) +
+						" " + ( ui.offset.top - result.top ) );
+					position();
+				});
+			}
+		});
+
+		position();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="parent">
+	<p>
+	This is the position parent element.
+	</p>
+</div>
+
+<div class="positionable">
+	<p>
+	to position
+	</p>
+</div>
+
+<div class="positionable" style="width:120px; height: 40px;">
+	<p>
+	to position 2
+	</p>
+</div>
+
+<div style="padding: 20px; margin-top: 75px;">
+	position...
+	<div style="padding-bottom: 20px;">
+		<b>my:</b>
+		<select id="my_horizontal">
+			<option value="left">left</option>
+			<option value="center">center</option>
+			<option value="right">right</option>
+		</select> 
+		<select id="my_vertical">
+			<option value="top">top</option>
+			<option value="middle">center</option>
+			<option value="bottom">bottom</option>
+		</select>
+	</div>
+	<div style="padding-bottom: 20px;">
+		<b>at:</b>
+		<select id="at_horizontal">
+			<option value="left">left</option>
+			<option value="center">center</option>
+			<option value="right">right</option>
+		</select>
+		<select id="at_vertical">
+			<option value="top">top</option>
+			<option value="middle">center</option>
+			<option value="bottom">bottom</option>
+		</select>
+	</div>
+	<div style="padding-bottom: 20px;">
+		<b>offset:</b>
+		<input id="offset" type="text" size="15"/>
+	</div>
+	<div style="padding-bottom: 20px;">
+		<b>collision:</b>
+		<select id="collision_horizontal">
+			<option value="flip">flip</option>
+			<option value="fit">fit</option>
+			<option value="none">none</option>
+		</select>
+		<select id="collision_vertical">
+			<option value="flip">flip</option>
+			<option value="fit">fit</option>
+			<option value="none">none</option>
+		</select>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Use the form controls to configure the positioning, or drag the positioned element to modify its offset.
+<br/>Drag around the parent element to see collision detection in action.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
Binary file jquery-ui/development-bundle/demos/position/images/earth.jpg has changed
Binary file jquery-ui/development-bundle/demos/position/images/flight.jpg has changed
Binary file jquery-ui/development-bundle/demos/position/images/rocket.jpg has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/position/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,19 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Position Demo</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="cycler.html">Cycling images</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/animate.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,43 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Animate</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { width: 150px; height: 150px; padding: 0.5em; }
+	#resizable h3 { text-align: center; margin: 0; }
+	.ui-resizable-helper { border: 1px dotted gray; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			animate: true
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Animate</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Animate the resize action using the <code>animate</code> option (boolean). When this option is set to true, drag the outline to the desired location; the element animates to that size on drag stop.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/aspect-ratio.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,42 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Preserve aspect ratio</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { width: 160px; height: 90px; padding: 0.5em; }
+	#resizable h3 { text-align: center; margin: 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			aspectRatio: 16 / 9
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Preserve aspect ratio</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Maintain the existing aspect ratio or set a new one to constrain the proportions on resize. Set the <code>aspectRatio</code> option to true, and optionally pass in a new ratio (i.e., 4/3)</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/constrain-area.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,47 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Constrain resize area</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style\>
+	#container { width: 300px; height: 300px; }
+	#container h3 { text-align: center; margin: 0; margin-bottom: 10px; }
+	#resizable { background-position: top left; width: 150px; height: 150px; }
+	#resizable, #container { padding: 0.5em; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			containment: "#container"
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="container" class="ui-widget-content">
+	<h3 class="ui-widget-header">Containment</h3>
+	<div id="resizable" class="ui-state-active">
+		<h3 class="ui-widget-header">Resizable</h3>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Define the boundaries of the resizable area. Use the <code>containment</code> option to specify a parent DOM element or a jQuery selector, like 'document.'</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,40 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { width: 150px; height: 150px; padding: 0.5em; }
+	#resizable h3 { text-align: center; margin: 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Resizable</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Enable any DOM element to be resizable.  With the cursor grab the right or bottom border and drag to the desired width or height.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/delay-start.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,52 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Delay start</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable, #resizable2 { width: 150px; height: 150px; padding: 0.5em; }
+	#resizable h3, #resizable2 h3 { text-align: center; margin: 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			delay: 1000
+		});
+		
+		$( "#resizable2" ).resizable({
+			distance: 40
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<h3 class="docs">Time delay (ms):</h3>
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Time</h3>
+</div>
+
+<h3 class="docs">Distance delay (px):</h3>
+<div id="resizable2" class="ui-widget-content">
+	<h3 class="ui-widget-header">Distance</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Delay the start of resizng for a number of milliseconds with the <code>delay</code> option; prevent resizing until the cursor is held down and dragged a specifed number of pixels with the <code>distance</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/helper.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,43 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Helper</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { width: 150px; height: 150px; padding: 0.5em; }
+	#resizable h3 { text-align: center; margin: 0; }
+	.ui-resizable-helper { border: 2px dotted #00F; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			helper: "ui-resizable-helper"
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Helper</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Display only an outline of the element while resizing by setting the <code>helper</code> option to a CSS class.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,28 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="aspect-ratio.html">Preserve aspect ratio</a></li>
+		<li><a href="max-min.html">Maximum / minimum size</a></li>
+		<li><a href="constrain-area.html">Constrain resize area</a></li>
+ 		<li><a href="delay-start.html">Delay start</a></li>
+		<li><a href="snap-to-grid.html">Snap to grid</a></li>
+		<li><a href="visual-feedback.html">Visual feedback</a></li>
+		<li><a href="synchronous-resize.html">Synchronous resize</a></li>
+		<li><a href="animate.html">Animate</a></li>
+		<li><a href="helper.html">Resize Helper</a></li>
+		<li><a href="textarea.html">Textarea</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/max-min.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,45 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Maximum / minimum size</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { width: 200px; height: 150px; padding: 5px; }
+	#resizable h3 { text-align: center; margin: 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			maxHeight: 250,
+			maxWidth: 350,
+			minHeight: 150,
+			minWidth: 200
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Resize larger / smaller</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Limit the resizable element to a maximum or minimum height or width using the <code>maxHeight</code>, <code>maxWidth</code>, <code>minHeight</code>, and <code>minWidth</code> options.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/snap-to-grid.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,42 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Snap to grid</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { width: 150px; height: 150px; padding: 0.5em; }
+	#resizable h3 { text-align: center; margin: 0; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			grid: 50
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Grid</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Snap the resizable element to a grid.  Set the dimensions of grid cells (height and width in pixels) with the <code>grid</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/synchronous-resize.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,49 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Synchronous resize</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { background-position: top left; }
+	#resizable, #also { width: 150px; height: 120px; padding: 0.5em; }
+	#resizable h3, #also h3 { text-align: center; margin: 0; }
+	#also { margin-top: 1em; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			alsoResize: "#also"
+		});
+		$( "#also" ).resizable();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-header">
+	<h3 class="ui-state-active">Resize</h3>
+</div>
+
+<div id="also" class="ui-widget-content">
+	<h3 class="ui-widget-header">will also resize</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Resize multiple elements simultaneously by clicking and dragging the sides of one.  Pass a shared selector into the <code>alsoResize</code> option.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/textarea.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,41 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Textarea</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.ui-resizable-se {
+		bottom: 17px;
+	}
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			handles: "se"
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<textarea id="resizable" rows="5" cols="20"></textarea>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Display only an outline of the element while resizing by setting the <code>helper</code> option to a CSS class.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/resizable/visual-feedback.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,43 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Resizable - Visual feedback</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.resizable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#resizable { width: 150px; height: 150px; padding: 0.5em; }
+	#resizable h3 { text-align: center; margin: 0; }
+	.ui-resizable-ghost { border: 1px dotted gray; }
+	</style>
+	<script>
+	$(function() {
+		$( "#resizable" ).resizable({
+			ghost: true
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+	
+<div id="resizable" class="ui-widget-content">
+	<h3 class="ui-widget-header">Ghost</h3>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Instead of showing the actual element during resize, set the <code>ghost</code> option to true to show a semi-transparent part of the element.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/selectable/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,50 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Selectable - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.selectable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	
+	<style>
+	#feedback { font-size: 1.4em; }
+	#selectable .ui-selecting { background: #FECA40; }
+	#selectable .ui-selected { background: #F39814; color: white; }
+	#selectable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+	#selectable li { margin: 3px; padding: 0.4em; font-size: 1.4em; height: 18px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#selectable" ).selectable();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<ol id="selectable">
+	<li class="ui-widget-content">Item 1</li>
+	<li class="ui-widget-content">Item 2</li>
+	<li class="ui-widget-content">Item 3</li>
+	<li class="ui-widget-content">Item 4</li>
+	<li class="ui-widget-content">Item 5</li>
+	<li class="ui-widget-content">Item 6</li>
+	<li class="ui-widget-content">Item 7</li>
+</ol>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Enable a DOM element (or group of elements) to be selectable. Draw a box with your cursor to select items. Hold down the Ctrl key to make multiple non-adjacent selections. </p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/selectable/display-grid.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,55 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Selectable - Display as grid</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.selectable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	
+	<style>
+	#feedback { font-size: 1.4em; }
+	#selectable .ui-selecting { background: #FECA40; }
+	#selectable .ui-selected { background: #F39814; color: white; }
+	#selectable { list-style-type: none; margin: 0; padding: 0; }
+	#selectable li { margin: 3px; padding: 1px; float: left; width: 100px; height: 80px; font-size: 4em; text-align: center; }
+	</style>
+	<script>
+	$(function() {
+		$( "#selectable" ).selectable();
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<ol id="selectable">
+	<li class="ui-state-default">1</li>
+	<li class="ui-state-default">2</li>
+	<li class="ui-state-default">3</li>
+	<li class="ui-state-default">4</li>
+	<li class="ui-state-default">5</li>
+	<li class="ui-state-default">6</li>
+	<li class="ui-state-default">7</li>
+	<li class="ui-state-default">8</li>
+	<li class="ui-state-default">9</li>
+	<li class="ui-state-default">10</li>
+	<li class="ui-state-default">11</li>
+	<li class="ui-state-default">12</li>
+</ol>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>To arrange selectable items as a grid, give them identical dimensions and float them using CSS.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/selectable/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,20 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Selectable Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="serialize.html">Serialize</a></li>
+		<li><a href="display-grid.html">Display as grid</a></li>		
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/selectable/serialize.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,61 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Selectable - Serialize</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.selectable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	
+	<style>
+	#feedback { font-size: 1.4em; }
+	#selectable .ui-selecting { background: #FECA40; }
+	#selectable .ui-selected { background: #F39814; color: white; }
+	#selectable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+	#selectable li { margin: 3px; padding: 0.4em; font-size: 1.4em; height: 18px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#selectable" ).selectable({
+			stop: function() {
+				var result = $( "#select-result" ).empty();
+				$( ".ui-selected", this ).each(function() {
+					var index = $( "#selectable li" ).index( this );
+					result.append( " #" + ( index + 1 ) );
+				});
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+
+<div class="demo">
+
+<p id="feedback">
+<span>You've selected:</span> <span id="select-result">none</span>.
+</p>
+
+<ol id="selectable">
+	<li class="ui-widget-content">Item 1</li>
+	<li class="ui-widget-content">Item 2</li>
+	<li class="ui-widget-content">Item 3</li>
+	<li class="ui-widget-content">Item 4</li>
+	<li class="ui-widget-content">Item 5</li>
+	<li class="ui-widget-content">Item 6</li>
+</ol>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Write a function that fires on the <code>stop</code> event to collect the index values of selected items.  Present values as feedback, or pass as a data string.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/connect-lists-through-tabs.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,78 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Connect lists with Tabs</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<script src="../../ui/jquery.ui.droppable.js"></script>
+	<script src="../../ui/jquery.ui.tabs.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 120px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable1, #sortable2" ).sortable().disableSelection();
+
+		var $tabs = $( "#tabs" ).tabs();
+
+		var $tab_items = $( "ul:first li", $tabs ).droppable({
+			accept: ".connectedSortable li",
+			hoverClass: "ui-state-hover",
+			drop: function( event, ui ) {
+				var $item = $( this );
+				var $list = $( $item.find( "a" ).attr( "href" ) )
+					.find( ".connectedSortable" );
+
+				ui.draggable.hide( "slow", function() {
+					$tabs.tabs( "select", $tab_items.index( $item ) );
+					$( this ).appendTo( $list ).show( "slow" );
+				});
+			}
+		});
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<div id="tabs">
+	<ul>
+		<li><a href="#tabs-1">Nunc tincidunt</a></li>
+		<li><a href="#tabs-2">Proin dolor</a></li>
+	</ul>
+	<div id="tabs-1">
+		<ul id="sortable1" class="connectedSortable ui-helper-reset">
+			<li class="ui-state-default">Item 1</li>
+			<li class="ui-state-default">Item 2</li>
+			<li class="ui-state-default">Item 3</li>
+			<li class="ui-state-default">Item 4</li>
+			<li class="ui-state-default">Item 5</li>
+		</ul>
+	</div>
+	<div id="tabs-2">
+		<ul id="sortable2" class="connectedSortable ui-helper-reset">
+			<li class="ui-state-highlight">Item 1</li>
+			<li class="ui-state-highlight">Item 2</li>
+			<li class="ui-state-highlight">Item 3</li>
+			<li class="ui-state-highlight">Item 4</li>
+			<li class="ui-state-highlight">Item 5</li>
+		</ul>
+	</div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>Sort items from one list into another and vice versa, by dropping the list item on the appropriate tab above.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/connect-lists.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,58 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Connect lists</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; float: left; margin-right: 10px; }
+	#sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 120px; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable1, #sortable2" ).sortable({
+			connectWith: ".connectedSortable"
+		}).disableSelection();
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable1" class="connectedSortable">
+	<li class="ui-state-default">Item 1</li>
+	<li class="ui-state-default">Item 2</li>
+	<li class="ui-state-default">Item 3</li>
+	<li class="ui-state-default">Item 4</li>
+	<li class="ui-state-default">Item 5</li>
+</ul>
+
+<ul id="sortable2" class="connectedSortable">
+	<li class="ui-state-highlight">Item 1</li>
+	<li class="ui-state-highlight">Item 2</li>
+	<li class="ui-state-highlight">Item 3</li>
+	<li class="ui-state-highlight">Item 4</li>
+	<li class="ui-state-highlight">Item 5</li>
+</ul>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	Sort items from one list into another and vice versa, by passing a selector into
+	the <code>connectWith</code> option. The simplest way to do this is to
+	group all related lists with a CSS class, and then pass that class into the
+	sortable function (i.e., <code>connectWith: '.myclass'</code>).
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/default.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Default functionality</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+	#sortable li { margin: 0 3px 3px 3px; padding: 0.4em; padding-left: 1.5em; font-size: 1.4em; height: 18px; }
+	#sortable li span { position: absolute; margin-left: -1.3em; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable" ).sortable();
+		$( "#sortable" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable">
+	<li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 1</li>
+	<li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 2</li>
+	<li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 3</li>
+	<li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 4</li>
+	<li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 5</li>
+	<li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 6</li>
+	<li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 7</li>
+</ul>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	Enable a group of DOM elements to be sortable. Click on and drag an
+	element to a new spot within the list, and the other items will adjust to
+	fit. By default, sortable items share <code>draggable</code> properties.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/delay-start.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,67 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Delay start</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; margin-bottom: 15px;zoom: 1; }
+	#sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 95%; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable1" ).sortable({
+			delay: 300
+		});
+		
+		$( "#sortable2" ).sortable({
+			distance: 15
+		});
+
+		$( "li" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">Time delay of 300ms:</h3>
+
+<ul id="sortable1">
+	<li class="ui-state-default">Item 1</li>
+	<li class="ui-state-default">Item 2</li>
+	<li class="ui-state-default">Item 3</li>
+	<li class="ui-state-default">Item 4</li>
+</ul>
+
+<h3 class="docs">Distance delay of 15px:</h3>
+
+<ul id="sortable2">
+	<li class="ui-state-default">Item 1</li>
+	<li class="ui-state-default">Item 2</li>
+	<li class="ui-state-default">Item 3</li>
+	<li class="ui-state-default">Item 4</li>
+</ul>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	Prevent accidental sorting either by delay (time) or distance. Set a number of
+	milliseconds the element needs to be dragged before sorting starts
+	with the <code>delay</code> option. Set a distance in pixels the element
+	needs to be dragged before sorting starts with the <code>distance</code>
+	option.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/display-grid.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,54 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Display as grid</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable { list-style-type: none; margin: 0; padding: 0; }
+	#sortable li { margin: 3px 3px 3px 0; padding: 1px; float: left; width: 100px; height: 90px; font-size: 4em; text-align: center; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable" ).sortable();
+		$( "#sortable" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable">
+	<li class="ui-state-default">1</li>
+	<li class="ui-state-default">2</li>
+	<li class="ui-state-default">3</li>
+	<li class="ui-state-default">4</li>
+	<li class="ui-state-default">5</li>
+	<li class="ui-state-default">6</li>
+	<li class="ui-state-default">7</li>
+	<li class="ui-state-default">8</li>
+	<li class="ui-state-default">9</li>
+	<li class="ui-state-default">10</li>
+	<li class="ui-state-default">11</li>
+	<li class="ui-state-default">12</li>
+</ul>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	To arrange sortable items as a grid, give them identical dimensions and
+	float them using CSS.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/empty-lists.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Handle empty lists</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable1, #sortable2, #sortable3 { list-style-type: none; margin: 0; padding: 0; float: left; margin-right: 10px; background: #eee; padding: 5px; width: 143px;}
+	#sortable1 li, #sortable2 li, #sortable3 li { margin: 5px; padding: 5px; font-size: 1.2em; width: 120px; }
+	</style>
+	<script>
+	$(function() {
+		$( "ul.droptrue" ).sortable({
+			connectWith: "ul"
+		});
+
+		$( "ul.dropfalse" ).sortable({
+			connectWith: "ul",
+			dropOnEmpty: false
+		});
+
+		$( "#sortable1, #sortable2, #sortable3" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable1" class='droptrue'>
+	<li class="ui-state-default">Can be dropped..</li>
+	<li class="ui-state-default">..on an empty list</li>
+	<li class="ui-state-default">Item 3</li>
+	<li class="ui-state-default">Item 4</li>
+	<li class="ui-state-default">Item 5</li>
+</ul>
+
+<ul id="sortable2" class='dropfalse'>
+	<li class="ui-state-highlight">Cannot be dropped..</li>
+	<li class="ui-state-highlight">..on an empty list</li>
+	<li class="ui-state-highlight">Item 3</li>
+	<li class="ui-state-highlight">Item 4</li>
+	<li class="ui-state-highlight">Item 5</li>
+</ul>
+
+<ul id="sortable3" class='droptrue'>
+</ul>
+
+<br clear="both" />
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	Prevent all items in a list from being dropped into a separate, empty list
+	using the <code>dropOnEmpty</code> option set to <code>false</code>.  By default,
+	sortable items can be dropped on empty lists.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,26 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable Demos</title>
+	<link rel="stylesheet" href="../demos.css">
+</head>
+<body>
+
+<div class="demos-nav">
+	<h4>Examples</h4>
+	<ul>
+		<li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+		<li><a href="placeholder.html">Drop placeholder</a></li>
+		<li><a href="connect-lists.html">Connect lists</a></li>
+		<li><a href="connect-lists-through-tabs.html">Connect lists through tabs</a></li>
+		<li><a href="empty-lists.html">Handle empty lists</a></li>
+		<li><a href="items.html">Include / exclude items</a></li>
+		<li><a href="delay-start.html">Delay start</a></li>
+		<li><a href="display-grid.html">Display as grid</a></li>		
+		<li><a href="portlets.html">Portlets</a></li>
+	</ul>
+</div>
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/items.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,70 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Include / exclude items</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; zoom: 1; }
+	#sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 3px; width: 90%; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable1" ).sortable({
+			items: "li:not(.ui-state-disabled)"
+		});
+
+		$( "#sortable2" ).sortable({
+			cancel: ".ui-state-disabled"
+		});
+
+		$( "#sortable1 li, #sortable2 li" ).disableSelection();		
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">Specify which items are sortable:</h3>
+
+<ul id="sortable1">
+	<li class="ui-state-default">Item 1</li>
+	<li class="ui-state-default ui-state-disabled">(I'm not sortable or a drop target)</li>
+	<li class="ui-state-default ui-state-disabled">(I'm not sortable or a drop target)</li>
+	<li class="ui-state-default">Item 4</li>
+</ul>
+
+<h3 class="docs">Cancel sorting (but keep as drop targets):</h3>
+
+<ul id="sortable2">
+	<li class="ui-state-default">Item 1</li>
+	<li class="ui-state-default ui-state-disabled">(I'm not sortable)</li>
+	<li class="ui-state-default ui-state-disabled">(I'm not sortable)</li>
+	<li class="ui-state-default">Item 4</li>
+</ul>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	Specify which items are eligible to sort by passing a jQuery selector into
+	the <code>items</code> option. Items excluded from this option are not
+	sortable, nor are they valid targets for sortable items.
+</p>
+<p>
+	To only prevent sorting on certain items, pass a jQuery selector into the
+	<code>cancel</code> option. Cancelled items remain valid sort targets for
+	others.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/placeholder.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Drop placeholder</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	#sortable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+	#sortable li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; height: 1.5em; }
+	html>body #sortable li { height: 1.5em; line-height: 1.2em; }
+	.ui-state-highlight { height: 1.5em; line-height: 1.2em; }
+	</style>
+	<script>
+	$(function() {
+		$( "#sortable" ).sortable({
+			placeholder: "ui-state-highlight"
+		});
+		$( "#sortable" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable">
+	<li class="ui-state-default">Item 1</li>
+	<li class="ui-state-default">Item 2</li>
+	<li class="ui-state-default">Item 3</li>
+	<li class="ui-state-default">Item 4</li>
+	<li class="ui-state-default">Item 5</li>
+	<li class="ui-state-default">Item 6</li>
+	<li class="ui-state-default">Item 7</li>
+</ul>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	When dragging a sortable item to a new location, other items will make room
+	for the that item by shifting to allow white space between them. Pass a
+	class into the <code>placeholder</code> option to style that space to
+	be visible.  Use the boolean <code>forcePlaceholderSize</code> option
+	to set dimensions on the placeholder.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/demos/sortable/portlets.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,96 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+	<meta charset="utf-8">
+	<title>jQuery UI Sortable - Portlets</title>
+	<link rel="stylesheet" href="../../themes/base/jquery.ui.all.css">
+	<script src="../../jquery-1.5.1.js"></script>
+	<script src="../../ui/jquery.ui.core.js"></script>
+	<script src="../../ui/jquery.ui.widget.js"></script>
+	<script src="../../ui/jquery.ui.mouse.js"></script>
+	<script src="../../ui/jquery.ui.sortable.js"></script>
+	<link rel="stylesheet" href="../demos.css">
+	<style>
+	.column { width: 170px; float: left; padding-bottom: 100px; }
+	.portlet { margin: 0 1em 1em 0; }
+	.portlet-header { margin: 0.3em; padding-bottom: 4px; padding-left: 0.2em; }
+	.portlet-header .ui-icon { float: right; }
+	.portlet-content { padding: 0.4em; }
+	.ui-sortable-placeholder { border: 1px dotted black; visibility: visible !important; height: 50px !important; }
+	.ui-sortable-placeholder * { visibility: hidden; }
+	</style>
+	<script>
+	$(function() {
+		$( ".column" ).sortable({
+			connectWith: ".column"
+		});
+
+		$( ".portlet" ).addClass( "ui-widget ui-widget-content ui-helper-clearfix ui-corner-all" )
+			.find( ".portlet-header" )
+				.addClass( "ui-widget-header ui-corner-all" )
+				.prepend( "<span class='ui-icon ui-icon-minusthick'></span>")
+				.end()
+			.find( ".portlet-content" );
+
+		$( ".portlet-header .ui-icon" ).click(function() {
+			$( this ).toggleClass( "ui-icon-minusthick" ).toggleClass( "ui-icon-plusthick" );
+			$( this ).parents( ".portlet:first" ).find( ".portlet-content" ).toggle();
+		});
+
+		$( ".column" ).disableSelection();
+	});
+	</script>
+</head>
+<body>
+<div class="demo">
+
+<div class="column">
+
+	<div class="portlet">
+		<div class="portlet-header">Feeds</div>
+		<div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+	</div>
+	
+	<div class="portlet">
+		<div class="portlet-header">News</div>
+		<div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+	</div>
+
+</div>
+
+<div class="column">
+
+	<div class="portlet">
+		<div class="portlet-header">Shopping</div>
+		<div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+	</div>
+
+</div>
+
+<div class="column">
+
+	<div class="portlet">
+		<div class="portlet-header">Links</div>
+		<div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+	</div>
+	
+	<div class="portlet">
+		<div class="portlet-header">Images</div>
+		<div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+	</div>
+
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+<p>
+	Enable portlets (styled divs) as sortables and use the <code>connectWith</code>
+	option to allow sorting between columns.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/accordion.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1017 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Accordion</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>Make the selected elements Accordion widgets. Semantic requirements:</p>
+<p>The markup of your accordion container needs pairs of headers and content panels:</p>
+<pre>&lt;div id=&quot;accordion&quot;&gt;
+    &lt;h3&gt;&lt;a href=&quot;#&quot;&gt;First header&lt;/a&gt;&lt;/h3&gt;
+    &lt;div&gt;First content&lt;/div&gt;
+    &lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Second header&lt;/a&gt;&lt;/h3&gt;
+    &lt;div&gt;Second content&lt;/div&gt;
+&lt;/div&gt;</pre>
+<p>If you use a different element for the header, specify the header-option with an appropriate selector, eg. header: 'a.header'. The content element must be always next to its header.</p>
+<p>If you have links inside the accordion content and use a-elements as headers, add a class to them and use that as the header, eg. header: 'a.header'.</p>
+<p>Use activate(Number) to change the active content programmatically.</p>
+<div class="editsection" style="float:right;margin-left:5px;">[<a href="http://docs.jquery.com/action/edit/UI/API/1.8/Accordion?section=1" title="Edit section: NOTE: If you want multiple sections open at once, don't use an accordion">edit</a>]</div><a name="NOTE:_If_you_want_multiple_sections_open_at_once.2C_don.27t_use_an_accordion"></a><h4>NOTE: If you want multiple sections open at once, don't use an accordion</h4>
+<p>An accordion doesn't allow more than one content panel to be open at the same time, and it takes a lot of effort to do that. If you are looking for a widget that allows more than one content panel to be open, don't use this. Usually it can be written with a few lines of jQuery instead, something like this:</p>
+<pre>jQuery(document).ready(function(){
+	$('.accordion .head').click(function() {
+		$(this).next().toggle();
+		return false;
+	}).next().hide();
+});</pre>
+<p>Or animated:</p>
+<pre>jQuery(document).ready(function(){
+	$('.accordion .head').click(function() {
+		$(this).next().toggle('slow');
+		return false;
+	}).next().hide();
+});</pre>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+<li>UI Effects Core (Optional - only for non-default animations)</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="310">
+A simple jQuery UI Accordion.<br />
+</p>
+<pre>$(&quot;#accordion&quot;).accordion();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#accordion&quot;).accordion();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;div id=&quot;accordion&quot;&gt;
+	&lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Section 1&lt;/a&gt;&lt;/h3&gt;
+	&lt;div&gt;
+		&lt;p&gt;
+		Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer
+		ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit
+		amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut
+		odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.
+		&lt;/p&gt;
+	&lt;/div&gt;
+	&lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Section 2&lt;/a&gt;&lt;/h3&gt;
+	&lt;div&gt;
+		&lt;p&gt;
+		Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet
+		purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor
+		velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In
+		suscipit faucibus urna.
+		&lt;/p&gt;
+	&lt;/div&gt;
+	&lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Section 3&lt;/a&gt;&lt;/h3&gt;
+	&lt;div&gt;
+		&lt;p&gt;
+		Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis.
+		Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero
+		ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis
+		lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui.
+		&lt;/p&gt;
+		&lt;ul&gt;
+			&lt;li&gt;List item one&lt;/li&gt;
+			&lt;li&gt;List item two&lt;/li&gt;
+			&lt;li&gt;List item three&lt;/li&gt;
+		&lt;/ul&gt;
+	&lt;/div&gt;
+	&lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Section 4&lt;/a&gt;&lt;/h3&gt;
+	&lt;div&gt;
+		&lt;p&gt;
+		Cras dictum. Pellentesque habitant morbi tristique senectus et netus
+		et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in
+		faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia
+		mauris vel est.
+		&lt;/p&gt;
+		&lt;p&gt;
+		Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus.
+		Class aptent taciti sociosqu ad litora torquent per conubia nostra, per
+		inceptos himenaeos.
+		&lt;/p&gt;
+	&lt;/div&gt;
+&lt;/div&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the accordion. Can be set when initialising (first creating) the accordion.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).accordion( "option", "disabled" );
+//setter
+$( ".selector" ).accordion( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-active">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-active">active</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector, Element, jQuery, Boolean, Number</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">first child</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Selector for the active element. Set to false to display none at start. Needs <code>collapsible: true</code>.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>active</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ active: 2 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>active</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var active = $( ".selector" ).accordion( "option", "active" );
+//setter
+$( ".selector" ).accordion( "option", "active", 2 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-animated">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-animated">animated</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean, String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'slide'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Choose your favorite animation, or disable them (set to false). In addition to the default, 'bounceslide' and all defined easing methods are supported ('bounceslide' requires UI Effects Core).</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>animated</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ animated: 'bounceslide' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>animated</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var animated = $( ".selector" ).accordion( "option", "animated" );
+//setter
+$( ".selector" ).accordion( "option", "animated", 'bounceslide' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-autoHeight">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-autoHeight">autoHeight</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set, the highest content part is used as height reference for all other parts. Provides more consistent animations.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>autoHeight</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ autoHeight: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>autoHeight</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var autoHeight = $( ".selector" ).accordion( "option", "autoHeight" );
+//setter
+$( ".selector" ).accordion( "option", "autoHeight", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-clearStyle">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-clearStyle">clearStyle</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set, clears height and overflow styles after finishing animations. This enables accordions to work with dynamic content. Won't work together with autoHeight.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>clearStyle</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ clearStyle: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>clearStyle</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var clearStyle = $( ".selector" ).accordion( "option", "clearStyle" );
+//setter
+$( ".selector" ).accordion( "option", "clearStyle", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-collapsible">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-collapsible">collapsible</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Whether all the sections can be closed at once. Allows collapsing the active section by the triggering event (click is the default).</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>collapsible</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ collapsible: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>collapsible</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var collapsible = $( ".selector" ).accordion( "option", "collapsible" );
+//setter
+$( ".selector" ).accordion( "option", "collapsible", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-event">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-event">event</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'click'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The event on which to trigger the accordion.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>event</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ event: 'mouseover' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>event</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var event = $( ".selector" ).accordion( "option", "event" );
+//setter
+$( ".selector" ).accordion( "option", "event", 'mouseover' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-fillSpace">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-fillSpace">fillSpace</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set, the accordion completely fills the height of the parent element. Overrides autoheight.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>fillSpace</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ fillSpace: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>fillSpace</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var fillSpace = $( ".selector" ).accordion( "option", "fillSpace" );
+//setter
+$( ".selector" ).accordion( "option", "fillSpace", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-header">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-header">header</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector, jQuery</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'&gt; li &gt;&nbsp;:first-child,&gt;&nbsp;:not(li):even'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Selector for the header element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>header</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ header: 'h3' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>header</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var header = $( ".selector" ).accordion( "option", "header" );
+//setter
+$( ".selector" ).accordion( "option", "header", 'h3' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-icons">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-icons">icons</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Object</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">{ 'header': 'ui-icon-triangle-1-e', 'headerSelected': 'ui-icon-triangle-1-s' }</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Icons to use for headers. Icons may be specified for 'header' and 'headerSelected', and we recommend using the icons native to the jQuery UI CSS Framework manipulated by <a href="http://www.themeroller.com" class="external text" title="http://www.themeroller.com">jQuery UI ThemeRoller</a></p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>icons</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ icons: { 'header': 'ui-icon-plus', 'headerSelected': 'ui-icon-minus' } });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>icons</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var icons = $( ".selector" ).accordion( "option", "icons" );
+//setter
+$( ".selector" ).accordion( "option", "icons", { 'header': 'ui-icon-plus', 'headerSelected': 'ui-icon-minus' } );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-navigation">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-navigation">navigation</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set, looks for the anchor that matches location.href and activates it. Great for href-based state-saving. Use navigationFilter to implement your own matcher.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>navigation</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ navigation: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>navigation</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var navigation = $( ".selector" ).accordion( "option", "navigation" );
+//setter
+$( ".selector" ).accordion( "option", "navigation", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-navigationFilter">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-navigationFilter">navigationFilter</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Function</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default"> </dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Overwrite the default location.href-matching with your own matcher.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a accordion with the <code>navigationFilter</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).accordion({ navigationFilter: function(){ ... } });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>navigationFilter</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var navigationFilter = $( ".selector" ).accordion( "option", "navigationFilter" );
+//setter
+$( ".selector" ).accordion( "option", "navigationFilter", function(){ ... } );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">accordioncreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when accordion is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).accordion({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>accordioncreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;accordioncreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-change">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-change">change</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">accordionchange</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered every time the accordion changes. If the accordion is animated, the event will be triggered upon completion of the animation; otherwise, it is triggered immediately.
+</p>
+<pre>$('.ui-accordion').bind('accordionchange', function(event, ui) {
+  ui.newHeader // jQuery object, activated header
+  ui.oldHeader // jQuery object, previous header
+  ui.newContent // jQuery object, activated content
+  ui.oldContent // jQuery object, previous content
+});</pre></p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>change</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).accordion({
+   change: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>change</code> event by type: <code>accordionchange</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;accordionchange&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+<p>
+<li class="event" id="event-changestart">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-changestart">changestart</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">accordionchangestart</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered every time the accordion starts to change.
+</p>
+<pre>$('.ui-accordion').bind('accordionchangestart', function(event, ui) {
+  ui.newHeader // jQuery object, activated header
+  ui.oldHeader // jQuery object, previous header
+  ui.newContent // jQuery object, activated content
+  ui.oldContent // jQuery object, previous content
+});</pre></p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>changestart</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).accordion({
+   changestart: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>changestart</code> event by type: <code>accordionchangestart</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;accordionchangestart&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the accordion functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+<p>
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the accordion.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the accordion.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any accordion option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple accordion options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-accordion element.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-activate">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-activate">activate</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "activate"
+
+, index
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Activate a content part of the Accordion programmatically. The index can be a zero-indexed number to match the position of the header to close or a Selector matching an element. Pass <code>false</code> to close all (only possible with <code>collapsible:true</code>).</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-resize">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-resize">resize</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.accordion( "resize"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Recompute heights of the accordion contents when using the fillSpace option and the container height changed. For example, when the container is a resizable, this method should be called by its resize-event.</p>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Accordion plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.accordion.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;div class="<strong>ui-accordion</strong> ui-widget ui-helper-reset"&gt;<br />
+&nbsp;&nbsp;&lt;h3 class="<strong>ui-accordion-header</strong> ui-helper-reset ui-state-active ui-corner-top"&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;span class="ui-icon ui-icon-triangle-1-s"/&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;a href="#"&gt;Section 1&lt;/a&gt;<br />
+&nbsp;&nbsp;&lt;/h3&gt;<br />
+&nbsp;&nbsp;&lt;div class="<strong>ui-accordion-content</strong> ui-helper-reset ui-widget-content ui-corner-bottom <strong>ui-accordion-content-active</strong>"&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;Section 1 content<br />
+&nbsp;&nbsp;&lt;/div&gt;<br />
+&nbsp;&nbsp;&lt;h3 class="<strong>ui-accordion-header</strong> ui-helper-reset ui-state-default ui-corner-all"&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;span class="ui-icon ui-icon-triangle-1-e"/&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;a href="#"&gt;Section 2&lt;/a&gt;<br />
+&nbsp;&nbsp;&lt;/h3&gt;<br />
+&nbsp;&nbsp;&lt;div class="<strong>ui-accordion-content</strong> ui-helper-reset ui-widget-content ui-corner-bottom"&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;Section 2 content<br />
+&nbsp;&nbsp;&lt;/div&gt;<br />
+&nbsp;&nbsp;&lt;h3 class="<strong>ui-accordion-header</strong> ui-helper-reset ui-state-default ui-corner-all"&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;span class="ui-icon ui-icon-triangle-1-e"/&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;a href="#"&gt;Section 3&lt;/a&gt;<br />
+&nbsp;&nbsp;&lt;/h3&gt;<br />
+&nbsp;&nbsp;&lt;div class="<strong>ui-accordion-content</strong> ui-helper-reset ui-widget-content ui-corner-bottom"&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;Section 3 content<br />
+&nbsp;&nbsp;&lt;/div&gt;<br />
+&lt;/div&gt;<br />
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the accordion plugin, not markup you should use to create a accordion. The only markup needed for that is <br />&lt;div&gt;<br />
+&#160;&#160;&#160;&lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Section 1&lt;/a&gt;&lt;/h3&gt;<br />
+&#160;&#160;&#160;&lt;div&gt;<br />
+&#160;&#160;&#160;&#160;&#160;&#160;Section 1 content<br />
+&#160;&#160;&#160;&lt;/div&gt;<br />
+&#160;&#160;&#160;&lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Section 2&lt;/a&gt;&lt;/h3&gt;<br />
+&#160;&#160;&#160;&lt;div&gt;<br />
+&#160;&#160;&#160;&#160;&#160;&#160;Section 2 content<br />
+&#160;&#160;&#160;&lt;/div&gt;<br />
+&#160;&#160;&#160;&lt;h3&gt;&lt;a href=&quot;#&quot;&gt;Section 3&lt;/a&gt;&lt;/h3&gt;<br />
+&#160;&#160;&#160;&lt;div&gt;<br />
+&#160;&#160;&#160;&#160;&#160;&#160;Section 3 content<br />
+&#160;&#160;&#160;&lt;/div&gt;<br />
+&lt;/div&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 38033 bytes
+Post-expand include size: 63819 bytes
+Template argument size: 35523 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3773-1!1!0!!en!2 and timestamp 20110315194429 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/autocomplete.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,833 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Autocomplete</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>Autocomplete, when added to an input field, enables users to quickly find and select from a pre-populated list of values as they type, leveraging searching and filtering.</p>
+<p>By giving an Autocomplete field focus or entering something into it, the plugin starts searching for entries that match and displays a list of values to choose from. By entering more characters, the user can filter down the list to better matches.</p>
+<p>This can be used to enter previous selected values, for example you could use Autocomplete for entering tags, to complete an address, you could enter a city name and get the zip code, or maybe enter email addresses from an address book.</p>
+<p>You can pull data in from a local and/or a remote source: Local is good for small data sets (like an address book with 50 entries), remote is necessary for big data sets, like a database with hundreds or millions of entries to select from.</p>
+<p>Autocomplete can be customized to work with various data sources, by just specifying the source option. A data source can be:</p>
+<ul>
+<li>an Array with local data</li>
+<li>a String, specifying a URL</li>
+<li>a Callback</li>
+</ul>
+<p>The local data can be a simple Array of Strings, or it contains Objects for each item in the array, with either a label or value property or both. The label property is displayed in the suggestion menu. The value will be inserted into the input element after the user selected something from the menu. If just one property is specified, it will be used for both, eg. if you provide only value-properties, the value will also be used as the label.</p>
+<p>When a String is used, the Autocomplete plugin expects that string to point to a URL resource that will return JSON data. It can be on the same host or on a different one (must provide JSONP). The request parameter "term" gets added to that URL. The data itself can be in the same format as the local data described above.</p>
+<p>The third variation, the callback, provides the most flexibility, and can be used to connect any data source to Autocomplete. The callback gets two arguments:</p>
+<ul>
+<li>A request object, with a single property called "term", which refers to the value currently in the text input. For example, when the user entered "new yo" in a city field, the Autocomplete term will equal "new yo".</li>
+<li>A response callback, which expects a single argument to contain the data to suggest to the user. This data should be filtered based on the provided term, and can be in any of the formats described above for simple local data (String-Array or Object-Array with label/value/both properties). It's important when providing a custom source callback to handle errors during the request. You must always call the response callback even if you encounter an error. This ensures that the widget always has the correct state.</li>
+</ul>
+<p>The label is always treated as text, if you want the label to be treated as html you can use <a href="https://github.com/scottgonzalez/jquery-ui-extensions/blob/master/autocomplete/jquery.ui.autocomplete.html.js" class="external text" title="https://github.com/scottgonzalez/jquery-ui-extensions/blob/master/autocomplete/jquery.ui.autocomplete.html.js">Scott González' html extension</a>. The demos all focus on different variations of the source-option - look for the one that matches your use case, and take a look at the code.</p>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+<li>UI Position</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="300">
+A simple jQuery UI Autocomplete.<br />
+</p>
+<pre>$(&quot;input#autocomplete&quot;).autocomplete({
+    source: [&quot;c++&quot;, &quot;java&quot;, &quot;php&quot;, &quot;coldfusion&quot;, &quot;javascript&quot;, &quot;asp&quot;, &quot;ruby&quot;]
+});
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;input#autocomplete&quot;).autocomplete({
+    source: [&quot;c++&quot;, &quot;java&quot;, &quot;php&quot;, &quot;coldfusion&quot;, &quot;javascript&quot;, &quot;asp&quot;, &quot;ruby&quot;]
+});
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;input id=&quot;autocomplete&quot; /&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the autocomplete. Can be set when initialising (first creating) the autocomplete.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a autocomplete with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).autocomplete({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).autocomplete( "option", "disabled" );
+//setter
+$( ".selector" ).autocomplete( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-appendTo">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-appendTo">appendTo</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">"body"</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Which element the menu should be appended to.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a autocomplete with the <code>appendTo</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).autocomplete({ appendTo: "#someElem" });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>appendTo</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var appendTo = $( ".selector" ).autocomplete( "option", "appendTo" );
+//setter
+$( ".selector" ).autocomplete( "option", "appendTo", "#someElem" );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-delay">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-delay">delay</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">300</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The delay in milliseconds the Autocomplete waits after a keystroke to activate itself. A zero-delay makes sense for local data (more responsive), but can produce a lot of load for remote data, while being less responsive.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a autocomplete with the <code>delay</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).autocomplete({ delay: 0 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>delay</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var delay = $( ".selector" ).autocomplete( "option", "delay" );
+//setter
+$( ".selector" ).autocomplete( "option", "delay", 0 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-minLength">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-minLength">minLength</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">1</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The minimum number of characters a user has to type before the Autocomplete activates. Zero is useful for local data with just a few items. Should be increased when there are a lot of items, where a single character would match a few thousand items.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a autocomplete with the <code>minLength</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).autocomplete({ minLength: 0 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>minLength</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var minLength = $( ".selector" ).autocomplete( "option", "minLength" );
+//setter
+$( ".selector" ).autocomplete( "option", "minLength", 0 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-position">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-position">position</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Object</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">{ my: &quot;left top&quot;, at: &quot;left bottom&quot;, collision: &quot;none&quot; }</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Identifies the position of the Autocomplete widget in relation to the associated input element. The "of" option defaults to the input element, but you can specify another element to position against. You can refer to the <a href="http://docs.jquery.com/UI/Position" class="external text" title="http://docs.jquery.com/UI/Position">jQuery UI Position</a> utility for more details about the various options.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a autocomplete with the <code>position</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).autocomplete({ position: { my : &quot;right top&quot;, at: &quot;right bottom&quot; } });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>position</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var position = $( ".selector" ).autocomplete( "option", "position" );
+//setter
+$( ".selector" ).autocomplete( "option", "position", { my : &quot;right top&quot;, at: &quot;right bottom&quot; } );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-source">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-source">source</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String, Array, Callback</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">none, must be specified</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Defines the data to use, must be specified. See Overview section for more details, and look at the various demos.
+</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a autocomplete with the <code>source</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).autocomplete({ source: [&quot;c++&quot;, &quot;java&quot;, &quot;php&quot;, &quot;coldfusion&quot;, &quot;javascript&quot;, &quot;asp&quot;, &quot;ruby&quot;] });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>source</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var source = $( ".selector" ).autocomplete( "option", "source" );
+//setter
+$( ".selector" ).autocomplete( "option", "source", [&quot;c++&quot;, &quot;java&quot;, &quot;php&quot;, &quot;coldfusion&quot;, &quot;javascript&quot;, &quot;asp&quot;, &quot;ruby&quot;] );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">autocompletecreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when autocomplete is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).autocomplete({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>autocompletecreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;autocompletecreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-search">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-search">search</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">autocompletesearch</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>Before a request (source-option) is started, after minLength and delay are met. Can be canceled (return false), then no request will be started and no items suggested.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>search</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).autocomplete({
+   search: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>search</code> event by type: <code>autocompletesearch</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;autocompletesearch&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-open">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-open">open</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">autocompleteopen</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>Triggered when the suggestion menu is opened.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>open</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).autocomplete({
+   open: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>open</code> event by type: <code>autocompleteopen</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;autocompleteopen&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-focus">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-focus">focus</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">autocompletefocus</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>Before focus is moved to an item (not selecting), ui.item refers to the focused item. The default action of focus is to replace the text field's value with the value of the focused item, though only if the focus event was triggered by a keyboard interaction. Canceling this event prevents the value from being updated, but does not prevent the menu item from being focused.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>focus</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).autocomplete({
+   focus: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>focus</code> event by type: <code>autocompletefocus</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;autocompletefocus&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-select">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-select">select</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">autocompleteselect</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>Triggered when an item is selected from the menu; ui.item refers to the selected item. The default action of select is to replace the text field's value with the value of the selected item. Canceling this event prevents the value from being updated, but does not prevent the menu from closing.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>select</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).autocomplete({
+   select: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>select</code> event by type: <code>autocompleteselect</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;autocompleteselect&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-close">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-close">close</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">autocompleteclose</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>When the list is hidden - doesn't have to occur together with a change.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>close</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).autocomplete({
+   close: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>close</code> event by type: <code>autocompleteclose</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;autocompleteclose&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-change">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-change">change</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">autocompletechange</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>After an item was selected; ui.item refers to the selected item. Always triggered after the close event.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>change</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).autocomplete({
+   change: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>change</code> event by type: <code>autocompletechange</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;autocompletechange&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the autocomplete functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the autocomplete.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the autocomplete.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any autocomplete option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple autocomplete options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-autocomplete element.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-search">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-search">search</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "search"
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Triggers a search event, which, when data is available, then will display the suggestions; can be used by a selectbox-like button to open the suggestions when clicked. If no value argument is specified, the current input's value is used. Can be called with an empty string and minLength: 0 to display all items.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-close">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-close">close</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.autocomplete( "close"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Close the Autocomplete menu. Useful in combination with the search method, to close the open menu.</p>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Autocomplete plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.autocomplete.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;input class=&quot;ui-autocomplete-input&quot;/&gt;<br />
+&lt;ul class=&quot;ui-autocomplete ui-menu ui-widget ui-widget-content ui-corner-all&quot;&gt;<br />
+&nbsp;&nbsp;&lt;li class=&quot;ui-menu-item&quot;&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;a class=&quot;ui-corner-all&quot;&gt;item 1&lt;/a&gt;<br />
+&nbsp;&nbsp;&lt;/li&gt;<br />
+&nbsp;&nbsp;&lt;li class=&quot;ui-menu-item&quot;&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;a class=&quot;ui-corner-all&quot;&gt;item 2&lt;/a&gt;<br />
+&nbsp;&nbsp;&lt;/li&gt;<br />
+&nbsp;&nbsp;&lt;li class=&quot;ui-menu-item&quot;&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&lt;a class=&quot;ui-corner-all&quot;&gt;item 3&lt;/a&gt;<br />
+&nbsp;&nbsp;&lt;/li&gt;<br />
+&lt;/ul&gt;
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the autocomplete plugin, not markup you should use to create a autocomplete. The only markup needed for that is &lt;input/&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 34461 bytes
+Post-expand include size: 58313 bytes
+Template argument size: 31985 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3766-1!1!0!!en!2 and timestamp 20110315194630 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/button.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,500 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Button</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>Button enhances standard form elements like button, input of type submit or reset or anchors to themable buttons with appropiate mouseover and active styles.</p>
+<p>In addition to basic push buttons, radio buttons and checkboxes (inputs of type radio and checkbox) can be converted to buttons: Their associated label is styled to appear as the button, while the underlying input is updated on click.</p>
+<p>In order to group radio buttons, Button also provides an additional widget-method, called Buttonset. Its used by selecting a container element (which contains the radio buttons) and calling buttonset(). Buttonset will also provide visual grouping, and therefore should be used whenever you have a group of buttons. It works by selecting all descendents and applying button() to them. You can enable and disable a buttonset, which will enable and disable all contained buttons. Destroying a buttonset also calls the button's destroy method.</p>
+<p>When using an input of type button, submit or reset, support is limited to plain text labels with no icons.</p>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="300">
+A simple jQuery UI Button.<br />
+</p>
+<pre>$(&quot;button&quot;).button();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;button&quot;).button();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;button&gt;Button label&lt;/button&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+<div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<div id="demo" class="tabs-container" rel="300">
+A simple jQuery UI Button.<br />
+</p>
+<pre>$(&quot;#radio&quot;).buttonset();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#radio&quot;).buttonset();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;div id=&quot;radio&quot;&gt;
+	&lt;input type=&quot;radio&quot; id=&quot;radio1&quot; name=&quot;radio&quot; /&gt;&lt;label for=&quot;radio1&quot;&gt;Choice 1&lt;/label&gt;
+	&lt;input type=&quot;radio&quot; id=&quot;radio2&quot; name=&quot;radio&quot; checked=&quot;checked&quot; /&gt;&lt;label for=&quot;radio2&quot;&gt;Choice 2&lt;/label&gt;
+	&lt;input type=&quot;radio&quot; id=&quot;radio3&quot; name=&quot;radio&quot; /&gt;&lt;label for=&quot;radio3&quot;&gt;Choice 3&lt;/label&gt;
+&lt;/div&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the button. Can be set when initialising (first creating) the button.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a button with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).button({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).button( "option", "disabled" );
+//setter
+$( ".selector" ).button( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-text">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-text">text</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Whether to show any text - when set to false (display no text), icons (see icons option) must be enabled, otherwise it'll be ignored.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a button with the <code>text</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).button({ text: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>text</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var text = $( ".selector" ).button( "option", "text" );
+//setter
+$( ".selector" ).button( "option", "text", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-icons">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-icons">icons</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Options</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">{ primary: null, secondary: null }</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Icons to display, with or without text (see text option). The primary icon is displayed by default on the left of the label text, the secondary by default is on the right. Value for the primary and secondary properties must be a classname (String), eg. "ui-icon-gear". For using only one icon: icons: {primary:'ui-icon-locked'}. For using two icons: icons: {primary:'ui-icon-gear',secondary:'ui-icon-triangle-1-s'}</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a button with the <code>icons</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).button({ icons: {primary:'ui-icon-gear',secondary:'ui-icon-triangle-1-s'} });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>icons</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var icons = $( ".selector" ).button( "option", "icons" );
+//setter
+$( ".selector" ).button( "option", "icons", {primary:'ui-icon-gear',secondary:'ui-icon-triangle-1-s'} );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-label">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-label">label</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">HTML content of the button, or value attribute</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Text to show on the button. When not specified (null), the element's html content is used, or its value attribute when it's an input element of type submit or reset; or the html content of the associated label element if its an input of type radio or checkbox</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a button with the <code>label</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).button({ label: "custom label" });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>label</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var label = $( ".selector" ).button( "option", "label" );
+//setter
+$( ".selector" ).button( "option", "label", "custom label" );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">buttoncreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when button is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).button({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>buttoncreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;buttoncreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+</p>
+<p>There are no events for this plugin.</p>
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.button( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the button functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+<p>
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.button( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the button.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.button( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the button.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.button( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any button option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.button( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple button options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.button( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-button element.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-refresh">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-refresh">refresh</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.button( "refresh"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Refreshes the visual state of the button. Useful for updating button state after the native element's checked or disabled state is changed programatically.</p>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Button plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.button.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;button class=&quot;<strong>ui-button ui-button-text-only</strong> ui-widget ui-state-default ui-corner-all&quot;&gt;<br />
+&nbsp;&nbsp;&nbsp;&lt;span class=&quot;<strong>ui-button-text</strong>&quot;&gt;Button Label&lt;/span&gt;<br />&lt;/button&gt;
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the button plugin, not markup you should use to create a button. The only markup needed for that is &lt;button&gt;Button Label&lt;/button&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 24542 bytes
+Post-expand include size: 31799 bytes
+Template argument size: 14018 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3767-1!1!0!!en!2 and timestamp 20110315194630 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/dialog.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1698 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Dialog</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>A dialog is a floating window that contains a title bar and a content area. The dialog window can be moved, resized and closed with the 'x' icon by default.</p>
+<p>If the content length exceeds the maximum height, a scrollbar will automatically appear.</p>
+<p>A bottom button bar and semi-transparent modal overlay layer are common options that can be added.</p>
+<p>A call to <code>$(foo).dialog()</code> will initialize a dialog instance and will auto-open the dialog by default. If you want to reuse a dialog, the easiest way is to disable the "auto-open" option with: <code>$(foo).dialog({ autoOpen: false })</code> and open it with <code>$(foo).dialog('open')</code>. To close it, use <code>$(foo).dialog('close')</code>. A more in-depth explanation with a full demo is available on <a href="http://blog.nemikor.com/2009/04/08/basic-usage-of-the-jquery-ui-dialog/" class="external text" title="http://blog.nemikor.com/2009/04/08/basic-usage-of-the-jquery-ui-dialog/">the Nemikor blog</a>.</p>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Position</li>
+<li>UI Widget</li>
+<li>UI Mouse (Optional; only needed if using UI Draggable or UI Resizable)</li>
+<li>UI Draggable (Optional)</li>
+<li>UI Resizable (Optional)</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="300">
+A simple jQuery UI Dialog.<br />
+</p>
+<pre>$(&quot;#dialog&quot;).dialog();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#dialog&quot;).dialog();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;div id=&quot;dialog&quot; title=&quot;Dialog Title&quot;&gt;I'm in a dialog&lt;/div&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the dialog. Can be set when initialising (first creating) the dialog.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).dialog( "option", "disabled" );
+//setter
+$( ".selector" ).dialog( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-autoOpen">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-autoOpen">autoOpen</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>When <i>autoOpen</i> is <i>true</i> the dialog will open automatically when <i>dialog</i> is called. If <i>false</i> it will stay hidden until <i>.dialog("open")</i> is called on it.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>autoOpen</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ autoOpen: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>autoOpen</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var autoOpen = $( ".selector" ).dialog( "option", "autoOpen" );
+//setter
+$( ".selector" ).dialog( "option", "autoOpen", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-buttons">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-buttons">buttons</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Object</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">{ }</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies which buttons should be displayed on the dialog. The property key is the text of the button. The value is the callback function for when the button is clicked.  The context of the callback is the dialog element; if you need access to the button, it is available as the target of the event object.
+</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>buttons</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ buttons: { &quot;Ok&quot;: function() { $(this).dialog(&quot;close&quot;); } } });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>buttons</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var buttons = $( ".selector" ).dialog( "option", "buttons" );
+//setter
+$( ".selector" ).dialog( "option", "buttons", { &quot;Ok&quot;: function() { $(this).dialog(&quot;close&quot;); } } );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-buttons">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-buttons">buttons</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Array</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">[ ]</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies which buttons should be displayed on the dialog. Each element of the array must be an Object defining the properties to set on the button.
+</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>buttons</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ buttons: [
+    {
+        text: &quot;Ok&quot;,
+        click: function() { $(this).dialog(&quot;close&quot;); }
+    }
+] });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>buttons</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var buttons = $( ".selector" ).dialog( "option", "buttons" );
+//setter
+$( ".selector" ).dialog( "option", "buttons", [
+    {
+        text: &quot;Ok&quot;,
+        click: function() { $(this).dialog(&quot;close&quot;); }
+    }
+] );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-closeOnEscape">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-closeOnEscape">closeOnEscape</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies whether the dialog should close when it has focus and the user presses the esacpe (ESC) key.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>closeOnEscape</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ closeOnEscape: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>closeOnEscape</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var closeOnEscape = $( ".selector" ).dialog( "option", "closeOnEscape" );
+//setter
+$( ".selector" ).dialog( "option", "closeOnEscape", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-closeText">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-closeText">closeText</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'close'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies the text for the close button. Note that the close text is visibly hidden when using a standard theme.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>closeText</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ closeText: 'hide' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>closeText</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var closeText = $( ".selector" ).dialog( "option", "closeText" );
+//setter
+$( ".selector" ).dialog( "option", "closeText", 'hide' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-dialogClass">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-dialogClass">dialogClass</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">''</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The specified class name(s) will be added to the dialog, for additional theming.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>dialogClass</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ dialogClass: 'alert' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>dialogClass</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var dialogClass = $( ".selector" ).dialog( "option", "dialogClass" );
+//setter
+$( ".selector" ).dialog( "option", "dialogClass", 'alert' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-draggable">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-draggable">draggable</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, the dialog will be draggable will be draggable by the titlebar.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>draggable</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ draggable: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>draggable</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var draggable = $( ".selector" ).dialog( "option", "draggable" );
+//setter
+$( ".selector" ).dialog( "option", "draggable", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-height">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-height">height</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Number</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'auto'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The height of the dialog, in pixels. Specifying 'auto' is also supported to make the dialog adjust based on its content.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>height</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ height: 530 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>height</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var height = $( ".selector" ).dialog( "option", "height" );
+//setter
+$( ".selector" ).dialog( "option", "height", 530 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-hide">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-hide">hide</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">null</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The effect to be used when the dialog is closed.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>hide</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ hide: 'slide' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>hide</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var hide = $( ".selector" ).dialog( "option", "hide" );
+//setter
+$( ".selector" ).dialog( "option", "hide", 'slide' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-maxHeight">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-maxHeight">maxHeight</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Number</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The maximum height to which the dialog can be resized, in pixels.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>maxHeight</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ maxHeight: 400 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>maxHeight</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var maxHeight = $( ".selector" ).dialog( "option", "maxHeight" );
+//setter
+$( ".selector" ).dialog( "option", "maxHeight", 400 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-maxWidth">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-maxWidth">maxWidth</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Number</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The maximum width to which the dialog can be resized, in pixels.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>maxWidth</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ maxWidth: 600 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>maxWidth</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var maxWidth = $( ".selector" ).dialog( "option", "maxWidth" );
+//setter
+$( ".selector" ).dialog( "option", "maxWidth", 600 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-minHeight">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-minHeight">minHeight</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Number</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">150</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The minimum height to which the dialog can be resized, in pixels.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>minHeight</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ minHeight: 300 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>minHeight</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var minHeight = $( ".selector" ).dialog( "option", "minHeight" );
+//setter
+$( ".selector" ).dialog( "option", "minHeight", 300 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-minWidth">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-minWidth">minWidth</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Number</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">150</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The minimum width to which the dialog can be resized, in pixels.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>minWidth</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ minWidth: 400 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>minWidth</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var minWidth = $( ".selector" ).dialog( "option", "minWidth" );
+//setter
+$( ".selector" ).dialog( "option", "minWidth", 400 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-modal">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-modal">modal</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, the dialog will have modal behavior; other items on the page will be disabled (i.e. cannot be interacted with). Modal dialogs create an overlay below the dialog but above other page elements.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>modal</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ modal: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>modal</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var modal = $( ".selector" ).dialog( "option", "modal" );
+//setter
+$( ".selector" ).dialog( "option", "modal", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-position">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-position">position</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String, Array</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'center'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies where the dialog should be displayed. Possible values: <br />1) a single string representing position within viewport: 'center', 'left', 'right', 'top', 'bottom'. <br />2) an array containing an <em>x,y</em> coordinate pair in pixel offset from left, top corner of viewport (e.g. [350,100]) <br />3) an array containing <em>x,y</em> position string values (e.g. ['right','top'] for top right corner).</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>position</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ position: 'top' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>position</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var position = $( ".selector" ).dialog( "option", "position" );
+//setter
+$( ".selector" ).dialog( "option", "position", 'top' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-resizable">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-resizable">resizable</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, the dialog will be resizeable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>resizable</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ resizable: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>resizable</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var resizable = $( ".selector" ).dialog( "option", "resizable" );
+//setter
+$( ".selector" ).dialog( "option", "resizable", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-show">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-show">show</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">null</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The effect to be used when the dialog is opened.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>show</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ show: 'slide' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>show</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var show = $( ".selector" ).dialog( "option", "show" );
+//setter
+$( ".selector" ).dialog( "option", "show", 'slide' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-stack">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-stack">stack</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies whether the dialog will stack on top of other dialogs. This will cause the dialog to move to the front of other dialogs when it gains focus.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>stack</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ stack: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>stack</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var stack = $( ".selector" ).dialog( "option", "stack" );
+//setter
+$( ".selector" ).dialog( "option", "stack", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-title">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-title">title</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">''</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies the title of the dialog. Any valid HTML may be set as the title. The title can also be specified by the title attribute on the dialog source element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>title</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ title: 'Dialog Title' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>title</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var title = $( ".selector" ).dialog( "option", "title" );
+//setter
+$( ".selector" ).dialog( "option", "title", 'Dialog Title' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-width">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-width">width</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Number</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">300</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The width of the dialog, in pixels.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>width</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ width: 460 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>width</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var width = $( ".selector" ).dialog( "option", "width" );
+//setter
+$( ".selector" ).dialog( "option", "width", 460 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-zIndex">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-zIndex">zIndex</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">1000</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The starting z-index for the dialog.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a dialog with the <code>zIndex</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).dialog({ zIndex: 3999 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>zIndex</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var zIndex = $( ".selector" ).dialog( "option", "zIndex" );
+//setter
+$( ".selector" ).dialog( "option", "zIndex", 3999 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogcreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when dialog is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>dialogcreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogcreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-beforeClose">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-beforeClose">beforeClose</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogbeforeclose</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when a dialog attempts to close. If the beforeClose event handler (callback function) returns false, the close will be prevented.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>beforeClose</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   beforeClose: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>beforeClose</code> event by type: <code>dialogbeforeclose</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogbeforeclose&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-open">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-open">open</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogopen</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when dialog is opened.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>open</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   open: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>open</code> event by type: <code>dialogopen</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogopen&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-focus">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-focus">focus</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogfocus</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when the dialog gains focus.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>focus</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   focus: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>focus</code> event by type: <code>dialogfocus</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogfocus&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-dragStart">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-dragStart">dragStart</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogdragstart</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the beginning of the dialog being dragged.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>dragStart</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   dragStart: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>dragStart</code> event by type: <code>dialogdragstart</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogdragstart&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-drag">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-drag">drag</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogdrag</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when the dialog is dragged.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>drag</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   drag: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>drag</code> event by type: <code>dialogdrag</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogdrag&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-dragStop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-dragStop">dragStop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogdragstop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered after the dialog has been dragged.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>dragStop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   dragStop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>dragStop</code> event by type: <code>dialogdragstop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogdragstop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-resizeStart">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-resizeStart">resizeStart</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogresizestart</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the beginning of the dialog being resized.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>resizeStart</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   resizeStart: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>resizeStart</code> event by type: <code>dialogresizestart</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogresizestart&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-resize">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-resize">resize</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogresize</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when the dialog is resized. <a href="http://www.jsfiddle.net/Jp7TM/18/" class="external text" title="http://www.jsfiddle.net/Jp7TM/18/">demo</a></p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>resize</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   resize: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>resize</code> event by type: <code>dialogresize</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogresize&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-resizeStop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-resizeStop">resizeStop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogresizestop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered after the dialog has been resized.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>resizeStop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   resizeStop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>resizeStop</code> event by type: <code>dialogresizestop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogresizestop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-close">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-close">close</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dialogclose</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when the dialog is closed.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>close</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).dialog({
+   close: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>close</code> event by type: <code>dialogclose</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dialogclose&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the dialog functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the dialog.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the dialog.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any dialog option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple dialog options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-dialog element.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-close">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-close">close</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "close"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Close the dialog.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-isOpen">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-isOpen">isOpen</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "isOpen"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns true if the dialog is currently open.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-moveToTop">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-moveToTop">moveToTop</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "moveToTop"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Move the dialog to the top of the dialogs stack.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-open">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-open">open</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.dialog( "open"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Open the dialog.</p>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Dialog plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.dialog.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;div class=&quot;<strong>ui-dialog</strong> ui-widget ui-widget-content ui-corner-all ui-draggable ui-resizable&quot;&gt;<br />
+&nbsp;&nbsp;&nbsp;&lt;div class=&quot;<strong>ui-dialog-titlebar</strong> ui-widget-header ui-corner-all ui-helper-clearfix&quot;&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&lt;span id=&quot;<strong>ui-dialog-title-dialog</strong>&quot; class=&quot;ui-dialog-title&quot;&gt;Dialog title&lt;/span&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&lt;a class=&quot;<strong>ui-dialog-titlebar-close</strong> ui-corner-all&quot; href=&quot;#&quot;&gt;&lt;span class=&quot;ui-icon ui-icon-closethick&quot;&gt;close&lt;/span&gt;&lt;/a&gt;<br />
+&nbsp;&nbsp;&nbsp;&lt;/div&gt;<br />
+&nbsp;&nbsp;&nbsp;&lt;div style=&quot;height: 200px; min-height: 109px; width: auto;&quot; class=&quot;<strong>ui-dialog-content</strong> ui-widget-content&quot; id=&quot;dialog&quot;&gt;<br />
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&lt;p&gt;Dialog content goes here.&lt;/p&gt;<br />
+&nbsp;&nbsp;&nbsp;&lt;/div&gt;<br />
+&lt;/div&gt;<br />
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the dialog plugin, not markup you should use to create a dialog. The only markup needed for that is &lt;div&gt;&lt;/div&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 66595 bytes
+Post-expand include size: 113099 bytes
+Template argument size: 62032 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3775-1!1!0!!en!2 and timestamp 20110315194523 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/draggable.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1577 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Draggable</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>The jQuery UI Draggable plugin makes selected elements draggable by mouse.</p>
+<p>Draggable elements gets a class of <code>ui-draggable</code>. During drag the element also gets a class of <code>ui-draggable-dragging</code>. If you want not just drag, but drag-and-drop, see the jQuery UI Droppable plugin, which provides a drop target for draggables.</p>
+<p>All callbacks (start, stop, drag) receive two arguments: The original browser event and a prepared ui object, view below for a documentation of this object (if you name your second argument 'ui'):</p>
+<ul>
+<li><b>ui.helper</b> - the jQuery object representing the helper that's being dragged</li>
+<li><b>ui.position</b> - current position of the helper as { top, left } object, relative to the offset element</li>
+<li><b>ui.offset</b> - current absolute position of the helper as { top, left } object, relative to page</li>
+</ul>
+<p><br />
+</p>
+<p>To manipulate the position of a draggable during drag, you can either <a href="http://jsbin.com/etako/edit" class="external text" title="http://jsbin.com/etako/edit">use a wrapper as the draggable helper</a> and position the wrapped element with absolute positioning, or  you can correct internal values like so: <code>$(this).data('draggable').offset.click.top -= x</code>.</p>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+<li>UI Mouse</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="170">
+Initialize a draggable with default options.<br />
+</p>
+<pre>$(&quot;#draggable&quot;).draggable();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  &lt;style type=&quot;text/css&quot;&gt;
+    #draggable { width: 100px; height: 70px; background: silver; }
+  &lt;/style&gt;
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#draggable&quot;).draggable();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;div id=&quot;draggable&quot;&gt;Drag me&lt;/div&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the draggable. Can be set when initialising (first creating) the draggable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).draggable( "option", "disabled" );
+//setter
+$( ".selector" ).draggable( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-addClasses">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-addClasses">addClasses</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to false, will prevent the <code>ui-draggable</code> class from being added. This may be desired as a performance optimization when calling <code>.draggable()</code> init on many hundreds of elements.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>addClasses</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ addClasses: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>addClasses</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var addClasses = $( ".selector" ).draggable( "option", "addClasses" );
+//setter
+$( ".selector" ).draggable( "option", "addClasses", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-appendTo">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-appendTo">appendTo</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Element, Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'parent'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The element passed to or selected by the <code>appendTo</code> option will be used as the draggable helper's container during dragging. By default, the helper is appended to the same container as the draggable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>appendTo</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ appendTo: 'body' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>appendTo</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var appendTo = $( ".selector" ).draggable( "option", "appendTo" );
+//setter
+$( ".selector" ).draggable( "option", "appendTo", 'body' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-axis">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-axis">axis</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Constrains dragging to either the horizontal (x) or vertical (y) axis. Possible values: 'x', 'y'.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>axis</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ axis: 'x' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>axis</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var axis = $( ".selector" ).draggable( "option", "axis" );
+//setter
+$( ".selector" ).draggable( "option", "axis", 'x' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cancel">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cancel">cancel</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">':input,option'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Prevents dragging from starting on specified elements.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>cancel</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ cancel: 'button' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cancel</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cancel = $( ".selector" ).draggable( "option", "cancel" );
+//setter
+$( ".selector" ).draggable( "option", "cancel", 'button' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-connectToSortable">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-connectToSortable">connectToSortable</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Allows the draggable to be dropped onto the specified sortables. If this option is used (<code>helper</code> must be set to 'clone' in order to work flawlessly), a draggable can be dropped onto a sortable list and then becomes part of it.
+</p><p>Note: Specifying this option as an array of selectors has been removed.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>connectToSortable</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ connectToSortable: 'ul#myList' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>connectToSortable</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var connectToSortable = $( ".selector" ).draggable( "option", "connectToSortable" );
+//setter
+$( ".selector" ).draggable( "option", "connectToSortable", 'ul#myList' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-containment">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-containment">containment</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector, Element, String, Array</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Constrains dragging to within the bounds of the specified element or region. Possible string values: 'parent', 'document', 'window', [x1, y1, x2, y2].</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>containment</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ containment: 'parent' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>containment</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var containment = $( ".selector" ).draggable( "option", "containment" );
+//setter
+$( ".selector" ).draggable( "option", "containment", 'parent' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cursor">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cursor">cursor</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'auto'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The css cursor during the drag operation.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>cursor</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ cursor: 'crosshair' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cursor</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cursor = $( ".selector" ).draggable( "option", "cursor" );
+//setter
+$( ".selector" ).draggable( "option", "cursor", 'crosshair' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cursorAt">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cursorAt">cursorAt</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Object</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Sets the offset of the dragging helper relative to the mouse cursor. Coordinates can be given as a hash using a combination of one or two keys: <code>{ top, left, right, bottom }</code>.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>cursorAt</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ cursorAt: { left: 5 } });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cursorAt</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cursorAt = $( ".selector" ).draggable( "option", "cursorAt" );
+//setter
+$( ".selector" ).draggable( "option", "cursorAt", { left: 5 } );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-delay">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-delay">delay</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">0</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Time in milliseconds after mousedown until dragging should start. This option can be used to prevent unwanted drags when clicking on an element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>delay</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ delay: 500 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>delay</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var delay = $( ".selector" ).draggable( "option", "delay" );
+//setter
+$( ".selector" ).draggable( "option", "delay", 500 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-distance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-distance">distance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">1</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Distance in pixels after mousedown the mouse must move before dragging should start. This option can be used to prevent unwanted drags when clicking on an element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>distance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ distance: 30 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>distance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var distance = $( ".selector" ).draggable( "option", "distance" );
+//setter
+$( ".selector" ).draggable( "option", "distance", 30 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-grid">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-grid">grid</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Array</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Snaps the dragging helper to a grid, every x and y pixels. Array values: [x, y]</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>grid</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ grid: [50, 20] });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>grid</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var grid = $( ".selector" ).draggable( "option", "grid" );
+//setter
+$( ".selector" ).draggable( "option", "grid", [50, 20] );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-handle">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-handle">handle</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Element, Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If specified, restricts drag start click to the specified element(s).</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>handle</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ handle: 'h2' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>handle</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var handle = $( ".selector" ).draggable( "option", "handle" );
+//setter
+$( ".selector" ).draggable( "option", "handle", 'h2' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-helper">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-helper">helper</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String, Function</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'original'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Allows for a helper element to be used for dragging display. Possible values: 'original', 'clone', Function. If a function is specified, it must return a DOMElement.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>helper</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ helper: 'clone' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>helper</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var helper = $( ".selector" ).draggable( "option", "helper" );
+//setter
+$( ".selector" ).draggable( "option", "helper", 'clone' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-iframeFix">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-iframeFix">iframeFix</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean, Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Prevent iframes from capturing the mousemove events during a drag. Useful in combination with cursorAt, or in any case, if the mouse cursor is not over the helper. If set to true, transparent overlays will be placed over all iframes on the page. If a selector is supplied, the matched iframes will have an overlay placed over them.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>iframeFix</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ iframeFix: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>iframeFix</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var iframeFix = $( ".selector" ).draggable( "option", "iframeFix" );
+//setter
+$( ".selector" ).draggable( "option", "iframeFix", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-opacity">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-opacity">opacity</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Float</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Opacity for the helper while being dragged.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>opacity</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ opacity: 0.35 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>opacity</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var opacity = $( ".selector" ).draggable( "option", "opacity" );
+//setter
+$( ".selector" ).draggable( "option", "opacity", 0.35 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-refreshPositions">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-refreshPositions">refreshPositions</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, all droppable positions are calculated on every mousemove. Caution: This solves issues on highly dynamic pages, but dramatically decreases performance.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>refreshPositions</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ refreshPositions: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>refreshPositions</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var refreshPositions = $( ".selector" ).draggable( "option", "refreshPositions" );
+//setter
+$( ".selector" ).draggable( "option", "refreshPositions", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-revert">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-revert">revert</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean, String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, the element will return to its start position when dragging stops. Possible string values: 'valid', 'invalid'. If set to invalid, revert will only occur if the draggable has not been dropped on a droppable. For valid, it's the other way around.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>revert</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ revert: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>revert</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var revert = $( ".selector" ).draggable( "option", "revert" );
+//setter
+$( ".selector" ).draggable( "option", "revert", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-revertDuration">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-revertDuration">revertDuration</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">500</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The duration of the revert animation, in milliseconds. Ignored if revert is false.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>revertDuration</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ revertDuration: 1000 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>revertDuration</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var revertDuration = $( ".selector" ).draggable( "option", "revertDuration" );
+//setter
+$( ".selector" ).draggable( "option", "revertDuration", 1000 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scope">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scope">scope</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'default'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Used to group sets of draggable and droppable items, in addition to droppable's accept option. A draggable with the same scope value as a droppable will be accepted by the droppable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>scope</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ scope: 'tasks' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scope</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scope = $( ".selector" ).draggable( "option", "scope" );
+//setter
+$( ".selector" ).draggable( "option", "scope", 'tasks' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scroll">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scroll">scroll</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, container auto-scrolls while dragging.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>scroll</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ scroll: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scroll</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scroll = $( ".selector" ).draggable( "option", "scroll" );
+//setter
+$( ".selector" ).draggable( "option", "scroll", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scrollSensitivity">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scrollSensitivity">scrollSensitivity</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">20</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Distance in pixels from the edge of the viewport after which the viewport should scroll. Distance is relative to pointer, not the draggable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>scrollSensitivity</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ scrollSensitivity: 40 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scrollSensitivity</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scrollSensitivity = $( ".selector" ).draggable( "option", "scrollSensitivity" );
+//setter
+$( ".selector" ).draggable( "option", "scrollSensitivity", 40 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scrollSpeed">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scrollSpeed">scrollSpeed</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">20</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The speed at which the window should scroll once the mouse pointer gets within the <code>scrollSensitivity</code> distance.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>scrollSpeed</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ scrollSpeed: 40 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scrollSpeed</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scrollSpeed = $( ".selector" ).draggable( "option", "scrollSpeed" );
+//setter
+$( ".selector" ).draggable( "option", "scrollSpeed", 40 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-snap">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-snap">snap</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean, Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to a selector or to true (equivalent to '.ui-draggable'), the draggable will snap to the edges of the selected elements when near an edge of the element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>snap</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ snap: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>snap</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var snap = $( ".selector" ).draggable( "option", "snap" );
+//setter
+$( ".selector" ).draggable( "option", "snap", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-snapMode">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-snapMode">snapMode</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'both'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Determines which edges of snap elements the draggable will snap to. Ignored if snap is false. Possible values: 'inner', 'outer', 'both'</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>snapMode</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ snapMode: 'outer' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>snapMode</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var snapMode = $( ".selector" ).draggable( "option", "snapMode" );
+//setter
+$( ".selector" ).draggable( "option", "snapMode", 'outer' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-snapTolerance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-snapTolerance">snapTolerance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">20</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The distance in pixels from the snap element edges at which snapping should occur. Ignored if snap is false.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>snapTolerance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ snapTolerance: 40 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>snapTolerance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var snapTolerance = $( ".selector" ).draggable( "option", "snapTolerance" );
+//setter
+$( ".selector" ).draggable( "option", "snapTolerance", 40 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-stack">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-stack">stack</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Controls the z-Index of the set of elements that match the selector, always brings to front the dragged item. Very useful in things like window managers.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>stack</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ stack: &quot;.products&quot; });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>stack</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var stack = $( ".selector" ).draggable( "option", "stack" );
+//setter
+$( ".selector" ).draggable( "option", "stack", &quot;.products&quot; );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-zIndex">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-zIndex">zIndex</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>z-index for the helper while being dragged.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a draggable with the <code>zIndex</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).draggable({ zIndex: 2700 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>zIndex</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var zIndex = $( ".selector" ).draggable( "option", "zIndex" );
+//setter
+$( ".selector" ).draggable( "option", "zIndex", 2700 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dragcreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when draggable is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).draggable({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>dragcreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dragcreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-start">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-start">start</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dragstart</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when dragging starts.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>start</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).draggable({
+   start: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>start</code> event by type: <code>dragstart</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dragstart&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-drag">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-drag">drag</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">drag</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when the mouse is moved during the dragging.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>drag</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).draggable({
+   drag: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>drag</code> event by type: <code>drag</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;drag&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-stop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-stop">stop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dragstop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when dragging stops.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>stop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).draggable({
+   stop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>stop</code> event by type: <code>dragstop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dragstop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.draggable( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the draggable functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.draggable( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the draggable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.draggable( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the draggable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.draggable( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any draggable option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.draggable( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple draggable options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.draggable( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-draggable element.</p>
+  </div>
+</li>
+
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Draggable plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.draggable.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;div class=&quot;<strong>ui-draggable</strong>&quot;&gt;&lt;/div&gt;
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the draggable plugin, not markup you should use to create a draggable. The only markup needed for that is &lt;div&gt;&lt;/div&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 61392 bytes
+Post-expand include size: 107565 bytes
+Template argument size: 58710 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3768-1!1!0!!en!2 and timestamp 20110315194328 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/droppable.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,829 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Droppable</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>The jQuery UI Droppable plugin makes selected elements droppable (meaning they accept being dropped on by draggables). You can specify which (individually) or which kind of draggables each will accept.</p>
+<p>All callbacks receive two arguments: The original browser event and a prepared ui object, view below for a documentation of this object (if you name your second argument 'ui'):</p>
+<ul>
+ <li> <b>ui.draggable</b> - current draggable element, a jQuery object.</li>
+ <li> <b>ui.helper</b> - current draggable helper, a jQuery object</li>
+ <li> <b>ui.position</b> - current position of the draggable helper { top: , left: }</li>
+ <li> <b>ui.offset</b> - current absolute position of the draggable helper { top: , left: }</li>
+</ul>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+<li>UI Mouse</li>
+<li><a href="http://docs.jquery.com/UI/Draggable" title="UI/Draggable">UI Draggable</a></li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="100">
+Makes the div droppable (a drop target for a draggable).<br />
+</p>
+<pre>$(&quot;#draggable&quot;).draggable();
+    $(&quot;#droppable&quot;).droppable({
+      drop: function() { alert('dropped'); }
+    });
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  &lt;style type=&quot;text/css&quot;&gt;
+    #draggable { width: 75px; height: 25px; background: silver; padding: 10px; }
+    #droppable { position: absolute; left: 250px; top: 0; width: 125px; height: 75px; background: gray; color: white; padding: 10px; }
+  &lt;/style&gt;
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#draggable&quot;).draggable();
+    $(&quot;#droppable&quot;).droppable({
+      drop: function() { alert('dropped'); }
+    });
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;div id=&quot;droppable&quot;&gt;Drop here&lt;/div&gt;
+&lt;div id=&quot;draggable&quot;&gt;Drag me&lt;/div&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the droppable. Can be set when initialising (first creating) the droppable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).droppable( "option", "disabled" );
+//setter
+$( ".selector" ).droppable( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-accept">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-accept">accept</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector, Function</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'*'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>All draggables that match the selector will be accepted. If a function is specified, the function will be called for each draggable on the page (passed as the first argument to the function), to provide a custom filter. The function should return true if the draggable should be accepted.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>accept</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ accept: '.special' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>accept</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var accept = $( ".selector" ).droppable( "option", "accept" );
+//setter
+$( ".selector" ).droppable( "option", "accept", '.special' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-activeClass">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-activeClass">activeClass</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If specified, the class will be added to the droppable while an acceptable draggable is being dragged.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>activeClass</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ activeClass: 'ui-state-highlight' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>activeClass</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var activeClass = $( ".selector" ).droppable( "option", "activeClass" );
+//setter
+$( ".selector" ).droppable( "option", "activeClass", 'ui-state-highlight' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-addClasses">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-addClasses">addClasses</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to false, will prevent the ui-droppable class from being added. This may be desired as a performance optimization when calling .droppable() init on many hundreds of elements.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>addClasses</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ addClasses: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>addClasses</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var addClasses = $( ".selector" ).droppable( "option", "addClasses" );
+//setter
+$( ".selector" ).droppable( "option", "addClasses", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-greedy">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-greedy">greedy</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If true, will prevent event propagation on nested droppables.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>greedy</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ greedy: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>greedy</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var greedy = $( ".selector" ).droppable( "option", "greedy" );
+//setter
+$( ".selector" ).droppable( "option", "greedy", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-hoverClass">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-hoverClass">hoverClass</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If specified, the class will be added to the droppable while an acceptable draggable is being hovered.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>hoverClass</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ hoverClass: 'drophover' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>hoverClass</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var hoverClass = $( ".selector" ).droppable( "option", "hoverClass" );
+//setter
+$( ".selector" ).droppable( "option", "hoverClass", 'drophover' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scope">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scope">scope</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'default'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Used to group sets of draggable and droppable items, in addition to droppable's accept option. A draggable with the same scope value as a droppable will be accepted.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>scope</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ scope: 'tasks' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scope</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scope = $( ".selector" ).droppable( "option", "scope" );
+//setter
+$( ".selector" ).droppable( "option", "scope", 'tasks' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-tolerance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-tolerance">tolerance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'intersect'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies which mode to use for testing whether a draggable is 'over' a droppable. Possible values: 'fit', 'intersect', 'pointer', 'touch'.
+</p>
+<ul>
+<li><b>fit</b>: draggable overlaps the droppable entirely</li>
+<li><b>intersect</b>: draggable overlaps the droppable at least 50%</li>
+<li><b>pointer</b>: mouse pointer overlaps the droppable</li>
+<li><b>touch</b>: draggable overlaps the droppable any amount</li>
+</ul>
+<p></p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a droppable with the <code>tolerance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).droppable({ tolerance: 'fit' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>tolerance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var tolerance = $( ".selector" ).droppable( "option", "tolerance" );
+//setter
+$( ".selector" ).droppable( "option", "tolerance", 'fit' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dropcreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when droppable is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).droppable({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>dropcreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dropcreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-activate">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-activate">activate</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dropactivate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered any time an accepted draggable starts dragging. This can be useful if you want to make the droppable 'light up' when it can be dropped on.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>activate</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).droppable({
+   activate: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>activate</code> event by type: <code>dropactivate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dropactivate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-deactivate">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-deactivate">deactivate</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dropdeactivate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered any time an accepted draggable stops dragging.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>deactivate</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).droppable({
+   deactivate: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>deactivate</code> event by type: <code>dropdeactivate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dropdeactivate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-over">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-over">over</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dropover</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered as an accepted draggable is dragged 'over' (within the tolerance of) this droppable.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>over</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).droppable({
+   over: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>over</code> event by type: <code>dropover</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dropover&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-out">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-out">out</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">dropout</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when an accepted draggable is dragged out (within the tolerance of) this droppable.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>out</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).droppable({
+   out: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>out</code> event by type: <code>dropout</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;dropout&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-drop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-drop">drop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">drop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when an accepted draggable is dropped 'over' (within the tolerance of) this droppable. In the callback, $(this) represents the droppable the draggable is dropped on.
+ui.draggable represents the draggable.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>drop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).droppable({
+   drop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>drop</code> event by type: <code>drop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;drop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.droppable( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the droppable functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.droppable( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the droppable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.droppable( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the droppable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.droppable( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any droppable option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.droppable( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple droppable options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.droppable( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-droppable element.</p>
+  </div>
+</li>
+
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Droppable plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.droppable.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;div class=&quot;<strong>ui-droppable</strong>&quot;&gt;&lt;/div&gt;
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the droppable plugin, not markup you should use to create a droppable. The only markup needed for that is &lt;div&gt;&lt;/div&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 33718 bytes
+Post-expand include size: 53508 bytes
+Template argument size: 26843 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3769-1!1!0!!en!2 and timestamp 20110315194340 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/position.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,227 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Arguments</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Position Utility</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>Utility script for positioning any widget relative to the window, document, a particular element, or the cursor/mouse.</p>
+<p><em>Note: jQuery UI does not support positioning hidden elements.</em></p>
+<p>Does not need ui.core.js or effects.core.js.</p>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li><i>none (only jQuery core)</i></li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="300">
+Clicking on the green element transfers to the other.<br />
+</p>
+<pre>
+$(&quot;#position1&quot;).position({
+  my: &quot;center&quot;,
+  at: &quot;center&quot;,
+  of: &quot;#targetElement&quot;
+});
+$(&quot;#position2&quot;).position({
+  my: &quot;left top&quot;,
+  at: &quot;left top&quot;,
+  of: &quot;#targetElement&quot;
+});
+$(&quot;#position3&quot;).position({
+  my: &quot;right center&quot;,
+  at: &quot;right bottom&quot;,
+  of: &quot;#targetElement&quot;
+});
+$(document).mousemove(function(ev){
+  $(&quot;#position4&quot;).position({
+    my: &quot;left bottom&quot;,
+    of: ev,
+    offset: &quot;3 -3&quot;,
+    collision: &quot;fit&quot;
+  });
+});
+
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  &lt;style type=&quot;text/css&quot;&gt;
+#targetElement { width:240px;height:200px;background-color:#999;margin:30px auto; }
+.positionDiv { width:50px;height:50px;opacity:0.6; }
+#position1 {background-color:#F00;}
+#position2 {background-color:#0F0;}
+#position3 {background-color:#00F;}
+#position4 {background-color:#FF0;}
+&lt;/style&gt;
+
+  &lt;script&gt;
+  $(document).ready(function() {
+    
+$(&quot;#position1&quot;).position({
+  my: &quot;center&quot;,
+  at: &quot;center&quot;,
+  of: &quot;#targetElement&quot;
+});
+$(&quot;#position2&quot;).position({
+  my: &quot;left top&quot;,
+  at: &quot;left top&quot;,
+  of: &quot;#targetElement&quot;
+});
+$(&quot;#position3&quot;).position({
+  my: &quot;right center&quot;,
+  at: &quot;right bottom&quot;,
+  of: &quot;#targetElement&quot;
+});
+$(document).mousemove(function(ev){
+  $(&quot;#position4&quot;).position({
+    my: &quot;left bottom&quot;,
+    of: ev,
+    offset: &quot;3 -3&quot;,
+    collision: &quot;fit&quot;
+  });
+});
+
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;div id=&quot;targetElement&quot;&gt;
+  &lt;div class=&quot;positionDiv&quot; id=&quot;position1&quot;&gt;&lt;/div&gt;
+  &lt;div class=&quot;positionDiv&quot; id=&quot;position2&quot;&gt;&lt;/div&gt;
+  &lt;div class=&quot;positionDiv&quot; id=&quot;position3&quot;&gt;&lt;/div&gt;
+  &lt;div class=&quot;positionDiv&quot; id=&quot;position4&quot;&gt;&lt;/div&gt;
+&lt;/div&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Arguments</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-my">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-my">my</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Defines which position on <b>the element being positioned</b> to align with the target element: "horizontal vertical" alignment. A single value such as "right" will default to "right center", "top" will default to "center top" (following CSS convention). Acceptable values: "top", "center", "bottom", "left", "right". Example: "left top" or "center center"</p>
+  </div>
+</li>
+
+
+<li class="option" id="option-at">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-at">at</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Defines which position on <b>the target element</b> to align the positioned element against: "horizontal vertical" alignment. A single value such as "right" will default to "right center", "top" will default to "center top" (following CSS convention). Acceptable values: "top", "center", "bottom", "left", "right". Example: "left top" or "center center"</p>
+  </div>
+</li>
+
+
+<li class="option" id="option-of">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-of">of</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector, Element, jQuery, Event</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Element to position against. If you provide a selector, the first matching element will be used. If you provide a jQuery object, the first element will be used. If you provide an event object, the pageX and pageY properties will be used. Example: "#top-menu"</p>
+  </div>
+</li>
+
+
+<li class="option" id="option-offset">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-offset">offset</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Add these left-top values to the calculated position, eg. "50 50" (left top) A single value such as "50" will apply to both.</p>
+  </div>
+</li>
+
+
+<li class="option" id="option-collision">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-collision">collision</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>When the positioned element overflows the window in some direction, move it to an alternative position. Similar to my and at, this accepts a single value or a pair for horizontal/vertical, eg. "flip", "fit", "fit flip", "fit none".
+</p>
+<ul><li> <b>flip</b>: to the opposite side and the collision detection is run again to see if it will fit. If it won't fit in either position, the center option should be used as a fall back.
+</li><li> <b>fit</b>: so the element keeps in the desired direction, but is re-positioned so it fits.
+</li><li> <b>none</b>: not do collision detection.
+</li></ul>
+<p></p>
+  </div>
+</li>
+
+
+<li class="option" id="option-using">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-using">using</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Function</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>When specified the actual property setting is delegated to this callback. Receives a single parameter which is a hash of top and left values for the position that should be set.</p>
+  </div>
+</li>
+
+    </ul>
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 7124 bytes
+Post-expand include size: 11012 bytes
+Template argument size: 7642 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3784-1!1!0!!en!2 and timestamp 20110315194632 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/resizable.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1201 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Resizable</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>The jQuery UI Resizable plugin makes selected elements resizable (meaning they have draggable resize handles). You can specify one or more handles as well as min and max width and height.</p>
+<p>All callbacks (start,stop,resize) receive two arguments: The original browser event and a prepared ui object.  The ui object has the following fields:</p>
+<ul>
+<li><b>ui.helper</b> - a jQuery object containing the helper element</li>
+<li><b>ui.originalPosition</b> - {top, left} before resizing started</li>
+<li><b>ui.originalSize</b> - {width, height} before resizing started</li>
+<li><b>ui.position</b> - {top, left} current position</li>
+<li><b>ui.size</b> - {width, height} current size</li>
+</ul>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+<li>UI Mouse</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="250">
+A simple jQuery UI Resizable.<br />
+</p>
+<pre>$(&quot;#resizable&quot;).resizable();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  &lt;style type=&quot;text/css&quot;&gt;
+    #resizable { width: 100px; height: 100px; background: silver; }
+  &lt;/style&gt;
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#resizable&quot;).resizable();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;div id=&quot;resizable&quot;&gt;&lt;/div&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the resizable. Can be set when initialising (first creating) the resizable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).resizable( "option", "disabled" );
+//setter
+$( ".selector" ).resizable( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-alsoResize">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-alsoResize">alsoResize</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector, jQuery, Element</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Resize these elements synchronous when resizing.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>alsoResize</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ alsoResize: '.other' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>alsoResize</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var alsoResize = $( ".selector" ).resizable( "option", "alsoResize" );
+//setter
+$( ".selector" ).resizable( "option", "alsoResize", '.other' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-animate">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-animate">animate</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Animates to the final size after resizing.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>animate</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ animate: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>animate</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var animate = $( ".selector" ).resizable( "option", "animate" );
+//setter
+$( ".selector" ).resizable( "option", "animate", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-animateDuration">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-animateDuration">animateDuration</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer, String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'slow'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Duration time for animating, in milliseconds. Other possible values: 'slow', 'normal', 'fast'.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>animateDuration</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ animateDuration: 500 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>animateDuration</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var animateDuration = $( ".selector" ).resizable( "option", "animateDuration" );
+//setter
+$( ".selector" ).resizable( "option", "animateDuration", 500 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-animateEasing">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-animateEasing">animateEasing</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'swing'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Easing effect for animating.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>animateEasing</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ animateEasing: 'swing' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>animateEasing</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var animateEasing = $( ".selector" ).resizable( "option", "animateEasing" );
+//setter
+$( ".selector" ).resizable( "option", "animateEasing", 'swing' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-aspectRatio">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-aspectRatio">aspectRatio</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean, Float</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, resizing is constrained by the original aspect ratio. Otherwise a custom aspect ratio can be specified, such as 9 / 16, or 0.5.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>aspectRatio</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ aspectRatio: .75 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>aspectRatio</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var aspectRatio = $( ".selector" ).resizable( "option", "aspectRatio" );
+//setter
+$( ".selector" ).resizable( "option", "aspectRatio", .75 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-autoHide">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-autoHide">autoHide</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, automatically hides the handles except when the mouse hovers over the element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>autoHide</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ autoHide: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>autoHide</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var autoHide = $( ".selector" ).resizable( "option", "autoHide" );
+//setter
+$( ".selector" ).resizable( "option", "autoHide", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cancel">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cancel">cancel</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">':input,option'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Prevents resizing if you start on elements matching the selector.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>cancel</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ cancel: ':input,option' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cancel</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cancel = $( ".selector" ).resizable( "option", "cancel" );
+//setter
+$( ".selector" ).resizable( "option", "cancel", ':input,option' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-containment">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-containment">containment</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String, Element, Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Constrains resizing to within the bounds of the specified element. Possible values: 'parent', 'document', a DOMElement, or a Selector.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>containment</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ containment: 'parent' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>containment</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var containment = $( ".selector" ).resizable( "option", "containment" );
+//setter
+$( ".selector" ).resizable( "option", "containment", 'parent' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-delay">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-delay">delay</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">0</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Tolerance, in milliseconds, for when resizing should start. If specified, resizing will not start until after mouse is moved beyond duration. This can help prevent unintended resizing when clicking on an element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>delay</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ delay: 20 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>delay</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var delay = $( ".selector" ).resizable( "option", "delay" );
+//setter
+$( ".selector" ).resizable( "option", "delay", 20 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-distance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-distance">distance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">1</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Tolerance, in pixels, for when resizing should start. If specified, resizing will not start until after mouse is moved beyond distance. This can help prevent unintended resizing when clicking on an element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>distance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ distance: 20 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>distance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var distance = $( ".selector" ).resizable( "option", "distance" );
+//setter
+$( ".selector" ).resizable( "option", "distance", 20 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-ghost">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-ghost">ghost</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, a semi-transparent helper element is shown for resizing.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>ghost</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ ghost: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>ghost</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var ghost = $( ".selector" ).resizable( "option", "ghost" );
+//setter
+$( ".selector" ).resizable( "option", "ghost", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-grid">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-grid">grid</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Array</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Snaps the resizing element to a grid, every x and y pixels. Array values: [x, y]</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>grid</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ grid: [50, 50] });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>grid</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var grid = $( ".selector" ).resizable( "option", "grid" );
+//setter
+$( ".selector" ).resizable( "option", "grid", [50, 50] );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-handles">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-handles">handles</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String, Object</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'e, s, se'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If specified as a string, should be a comma-split list of any of the following: 'n, e, s, w, ne, se, sw, nw, all'. The necessary handles will be auto-generated by the plugin.
+</p><p>If specified as an object, the following keys are supported: { n, e, s, w, ne, se, sw, nw }. The value of any specified should be a jQuery selector matching the child element of the resizable to use as that handle. If the handle is not a child of the resizable, you can pass in the DOMElement or a valid jQuery object directly.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>handles</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ handles: 'n, e, s, w' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>handles</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var handles = $( ".selector" ).resizable( "option", "handles" );
+//setter
+$( ".selector" ).resizable( "option", "handles", 'n, e, s, w' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-helper">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-helper">helper</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>This is the css class that will be added to a proxy element to outline the resize during the drag of the resize handle. Once the resize is complete, the original element is sized.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>helper</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ helper: 'ui-state-highlight' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>helper</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var helper = $( ".selector" ).resizable( "option", "helper" );
+//setter
+$( ".selector" ).resizable( "option", "helper", 'ui-state-highlight' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-maxHeight">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-maxHeight">maxHeight</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">null</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>This is the maximum height the resizable should be allowed to resize to.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>maxHeight</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ maxHeight: 300 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>maxHeight</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var maxHeight = $( ".selector" ).resizable( "option", "maxHeight" );
+//setter
+$( ".selector" ).resizable( "option", "maxHeight", 300 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-maxWidth">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-maxWidth">maxWidth</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">null</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>This is the maximum width the resizable should be allowed to resize to.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>maxWidth</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ maxWidth: 250 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>maxWidth</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var maxWidth = $( ".selector" ).resizable( "option", "maxWidth" );
+//setter
+$( ".selector" ).resizable( "option", "maxWidth", 250 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-minHeight">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-minHeight">minHeight</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">10</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>This is the minimum height the resizable should be allowed to resize to.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>minHeight</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ minHeight: 150 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>minHeight</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var minHeight = $( ".selector" ).resizable( "option", "minHeight" );
+//setter
+$( ".selector" ).resizable( "option", "minHeight", 150 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-minWidth">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-minWidth">minWidth</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">10</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>This is the minimum width the resizable should be allowed to resize to.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a resizable with the <code>minWidth</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).resizable({ minWidth: 75 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>minWidth</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var minWidth = $( ".selector" ).resizable( "option", "minWidth" );
+//setter
+$( ".selector" ).resizable( "option", "minWidth", 75 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">resizecreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when resizable is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).resizable({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>resizecreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;resizecreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-start">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-start">start</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">resizestart</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the start of a resize operation.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>start</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).resizable({
+   start: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>start</code> event by type: <code>resizestart</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;resizestart&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-resize">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-resize">resize</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">resize</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered during the resize, on the drag of the resize handler.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>resize</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).resizable({
+   resize: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>resize</code> event by type: <code>resize</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;resize&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-stop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-stop">stop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">resizestop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the end of a resize operation.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>stop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).resizable({
+   stop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>stop</code> event by type: <code>resizestop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;resizestop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.resizable( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the resizable functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.resizable( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the resizable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.resizable( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the resizable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.resizable( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any resizable option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.resizable( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple resizable options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.resizable( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-resizable element.</p>
+  </div>
+</li>
+
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Resizable plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.resizable.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;div class=&quot;<strong>ui-resizable</strong>&quot;&gt;<br />
+&#160;&#160;&#160;&lt;div style=&quot;-moz-user-select: none;&quot; unselectable=&quot;on&quot; class=&quot;<strong>ui-resizable-handle ui-resizable-e</strong>&quot;&gt;&lt;/div&gt;<br />
+&#160;&#160;&#160;&lt;div style=&quot;-moz-user-select: none;&quot; unselectable=&quot;on&quot; class=&quot;<strong>ui-resizable-handle ui-resizable-s</strong>&quot;&gt;&lt;/div&gt;<br />
+&#160;&#160;&#160;&lt;div unselectable=&quot;on&quot; style=&quot;z-index: 1001; -moz-user-select: none;&quot; class=&quot;<strong>ui-resizable-handle ui-resizable-se</strong> ui-icon ui-icon-gripsmall-diagonal-se&quot;&gt;&lt;/div&gt;<br />
+&lt;/div&gt;
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the resizable plugin, not markup you should use to create a resizable. The only markup needed for that is &lt;div&gt;&lt;/div&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 47634 bytes
+Post-expand include size: 79001 bytes
+Template argument size: 41937 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3770-1!1!0!!en!2 and timestamp 20110315182908 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/selectable.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,848 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Selectable</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>The jQuery UI Selectable plugin allows for elements to be selected by dragging a box (sometimes called a lasso) with the mouse over the elements. Also, elements can be selected by click or drag while holding the Ctrl/Meta key, allowing for multiple (non-contiguous) selections.</p>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+<li>UI Mouse</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="">
+A simple jQuery UI Selectable.<br />
+</p>
+<pre>$(&quot;#selectable&quot;).selectable();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  &lt;style type=&quot;text/css&quot;&gt;
+#selectable .ui-selecting {
+	background: silver;
+}
+#selectable .ui-selected {
+	background: gray;
+}
+&lt;/style&gt;
+
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#selectable&quot;).selectable();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;ul id=&quot;selectable&quot;&gt;
+&lt;li&gt;Item 1&lt;/li&gt;
+&lt;li&gt;Item 2&lt;/li&gt;
+&lt;li&gt;Item 3&lt;/li&gt;
+&lt;li&gt;Item 4&lt;/li&gt;
+&lt;li&gt;Item 5&lt;/li&gt;
+&lt;/ul&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the selectable. Can be set when initialising (first creating) the selectable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a selectable with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).selectable({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).selectable( "option", "disabled" );
+//setter
+$( ".selector" ).selectable( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-autoRefresh">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-autoRefresh">autoRefresh</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>This determines whether to refresh (recalculate) the position and size of each selectee at the beginning of each select operation. If you have many many items, you may want to set this to false and call the refresh method manually.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a selectable with the <code>autoRefresh</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).selectable({ autoRefresh: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>autoRefresh</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var autoRefresh = $( ".selector" ).selectable( "option", "autoRefresh" );
+//setter
+$( ".selector" ).selectable( "option", "autoRefresh", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cancel">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cancel">cancel</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">':input,option'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Prevents selecting if you start on elements matching the selector.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a selectable with the <code>cancel</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).selectable({ cancel: ':input,option' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cancel</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cancel = $( ".selector" ).selectable( "option", "cancel" );
+//setter
+$( ".selector" ).selectable( "option", "cancel", ':input,option' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-delay">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-delay">delay</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">0</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Time in milliseconds to define when the selecting should start. It helps preventing unwanted selections when clicking on an element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a selectable with the <code>delay</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).selectable({ delay: 20 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>delay</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var delay = $( ".selector" ).selectable( "option", "delay" );
+//setter
+$( ".selector" ).selectable( "option", "delay", 20 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-distance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-distance">distance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">0</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Tolerance, in pixels, for when selecting should start. If specified, selecting will not start until after mouse is dragged beyond distance.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a selectable with the <code>distance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).selectable({ distance: 20 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>distance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var distance = $( ".selector" ).selectable( "option", "distance" );
+//setter
+$( ".selector" ).selectable( "option", "distance", 20 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-filter">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-filter">filter</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'*'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The matching child elements will be made selectees (able to be selected).</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a selectable with the <code>filter</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).selectable({ filter: 'li' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>filter</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var filter = $( ".selector" ).selectable( "option", "filter" );
+//setter
+$( ".selector" ).selectable( "option", "filter", 'li' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-tolerance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-tolerance">tolerance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'touch'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Possible values: 'touch', 'fit'.
+</p>
+<ul>
+<li><b>fit</b>: draggable overlaps the droppable entirely</li>
+<li><b>touch</b>: draggable overlaps the droppable any amount</li>
+</ul>
+<p></p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a selectable with the <code>tolerance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).selectable({ tolerance: 'fit' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>tolerance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var tolerance = $( ".selector" ).selectable( "option", "tolerance" );
+//setter
+$( ".selector" ).selectable( "option", "tolerance", 'fit' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">selectablecreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when selectable is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).selectable({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>selectablecreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;selectablecreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-selected">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-selected">selected</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">selectableselected</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the end of the select operation, on each element added to the selection.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>selected</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).selectable({
+   selected: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>selected</code> event by type: <code>selectableselected</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;selectableselected&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-selecting">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-selecting">selecting</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">selectableselecting</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered during the select operation, on each element added to the selection.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>selecting</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).selectable({
+   selecting: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>selecting</code> event by type: <code>selectableselecting</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;selectableselecting&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-start">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-start">start</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">selectablestart</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the beginning of the select operation.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>start</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).selectable({
+   start: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>start</code> event by type: <code>selectablestart</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;selectablestart&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-stop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-stop">stop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">selectablestop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the end of the select operation.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>stop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).selectable({
+   stop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>stop</code> event by type: <code>selectablestop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;selectablestop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-unselected">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-unselected">unselected</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">selectableunselected</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered at the end of the select operation, on each element removed from the selection.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>unselected</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).selectable({
+   unselected: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>unselected</code> event by type: <code>selectableunselected</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;selectableunselected&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-unselecting">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-unselecting">unselecting</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">selectableunselecting</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered during the select operation, on each element removed from the selection.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>unselecting</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).selectable({
+   unselecting: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>unselecting</code> event by type: <code>selectableunselecting</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;selectableunselecting&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.selectable( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the selectable functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.selectable( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the selectable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.selectable( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the selectable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.selectable( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any selectable option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.selectable( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple selectable options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.selectable( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-selectable element.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-refresh">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-refresh">refresh</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.selectable( "refresh"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Refresh the position and size of each selectee element. This method can be used to manually recalculate the position and size of each selectee element. Very useful if autoRefresh is set to false.</p>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Selectable plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.selectable.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;ul class=&quot;<strong>ui-selectable</strong>&quot;&gt;<br />
+&#160;&#160;&#160;&lt;li class=&quot;<strong>ui-selectee</strong>&quot;&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li class=&quot;<strong>ui-selectee</strong>&quot;&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li class=&quot;<strong>ui-selectee</strong>&quot;&gt;&lt;/li&gt;<br />
+&lt;/ul&gt;
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the selectable plugin, not markup you should use to create a selectable. The only markup needed for that is <br />&lt;ul&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&lt;/ul&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 34674 bytes
+Post-expand include size: 53359 bytes
+Template argument size: 26926 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3771-1!1!0!!en!2 and timestamp 20110315194405 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/docs/sortable.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1952 @@
+
+<ul class="UIAPIPlugin-toc">
+<li><a href="#overview">Overview</a></li>
+<li><a href="#options">Options</a></li>
+<li><a href="#events">Events</a></li>
+<li><a href="#methods">Methods</a></li>
+<li><a href="#theming">Theming</a></li>
+</ul>
+<div class="UIAPIPlugin">
+  <h1>jQuery UI Sortable</h1>
+  <div id="overview">
+    <h2 class="top-header">Overview</h2>
+    <div id="overview-main">
+        <p>The jQuery UI Sortable plugin makes selected elements sortable by dragging with the mouse.</p>
+<p>All callbacks receive two arguments: The original browser event and a prepared ui object, view below for a documentation of this object (if you name your second argument 'ui'):</p>
+<ul>
+<li><b>ui.helper</b> - the current helper element (most often a clone of the item)</li>
+<li><b>ui.position</b> - current position of the helper</li>
+<li><b>ui.offset</b> - current absolute position of the helper</li>
+<li><b>ui.item</b> - the current dragged element</li>
+<li><b>ui.placeholder</b> - the placeholder (if you defined one)</li>
+<li><b>ui.sender</b> - the sortable where the item comes from (only exists if you move from one connected list to another)</li>
+</ul>
+    </div>
+    <div id="overview-dependencies">
+        <h3>Dependencies</h3>
+        <ul>
+<li>UI Core</li>
+<li>UI Widget</li>
+<li>UI Mouse</li>
+</ul>
+    </div>
+    <div id="overview-example">
+        <h3>Example</h3>
+        <div id="overview-example" class="example">
+<ul><li><a href="#demo"><span>Demo</span></a></li><li><a href="#source"><span>View Source</span></a></li></ul>
+<p><div id="demo" class="tabs-container" rel="100">
+A simple jQuery UI Sortable.<br />
+</p>
+<pre>$(&quot;#sortable&quot;).sortable();
+</pre>
+<p></div><div id="source" class="tabs-container">
+</p>
+<pre>&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+&lt;head&gt;
+  &lt;link href=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/themes/base/jquery-ui.css&quot; rel=&quot;stylesheet&quot; type=&quot;text/css&quot;/&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jquery/1.4/jquery.min.js&quot;&gt;&lt;/script&gt;
+  &lt;script src=&quot;http://ajax.googleapis.com/ajax/libs/jqueryui/1.8/jquery-ui.min.js&quot;&gt;&lt;/script&gt;
+  
+  &lt;script&gt;
+  $(document).ready(function() {
+    $(&quot;#sortable&quot;).sortable();
+  });
+  &lt;/script&gt;
+&lt;/head&gt;
+&lt;body style="font-size:62.5%;"&gt;
+  
+&lt;ul id=&quot;sortable&quot;&gt;
+&lt;li&gt;Item 1&lt;/li&gt;
+&lt;li&gt;Item 2&lt;/li&gt;
+&lt;li&gt;Item 3&lt;/li&gt;
+&lt;li&gt;Item 4&lt;/li&gt;
+&lt;li&gt;Item 5&lt;/li&gt;
+&lt;/ul&gt;
+
+&lt;/body&gt;
+&lt;/html&gt;
+</pre>
+<p></div>
+</p><p></div>
+    </div>
+  </div>
+  <div id="options">
+    <h2 class="top-header">Options</h2>
+    <ul class="options-list">
+      
+<li class="option" id="option-disabled">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-disabled">disabled</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Disables (true) or enables (false) the sortable. Can be set when initialising (first creating) the sortable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>disabled</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ disabled: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>disabled</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var disabled = $( ".selector" ).sortable( "option", "disabled" );
+//setter
+$( ".selector" ).sortable( "option", "disabled", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-appendTo">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-appendTo">appendTo</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'parent'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Defines where the helper that moves with the mouse is being appended to during the drag (for example, to resolve overlap/zIndex issues).</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>appendTo</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ appendTo: 'body' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>appendTo</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var appendTo = $( ".selector" ).sortable( "option", "appendTo" );
+//setter
+$( ".selector" ).sortable( "option", "appendTo", 'body' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-axis">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-axis">axis</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If defined, the items can be dragged only horizontally or vertically. Possible values:'x', 'y'.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>axis</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ axis: 'x' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>axis</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var axis = $( ".selector" ).sortable( "option", "axis" );
+//setter
+$( ".selector" ).sortable( "option", "axis", 'x' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cancel">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cancel">cancel</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">':input,button'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Prevents sorting if you start on elements matching the selector.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>cancel</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ cancel: 'button' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cancel</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cancel = $( ".selector" ).sortable( "option", "cancel" );
+//setter
+$( ".selector" ).sortable( "option", "cancel", 'button' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-connectWith">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-connectWith">connectWith</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Takes a jQuery selector with items that also have sortables applied. If used, the sortable is now connected to the other one-way, so you can drag from this sortable to the other.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>connectWith</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ connectWith: '.otherlist' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>connectWith</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var connectWith = $( ".selector" ).sortable( "option", "connectWith" );
+//setter
+$( ".selector" ).sortable( "option", "connectWith", '.otherlist' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-containment">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-containment">containment</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Element, String, Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Constrains dragging to within the bounds of the specified element - can be a DOM element, 'parent', 'document', 'window', or a jQuery selector.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>containment</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ containment: 'parent' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>containment</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var containment = $( ".selector" ).sortable( "option", "containment" );
+//setter
+$( ".selector" ).sortable( "option", "containment", 'parent' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cursor">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cursor">cursor</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'auto'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Defines the cursor that is being shown while sorting.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>cursor</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ cursor: 'crosshair' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cursor</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cursor = $( ".selector" ).sortable( "option", "cursor" );
+//setter
+$( ".selector" ).sortable( "option", "cursor", 'crosshair' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-cursorAt">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-cursorAt">cursorAt</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Object</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Moves the sorting element or helper so the cursor always appears to drag from the same position. Coordinates can be given as a hash using a combination of one or two keys: <code>{ top, left, right, bottom }</code>.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>cursorAt</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ cursorAt: 'top' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>cursorAt</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var cursorAt = $( ".selector" ).sortable( "option", "cursorAt" );
+//setter
+$( ".selector" ).sortable( "option", "cursorAt", 'top' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-delay">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-delay">delay</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">0</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Time in milliseconds to define when the sorting should start. It helps preventing unwanted drags when clicking on an element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>delay</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ delay: 500 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>delay</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var delay = $( ".selector" ).sortable( "option", "delay" );
+//setter
+$( ".selector" ).sortable( "option", "delay", 500 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-distance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-distance">distance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">1</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Tolerance, in pixels, for when sorting should start. If specified, sorting will not start until after mouse is dragged beyond distance. Can be used to allow for clicks on elements within a handle.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>distance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ distance: 30 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>distance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var distance = $( ".selector" ).sortable( "option", "distance" );
+//setter
+$( ".selector" ).sortable( "option", "distance", 30 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-dropOnEmpty">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-dropOnEmpty">dropOnEmpty</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If false items from this sortable can't be dropped to an empty linked sortable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>dropOnEmpty</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ dropOnEmpty: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>dropOnEmpty</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var dropOnEmpty = $( ".selector" ).sortable( "option", "dropOnEmpty" );
+//setter
+$( ".selector" ).sortable( "option", "dropOnEmpty", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-forceHelperSize">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-forceHelperSize">forceHelperSize</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If true, forces the helper to have a size.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>forceHelperSize</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ forceHelperSize: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>forceHelperSize</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var forceHelperSize = $( ".selector" ).sortable( "option", "forceHelperSize" );
+//setter
+$( ".selector" ).sortable( "option", "forceHelperSize", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-forcePlaceholderSize">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-forcePlaceholderSize">forcePlaceholderSize</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If true, forces the placeholder to have a size.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>forcePlaceholderSize</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ forcePlaceholderSize: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>forcePlaceholderSize</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var forcePlaceholderSize = $( ".selector" ).sortable( "option", "forcePlaceholderSize" );
+//setter
+$( ".selector" ).sortable( "option", "forcePlaceholderSize", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-grid">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-grid">grid</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Array</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Snaps the sorting element or helper to a grid, every x and y pixels. Array values: [x, y]</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>grid</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ grid: [50, 20] });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>grid</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var grid = $( ".selector" ).sortable( "option", "grid" );
+//setter
+$( ".selector" ).sortable( "option", "grid", [50, 20] );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-handle">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-handle">handle</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector, Element</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Restricts sort start click to the specified element.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>handle</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ handle: 'h2' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>handle</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var handle = $( ".selector" ).sortable( "option", "handle" );
+//setter
+$( ".selector" ).sortable( "option", "handle", 'h2' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-helper">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-helper">helper</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String, Function</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'original'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Allows for a helper element to be used for dragging display. The supplied function receives the event and the element being sorted, and should return a DOMElement to be used as a custom proxy helper. Possible values: 'original', 'clone'</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>helper</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ helper: 'clone' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>helper</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var helper = $( ".selector" ).sortable( "option", "helper" );
+//setter
+$( ".selector" ).sortable( "option", "helper", 'clone' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-items">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-items">items</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Selector</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'&gt; *'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Specifies which items inside the element should be sortable.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>items</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ items: 'li' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>items</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var items = $( ".selector" ).sortable( "option", "items" );
+//setter
+$( ".selector" ).sortable( "option", "items", 'li' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-opacity">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-opacity">opacity</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Float</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Defines the opacity of the helper while sorting. From 0.01 to 1</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>opacity</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ opacity: 0.6 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>opacity</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var opacity = $( ".selector" ).sortable( "option", "opacity" );
+//setter
+$( ".selector" ).sortable( "option", "opacity", 0.6 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-placeholder">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-placeholder">placeholder</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Class that gets applied to the otherwise white space.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>placeholder</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ placeholder: 'ui-state-highlight' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>placeholder</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var placeholder = $( ".selector" ).sortable( "option", "placeholder" );
+//setter
+$( ".selector" ).sortable( "option", "placeholder", 'ui-state-highlight' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-revert">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-revert">revert</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean/Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">false</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, the item will be reverted to its new DOM position with a smooth animation. Optionally, it can also be set to a number that controls the duration of the animation in ms.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>revert</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ revert: true });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>revert</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var revert = $( ".selector" ).sortable( "option", "revert" );
+//setter
+$( ".selector" ).sortable( "option", "revert", true );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scroll">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scroll">scroll</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Boolean</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">true</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>If set to true, the page scrolls when coming to an edge.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>scroll</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ scroll: false });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scroll</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scroll = $( ".selector" ).sortable( "option", "scroll" );
+//setter
+$( ".selector" ).sortable( "option", "scroll", false );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scrollSensitivity">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scrollSensitivity">scrollSensitivity</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">20</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Defines how near the mouse must be to an edge to start scrolling.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>scrollSensitivity</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ scrollSensitivity: 40 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scrollSensitivity</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scrollSensitivity = $( ".selector" ).sortable( "option", "scrollSensitivity" );
+//setter
+$( ".selector" ).sortable( "option", "scrollSensitivity", 40 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-scrollSpeed">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-scrollSpeed">scrollSpeed</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">20</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>The speed at which the window should scroll once the mouse pointer gets within the scrollSensitivity distance.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>scrollSpeed</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ scrollSpeed: 40 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>scrollSpeed</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var scrollSpeed = $( ".selector" ).sortable( "option", "scrollSpeed" );
+//setter
+$( ".selector" ).sortable( "option", "scrollSpeed", 40 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-tolerance">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-tolerance">tolerance</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">String</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">'intersect'</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>This is the way the reordering behaves during drag. Possible values: 'intersect', 'pointer'. In some setups, 'pointer' is more natural.
+</p>
+<ul>
+<li><b>intersect</b>: draggable overlaps the droppable at least 50%</li>
+<li><b>pointer</b>: mouse pointer overlaps the droppable</li>
+</ul>
+<p></p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>tolerance</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ tolerance: 'pointer' });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>tolerance</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var tolerance = $( ".selector" ).sortable( "option", "tolerance" );
+//setter
+$( ".selector" ).sortable( "option", "tolerance", 'pointer' );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="option" id="option-zIndex">
+  <div class="option-header">
+    <h3 class="option-name"><a href="#option-zIndex">zIndex</a></h3>
+    <dl>
+      <dt class="option-type-label">Type:</dt>
+        <dd class="option-type">Integer</dd>
+      
+      <dt class="option-default-label">Default:</dt>
+        <dd class="option-default">1000</dd>
+      
+    </dl>
+  </div>
+  <div class="option-description">
+    <p>Z-index for element/helper while being sorted.</p>
+  </div>
+  <div class="option-examples">
+    <h4>Code examples</h4>
+    <dl class="option-examples-list">
+    
+<dt>
+  Initialize a sortable with the <code>zIndex</code> option specified.
+</dt>
+<dd>
+<pre><code>$( ".selector" ).sortable({ zIndex: 5 });</code></pre>
+</dd>
+
+    
+<dt>
+  Get or set the <code>zIndex</code> option, after init.
+</dt>
+<dd>
+<pre><code>//getter
+var zIndex = $( ".selector" ).sortable( "option", "zIndex" );
+//setter
+$( ".selector" ).sortable( "option", "zIndex", 5 );</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="events">
+    <h2 class="top-header">Events</h2>
+    <ul class="events-list">
+      
+<li class="event" id="event-create">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-create">create</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortcreate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when sortable is created.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>create</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   create: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>create</code> event by type: <code>sortcreate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortcreate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-start">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-start">start</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortstart</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when sorting starts.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>start</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   start: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>start</code> event by type: <code>sortstart</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortstart&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-sort">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-sort">sort</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sort</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered during sorting.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>sort</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   sort: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>sort</code> event by type: <code>sort</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sort&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-change">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-change">change</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortchange</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered during sorting, but only when the DOM position has changed.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>change</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   change: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>change</code> event by type: <code>sortchange</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortchange&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-beforeStop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-beforeStop">beforeStop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortbeforestop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when sorting stops, but when the placeholder/helper is still available.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>beforeStop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   beforeStop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>beforeStop</code> event by type: <code>sortbeforestop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortbeforestop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-stop">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-stop">stop</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortstop</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when sorting has stopped.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>stop</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   stop: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>stop</code> event by type: <code>sortstop</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortstop&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-update">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-update">update</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortupdate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when the user stopped sorting and the DOM position has changed.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>update</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   update: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>update</code> event by type: <code>sortupdate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortupdate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-receive">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-receive">receive</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortreceive</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when a connected sortable list has received an item from another list.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>receive</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   receive: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>receive</code> event by type: <code>sortreceive</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortreceive&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-remove">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-remove">remove</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortremove</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when a sortable item has been dragged out from the list and into another.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>remove</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   remove: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>remove</code> event by type: <code>sortremove</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortremove&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-over">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-over">over</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortover</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when a sortable item is moved into a connected list.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>over</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   over: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>over</code> event by type: <code>sortover</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortover&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-out">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-out">out</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortout</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when a sortable item is moved away from a connected list.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>out</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   out: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>out</code> event by type: <code>sortout</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortout&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-activate">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-activate">activate</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortactivate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when using connected lists, every connected list on drag start receives it.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>activate</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   activate: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>activate</code> event by type: <code>sortactivate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortactivate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+
+<li class="event" id="event-deactivate">
+  <div class="event-header">
+    <h3 class="event-name"><a href="#event-deactivate">deactivate</a></h3>
+    <dl>
+      <dt class="event-type-label">Type:</dt>
+        <dd class="event-type">sortdeactivate</dd>
+    </dl>
+  </div>
+  <div class="event-description">
+    <p>This event is triggered when sorting was stopped, is propagated to all possible connected lists.</p>
+  </div>
+  <div class="event-examples">
+    <h4>Code examples</h4>
+    <dl class="event-examples-list">
+    
+<dt>
+  Supply a callback function to handle the <code>deactivate</code> event as an init option.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).sortable({
+   deactivate: function(event, ui) { ... }
+});</code></pre>
+</dd>
+
+    
+<dt>
+  Bind to the <code>deactivate</code> event by type: <code>sortdeactivate</code>.
+</dt>
+<dd>
+<pre><code>$( &quot;.selector&quot; ).bind( &quot;sortdeactivate&quot;, function(event, ui) {
+  ...
+});</code></pre>
+</dd>
+
+    </dl>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="methods">
+    <h2 class="top-header">Methods</h2>
+    <ul class="methods-list">
+      
+<li class="method" id="method-destroy">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-destroy">destroy</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "destroy"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Remove the sortable functionality completely. This will return the element back to its pre-init state.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-disable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-disable">disable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "disable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Disable the sortable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-enable">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-enable">enable</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "enable"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Enable the sortable.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "option"
+
+, optionName
+
+, <span class="optional">[</span>value<span class="optional">] </span>
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Get or set any sortable option. If no value is specified, will act as a getter.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-option">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-option">option</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "option"
+
+, options
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Set multiple sortable options at once by providing an options object.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-widget">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-widget">widget</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "widget"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Returns the .ui-sortable element.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-serialize">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-serialize">serialize</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "serialize"
+
+, <span class="optional">[</span>options<span class="optional">] </span>
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Serializes the sortable's item id's into a form/ajax submittable string. Calling this method produces a hash that can be appended to any url to easily submit a new item order back to the server.
+</p><p>It works by default by looking at the id of each item in the format 'setname_number', and it spits out a hash like "setname[]=number&amp;setname[]=number".
+</p><p>You can also give in a option hash as second argument to custom define how the function works. The possible options are: 'key' (replaces part1[] with whatever you want), 'attribute' (test another attribute than 'id') and 'expression' (use your own regexp).
+</p><p>If serialize returns an empty string, make sure the id attributes include an underscore.  They must be in the form: "set_number" For example, a 3 element list with id attributes foo_1, foo_5, foo_2 will serialize to foo[]=1&amp;foo[]=5&amp;foo[]=2. You can use an underscore, equal sign or hyphen to separate the set and number.  For example foo=1 or foo-1 or foo_1 all serialize to foo[]=1.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-toArray">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-toArray">toArray</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "toArray"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Serializes the sortable's item id's into an array of string. If you have
+</p>
+<pre>
+&lt;ul id=&quot;a_sortable&quot;&gt;&lt;br&gt;
+&lt;li id=&quot;hello&quot;&gt;Hello&lt;/li&gt;&lt;br&gt;
+&lt;li id=&quot;goodbye&quot;&gt;Good bye&lt;/li&gt;&lt;br&gt;
+&lt;/ul&gt;
+</pre>
+<p>and do
+</p>
+<pre>var result = $('#a_sortable').sortable('toArray');</pre>
+<p>then
+</p>
+<pre>result[0] will contain &quot;hello&quot; and result[1] will contain &quot;goodbye&quot;.</pre></p>
+  </div>
+</li>
+
+<p>
+<li class="method" id="method-refresh">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-refresh">refresh</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "refresh"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Refresh the sortable items. Custom trigger the reloading of all sortable items, causing new items to be recognized.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-refreshPositions">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-refreshPositions">refreshPositions</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "refreshPositions"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Refresh the cached positions of the sortables' items. Calling this method refreshes the cached item positions of all sortables. This is usually done automatically by the script and slows down performance. Use wisely.</p>
+  </div>
+</li>
+
+
+<li class="method" id="method-cancel">
+  <div class="method-header">
+    <h3 class="method-name"><a href="#method-cancel">cancel</a></h3>
+    <dl>
+      <dt class="method-signature-label">Signature:</dt>
+        <dd class="method-signature">.sortable( "cancel"
+
+
+
+
+
+
+
+)</dd>
+    </dl>
+  </div>
+  <div class="method-description">
+    <p>Cancels a change in the current sortable and reverts it back to how it was before the current sort started. Useful in the stop and receive callback functions.
+</p><p>If the sortable item is not being moved from one connected sortable to another:
+</p>
+<pre>$(this).sortable('cancel');</pre>
+<p>will cancel the change.
+</p><p>If the sortable item is being moved from one connected sortable to another:
+</p>
+<pre>$(ui.sender).sortable('cancel');</pre>
+<p>will cancel the change. Useful in the 'receive' callback.</p>
+  </div>
+</li>
+
+    </ul>
+  </div>
+  <div id="theming">
+    <h2 class="top-header">Theming</h2>
+    <p>The jQuery UI Sortable plugin uses the jQuery UI CSS Framework to style its look and feel, including colors and background textures. We recommend using the ThemeRoller tool to create and download custom themes that are easy to build and maintain.
+</p>
+  <p>If a deeper level of customization is needed, there are widget-specific classes referenced within the jquery.ui.sortable.css stylesheet that can be modified. These classes are highlighed in bold below.
+</p>
+    
+  <h3>Sample markup with jQuery UI CSS Framework classes</h3>
+  &lt;ul class=&quot;<strong>ui-sortable</strong>&quot;&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li class=&quot;<strong>ui-sortable-helper</strong>&quot;&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li class=&quot;<strong>ui-sortable-placeholder</strong>&quot;&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&lt;/ul&gt;
+  <p class="theme-note">
+    <strong>
+      Note: This is a sample of markup generated by the sortable plugin, not markup you should use to create a sortable. The only markup needed for that is <br />&lt;ul&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&#160;&#160;&#160;&lt;li&gt;&lt;/li&gt;<br />
+&lt;/ul&gt;.
+    </strong>
+  </p>
+
+  </div>
+</div>
+
+</p><!-- 
+Pre-expand include size: 74974 bytes
+Post-expand include size: 128872 bytes
+Template argument size: 72454 bytes
+Maximum: 2097152 bytes
+-->
+
+<!-- Saved in parser cache with key jqdocs_docs:pcache:idhash:3772-1!1!0!!en!2 and timestamp 20110315194349 -->
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/external/jquery.bgiframe-2.1.2.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,39 @@
+/*! Copyright (c) 2010 Brandon Aaron (http://brandonaaron.net)
+ * Licensed under the MIT License (LICENSE.txt).
+ *
+ * Version 2.1.2
+ */
+
+(function($){
+
+$.fn.bgiframe = ($.browser.msie && /msie 6\.0/i.test(navigator.userAgent) ? function(s) {
+    s = $.extend({
+        top     : 'auto', // auto == .currentStyle.borderTopWidth
+        left    : 'auto', // auto == .currentStyle.borderLeftWidth
+        width   : 'auto', // auto == offsetWidth
+        height  : 'auto', // auto == offsetHeight
+        opacity : true,
+        src     : 'javascript:false;'
+    }, s);
+    var html = '<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+
+                   'style="display:block;position:absolute;z-index:-1;'+
+                       (s.opacity !== false?'filter:Alpha(Opacity=\'0\');':'')+
+                       'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+
+                       'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+
+                       'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+
+                       'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+
+                '"/>';
+    return this.each(function() {
+        if ( $(this).children('iframe.bgiframe').length === 0 )
+            this.insertBefore( document.createElement(html), this.firstChild );
+    });
+} : function() { return this; });
+
+// old alias
+$.fn.bgIframe = $.fn.bgiframe;
+
+function prop(n) {
+    return n && n.constructor === Number ? n + 'px' : n;
+}
+
+})(jQuery);
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/external/jquery.cookie.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,89 @@
+/*jslint browser: true */ /*global jQuery: true */
+
+/**
+ * jQuery Cookie plugin
+ *
+ * Copyright (c) 2010 Klaus Hartl (stilbuero.de)
+ * Dual licensed under the MIT and GPL licenses:
+ * http://www.opensource.org/licenses/mit-license.php
+ * http://www.gnu.org/licenses/gpl.html
+ *
+ */
+
+// TODO JsDoc
+
+/**
+ * Create a cookie with the given key and value and other optional parameters.
+ *
+ * @example $.cookie('the_cookie', 'the_value');
+ * @desc Set the value of a cookie.
+ * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true });
+ * @desc Create a cookie with all available options.
+ * @example $.cookie('the_cookie', 'the_value');
+ * @desc Create a session cookie.
+ * @example $.cookie('the_cookie', null);
+ * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain
+ *       used when the cookie was set.
+ *
+ * @param String key The key of the cookie.
+ * @param String value The value of the cookie.
+ * @param Object options An object literal containing key/value pairs to provide optional cookie attributes.
+ * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object.
+ *                             If a negative value is specified (e.g. a date in the past), the cookie will be deleted.
+ *                             If set to null or omitted, the cookie will be a session cookie and will not be retained
+ *                             when the the browser exits.
+ * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie).
+ * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie).
+ * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will
+ *                        require a secure protocol (like HTTPS).
+ * @type undefined
+ *
+ * @name $.cookie
+ * @cat Plugins/Cookie
+ * @author Klaus Hartl/klaus.hartl@stilbuero.de
+ */
+
+/**
+ * Get the value of a cookie with the given key.
+ *
+ * @example $.cookie('the_cookie');
+ * @desc Get the value of a cookie.
+ *
+ * @param String key The key of the cookie.
+ * @return The value of the cookie.
+ * @type String
+ *
+ * @name $.cookie
+ * @cat Plugins/Cookie
+ * @author Klaus Hartl/klaus.hartl@stilbuero.de
+ */
+jQuery.cookie = function (key, value, options) {
+
+    // key and value given, set cookie...
+    if (arguments.length > 1 && (value === null || typeof value !== "object")) {
+        options = jQuery.extend({}, options);
+
+        if (value === null) {
+            options.expires = -1;
+        }
+
+        if (typeof options.expires === 'number') {
+            var days = options.expires, t = options.expires = new Date();
+            t.setDate(t.getDate() + days);
+        }
+
+        return (document.cookie = [
+            encodeURIComponent(key), '=',
+            options.raw ? String(value) : encodeURIComponent(String(value)),
+            options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE
+            options.path ? '; path=' + options.path : '',
+            options.domain ? '; domain=' + options.domain : '',
+            options.secure ? '; secure' : ''
+        ].join(''));
+    }
+
+    // key and possibly options given, get cookie...
+    options = value || {};
+    var result, decode = options.raw ? function (s) { return s; } : decodeURIComponent;
+    return (result = new RegExp('(?:^|; )' + encodeURIComponent(key) + '=([^;]*)').exec(document.cookie)) ? decode(result[1]) : null;
+};
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/external/jquery.metadata.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,122 @@
+/*
+ * Metadata - jQuery plugin for parsing metadata from elements
+ *
+ * Copyright (c) 2006 John Resig, Yehuda Katz, J�örn Zaefferer, Paul McLanahan
+ *
+ * Dual licensed under the MIT and GPL licenses:
+ *   http://www.opensource.org/licenses/mit-license.php
+ *   http://www.gnu.org/licenses/gpl.html
+ *
+ * Revision: $Id: jquery.metadata.js 4187 2007-12-16 17:15:27Z joern.zaefferer $
+ *
+ */
+
+/**
+ * Sets the type of metadata to use. Metadata is encoded in JSON, and each property
+ * in the JSON will become a property of the element itself.
+ *
+ * There are three supported types of metadata storage:
+ *
+ *   attr:  Inside an attribute. The name parameter indicates *which* attribute.
+ *          
+ *   class: Inside the class attribute, wrapped in curly braces: { }
+ *   
+ *   elem:  Inside a child element (e.g. a script tag). The
+ *          name parameter indicates *which* element.
+ *          
+ * The metadata for an element is loaded the first time the element is accessed via jQuery.
+ *
+ * As a result, you can define the metadata type, use $(expr) to load the metadata into the elements
+ * matched by expr, then redefine the metadata type and run another $(expr) for other elements.
+ * 
+ * @name $.metadata.setType
+ *
+ * @example <p id="one" class="some_class {item_id: 1, item_label: 'Label'}">This is a p</p>
+ * @before $.metadata.setType("class")
+ * @after $("#one").metadata().item_id == 1; $("#one").metadata().item_label == "Label"
+ * @desc Reads metadata from the class attribute
+ * 
+ * @example <p id="one" class="some_class" data="{item_id: 1, item_label: 'Label'}">This is a p</p>
+ * @before $.metadata.setType("attr", "data")
+ * @after $("#one").metadata().item_id == 1; $("#one").metadata().item_label == "Label"
+ * @desc Reads metadata from a "data" attribute
+ * 
+ * @example <p id="one" class="some_class"><script>{item_id: 1, item_label: 'Label'}</script>This is a p</p>
+ * @before $.metadata.setType("elem", "script")
+ * @after $("#one").metadata().item_id == 1; $("#one").metadata().item_label == "Label"
+ * @desc Reads metadata from a nested script element
+ * 
+ * @param String type The encoding type
+ * @param String name The name of the attribute to be used to get metadata (optional)
+ * @cat Plugins/Metadata
+ * @descr Sets the type of encoding to be used when loading metadata for the first time
+ * @type undefined
+ * @see metadata()
+ */
+
+(function($) {
+
+$.extend({
+	metadata : {
+		defaults : {
+			type: 'class',
+			name: 'metadata',
+			cre: /({.*})/,
+			single: 'metadata'
+		},
+		setType: function( type, name ){
+			this.defaults.type = type;
+			this.defaults.name = name;
+		},
+		get: function( elem, opts ){
+			var settings = $.extend({},this.defaults,opts);
+			// check for empty string in single property
+			if ( !settings.single.length ) settings.single = 'metadata';
+			
+			var data = $.data(elem, settings.single);
+			// returned cached data if it already exists
+			if ( data ) return data;
+			
+			data = "{}";
+			
+			if ( settings.type == "class" ) {
+				var m = settings.cre.exec( elem.className );
+				if ( m )
+					data = m[1];
+			} else if ( settings.type == "elem" ) {
+				if( !elem.getElementsByTagName )
+					return undefined;
+				var e = elem.getElementsByTagName(settings.name);
+				if ( e.length )
+					data = $.trim(e[0].innerHTML);
+			} else if ( elem.getAttribute != undefined ) {
+				var attr = elem.getAttribute( settings.name );
+				if ( attr )
+					data = attr;
+			}
+			
+			if ( data.indexOf( '{' ) <0 )
+			data = "{" + data + "}";
+			
+			data = eval("(" + data + ")");
+			
+			$.data( elem, settings.single, data );
+			return data;
+		}
+	}
+});
+
+/**
+ * Returns the metadata object for the first member of the jQuery object.
+ *
+ * @name metadata
+ * @descr Returns element's metadata object
+ * @param Object opts An object contianing settings to override the defaults
+ * @type jQuery
+ * @cat Plugins/Metadata
+ */
+$.fn.metadata = function( opts ){
+	return $.metadata.get( this[0], opts );
+};
+
+})(jQuery);
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/external/qunit.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,153 @@
+/** Font Family and Sizes */
+
+#qunit-tests, #qunit-header, #qunit-banner, #qunit-testrunner-toolbar, #qunit-userAgent, #qunit-testresult {
+	font-family: "Helvetica Neue Light", "HelveticaNeue-Light", "Helvetica Neue", Calibri, Helvetica, Arial;
+}
+
+#qunit-testrunner-toolbar, #qunit-userAgent, #qunit-testresult, #qunit-tests li { font-size: small; }
+#qunit-tests { font-size: smaller; }
+
+
+/** Resets */
+
+#qunit-tests, #qunit-tests li ol, #qunit-header, #qunit-banner, #qunit-userAgent, #qunit-testresult {
+	margin: 0;
+	padding: 0;
+}
+
+
+/** Header */
+
+#qunit-header {
+	padding: 0.5em 0 0.5em 1em;
+	
+	color: #fff;
+	text-shadow: rgba(0, 0, 0, 0.5) 4px 4px 1px;
+	background-color: #0d3349;
+	
+	border-radius: 15px 15px 0 0;
+	-moz-border-radius: 15px 15px 0 0;
+	-webkit-border-top-right-radius: 15px;
+	-webkit-border-top-left-radius: 15px;
+}
+
+#qunit-header a {
+	text-decoration: none;
+	color: white;
+}
+
+#qunit-banner {
+	height: 5px;
+}
+
+#qunit-testrunner-toolbar {
+	padding: 0em 0 0.5em 2em;
+}
+
+#qunit-userAgent {
+	padding: 0.5em 0 0.5em 2.5em;
+	background-color: #2b81af;
+	color: #fff;
+	text-shadow: rgba(0, 0, 0, 0.5) 2px 2px 1px;
+}
+
+
+/** Tests: Pass/Fail */
+
+#qunit-tests {
+	list-style-position: inside;
+}
+
+#qunit-tests li {
+	padding: 0.4em 0.5em 0.4em 2.5em;
+	border-bottom: 1px solid #fff;
+	list-style-position: inside;
+}
+
+#qunit-tests li strong {
+	cursor: pointer;
+}
+
+#qunit-tests li ol {
+	margin-top: 0.5em;
+	padding: 0.5em;
+	
+	background-color: #fff;
+	
+	border-radius: 15px;
+	-moz-border-radius: 15px;
+	-webkit-border-radius: 15px;
+	
+	box-shadow: inset 0px 2px 13px #999;
+	-moz-box-shadow: inset 0px 2px 13px #999;
+	-webkit-box-shadow: inset 0px 2px 13px #999;
+}
+
+#qunit-tests li li {
+	margin: 0.5em;
+	padding: 0.4em 0.5em 0.4em 0.5em;
+	background-color: #fff;
+	border-bottom: none;
+	list-style-position: inside;
+}
+
+/*** Passing Styles */
+
+#qunit-tests li li.pass {
+	color: #5E740B;
+	background-color: #fff;
+	border-left: 26px solid #C6E746;
+}
+
+#qunit-tests li.pass                        { color: #528CE0; background-color: #D2E0E6; }
+#qunit-tests li.pass span.test-name         { color: #366097; }
+ 
+#qunit-tests li li.pass span.test-actual,
+#qunit-tests li li.pass span.test-expected  { color: #999999; }
+
+strong b.pass                               { color: #5E740B; }
+
+#qunit-banner.qunit-pass                    { background-color: #C6E746; }
+
+/*** Failing Styles */
+
+#qunit-tests li li.fail {
+	color: #710909;
+	background-color: #fff;
+	border-left: 26px solid #EE5757;
+}
+
+#qunit-tests li.fail                        { color: #000000; background-color: #EE5757; }
+#qunit-tests li.fail span.test-name,
+#qunit-tests li.fail span.module-name       { color: #000000; }
+
+#qunit-tests li li.fail span.test-actual    { color: #EE5757; }
+#qunit-tests li li.fail span.test-expected  { color: green;   }
+
+strong b.fail                               { color: #710909; }
+
+#qunit-banner.qunit-fail, 
+#qunit-testrunner-toolbar                   { background-color: #EE5757; }
+
+
+/** Footer */
+
+#qunit-testresult {
+	padding: 0.5em 0.5em 0.5em 2.5em;
+	
+	color: #2b81af;
+	background-color: #D2E0E6;
+
+	border-radius: 0 0 15px 15px;
+	-moz-border-radius: 0 0 15px 15px;
+	-webkit-border-bottom-right-radius: 15px;
+	-webkit-border-bottom-left-radius: 15px;	
+}
+
+/** Fixture */
+
+#qunit-fixture {
+	position: absolute;
+	top: -10000px;
+	left: -10000px;
+}
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/external/qunit.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1261 @@
+/*
+ * QUnit - A JavaScript Unit Testing Framework
+ * 
+ * http://docs.jquery.com/QUnit
+ *
+ * Copyright (c) 2009 John Resig, Jörn Zaefferer
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ */
+
+(function(window) {
+
+var QUnit = {
+
+	// call on start of module test to prepend name to all tests
+	module: function(name, testEnvironment) {
+		config.currentModule = name;
+
+		synchronize(function() {
+			if ( config.currentModule ) {
+				QUnit.moduleDone( config.currentModule, config.moduleStats.bad, config.moduleStats.all );
+			}
+
+			config.currentModule = name;
+			config.moduleTestEnvironment = testEnvironment;
+			config.moduleStats = { all: 0, bad: 0 };
+
+			QUnit.moduleStart( name, testEnvironment );
+		});
+	},
+
+	asyncTest: function(testName, expected, callback) {
+		if ( arguments.length === 2 ) {
+			callback = expected;
+			expected = 0;
+		}
+
+		QUnit.test(testName, expected, callback, true);
+	},
+	
+	test: function(testName, expected, callback, async) {
+		var name = '<span class="test-name">' + testName + '</span>', testEnvironment, testEnvironmentArg;
+
+		if ( arguments.length === 2 ) {
+			callback = expected;
+			expected = null;
+		}
+		// is 2nd argument a testEnvironment?
+		if ( expected && typeof expected === 'object') {
+			testEnvironmentArg =  expected;
+			expected = null;
+		}
+
+		if ( config.currentModule ) {
+			name = '<span class="module-name">' + config.currentModule + "</span>: " + name;
+		}
+
+		if ( !validTest(config.currentModule + ": " + testName) ) {
+			return;
+		}
+
+		synchronize(function() {
+
+			testEnvironment = extend({
+				setup: function() {},
+				teardown: function() {}
+			}, config.moduleTestEnvironment);
+			if (testEnvironmentArg) {
+				extend(testEnvironment,testEnvironmentArg);
+			}
+
+			QUnit.testStart( testName, testEnvironment );
+
+			// allow utility functions to access the current test environment
+			QUnit.current_testEnvironment = testEnvironment;
+			
+			config.assertions = [];
+			config.expected = expected;
+			
+			var tests = id("qunit-tests");
+			if (tests) {
+				var b = document.createElement("strong");
+					b.innerHTML = "Running " + name;
+				var li = document.createElement("li");
+					li.appendChild( b );
+					li.id = "current-test-output";
+				tests.appendChild( li )
+			}
+
+			try {
+				if ( !config.pollution ) {
+					saveGlobal();
+				}
+
+				testEnvironment.setup.call(testEnvironment);
+			} catch(e) {
+				QUnit.ok( false, "Setup failed on " + name + ": " + e.message );
+			}
+	    });
+	
+	    synchronize(function() {
+			if ( async ) {
+				QUnit.stop();
+			}
+
+			try {
+				callback.call(testEnvironment);
+			} catch(e) {
+				fail("Test " + name + " died, exception and test follows", e, callback);
+				QUnit.ok( false, "Died on test #" + (config.assertions.length + 1) + ": " + e.message );
+				// else next test will carry the responsibility
+				saveGlobal();
+
+				// Restart the tests if they're blocking
+				if ( config.blocking ) {
+					start();
+				}
+			}
+		});
+
+		synchronize(function() {
+			try {
+				checkPollution();
+				testEnvironment.teardown.call(testEnvironment);
+			} catch(e) {
+				QUnit.ok( false, "Teardown failed on " + name + ": " + e.message );
+			}
+	    });
+	
+	    synchronize(function() {
+			try {
+				QUnit.reset();
+			} catch(e) {
+				fail("reset() failed, following Test " + name + ", exception and reset fn follows", e, reset);
+			}
+
+			if ( config.expected && config.expected != config.assertions.length ) {
+				QUnit.ok( false, "Expected " + config.expected + " assertions, but " + config.assertions.length + " were run" );
+			}
+
+			var good = 0, bad = 0,
+				tests = id("qunit-tests");
+
+			config.stats.all += config.assertions.length;
+			config.moduleStats.all += config.assertions.length;
+
+			if ( tests ) {
+				var ol  = document.createElement("ol");
+
+				for ( var i = 0; i < config.assertions.length; i++ ) {
+					var assertion = config.assertions[i];
+
+					var li = document.createElement("li");
+					li.className = assertion.result ? "pass" : "fail";
+					li.innerHTML = assertion.message || "(no message)";
+					ol.appendChild( li );
+
+					if ( assertion.result ) {
+						good++;
+					} else {
+						bad++;
+						config.stats.bad++;
+						config.moduleStats.bad++;
+					}
+				}
+				if (bad == 0) {
+					ol.style.display = "none";
+				}
+
+				var b = document.createElement("strong");
+				b.innerHTML = name + " <b style='color:black;'>(<b class='fail'>" + bad + "</b>, <b class='pass'>" + good + "</b>, " + config.assertions.length + ")</b>";
+				
+				addEvent(b, "click", function() {
+					var next = b.nextSibling, display = next.style.display;
+					next.style.display = display === "none" ? "block" : "none";
+				});
+				
+				addEvent(b, "dblclick", function(e) {
+					var target = e && e.target ? e.target : window.event.srcElement;
+					if ( target.nodeName.toLowerCase() == "span" || target.nodeName.toLowerCase() == "b" ) {
+						target = target.parentNode;
+					}
+					if ( window.location && target.nodeName.toLowerCase() === "strong" ) {
+						window.location.search = "?" + encodeURIComponent(getText([target]).replace(/\(.+\)$/, "").replace(/(^\s*|\s*$)/g, ""));
+					}
+				});
+
+				var li = id("current-test-output");
+				li.id = "";
+				li.className = bad ? "fail" : "pass";
+				li.removeChild( li.firstChild );
+				li.appendChild( b );
+				li.appendChild( ol );
+
+				if ( bad ) {
+					var toolbar = id("qunit-testrunner-toolbar");
+					if ( toolbar ) {
+						toolbar.style.display = "block";
+						id("qunit-filter-pass").disabled = null;
+						id("qunit-filter-missing").disabled = null;
+					}
+				}
+
+			} else {
+				for ( var i = 0; i < config.assertions.length; i++ ) {
+					if ( !config.assertions[i].result ) {
+						bad++;
+						config.stats.bad++;
+						config.moduleStats.bad++;
+					}
+				}
+			}
+
+			QUnit.testDone( testName, bad, config.assertions.length );
+
+			if ( !window.setTimeout && !config.queue.length ) {
+				done();
+			}
+		});
+
+		synchronize( done );
+	},
+	
+	/**
+	 * Specify the number of expected assertions to gurantee that failed test (no assertions are run at all) don't slip through.
+	 */
+	expect: function(asserts) {
+		config.expected = asserts;
+	},
+
+	/**
+	 * Asserts true.
+	 * @example ok( "asdfasdf".length > 5, "There must be at least 5 chars" );
+	 */
+	ok: function(a, msg) {
+		msg = escapeHtml(msg);
+		QUnit.log(a, msg);
+
+		config.assertions.push({
+			result: !!a,
+			message: msg
+		});
+	},
+
+	/**
+	 * Checks that the first two arguments are equal, with an optional message.
+	 * Prints out both actual and expected values.
+	 *
+	 * Prefered to ok( actual == expected, message )
+	 *
+	 * @example equal( format("Received {0} bytes.", 2), "Received 2 bytes." );
+	 *
+	 * @param Object actual
+	 * @param Object expected
+	 * @param String message (optional)
+	 */
+	equal: function(actual, expected, message) {
+		push(expected == actual, actual, expected, message);
+	},
+
+	notEqual: function(actual, expected, message) {
+		push(expected != actual, actual, expected, message);
+	},
+	
+	deepEqual: function(actual, expected, message) {
+		push(QUnit.equiv(actual, expected), actual, expected, message);
+	},
+
+	notDeepEqual: function(actual, expected, message) {
+		push(!QUnit.equiv(actual, expected), actual, expected, message);
+	},
+
+	strictEqual: function(actual, expected, message) {
+		push(expected === actual, actual, expected, message);
+	},
+
+	notStrictEqual: function(actual, expected, message) {
+		push(expected !== actual, actual, expected, message);
+	},
+
+	raises: function(fn,  message) {
+		try {
+			fn();
+			ok( false, message );
+		}
+		catch (e) {
+			ok( true, message );
+		}
+	},
+
+	start: function() {
+		// A slight delay, to avoid any current callbacks
+		if ( window.setTimeout ) {
+			window.setTimeout(function() {
+				if ( config.timeout ) {
+					clearTimeout(config.timeout);
+				}
+
+				config.blocking = false;
+				process();
+			}, 13);
+		} else {
+			config.blocking = false;
+			process();
+		}
+	},
+	
+	stop: function(timeout) {
+		config.blocking = true;
+
+		if ( timeout && window.setTimeout ) {
+			config.timeout = window.setTimeout(function() {
+				QUnit.ok( false, "Test timed out" );
+				QUnit.start();
+			}, timeout);
+		}
+	}
+
+};
+
+// Backwards compatibility, deprecated
+QUnit.equals = QUnit.equal;
+QUnit.same = QUnit.deepEqual;
+
+// Maintain internal state
+var config = {
+	// The queue of tests to run
+	queue: [],
+
+	// block until document ready
+	blocking: true
+};
+
+// Load paramaters
+(function() {
+	var location = window.location || { search: "", protocol: "file:" },
+		GETParams = location.search.slice(1).split('&');
+
+	for ( var i = 0; i < GETParams.length; i++ ) {
+		GETParams[i] = decodeURIComponent( GETParams[i] );
+		if ( GETParams[i] === "noglobals" ) {
+			GETParams.splice( i, 1 );
+			i--;
+			config.noglobals = true;
+		} else if ( GETParams[i].search('=') > -1 ) {
+			GETParams.splice( i, 1 );
+			i--;
+		}
+	}
+	
+	// restrict modules/tests by get parameters
+	config.filters = GETParams;
+	
+	// Figure out if we're running the tests from a server or not
+	QUnit.isLocal = !!(location.protocol === 'file:');
+})();
+
+// Expose the API as global variables, unless an 'exports'
+// object exists, in that case we assume we're in CommonJS
+if ( typeof exports === "undefined" || typeof require === "undefined" ) {
+	extend(window, QUnit);
+	window.QUnit = QUnit;
+} else {
+	extend(exports, QUnit);
+	exports.QUnit = QUnit;
+}
+
+// define these after exposing globals to keep them in these QUnit namespace only
+extend(QUnit, {
+	config: config,
+
+	// Initialize the configuration options
+	init: function() {
+		extend(config, {
+			stats: { all: 0, bad: 0 },
+			moduleStats: { all: 0, bad: 0 },
+			started: +new Date,
+			updateRate: 1000,
+			blocking: false,
+			autostart: true,
+			autorun: false,
+			assertions: [],
+			filters: [],
+			queue: []
+		});
+
+		var tests = id("qunit-tests"),
+			banner = id("qunit-banner"),
+			result = id("qunit-testresult");
+
+		if ( tests ) {
+			tests.innerHTML = "";
+		}
+
+		if ( banner ) {
+			banner.className = "";
+		}
+
+		if ( result ) {
+			result.parentNode.removeChild( result );
+		}
+	},
+	
+	/**
+	 * Resets the test setup. Useful for tests that modify the DOM.
+	 */
+	reset: function() {
+		if ( window.jQuery ) {
+			jQuery("#main, #qunit-fixture").html( config.fixture );
+		}
+	},
+	
+	/**
+	 * Trigger an event on an element.
+	 *
+	 * @example triggerEvent( document.body, "click" );
+	 *
+	 * @param DOMElement elem
+	 * @param String type
+	 */
+	triggerEvent: function( elem, type, event ) {
+		if ( document.createEvent ) {
+			event = document.createEvent("MouseEvents");
+			event.initMouseEvent(type, true, true, elem.ownerDocument.defaultView,
+				0, 0, 0, 0, 0, false, false, false, false, 0, null);
+			elem.dispatchEvent( event );
+
+		} else if ( elem.fireEvent ) {
+			elem.fireEvent("on"+type);
+		}
+	},
+	
+	// Safe object type checking
+	is: function( type, obj ) {
+		return QUnit.objectType( obj ) == type;
+	},
+	
+	objectType: function( obj ) {
+		if (typeof obj === "undefined") {
+				return "undefined";
+
+		// consider: typeof null === object
+		}
+		if (obj === null) {
+				return "null";
+		}
+
+		var type = Object.prototype.toString.call( obj )
+			.match(/^\[object\s(.*)\]$/)[1] || '';
+
+		switch (type) {
+				case 'Number':
+						if (isNaN(obj)) {
+								return "nan";
+						} else {
+								return "number";
+						}
+				case 'String':
+				case 'Boolean':
+				case 'Array':
+				case 'Date':
+				case 'RegExp':
+				case 'Function':
+						return type.toLowerCase();
+		}
+		if (typeof obj === "object") {
+				return "object";
+		}
+		return undefined;
+	},
+	
+	// Logging callbacks
+	begin: function() {},
+	done: function(failures, total) {},
+	log: function(result, message) {},
+	testStart: function(name, testEnvironment) {},
+	testDone: function(name, failures, total) {},
+	moduleStart: function(name, testEnvironment) {},
+	moduleDone: function(name, failures, total) {}
+});
+
+if ( typeof document === "undefined" || document.readyState === "complete" ) {
+	config.autorun = true;
+}
+
+addEvent(window, "load", function() {
+	QUnit.begin();
+	
+	// Initialize the config, saving the execution queue
+	var oldconfig = extend({}, config);
+	QUnit.init();
+	extend(config, oldconfig);
+
+	config.blocking = false;
+
+	var userAgent = id("qunit-userAgent");
+	if ( userAgent ) {
+		userAgent.innerHTML = navigator.userAgent;
+	}
+	var banner = id("qunit-header");
+	if ( banner ) {
+		banner.innerHTML = '<a href="' + location.href + '">' + banner.innerHTML + '</a>'; 
+	}
+	
+	var toolbar = id("qunit-testrunner-toolbar");
+	if ( toolbar ) {
+		toolbar.style.display = "none";
+		
+		var filter = document.createElement("input");
+		filter.type = "checkbox";
+		filter.id = "qunit-filter-pass";
+		filter.disabled = true;
+		addEvent( filter, "click", function() {
+			var li = document.getElementsByTagName("li");
+			for ( var i = 0; i < li.length; i++ ) {
+				if ( li[i].className.indexOf("pass") > -1 ) {
+					li[i].style.display = filter.checked ? "none" : "";
+				}
+			}
+		});
+		toolbar.appendChild( filter );
+
+		var label = document.createElement("label");
+		label.setAttribute("for", "qunit-filter-pass");
+		label.innerHTML = "Hide passed tests";
+		toolbar.appendChild( label );
+
+		var missing = document.createElement("input");
+		missing.type = "checkbox";
+		missing.id = "qunit-filter-missing";
+		missing.disabled = true;
+		addEvent( missing, "click", function() {
+			var li = document.getElementsByTagName("li");
+			for ( var i = 0; i < li.length; i++ ) {
+				if ( li[i].className.indexOf("fail") > -1 && li[i].innerHTML.indexOf('missing test - untested code is broken code') > - 1 ) {
+					li[i].parentNode.parentNode.style.display = missing.checked ? "none" : "block";
+				}
+			}
+		});
+		toolbar.appendChild( missing );
+
+		label = document.createElement("label");
+		label.setAttribute("for", "qunit-filter-missing");
+		label.innerHTML = "Hide missing tests (untested code is broken code)";
+		toolbar.appendChild( label );
+	}
+
+	var main = id('main') || id('qunit-fixture');
+	if ( main ) {
+		config.fixture = main.innerHTML;
+	}
+
+	if (config.autostart) {
+		QUnit.start();
+	}
+});
+
+function done() {
+	if ( config.doneTimer && window.clearTimeout ) {
+		window.clearTimeout( config.doneTimer );
+		config.doneTimer = null;
+	}
+
+	if ( config.queue.length ) {
+		config.doneTimer = window.setTimeout(function(){
+			if ( !config.queue.length ) {
+				done();
+			} else {
+				synchronize( done );
+			}
+		}, 13);
+
+		return;
+	}
+
+	config.autorun = true;
+
+	// Log the last module results
+	if ( config.currentModule ) {
+		QUnit.moduleDone( config.currentModule, config.moduleStats.bad, config.moduleStats.all );
+	}
+
+	var banner = id("qunit-banner"),
+		tests = id("qunit-tests"),
+		html = ['Tests completed in ',
+		+new Date - config.started, ' milliseconds.<br/>',
+		'<span class="passed">', config.stats.all - config.stats.bad, '</span> tests of <span class="total">', config.stats.all, '</span> passed, <span class="failed">', config.stats.bad,'</span> failed.'].join('');
+
+	if ( banner ) {
+		banner.className = (config.stats.bad ? "qunit-fail" : "qunit-pass");
+	}
+
+	if ( tests ) {	
+		var result = id("qunit-testresult");
+
+		if ( !result ) {
+			result = document.createElement("p");
+			result.id = "qunit-testresult";
+			result.className = "result";
+			tests.parentNode.insertBefore( result, tests.nextSibling );
+		}
+
+		result.innerHTML = html;
+	}
+
+	QUnit.done( config.stats.bad, config.stats.all );
+}
+
+function validTest( name ) {
+	var i = config.filters.length,
+		run = false;
+
+	if ( !i ) {
+		return true;
+	}
+	
+	while ( i-- ) {
+		var filter = config.filters[i],
+			not = filter.charAt(0) == '!';
+
+		if ( not ) {
+			filter = filter.slice(1);
+		}
+
+		if ( name.indexOf(filter) !== -1 ) {
+			return !not;
+		}
+
+		if ( not ) {
+			run = true;
+		}
+	}
+
+	return run;
+}
+
+function escapeHtml(s) {
+	s = s === null ? "" : s + "";
+	return s.replace(/[\&"<>\\]/g, function(s) {
+		switch(s) {
+			case "&": return "&amp;";
+			case "\\": return "\\\\";
+			case '"': return '\"';
+			case "<": return "&lt;";
+			case ">": return "&gt;";
+			default: return s;
+		}
+	});
+}
+
+function push(result, actual, expected, message) {
+	message = escapeHtml(message) || (result ? "okay" : "failed");
+	message = '<span class="test-message">' + message + "</span>";
+	expected = escapeHtml(QUnit.jsDump.parse(expected));
+	actual = escapeHtml(QUnit.jsDump.parse(actual));
+	var output = message + ', expected: <span class="test-expected">' + expected + '</span>';
+	if (actual != expected) {
+		output += ' result: <span class="test-actual">' + actual + '</span>, diff: ' + QUnit.diff(expected, actual);
+	}
+	
+	// can't use ok, as that would double-escape messages
+	QUnit.log(result, output);
+	config.assertions.push({
+		result: !!result,
+		message: output
+	});
+}
+
+function synchronize( callback ) {
+	config.queue.push( callback );
+
+	if ( config.autorun && !config.blocking ) {
+		process();
+	}
+}
+
+function process() {
+	var start = (new Date()).getTime();
+
+	while ( config.queue.length && !config.blocking ) {
+		if ( config.updateRate <= 0 || (((new Date()).getTime() - start) < config.updateRate) ) {
+			config.queue.shift()();
+
+		} else {
+			setTimeout( process, 13 );
+			break;
+		}
+	}
+}
+
+function saveGlobal() {
+	config.pollution = [];
+	
+	if ( config.noglobals ) {
+		for ( var key in window ) {
+			config.pollution.push( key );
+		}
+	}
+}
+
+function checkPollution( name ) {
+	var old = config.pollution;
+	saveGlobal();
+	
+	var newGlobals = diff( old, config.pollution );
+	if ( newGlobals.length > 0 ) {
+		ok( false, "Introduced global variable(s): " + newGlobals.join(", ") );
+		config.expected++;
+	}
+
+	var deletedGlobals = diff( config.pollution, old );
+	if ( deletedGlobals.length > 0 ) {
+		ok( false, "Deleted global variable(s): " + deletedGlobals.join(", ") );
+		config.expected++;
+	}
+}
+
+// returns a new Array with the elements that are in a but not in b
+function diff( a, b ) {
+	var result = a.slice();
+	for ( var i = 0; i < result.length; i++ ) {
+		for ( var j = 0; j < b.length; j++ ) {
+			if ( result[i] === b[j] ) {
+				result.splice(i, 1);
+				i--;
+				break;
+			}
+		}
+	}
+	return result;
+}
+
+function fail(message, exception, callback) {
+	if ( typeof console !== "undefined" && console.error && console.warn ) {
+		console.error(message);
+		console.error(exception);
+		console.warn(callback.toString());
+
+	} else if ( window.opera && opera.postError ) {
+		opera.postError(message, exception, callback.toString);
+	}
+}
+
+function extend(a, b) {
+	for ( var prop in b ) {
+		a[prop] = b[prop];
+	}
+
+	return a;
+}
+
+function addEvent(elem, type, fn) {
+	if ( elem.addEventListener ) {
+		elem.addEventListener( type, fn, false );
+	} else if ( elem.attachEvent ) {
+		elem.attachEvent( "on" + type, fn );
+	} else {
+		fn();
+	}
+}
+
+function id(name) {
+	return !!(typeof document !== "undefined" && document && document.getElementById) &&
+		document.getElementById( name );
+}
+
+// Test for equality any JavaScript type.
+// Discussions and reference: http://philrathe.com/articles/equiv
+// Test suites: http://philrathe.com/tests/equiv
+// Author: Philippe Rathé <prathe@gmail.com>
+QUnit.equiv = function () {
+
+    var innerEquiv; // the real equiv function
+    var callers = []; // stack to decide between skip/abort functions
+    var parents = []; // stack to avoiding loops from circular referencing
+
+    // Call the o related callback with the given arguments.
+    function bindCallbacks(o, callbacks, args) {
+        var prop = QUnit.objectType(o);
+        if (prop) {
+            if (QUnit.objectType(callbacks[prop]) === "function") {
+                return callbacks[prop].apply(callbacks, args);
+            } else {
+                return callbacks[prop]; // or undefined
+            }
+        }
+    }
+    
+    var callbacks = function () {
+
+        // for string, boolean, number and null
+        function useStrictEquality(b, a) {
+            if (b instanceof a.constructor || a instanceof b.constructor) {
+                // to catch short annotaion VS 'new' annotation of a declaration
+                // e.g. var i = 1;
+                //      var j = new Number(1);
+                return a == b;
+            } else {
+                return a === b;
+            }
+        }
+
+        return {
+            "string": useStrictEquality,
+            "boolean": useStrictEquality,
+            "number": useStrictEquality,
+            "null": useStrictEquality,
+            "undefined": useStrictEquality,
+
+            "nan": function (b) {
+                return isNaN(b);
+            },
+
+            "date": function (b, a) {
+                return QUnit.objectType(b) === "date" && a.valueOf() === b.valueOf();
+            },
+
+            "regexp": function (b, a) {
+                return QUnit.objectType(b) === "regexp" &&
+                    a.source === b.source && // the regex itself
+                    a.global === b.global && // and its modifers (gmi) ...
+                    a.ignoreCase === b.ignoreCase &&
+                    a.multiline === b.multiline;
+            },
+
+            // - skip when the property is a method of an instance (OOP)
+            // - abort otherwise,
+            //   initial === would have catch identical references anyway
+            "function": function () {
+                var caller = callers[callers.length - 1];
+                return caller !== Object &&
+                        typeof caller !== "undefined";
+            },
+
+            "array": function (b, a) {
+                var i, j, loop;
+                var len;
+
+                // b could be an object literal here
+                if ( ! (QUnit.objectType(b) === "array")) {
+                    return false;
+                }   
+                
+                len = a.length;
+                if (len !== b.length) { // safe and faster
+                    return false;
+                }
+                
+                //track reference to avoid circular references
+                parents.push(a);
+                for (i = 0; i < len; i++) {
+                    loop = false;
+                    for(j=0;j<parents.length;j++){
+                        if(parents[j] === a[i]){
+                            loop = true;//dont rewalk array
+                        }
+                    }
+                    if (!loop && ! innerEquiv(a[i], b[i])) {
+                        parents.pop();
+                        return false;
+                    }
+                }
+                parents.pop();
+                return true;
+            },
+
+            "object": function (b, a) {
+                var i, j, loop;
+                var eq = true; // unless we can proove it
+                var aProperties = [], bProperties = []; // collection of strings
+
+                // comparing constructors is more strict than using instanceof
+                if ( a.constructor !== b.constructor) {
+                    return false;
+                }
+
+                // stack constructor before traversing properties
+                callers.push(a.constructor);
+                //track reference to avoid circular references
+                parents.push(a);
+                
+                for (i in a) { // be strict: don't ensures hasOwnProperty and go deep
+                    loop = false;
+                    for(j=0;j<parents.length;j++){
+                        if(parents[j] === a[i])
+                            loop = true; //don't go down the same path twice
+                    }
+                    aProperties.push(i); // collect a's properties
+
+                    if (!loop && ! innerEquiv(a[i], b[i])) {
+                        eq = false;
+                        break;
+                    }
+                }
+
+                callers.pop(); // unstack, we are done
+                parents.pop();
+
+                for (i in b) {
+                    bProperties.push(i); // collect b's properties
+                }
+
+                // Ensures identical properties name
+                return eq && innerEquiv(aProperties.sort(), bProperties.sort());
+            }
+        };
+    }();
+
+    innerEquiv = function () { // can take multiple arguments
+        var args = Array.prototype.slice.apply(arguments);
+        if (args.length < 2) {
+            return true; // end transition
+        }
+
+        return (function (a, b) {
+            if (a === b) {
+                return true; // catch the most you can
+            } else if (a === null || b === null || typeof a === "undefined" || typeof b === "undefined" || QUnit.objectType(a) !== QUnit.objectType(b)) {
+                return false; // don't lose time with error prone cases
+            } else {
+                return bindCallbacks(a, callbacks, [b, a]);
+            }
+
+        // apply transition with (1..n) arguments
+        })(args[0], args[1]) && arguments.callee.apply(this, args.splice(1, args.length -1));
+    };
+
+    return innerEquiv;
+
+}();
+
+/**
+ * jsDump
+ * Copyright (c) 2008 Ariel Flesler - aflesler(at)gmail(dot)com | http://flesler.blogspot.com
+ * Licensed under BSD (http://www.opensource.org/licenses/bsd-license.php)
+ * Date: 5/15/2008
+ * @projectDescription Advanced and extensible data dumping for Javascript.
+ * @version 1.0.0
+ * @author Ariel Flesler
+ * @link {http://flesler.blogspot.com/2008/05/jsdump-pretty-dump-of-any-javascript.html}
+ */
+QUnit.jsDump = (function() {
+	function quote( str ) {
+		return '"' + str.toString().replace(/"/g, '\\"') + '"';
+	};
+	function literal( o ) {
+		return o + '';	
+	};
+	function join( pre, arr, post ) {
+		var s = jsDump.separator(),
+			base = jsDump.indent(),
+			inner = jsDump.indent(1);
+		if ( arr.join )
+			arr = arr.join( ',' + s + inner );
+		if ( !arr )
+			return pre + post;
+		return [ pre, inner + arr, base + post ].join(s);
+	};
+	function array( arr ) {
+		var i = arr.length,	ret = Array(i);					
+		this.up();
+		while ( i-- )
+			ret[i] = this.parse( arr[i] );				
+		this.down();
+		return join( '[', ret, ']' );
+	};
+	
+	var reName = /^function (\w+)/;
+	
+	var jsDump = {
+		parse:function( obj, type ) { //type is used mostly internally, you can fix a (custom)type in advance
+			var	parser = this.parsers[ type || this.typeOf(obj) ];
+			type = typeof parser;			
+			
+			return type == 'function' ? parser.call( this, obj ) :
+				   type == 'string' ? parser :
+				   this.parsers.error;
+		},
+		typeOf:function( obj ) {
+			var type;
+			if ( obj === null ) {
+				type = "null";
+			} else if (typeof obj === "undefined") {
+				type = "undefined";
+			} else if (QUnit.is("RegExp", obj)) {
+				type = "regexp";
+			} else if (QUnit.is("Date", obj)) {
+				type = "date";
+			} else if (QUnit.is("Function", obj)) {
+				type = "function";
+			} else if (obj.setInterval && obj.document && !obj.nodeType) {
+				type = "window";
+			} else if (obj.nodeType === 9) {
+				type = "document";
+			} else if (obj.nodeType) {
+				type = "node";
+			} else if (typeof obj === "object" && typeof obj.length === "number" && obj.length >= 0) {
+				type = "array";
+			} else {
+				type = typeof obj;
+			}
+			return type;
+		},
+		separator:function() {
+			return this.multiline ?	this.HTML ? '<br />' : '\n' : this.HTML ? '&nbsp;' : ' ';
+		},
+		indent:function( extra ) {// extra can be a number, shortcut for increasing-calling-decreasing
+			if ( !this.multiline )
+				return '';
+			var chr = this.indentChar;
+			if ( this.HTML )
+				chr = chr.replace(/\t/g,'   ').replace(/ /g,'&nbsp;');
+			return Array( this._depth_ + (extra||0) ).join(chr);
+		},
+		up:function( a ) {
+			this._depth_ += a || 1;
+		},
+		down:function( a ) {
+			this._depth_ -= a || 1;
+		},
+		setParser:function( name, parser ) {
+			this.parsers[name] = parser;
+		},
+		// The next 3 are exposed so you can use them
+		quote:quote, 
+		literal:literal,
+		join:join,
+		//
+		_depth_: 1,
+		// This is the list of parsers, to modify them, use jsDump.setParser
+		parsers:{
+			window: '[Window]',
+			document: '[Document]',
+			error:'[ERROR]', //when no parser is found, shouldn't happen
+			unknown: '[Unknown]',
+			'null':'null',
+			undefined:'undefined',
+			'function':function( fn ) {
+				var ret = 'function',
+					name = 'name' in fn ? fn.name : (reName.exec(fn)||[])[1];//functions never have name in IE
+				if ( name )
+					ret += ' ' + name;
+				ret += '(';
+				
+				ret = [ ret, this.parse( fn, 'functionArgs' ), '){'].join('');
+				return join( ret, this.parse(fn,'functionCode'), '}' );
+			},
+			array: array,
+			nodelist: array,
+			arguments: array,
+			object:function( map ) {
+				var ret = [ ];
+				this.up();
+				for ( var key in map )
+					ret.push( this.parse(key,'key') + ': ' + this.parse(map[key]) );
+				this.down();
+				return join( '{', ret, '}' );
+			},
+			node:function( node ) {
+				var open = this.HTML ? '&lt;' : '<',
+					close = this.HTML ? '&gt;' : '>';
+					
+				var tag = node.nodeName.toLowerCase(),
+					ret = open + tag;
+					
+				for ( var a in this.DOMAttrs ) {
+					var val = node[this.DOMAttrs[a]];
+					if ( val )
+						ret += ' ' + a + '=' + this.parse( val, 'attribute' );
+				}
+				return ret + close + open + '/' + tag + close;
+			},
+			functionArgs:function( fn ) {//function calls it internally, it's the arguments part of the function
+				var l = fn.length;
+				if ( !l ) return '';				
+				
+				var args = Array(l);
+				while ( l-- )
+					args[l] = String.fromCharCode(97+l);//97 is 'a'
+				return ' ' + args.join(', ') + ' ';
+			},
+			key:quote, //object calls it internally, the key part of an item in a map
+			functionCode:'[code]', //function calls it internally, it's the content of the function
+			attribute:quote, //node calls it internally, it's an html attribute value
+			string:quote,
+			date:quote,
+			regexp:literal, //regex
+			number:literal,
+			'boolean':literal
+		},
+		DOMAttrs:{//attributes to dump from nodes, name=>realName
+			id:'id',
+			name:'name',
+			'class':'className'
+		},
+		HTML:false,//if true, entities are escaped ( <, >, \t, space and \n )
+		indentChar:'   ',//indentation unit
+		multiline:false //if true, items in a collection, are separated by a \n, else just a space.
+	};
+
+	return jsDump;
+})();
+
+// from Sizzle.js
+function getText( elems ) {
+	var ret = "", elem;
+
+	for ( var i = 0; elems[i]; i++ ) {
+		elem = elems[i];
+
+		// Get the text from text nodes and CDATA nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 4 ) {
+			ret += elem.nodeValue;
+
+		// Traverse everything else, except comment nodes
+		} else if ( elem.nodeType !== 8 ) {
+			ret += getText( elem.childNodes );
+		}
+	}
+
+	return ret;
+};
+
+/*
+ * Javascript Diff Algorithm
+ *  By John Resig (http://ejohn.org/)
+ *  Modified by Chu Alan "sprite"
+ *
+ * Released under the MIT license.
+ *
+ * More Info:
+ *  http://ejohn.org/projects/javascript-diff-algorithm/
+ *  
+ * Usage: QUnit.diff(expected, actual)
+ * 
+ * QUnit.diff("the quick brown fox jumped over", "the quick fox jumps over") == "the  quick <del>brown </del> fox <del>jumped </del><ins>jumps </ins> over"
+ */
+QUnit.diff = (function() {
+	function diff(o, n){
+		var ns = new Object();
+		var os = new Object();
+		
+		for (var i = 0; i < n.length; i++) {
+			if (ns[n[i]] == null) 
+				ns[n[i]] = {
+					rows: new Array(),
+					o: null
+				};
+			ns[n[i]].rows.push(i);
+		}
+		
+		for (var i = 0; i < o.length; i++) {
+			if (os[o[i]] == null) 
+				os[o[i]] = {
+					rows: new Array(),
+					n: null
+				};
+			os[o[i]].rows.push(i);
+		}
+		
+		for (var i in ns) {
+			if (ns[i].rows.length == 1 && typeof(os[i]) != "undefined" && os[i].rows.length == 1) {
+				n[ns[i].rows[0]] = {
+					text: n[ns[i].rows[0]],
+					row: os[i].rows[0]
+				};
+				o[os[i].rows[0]] = {
+					text: o[os[i].rows[0]],
+					row: ns[i].rows[0]
+				};
+			}
+		}
+		
+		for (var i = 0; i < n.length - 1; i++) {
+			if (n[i].text != null && n[i + 1].text == null && n[i].row + 1 < o.length && o[n[i].row + 1].text == null &&
+			n[i + 1] == o[n[i].row + 1]) {
+				n[i + 1] = {
+					text: n[i + 1],
+					row: n[i].row + 1
+				};
+				o[n[i].row + 1] = {
+					text: o[n[i].row + 1],
+					row: i + 1
+				};
+			}
+		}
+		
+		for (var i = n.length - 1; i > 0; i--) {
+			if (n[i].text != null && n[i - 1].text == null && n[i].row > 0 && o[n[i].row - 1].text == null &&
+			n[i - 1] == o[n[i].row - 1]) {
+				n[i - 1] = {
+					text: n[i - 1],
+					row: n[i].row - 1
+				};
+				o[n[i].row - 1] = {
+					text: o[n[i].row - 1],
+					row: i - 1
+				};
+			}
+		}
+		
+		return {
+			o: o,
+			n: n
+		};
+	}
+	
+	return function(o, n){
+		o = o.replace(/\s+$/, '');
+		n = n.replace(/\s+$/, '');
+		var out = diff(o == "" ? [] : o.split(/\s+/), n == "" ? [] : n.split(/\s+/));
+
+		var str = "";
+		
+		var oSpace = o.match(/\s+/g);
+		if (oSpace == null) {
+			oSpace = [" "];
+		}
+		else {
+			oSpace.push(" ");
+		}
+		var nSpace = n.match(/\s+/g);
+		if (nSpace == null) {
+			nSpace = [" "];
+		}
+		else {
+			nSpace.push(" ");
+		}
+		
+		if (out.n.length == 0) {
+			for (var i = 0; i < out.o.length; i++) {
+				str += '<del>' + out.o[i] + oSpace[i] + "</del>";
+			}
+		}
+		else {
+			if (out.n[0].text == null) {
+				for (n = 0; n < out.o.length && out.o[n].text == null; n++) {
+					str += '<del>' + out.o[n] + oSpace[n] + "</del>";
+				}
+			}
+			
+			for (var i = 0; i < out.n.length; i++) {
+				if (out.n[i].text == null) {
+					str += '<ins>' + out.n[i] + nSpace[i] + "</ins>";
+				}
+				else {
+					var pre = "";
+					
+					for (n = out.n[i].row + 1; n < out.o.length && out.o[n].text == null; n++) {
+						pre += '<del>' + out.o[n] + oSpace[n] + "</del>";
+					}
+					str += " " + out.n[i].text + nSpace[i] + pre;
+				}
+			}
+		}
+		
+		return str;
+	}
+})();
+
+})(this);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/jquery-1.5.1.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,8316 @@
+/*!
+ * jQuery JavaScript Library v1.5.1
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Wed Feb 23 13:55:29 2011 -0500
+ */
+(function( window, undefined ) {
+
+// Use the correct document accordingly with window argument (sandbox)
+var document = window.document;
+var jQuery = (function() {
+
+// Define a local copy of jQuery
+var jQuery = function( selector, context ) {
+		// The jQuery object is actually just the init constructor 'enhanced'
+		return new jQuery.fn.init( selector, context, rootjQuery );
+	},
+
+	// Map over jQuery in case of overwrite
+	_jQuery = window.jQuery,
+
+	// Map over the $ in case of overwrite
+	_$ = window.$,
+
+	// A central reference to the root jQuery(document)
+	rootjQuery,
+
+	// A simple way to check for HTML strings or ID strings
+	// (both of which we optimize for)
+	quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,
+
+	// Check if a string has a non-whitespace character in it
+	rnotwhite = /\S/,
+
+	// Used for trimming whitespace
+	trimLeft = /^\s+/,
+	trimRight = /\s+$/,
+
+	// Check for digits
+	rdigit = /\d/,
+
+	// Match a standalone tag
+	rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
+
+	// JSON RegExp
+	rvalidchars = /^[\],:{}\s]*$/,
+	rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,
+	rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,
+	rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
+
+	// Useragent RegExp
+	rwebkit = /(webkit)[ \/]([\w.]+)/,
+	ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/,
+	rmsie = /(msie) ([\w.]+)/,
+	rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/,
+
+	// Keep a UserAgent string for use with jQuery.browser
+	userAgent = navigator.userAgent,
+
+	// For matching the engine and version of the browser
+	browserMatch,
+
+	// Has the ready events already been bound?
+	readyBound = false,
+
+	// The deferred used on DOM ready
+	readyList,
+
+	// Promise methods
+	promiseMethods = "then done fail isResolved isRejected promise".split( " " ),
+
+	// The ready event handler
+	DOMContentLoaded,
+
+	// Save a reference to some core methods
+	toString = Object.prototype.toString,
+	hasOwn = Object.prototype.hasOwnProperty,
+	push = Array.prototype.push,
+	slice = Array.prototype.slice,
+	trim = String.prototype.trim,
+	indexOf = Array.prototype.indexOf,
+
+	// [[Class]] -> type pairs
+	class2type = {};
+
+jQuery.fn = jQuery.prototype = {
+	constructor: jQuery,
+	init: function( selector, context, rootjQuery ) {
+		var match, elem, ret, doc;
+
+		// Handle $(""), $(null), or $(undefined)
+		if ( !selector ) {
+			return this;
+		}
+
+		// Handle $(DOMElement)
+		if ( selector.nodeType ) {
+			this.context = this[0] = selector;
+			this.length = 1;
+			return this;
+		}
+
+		// The body element only exists once, optimize finding it
+		if ( selector === "body" && !context && document.body ) {
+			this.context = document;
+			this[0] = document.body;
+			this.selector = "body";
+			this.length = 1;
+			return this;
+		}
+
+		// Handle HTML strings
+		if ( typeof selector === "string" ) {
+			// Are we dealing with HTML string or an ID?
+			match = quickExpr.exec( selector );
+
+			// Verify a match, and that no context was specified for #id
+			if ( match && (match[1] || !context) ) {
+
+				// HANDLE: $(html) -> $(array)
+				if ( match[1] ) {
+					context = context instanceof jQuery ? context[0] : context;
+					doc = (context ? context.ownerDocument || context : document);
+
+					// If a single string is passed in and it's a single tag
+					// just do a createElement and skip the rest
+					ret = rsingleTag.exec( selector );
+
+					if ( ret ) {
+						if ( jQuery.isPlainObject( context ) ) {
+							selector = [ document.createElement( ret[1] ) ];
+							jQuery.fn.attr.call( selector, context, true );
+
+						} else {
+							selector = [ doc.createElement( ret[1] ) ];
+						}
+
+					} else {
+						ret = jQuery.buildFragment( [ match[1] ], [ doc ] );
+						selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes;
+					}
+
+					return jQuery.merge( this, selector );
+
+				// HANDLE: $("#id")
+				} else {
+					elem = document.getElementById( match[2] );
+
+					// Check parentNode to catch when Blackberry 4.6 returns
+					// nodes that are no longer in the document #6963
+					if ( elem && elem.parentNode ) {
+						// Handle the case where IE and Opera return items
+						// by name instead of ID
+						if ( elem.id !== match[2] ) {
+							return rootjQuery.find( selector );
+						}
+
+						// Otherwise, we inject the element directly into the jQuery object
+						this.length = 1;
+						this[0] = elem;
+					}
+
+					this.context = document;
+					this.selector = selector;
+					return this;
+				}
+
+			// HANDLE: $(expr, $(...))
+			} else if ( !context || context.jquery ) {
+				return (context || rootjQuery).find( selector );
+
+			// HANDLE: $(expr, context)
+			// (which is just equivalent to: $(context).find(expr)
+			} else {
+				return this.constructor( context ).find( selector );
+			}
+
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( jQuery.isFunction( selector ) ) {
+			return rootjQuery.ready( selector );
+		}
+
+		if (selector.selector !== undefined) {
+			this.selector = selector.selector;
+			this.context = selector.context;
+		}
+
+		return jQuery.makeArray( selector, this );
+	},
+
+	// Start with an empty selector
+	selector: "",
+
+	// The current version of jQuery being used
+	jquery: "1.5.1",
+
+	// The default length of a jQuery object is 0
+	length: 0,
+
+	// The number of elements contained in the matched element set
+	size: function() {
+		return this.length;
+	},
+
+	toArray: function() {
+		return slice.call( this, 0 );
+	},
+
+	// Get the Nth element in the matched element set OR
+	// Get the whole matched element set as a clean array
+	get: function( num ) {
+		return num == null ?
+
+			// Return a 'clean' array
+			this.toArray() :
+
+			// Return just the object
+			( num < 0 ? this[ this.length + num ] : this[ num ] );
+	},
+
+	// Take an array of elements and push it onto the stack
+	// (returning the new matched element set)
+	pushStack: function( elems, name, selector ) {
+		// Build a new jQuery matched element set
+		var ret = this.constructor();
+
+		if ( jQuery.isArray( elems ) ) {
+			push.apply( ret, elems );
+
+		} else {
+			jQuery.merge( ret, elems );
+		}
+
+		// Add the old object onto the stack (as a reference)
+		ret.prevObject = this;
+
+		ret.context = this.context;
+
+		if ( name === "find" ) {
+			ret.selector = this.selector + (this.selector ? " " : "") + selector;
+		} else if ( name ) {
+			ret.selector = this.selector + "." + name + "(" + selector + ")";
+		}
+
+		// Return the newly-formed element set
+		return ret;
+	},
+
+	// Execute a callback for every element in the matched set.
+	// (You can seed the arguments with an array of args, but this is
+	// only used internally.)
+	each: function( callback, args ) {
+		return jQuery.each( this, callback, args );
+	},
+
+	ready: function( fn ) {
+		// Attach the listeners
+		jQuery.bindReady();
+
+		// Add the callback
+		readyList.done( fn );
+
+		return this;
+	},
+
+	eq: function( i ) {
+		return i === -1 ?
+			this.slice( i ) :
+			this.slice( i, +i + 1 );
+	},
+
+	first: function() {
+		return this.eq( 0 );
+	},
+
+	last: function() {
+		return this.eq( -1 );
+	},
+
+	slice: function() {
+		return this.pushStack( slice.apply( this, arguments ),
+			"slice", slice.call(arguments).join(",") );
+	},
+
+	map: function( callback ) {
+		return this.pushStack( jQuery.map(this, function( elem, i ) {
+			return callback.call( elem, i, elem );
+		}));
+	},
+
+	end: function() {
+		return this.prevObject || this.constructor(null);
+	},
+
+	// For internal use only.
+	// Behaves like an Array's method, not like a jQuery method.
+	push: push,
+	sort: [].sort,
+	splice: [].splice
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+jQuery.extend = jQuery.fn.extend = function() {
+	var options, name, src, copy, copyIsArray, clone,
+		target = arguments[0] || {},
+		i = 1,
+		length = arguments.length,
+		deep = false;
+
+	// Handle a deep copy situation
+	if ( typeof target === "boolean" ) {
+		deep = target;
+		target = arguments[1] || {};
+		// skip the boolean and the target
+		i = 2;
+	}
+
+	// Handle case when target is a string or something (possible in deep copy)
+	if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+		target = {};
+	}
+
+	// extend jQuery itself if only one argument is passed
+	if ( length === i ) {
+		target = this;
+		--i;
+	}
+
+	for ( ; i < length; i++ ) {
+		// Only deal with non-null/undefined values
+		if ( (options = arguments[ i ]) != null ) {
+			// Extend the base object
+			for ( name in options ) {
+				src = target[ name ];
+				copy = options[ name ];
+
+				// Prevent never-ending loop
+				if ( target === copy ) {
+					continue;
+				}
+
+				// Recurse if we're merging plain objects or arrays
+				if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+					if ( copyIsArray ) {
+						copyIsArray = false;
+						clone = src && jQuery.isArray(src) ? src : [];
+
+					} else {
+						clone = src && jQuery.isPlainObject(src) ? src : {};
+					}
+
+					// Never move original objects, clone them
+					target[ name ] = jQuery.extend( deep, clone, copy );
+
+				// Don't bring in undefined values
+				} else if ( copy !== undefined ) {
+					target[ name ] = copy;
+				}
+			}
+		}
+	}
+
+	// Return the modified object
+	return target;
+};
+
+jQuery.extend({
+	noConflict: function( deep ) {
+		window.$ = _$;
+
+		if ( deep ) {
+			window.jQuery = _jQuery;
+		}
+
+		return jQuery;
+	},
+
+	// Is the DOM ready to be used? Set to true once it occurs.
+	isReady: false,
+
+	// A counter to track how many items to wait for before
+	// the ready event fires. See #6781
+	readyWait: 1,
+
+	// Handle when the DOM is ready
+	ready: function( wait ) {
+		// A third-party is pushing the ready event forwards
+		if ( wait === true ) {
+			jQuery.readyWait--;
+		}
+
+		// Make sure that the DOM is not already loaded
+		if ( !jQuery.readyWait || (wait !== true && !jQuery.isReady) ) {
+			// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+			if ( !document.body ) {
+				return setTimeout( jQuery.ready, 1 );
+			}
+
+			// Remember that the DOM is ready
+			jQuery.isReady = true;
+
+			// If a normal DOM Ready event fired, decrement, and wait if need be
+			if ( wait !== true && --jQuery.readyWait > 0 ) {
+				return;
+			}
+
+			// If there are functions bound, to execute
+			readyList.resolveWith( document, [ jQuery ] );
+
+			// Trigger any bound ready events
+			if ( jQuery.fn.trigger ) {
+				jQuery( document ).trigger( "ready" ).unbind( "ready" );
+			}
+		}
+	},
+
+	bindReady: function() {
+		if ( readyBound ) {
+			return;
+		}
+
+		readyBound = true;
+
+		// Catch cases where $(document).ready() is called after the
+		// browser event has already occurred.
+		if ( document.readyState === "complete" ) {
+			// Handle it asynchronously to allow scripts the opportunity to delay ready
+			return setTimeout( jQuery.ready, 1 );
+		}
+
+		// Mozilla, Opera and webkit nightlies currently support this event
+		if ( document.addEventListener ) {
+			// Use the handy event callback
+			document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+
+			// A fallback to window.onload, that will always work
+			window.addEventListener( "load", jQuery.ready, false );
+
+		// If IE event model is used
+		} else if ( document.attachEvent ) {
+			// ensure firing before onload,
+			// maybe late but safe also for iframes
+			document.attachEvent("onreadystatechange", DOMContentLoaded);
+
+			// A fallback to window.onload, that will always work
+			window.attachEvent( "onload", jQuery.ready );
+
+			// If IE and not a frame
+			// continually check to see if the document is ready
+			var toplevel = false;
+
+			try {
+				toplevel = window.frameElement == null;
+			} catch(e) {}
+
+			if ( document.documentElement.doScroll && toplevel ) {
+				doScrollCheck();
+			}
+		}
+	},
+
+	// See test/unit/core.js for details concerning isFunction.
+	// Since version 1.3, DOM methods and functions like alert
+	// aren't supported. They return false on IE (#2968).
+	isFunction: function( obj ) {
+		return jQuery.type(obj) === "function";
+	},
+
+	isArray: Array.isArray || function( obj ) {
+		return jQuery.type(obj) === "array";
+	},
+
+	// A crude way of determining if an object is a window
+	isWindow: function( obj ) {
+		return obj && typeof obj === "object" && "setInterval" in obj;
+	},
+
+	isNaN: function( obj ) {
+		return obj == null || !rdigit.test( obj ) || isNaN( obj );
+	},
+
+	type: function( obj ) {
+		return obj == null ?
+			String( obj ) :
+			class2type[ toString.call(obj) ] || "object";
+	},
+
+	isPlainObject: function( obj ) {
+		// Must be an Object.
+		// Because of IE, we also have to check the presence of the constructor property.
+		// Make sure that DOM nodes and window objects don't pass through, as well
+		if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
+			return false;
+		}
+
+		// Not own constructor property must be Object
+		if ( obj.constructor &&
+			!hasOwn.call(obj, "constructor") &&
+			!hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
+			return false;
+		}
+
+		// Own properties are enumerated firstly, so to speed up,
+		// if last one is own, then all properties are own.
+
+		var key;
+		for ( key in obj ) {}
+
+		return key === undefined || hasOwn.call( obj, key );
+	},
+
+	isEmptyObject: function( obj ) {
+		for ( var name in obj ) {
+			return false;
+		}
+		return true;
+	},
+
+	error: function( msg ) {
+		throw msg;
+	},
+
+	parseJSON: function( data ) {
+		if ( typeof data !== "string" || !data ) {
+			return null;
+		}
+
+		// Make sure leading/trailing whitespace is removed (IE can't handle it)
+		data = jQuery.trim( data );
+
+		// Make sure the incoming data is actual JSON
+		// Logic borrowed from http://json.org/json2.js
+		if ( rvalidchars.test(data.replace(rvalidescape, "@")
+			.replace(rvalidtokens, "]")
+			.replace(rvalidbraces, "")) ) {
+
+			// Try to use the native JSON parser first
+			return window.JSON && window.JSON.parse ?
+				window.JSON.parse( data ) :
+				(new Function("return " + data))();
+
+		} else {
+			jQuery.error( "Invalid JSON: " + data );
+		}
+	},
+
+	// Cross-browser xml parsing
+	// (xml & tmp used internally)
+	parseXML: function( data , xml , tmp ) {
+
+		if ( window.DOMParser ) { // Standard
+			tmp = new DOMParser();
+			xml = tmp.parseFromString( data , "text/xml" );
+		} else { // IE
+			xml = new ActiveXObject( "Microsoft.XMLDOM" );
+			xml.async = "false";
+			xml.loadXML( data );
+		}
+
+		tmp = xml.documentElement;
+
+		if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) {
+			jQuery.error( "Invalid XML: " + data );
+		}
+
+		return xml;
+	},
+
+	noop: function() {},
+
+	// Evalulates a script in a global context
+	globalEval: function( data ) {
+		if ( data && rnotwhite.test(data) ) {
+			// Inspired by code by Andrea Giammarchi
+			// http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
+			var head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement,
+				script = document.createElement( "script" );
+
+			if ( jQuery.support.scriptEval() ) {
+				script.appendChild( document.createTextNode( data ) );
+			} else {
+				script.text = data;
+			}
+
+			// Use insertBefore instead of appendChild to circumvent an IE6 bug.
+			// This arises when a base node is used (#2709).
+			head.insertBefore( script, head.firstChild );
+			head.removeChild( script );
+		}
+	},
+
+	nodeName: function( elem, name ) {
+		return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
+	},
+
+	// args is for internal usage only
+	each: function( object, callback, args ) {
+		var name, i = 0,
+			length = object.length,
+			isObj = length === undefined || jQuery.isFunction(object);
+
+		if ( args ) {
+			if ( isObj ) {
+				for ( name in object ) {
+					if ( callback.apply( object[ name ], args ) === false ) {
+						break;
+					}
+				}
+			} else {
+				for ( ; i < length; ) {
+					if ( callback.apply( object[ i++ ], args ) === false ) {
+						break;
+					}
+				}
+			}
+
+		// A special, fast, case for the most common use of each
+		} else {
+			if ( isObj ) {
+				for ( name in object ) {
+					if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
+						break;
+					}
+				}
+			} else {
+				for ( var value = object[0];
+					i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {}
+			}
+		}
+
+		return object;
+	},
+
+	// Use native String.trim function wherever possible
+	trim: trim ?
+		function( text ) {
+			return text == null ?
+				"" :
+				trim.call( text );
+		} :
+
+		// Otherwise use our own trimming functionality
+		function( text ) {
+			return text == null ?
+				"" :
+				text.toString().replace( trimLeft, "" ).replace( trimRight, "" );
+		},
+
+	// results is for internal usage only
+	makeArray: function( array, results ) {
+		var ret = results || [];
+
+		if ( array != null ) {
+			// The window, strings (and functions) also have 'length'
+			// The extra typeof function check is to prevent crashes
+			// in Safari 2 (See: #3039)
+			// Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
+			var type = jQuery.type(array);
+
+			if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) {
+				push.call( ret, array );
+			} else {
+				jQuery.merge( ret, array );
+			}
+		}
+
+		return ret;
+	},
+
+	inArray: function( elem, array ) {
+		if ( array.indexOf ) {
+			return array.indexOf( elem );
+		}
+
+		for ( var i = 0, length = array.length; i < length; i++ ) {
+			if ( array[ i ] === elem ) {
+				return i;
+			}
+		}
+
+		return -1;
+	},
+
+	merge: function( first, second ) {
+		var i = first.length,
+			j = 0;
+
+		if ( typeof second.length === "number" ) {
+			for ( var l = second.length; j < l; j++ ) {
+				first[ i++ ] = second[ j ];
+			}
+
+		} else {
+			while ( second[j] !== undefined ) {
+				first[ i++ ] = second[ j++ ];
+			}
+		}
+
+		first.length = i;
+
+		return first;
+	},
+
+	grep: function( elems, callback, inv ) {
+		var ret = [], retVal;
+		inv = !!inv;
+
+		// Go through the array, only saving the items
+		// that pass the validator function
+		for ( var i = 0, length = elems.length; i < length; i++ ) {
+			retVal = !!callback( elems[ i ], i );
+			if ( inv !== retVal ) {
+				ret.push( elems[ i ] );
+			}
+		}
+
+		return ret;
+	},
+
+	// arg is for internal usage only
+	map: function( elems, callback, arg ) {
+		var ret = [], value;
+
+		// Go through the array, translating each of the items to their
+		// new value (or values).
+		for ( var i = 0, length = elems.length; i < length; i++ ) {
+			value = callback( elems[ i ], i, arg );
+
+			if ( value != null ) {
+				ret[ ret.length ] = value;
+			}
+		}
+
+		// Flatten any nested arrays
+		return ret.concat.apply( [], ret );
+	},
+
+	// A global GUID counter for objects
+	guid: 1,
+
+	proxy: function( fn, proxy, thisObject ) {
+		if ( arguments.length === 2 ) {
+			if ( typeof proxy === "string" ) {
+				thisObject = fn;
+				fn = thisObject[ proxy ];
+				proxy = undefined;
+
+			} else if ( proxy && !jQuery.isFunction( proxy ) ) {
+				thisObject = proxy;
+				proxy = undefined;
+			}
+		}
+
+		if ( !proxy && fn ) {
+			proxy = function() {
+				return fn.apply( thisObject || this, arguments );
+			};
+		}
+
+		// Set the guid of unique handler to the same of original handler, so it can be removed
+		if ( fn ) {
+			proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+		}
+
+		// So proxy can be declared as an argument
+		return proxy;
+	},
+
+	// Mutifunctional method to get and set values to a collection
+	// The value/s can be optionally by executed if its a function
+	access: function( elems, key, value, exec, fn, pass ) {
+		var length = elems.length;
+
+		// Setting many attributes
+		if ( typeof key === "object" ) {
+			for ( var k in key ) {
+				jQuery.access( elems, k, key[k], exec, fn, value );
+			}
+			return elems;
+		}
+
+		// Setting one attribute
+		if ( value !== undefined ) {
+			// Optionally, function values get executed if exec is true
+			exec = !pass && exec && jQuery.isFunction(value);
+
+			for ( var i = 0; i < length; i++ ) {
+				fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+			}
+
+			return elems;
+		}
+
+		// Getting an attribute
+		return length ? fn( elems[0], key ) : undefined;
+	},
+
+	now: function() {
+		return (new Date()).getTime();
+	},
+
+	// Create a simple deferred (one callbacks list)
+	_Deferred: function() {
+		var // callbacks list
+			callbacks = [],
+			// stored [ context , args ]
+			fired,
+			// to avoid firing when already doing so
+			firing,
+			// flag to know if the deferred has been cancelled
+			cancelled,
+			// the deferred itself
+			deferred  = {
+
+				// done( f1, f2, ...)
+				done: function() {
+					if ( !cancelled ) {
+						var args = arguments,
+							i,
+							length,
+							elem,
+							type,
+							_fired;
+						if ( fired ) {
+							_fired = fired;
+							fired = 0;
+						}
+						for ( i = 0, length = args.length; i < length; i++ ) {
+							elem = args[ i ];
+							type = jQuery.type( elem );
+							if ( type === "array" ) {
+								deferred.done.apply( deferred, elem );
+							} else if ( type === "function" ) {
+								callbacks.push( elem );
+							}
+						}
+						if ( _fired ) {
+							deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] );
+						}
+					}
+					return this;
+				},
+
+				// resolve with given context and args
+				resolveWith: function( context, args ) {
+					if ( !cancelled && !fired && !firing ) {
+						firing = 1;
+						try {
+							while( callbacks[ 0 ] ) {
+								callbacks.shift().apply( context, args );
+							}
+						}
+						// We have to add a catch block for
+						// IE prior to 8 or else the finally
+						// block will never get executed
+						catch (e) {
+							throw e;
+						}
+						finally {
+							fired = [ context, args ];
+							firing = 0;
+						}
+					}
+					return this;
+				},
+
+				// resolve with this as context and given arguments
+				resolve: function() {
+					deferred.resolveWith( jQuery.isFunction( this.promise ) ? this.promise() : this, arguments );
+					return this;
+				},
+
+				// Has this deferred been resolved?
+				isResolved: function() {
+					return !!( firing || fired );
+				},
+
+				// Cancel
+				cancel: function() {
+					cancelled = 1;
+					callbacks = [];
+					return this;
+				}
+			};
+
+		return deferred;
+	},
+
+	// Full fledged deferred (two callbacks list)
+	Deferred: function( func ) {
+		var deferred = jQuery._Deferred(),
+			failDeferred = jQuery._Deferred(),
+			promise;
+		// Add errorDeferred methods, then and promise
+		jQuery.extend( deferred, {
+			then: function( doneCallbacks, failCallbacks ) {
+				deferred.done( doneCallbacks ).fail( failCallbacks );
+				return this;
+			},
+			fail: failDeferred.done,
+			rejectWith: failDeferred.resolveWith,
+			reject: failDeferred.resolve,
+			isRejected: failDeferred.isResolved,
+			// Get a promise for this deferred
+			// If obj is provided, the promise aspect is added to the object
+			promise: function( obj ) {
+				if ( obj == null ) {
+					if ( promise ) {
+						return promise;
+					}
+					promise = obj = {};
+				}
+				var i = promiseMethods.length;
+				while( i-- ) {
+					obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ];
+				}
+				return obj;
+			}
+		} );
+		// Make sure only one callback list will be used
+		deferred.done( failDeferred.cancel ).fail( deferred.cancel );
+		// Unexpose cancel
+		delete deferred.cancel;
+		// Call given func if any
+		if ( func ) {
+			func.call( deferred, deferred );
+		}
+		return deferred;
+	},
+
+	// Deferred helper
+	when: function( object ) {
+		var lastIndex = arguments.length,
+			deferred = lastIndex <= 1 && object && jQuery.isFunction( object.promise ) ?
+				object :
+				jQuery.Deferred(),
+			promise = deferred.promise();
+
+		if ( lastIndex > 1 ) {
+			var array = slice.call( arguments, 0 ),
+				count = lastIndex,
+				iCallback = function( index ) {
+					return function( value ) {
+						array[ index ] = arguments.length > 1 ? slice.call( arguments, 0 ) : value;
+						if ( !( --count ) ) {
+							deferred.resolveWith( promise, array );
+						}
+					};
+				};
+			while( ( lastIndex-- ) ) {
+				object = array[ lastIndex ];
+				if ( object && jQuery.isFunction( object.promise ) ) {
+					object.promise().then( iCallback(lastIndex), deferred.reject );
+				} else {
+					--count;
+				}
+			}
+			if ( !count ) {
+				deferred.resolveWith( promise, array );
+			}
+		} else if ( deferred !== object ) {
+			deferred.resolve( object );
+		}
+		return promise;
+	},
+
+	// Use of jQuery.browser is frowned upon.
+	// More details: http://docs.jquery.com/Utilities/jQuery.browser
+	uaMatch: function( ua ) {
+		ua = ua.toLowerCase();
+
+		var match = rwebkit.exec( ua ) ||
+			ropera.exec( ua ) ||
+			rmsie.exec( ua ) ||
+			ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) ||
+			[];
+
+		return { browser: match[1] || "", version: match[2] || "0" };
+	},
+
+	sub: function() {
+		function jQuerySubclass( selector, context ) {
+			return new jQuerySubclass.fn.init( selector, context );
+		}
+		jQuery.extend( true, jQuerySubclass, this );
+		jQuerySubclass.superclass = this;
+		jQuerySubclass.fn = jQuerySubclass.prototype = this();
+		jQuerySubclass.fn.constructor = jQuerySubclass;
+		jQuerySubclass.subclass = this.subclass;
+		jQuerySubclass.fn.init = function init( selector, context ) {
+			if ( context && context instanceof jQuery && !(context instanceof jQuerySubclass) ) {
+				context = jQuerySubclass(context);
+			}
+
+			return jQuery.fn.init.call( this, selector, context, rootjQuerySubclass );
+		};
+		jQuerySubclass.fn.init.prototype = jQuerySubclass.fn;
+		var rootjQuerySubclass = jQuerySubclass(document);
+		return jQuerySubclass;
+	},
+
+	browser: {}
+});
+
+// Create readyList deferred
+readyList = jQuery._Deferred();
+
+// Populate the class2type map
+jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
+	class2type[ "[object " + name + "]" ] = name.toLowerCase();
+});
+
+browserMatch = jQuery.uaMatch( userAgent );
+if ( browserMatch.browser ) {
+	jQuery.browser[ browserMatch.browser ] = true;
+	jQuery.browser.version = browserMatch.version;
+}
+
+// Deprecated, use jQuery.browser.webkit instead
+if ( jQuery.browser.webkit ) {
+	jQuery.browser.safari = true;
+}
+
+if ( indexOf ) {
+	jQuery.inArray = function( elem, array ) {
+		return indexOf.call( array, elem );
+	};
+}
+
+// IE doesn't match non-breaking spaces with \s
+if ( rnotwhite.test( "\xA0" ) ) {
+	trimLeft = /^[\s\xA0]+/;
+	trimRight = /[\s\xA0]+$/;
+}
+
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
+
+// Cleanup functions for the document ready method
+if ( document.addEventListener ) {
+	DOMContentLoaded = function() {
+		document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+		jQuery.ready();
+	};
+
+} else if ( document.attachEvent ) {
+	DOMContentLoaded = function() {
+		// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+		if ( document.readyState === "complete" ) {
+			document.detachEvent( "onreadystatechange", DOMContentLoaded );
+			jQuery.ready();
+		}
+	};
+}
+
+// The DOM ready check for Internet Explorer
+function doScrollCheck() {
+	if ( jQuery.isReady ) {
+		return;
+	}
+
+	try {
+		// If IE is used, use the trick by Diego Perini
+		// http://javascript.nwbox.com/IEContentLoaded/
+		document.documentElement.doScroll("left");
+	} catch(e) {
+		setTimeout( doScrollCheck, 1 );
+		return;
+	}
+
+	// and execute any waiting functions
+	jQuery.ready();
+}
+
+// Expose jQuery to the global object
+return jQuery;
+
+})();
+
+
+(function() {
+
+	jQuery.support = {};
+
+	var div = document.createElement("div");
+
+	div.style.display = "none";
+	div.innerHTML = "   <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+
+	var all = div.getElementsByTagName("*"),
+		a = div.getElementsByTagName("a")[0],
+		select = document.createElement("select"),
+		opt = select.appendChild( document.createElement("option") ),
+		input = div.getElementsByTagName("input")[0];
+
+	// Can't get basic test support
+	if ( !all || !all.length || !a ) {
+		return;
+	}
+
+	jQuery.support = {
+		// IE strips leading whitespace when .innerHTML is used
+		leadingWhitespace: div.firstChild.nodeType === 3,
+
+		// Make sure that tbody elements aren't automatically inserted
+		// IE will insert them into empty tables
+		tbody: !div.getElementsByTagName("tbody").length,
+
+		// Make sure that link elements get serialized correctly by innerHTML
+		// This requires a wrapper element in IE
+		htmlSerialize: !!div.getElementsByTagName("link").length,
+
+		// Get the style information from getAttribute
+		// (IE uses .cssText insted)
+		style: /red/.test( a.getAttribute("style") ),
+
+		// Make sure that URLs aren't manipulated
+		// (IE normalizes it by default)
+		hrefNormalized: a.getAttribute("href") === "/a",
+
+		// Make sure that element opacity exists
+		// (IE uses filter instead)
+		// Use a regex to work around a WebKit issue. See #5145
+		opacity: /^0.55$/.test( a.style.opacity ),
+
+		// Verify style float existence
+		// (IE uses styleFloat instead of cssFloat)
+		cssFloat: !!a.style.cssFloat,
+
+		// Make sure that if no value is specified for a checkbox
+		// that it defaults to "on".
+		// (WebKit defaults to "" instead)
+		checkOn: input.value === "on",
+
+		// Make sure that a selected-by-default option has a working selected property.
+		// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+		optSelected: opt.selected,
+
+		// Will be defined later
+		deleteExpando: true,
+		optDisabled: false,
+		checkClone: false,
+		noCloneEvent: true,
+		noCloneChecked: true,
+		boxModel: null,
+		inlineBlockNeedsLayout: false,
+		shrinkWrapBlocks: false,
+		reliableHiddenOffsets: true
+	};
+
+	input.checked = true;
+	jQuery.support.noCloneChecked = input.cloneNode( true ).checked;
+
+	// Make sure that the options inside disabled selects aren't marked as disabled
+	// (WebKit marks them as diabled)
+	select.disabled = true;
+	jQuery.support.optDisabled = !opt.disabled;
+
+	var _scriptEval = null;
+	jQuery.support.scriptEval = function() {
+		if ( _scriptEval === null ) {
+			var root = document.documentElement,
+				script = document.createElement("script"),
+				id = "script" + jQuery.now();
+
+			try {
+				script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
+			} catch(e) {}
+
+			root.insertBefore( script, root.firstChild );
+
+			// Make sure that the execution of code works by injecting a script
+			// tag with appendChild/createTextNode
+			// (IE doesn't support this, fails, and uses .text instead)
+			if ( window[ id ] ) {
+				_scriptEval = true;
+				delete window[ id ];
+			} else {
+				_scriptEval = false;
+			}
+
+			root.removeChild( script );
+			// release memory in IE
+			root = script = id  = null;
+		}
+
+		return _scriptEval;
+	};
+
+	// Test to see if it's possible to delete an expando from an element
+	// Fails in Internet Explorer
+	try {
+		delete div.test;
+
+	} catch(e) {
+		jQuery.support.deleteExpando = false;
+	}
+
+	if ( !div.addEventListener && div.attachEvent && div.fireEvent ) {
+		div.attachEvent("onclick", function click() {
+			// Cloning a node shouldn't copy over any
+			// bound event handlers (IE does this)
+			jQuery.support.noCloneEvent = false;
+			div.detachEvent("onclick", click);
+		});
+		div.cloneNode(true).fireEvent("onclick");
+	}
+
+	div = document.createElement("div");
+	div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>";
+
+	var fragment = document.createDocumentFragment();
+	fragment.appendChild( div.firstChild );
+
+	// WebKit doesn't clone checked state correctly in fragments
+	jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
+
+	// Figure out if the W3C box model works as expected
+	// document.body must exist before we can do this
+	jQuery(function() {
+		var div = document.createElement("div"),
+			body = document.getElementsByTagName("body")[0];
+
+		// Frameset documents with no body should not run this code
+		if ( !body ) {
+			return;
+		}
+
+		div.style.width = div.style.paddingLeft = "1px";
+		body.appendChild( div );
+		jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
+
+		if ( "zoom" in div.style ) {
+			// Check if natively block-level elements act like inline-block
+			// elements when setting their display to 'inline' and giving
+			// them layout
+			// (IE < 8 does this)
+			div.style.display = "inline";
+			div.style.zoom = 1;
+			jQuery.support.inlineBlockNeedsLayout = div.offsetWidth === 2;
+
+			// Check if elements with layout shrink-wrap their children
+			// (IE 6 does this)
+			div.style.display = "";
+			div.innerHTML = "<div style='width:4px;'></div>";
+			jQuery.support.shrinkWrapBlocks = div.offsetWidth !== 2;
+		}
+
+		div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";
+		var tds = div.getElementsByTagName("td");
+
+		// Check if table cells still have offsetWidth/Height when they are set
+		// to display:none and there are still other visible table cells in a
+		// table row; if so, offsetWidth/Height are not reliable for use when
+		// determining if an element has been hidden directly using
+		// display:none (it is still safe to use offsets if a parent element is
+		// hidden; don safety goggles and see bug #4512 for more information).
+		// (only IE 8 fails this test)
+		jQuery.support.reliableHiddenOffsets = tds[0].offsetHeight === 0;
+
+		tds[0].style.display = "";
+		tds[1].style.display = "none";
+
+		// Check if empty table cells still have offsetWidth/Height
+		// (IE < 8 fail this test)
+		jQuery.support.reliableHiddenOffsets = jQuery.support.reliableHiddenOffsets && tds[0].offsetHeight === 0;
+		div.innerHTML = "";
+
+		body.removeChild( div ).style.display = "none";
+		div = tds = null;
+	});
+
+	// Technique from Juriy Zaytsev
+	// http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
+	var eventSupported = function( eventName ) {
+		var el = document.createElement("div");
+		eventName = "on" + eventName;
+
+		// We only care about the case where non-standard event systems
+		// are used, namely in IE. Short-circuiting here helps us to
+		// avoid an eval call (in setAttribute) which can cause CSP
+		// to go haywire. See: https://developer.mozilla.org/en/Security/CSP
+		if ( !el.attachEvent ) {
+			return true;
+		}
+
+		var isSupported = (eventName in el);
+		if ( !isSupported ) {
+			el.setAttribute(eventName, "return;");
+			isSupported = typeof el[eventName] === "function";
+		}
+		el = null;
+
+		return isSupported;
+	};
+
+	jQuery.support.submitBubbles = eventSupported("submit");
+	jQuery.support.changeBubbles = eventSupported("change");
+
+	// release memory in IE
+	div = all = a = null;
+})();
+
+
+
+var rbrace = /^(?:\{.*\}|\[.*\])$/;
+
+jQuery.extend({
+	cache: {},
+
+	// Please use with caution
+	uuid: 0,
+
+	// Unique for each copy of jQuery on the page
+	// Non-digits removed to match rinlinejQuery
+	expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
+
+	// The following elements throw uncatchable exceptions if you
+	// attempt to add expando properties to them.
+	noData: {
+		"embed": true,
+		// Ban all objects except for Flash (which handle expandos)
+		"object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
+		"applet": true
+	},
+
+	hasData: function( elem ) {
+		elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
+
+		return !!elem && !isEmptyDataObject( elem );
+	},
+
+	data: function( elem, name, data, pvt /* Internal Use Only */ ) {
+		if ( !jQuery.acceptData( elem ) ) {
+			return;
+		}
+
+		var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache,
+
+			// We have to handle DOM nodes and JS objects differently because IE6-7
+			// can't GC object references properly across the DOM-JS boundary
+			isNode = elem.nodeType,
+
+			// Only DOM nodes need the global jQuery cache; JS object data is
+			// attached directly to the object so GC can occur automatically
+			cache = isNode ? jQuery.cache : elem,
+
+			// Only defining an ID for JS objects if its cache already exists allows
+			// the code to shortcut on the same path as a DOM node with no cache
+			id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando;
+
+		// Avoid doing any more work than we need to when trying to get data on an
+		// object that has no data at all
+		if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) {
+			return;
+		}
+
+		if ( !id ) {
+			// Only DOM nodes need a new unique ID for each element since their data
+			// ends up in the global cache
+			if ( isNode ) {
+				elem[ jQuery.expando ] = id = ++jQuery.uuid;
+			} else {
+				id = jQuery.expando;
+			}
+		}
+
+		if ( !cache[ id ] ) {
+			cache[ id ] = {};
+
+			// TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery
+			// metadata on plain JS objects when the object is serialized using
+			// JSON.stringify
+			if ( !isNode ) {
+				cache[ id ].toJSON = jQuery.noop;
+			}
+		}
+
+		// An object can be passed to jQuery.data instead of a key/value pair; this gets
+		// shallow copied over onto the existing cache
+		if ( typeof name === "object" || typeof name === "function" ) {
+			if ( pvt ) {
+				cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name);
+			} else {
+				cache[ id ] = jQuery.extend(cache[ id ], name);
+			}
+		}
+
+		thisCache = cache[ id ];
+
+		// Internal jQuery data is stored in a separate object inside the object's data
+		// cache in order to avoid key collisions between internal data and user-defined
+		// data
+		if ( pvt ) {
+			if ( !thisCache[ internalKey ] ) {
+				thisCache[ internalKey ] = {};
+			}
+
+			thisCache = thisCache[ internalKey ];
+		}
+
+		if ( data !== undefined ) {
+			thisCache[ name ] = data;
+		}
+
+		// TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should
+		// not attempt to inspect the internal events object using jQuery.data, as this
+		// internal data object is undocumented and subject to change.
+		if ( name === "events" && !thisCache[name] ) {
+			return thisCache[ internalKey ] && thisCache[ internalKey ].events;
+		}
+
+		return getByName ? thisCache[ name ] : thisCache;
+	},
+
+	removeData: function( elem, name, pvt /* Internal Use Only */ ) {
+		if ( !jQuery.acceptData( elem ) ) {
+			return;
+		}
+
+		var internalKey = jQuery.expando, isNode = elem.nodeType,
+
+			// See jQuery.data for more information
+			cache = isNode ? jQuery.cache : elem,
+
+			// See jQuery.data for more information
+			id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
+
+		// If there is already no cache entry for this object, there is no
+		// purpose in continuing
+		if ( !cache[ id ] ) {
+			return;
+		}
+
+		if ( name ) {
+			var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ];
+
+			if ( thisCache ) {
+				delete thisCache[ name ];
+
+				// If there is no data left in the cache, we want to continue
+				// and let the cache object itself get destroyed
+				if ( !isEmptyDataObject(thisCache) ) {
+					return;
+				}
+			}
+		}
+
+		// See jQuery.data for more information
+		if ( pvt ) {
+			delete cache[ id ][ internalKey ];
+
+			// Don't destroy the parent cache unless the internal data object
+			// had been the only thing left in it
+			if ( !isEmptyDataObject(cache[ id ]) ) {
+				return;
+			}
+		}
+
+		var internalCache = cache[ id ][ internalKey ];
+
+		// Browsers that fail expando deletion also refuse to delete expandos on
+		// the window, but it will allow it on all other JS objects; other browsers
+		// don't care
+		if ( jQuery.support.deleteExpando || cache != window ) {
+			delete cache[ id ];
+		} else {
+			cache[ id ] = null;
+		}
+
+		// We destroyed the entire user cache at once because it's faster than
+		// iterating through each key, but we need to continue to persist internal
+		// data if it existed
+		if ( internalCache ) {
+			cache[ id ] = {};
+			// TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery
+			// metadata on plain JS objects when the object is serialized using
+			// JSON.stringify
+			if ( !isNode ) {
+				cache[ id ].toJSON = jQuery.noop;
+			}
+
+			cache[ id ][ internalKey ] = internalCache;
+
+		// Otherwise, we need to eliminate the expando on the node to avoid
+		// false lookups in the cache for entries that no longer exist
+		} else if ( isNode ) {
+			// IE does not allow us to delete expando properties from nodes,
+			// nor does it have a removeAttribute function on Document nodes;
+			// we must handle all of these cases
+			if ( jQuery.support.deleteExpando ) {
+				delete elem[ jQuery.expando ];
+			} else if ( elem.removeAttribute ) {
+				elem.removeAttribute( jQuery.expando );
+			} else {
+				elem[ jQuery.expando ] = null;
+			}
+		}
+	},
+
+	// For internal use only.
+	_data: function( elem, name, data ) {
+		return jQuery.data( elem, name, data, true );
+	},
+
+	// A method for determining if a DOM node can handle the data expando
+	acceptData: function( elem ) {
+		if ( elem.nodeName ) {
+			var match = jQuery.noData[ elem.nodeName.toLowerCase() ];
+
+			if ( match ) {
+				return !(match === true || elem.getAttribute("classid") !== match);
+			}
+		}
+
+		return true;
+	}
+});
+
+jQuery.fn.extend({
+	data: function( key, value ) {
+		var data = null;
+
+		if ( typeof key === "undefined" ) {
+			if ( this.length ) {
+				data = jQuery.data( this[0] );
+
+				if ( this[0].nodeType === 1 ) {
+					var attr = this[0].attributes, name;
+					for ( var i = 0, l = attr.length; i < l; i++ ) {
+						name = attr[i].name;
+
+						if ( name.indexOf( "data-" ) === 0 ) {
+							name = name.substr( 5 );
+							dataAttr( this[0], name, data[ name ] );
+						}
+					}
+				}
+			}
+
+			return data;
+
+		} else if ( typeof key === "object" ) {
+			return this.each(function() {
+				jQuery.data( this, key );
+			});
+		}
+
+		var parts = key.split(".");
+		parts[1] = parts[1] ? "." + parts[1] : "";
+
+		if ( value === undefined ) {
+			data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+
+			// Try to fetch any internally stored data first
+			if ( data === undefined && this.length ) {
+				data = jQuery.data( this[0], key );
+				data = dataAttr( this[0], key, data );
+			}
+
+			return data === undefined && parts[1] ?
+				this.data( parts[0] ) :
+				data;
+
+		} else {
+			return this.each(function() {
+				var $this = jQuery( this ),
+					args = [ parts[0], value ];
+
+				$this.triggerHandler( "setData" + parts[1] + "!", args );
+				jQuery.data( this, key, value );
+				$this.triggerHandler( "changeData" + parts[1] + "!", args );
+			});
+		}
+	},
+
+	removeData: function( key ) {
+		return this.each(function() {
+			jQuery.removeData( this, key );
+		});
+	}
+});
+
+function dataAttr( elem, key, data ) {
+	// If nothing was found internally, try to fetch any
+	// data from the HTML5 data-* attribute
+	if ( data === undefined && elem.nodeType === 1 ) {
+		data = elem.getAttribute( "data-" + key );
+
+		if ( typeof data === "string" ) {
+			try {
+				data = data === "true" ? true :
+				data === "false" ? false :
+				data === "null" ? null :
+				!jQuery.isNaN( data ) ? parseFloat( data ) :
+					rbrace.test( data ) ? jQuery.parseJSON( data ) :
+					data;
+			} catch( e ) {}
+
+			// Make sure we set the data so it isn't changed later
+			jQuery.data( elem, key, data );
+
+		} else {
+			data = undefined;
+		}
+	}
+
+	return data;
+}
+
+// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON
+// property to be considered empty objects; this property always exists in
+// order to make sure JSON.stringify does not expose internal metadata
+function isEmptyDataObject( obj ) {
+	for ( var name in obj ) {
+		if ( name !== "toJSON" ) {
+			return false;
+		}
+	}
+
+	return true;
+}
+
+
+
+
+jQuery.extend({
+	queue: function( elem, type, data ) {
+		if ( !elem ) {
+			return;
+		}
+
+		type = (type || "fx") + "queue";
+		var q = jQuery._data( elem, type );
+
+		// Speed up dequeue by getting out quickly if this is just a lookup
+		if ( !data ) {
+			return q || [];
+		}
+
+		if ( !q || jQuery.isArray(data) ) {
+			q = jQuery._data( elem, type, jQuery.makeArray(data) );
+
+		} else {
+			q.push( data );
+		}
+
+		return q;
+	},
+
+	dequeue: function( elem, type ) {
+		type = type || "fx";
+
+		var queue = jQuery.queue( elem, type ),
+			fn = queue.shift();
+
+		// If the fx queue is dequeued, always remove the progress sentinel
+		if ( fn === "inprogress" ) {
+			fn = queue.shift();
+		}
+
+		if ( fn ) {
+			// Add a progress sentinel to prevent the fx queue from being
+			// automatically dequeued
+			if ( type === "fx" ) {
+				queue.unshift("inprogress");
+			}
+
+			fn.call(elem, function() {
+				jQuery.dequeue(elem, type);
+			});
+		}
+
+		if ( !queue.length ) {
+			jQuery.removeData( elem, type + "queue", true );
+		}
+	}
+});
+
+jQuery.fn.extend({
+	queue: function( type, data ) {
+		if ( typeof type !== "string" ) {
+			data = type;
+			type = "fx";
+		}
+
+		if ( data === undefined ) {
+			return jQuery.queue( this[0], type );
+		}
+		return this.each(function( i ) {
+			var queue = jQuery.queue( this, type, data );
+
+			if ( type === "fx" && queue[0] !== "inprogress" ) {
+				jQuery.dequeue( this, type );
+			}
+		});
+	},
+	dequeue: function( type ) {
+		return this.each(function() {
+			jQuery.dequeue( this, type );
+		});
+	},
+
+	// Based off of the plugin by Clint Helfers, with permission.
+	// http://blindsignals.com/index.php/2009/07/jquery-delay/
+	delay: function( time, type ) {
+		time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
+		type = type || "fx";
+
+		return this.queue( type, function() {
+			var elem = this;
+			setTimeout(function() {
+				jQuery.dequeue( elem, type );
+			}, time );
+		});
+	},
+
+	clearQueue: function( type ) {
+		return this.queue( type || "fx", [] );
+	}
+});
+
+
+
+
+var rclass = /[\n\t\r]/g,
+	rspaces = /\s+/,
+	rreturn = /\r/g,
+	rspecialurl = /^(?:href|src|style)$/,
+	rtype = /^(?:button|input)$/i,
+	rfocusable = /^(?:button|input|object|select|textarea)$/i,
+	rclickable = /^a(?:rea)?$/i,
+	rradiocheck = /^(?:radio|checkbox)$/i;
+
+jQuery.props = {
+	"for": "htmlFor",
+	"class": "className",
+	readonly: "readOnly",
+	maxlength: "maxLength",
+	cellspacing: "cellSpacing",
+	rowspan: "rowSpan",
+	colspan: "colSpan",
+	tabindex: "tabIndex",
+	usemap: "useMap",
+	frameborder: "frameBorder"
+};
+
+jQuery.fn.extend({
+	attr: function( name, value ) {
+		return jQuery.access( this, name, value, true, jQuery.attr );
+	},
+
+	removeAttr: function( name, fn ) {
+		return this.each(function(){
+			jQuery.attr( this, name, "" );
+			if ( this.nodeType === 1 ) {
+				this.removeAttribute( name );
+			}
+		});
+	},
+
+	addClass: function( value ) {
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.addClass( value.call(this, i, self.attr("class")) );
+			});
+		}
+
+		if ( value && typeof value === "string" ) {
+			var classNames = (value || "").split( rspaces );
+
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var elem = this[i];
+
+				if ( elem.nodeType === 1 ) {
+					if ( !elem.className ) {
+						elem.className = value;
+
+					} else {
+						var className = " " + elem.className + " ",
+							setClass = elem.className;
+
+						for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+							if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) {
+								setClass += " " + classNames[c];
+							}
+						}
+						elem.className = jQuery.trim( setClass );
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	removeClass: function( value ) {
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.removeClass( value.call(this, i, self.attr("class")) );
+			});
+		}
+
+		if ( (value && typeof value === "string") || value === undefined ) {
+			var classNames = (value || "").split( rspaces );
+
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var elem = this[i];
+
+				if ( elem.nodeType === 1 && elem.className ) {
+					if ( value ) {
+						var className = (" " + elem.className + " ").replace(rclass, " ");
+						for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+							className = className.replace(" " + classNames[c] + " ", " ");
+						}
+						elem.className = jQuery.trim( className );
+
+					} else {
+						elem.className = "";
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	toggleClass: function( value, stateVal ) {
+		var type = typeof value,
+			isBool = typeof stateVal === "boolean";
+
+		if ( jQuery.isFunction( value ) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal );
+			});
+		}
+
+		return this.each(function() {
+			if ( type === "string" ) {
+				// toggle individual class names
+				var className,
+					i = 0,
+					self = jQuery( this ),
+					state = stateVal,
+					classNames = value.split( rspaces );
+
+				while ( (className = classNames[ i++ ]) ) {
+					// check each className given, space seperated list
+					state = isBool ? state : !self.hasClass( className );
+					self[ state ? "addClass" : "removeClass" ]( className );
+				}
+
+			} else if ( type === "undefined" || type === "boolean" ) {
+				if ( this.className ) {
+					// store className if set
+					jQuery._data( this, "__className__", this.className );
+				}
+
+				// toggle whole className
+				this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
+			}
+		});
+	},
+
+	hasClass: function( selector ) {
+		var className = " " + selector + " ";
+		for ( var i = 0, l = this.length; i < l; i++ ) {
+			if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
+				return true;
+			}
+		}
+
+		return false;
+	},
+
+	val: function( value ) {
+		if ( !arguments.length ) {
+			var elem = this[0];
+
+			if ( elem ) {
+				if ( jQuery.nodeName( elem, "option" ) ) {
+					// attributes.value is undefined in Blackberry 4.7 but
+					// uses .value. See #6932
+					var val = elem.attributes.value;
+					return !val || val.specified ? elem.value : elem.text;
+				}
+
+				// We need to handle select boxes special
+				if ( jQuery.nodeName( elem, "select" ) ) {
+					var index = elem.selectedIndex,
+						values = [],
+						options = elem.options,
+						one = elem.type === "select-one";
+
+					// Nothing was selected
+					if ( index < 0 ) {
+						return null;
+					}
+
+					// Loop through all the selected options
+					for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+						var option = options[ i ];
+
+						// Don't return options that are disabled or in a disabled optgroup
+						if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
+								(!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
+
+							// Get the specific value for the option
+							value = jQuery(option).val();
+
+							// We don't need an array for one selects
+							if ( one ) {
+								return value;
+							}
+
+							// Multi-Selects return an array
+							values.push( value );
+						}
+					}
+
+					// Fixes Bug #2551 -- select.val() broken in IE after form.reset()
+					if ( one && !values.length && options.length ) {
+						return jQuery( options[ index ] ).val();
+					}
+
+					return values;
+				}
+
+				// Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+				if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) {
+					return elem.getAttribute("value") === null ? "on" : elem.value;
+				}
+
+				// Everything else, we just grab the value
+				return (elem.value || "").replace(rreturn, "");
+
+			}
+
+			return undefined;
+		}
+
+		var isFunction = jQuery.isFunction(value);
+
+		return this.each(function(i) {
+			var self = jQuery(this), val = value;
+
+			if ( this.nodeType !== 1 ) {
+				return;
+			}
+
+			if ( isFunction ) {
+				val = value.call(this, i, self.val());
+			}
+
+			// Treat null/undefined as ""; convert numbers to string
+			if ( val == null ) {
+				val = "";
+			} else if ( typeof val === "number" ) {
+				val += "";
+			} else if ( jQuery.isArray(val) ) {
+				val = jQuery.map(val, function (value) {
+					return value == null ? "" : value + "";
+				});
+			}
+
+			if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) {
+				this.checked = jQuery.inArray( self.val(), val ) >= 0;
+
+			} else if ( jQuery.nodeName( this, "select" ) ) {
+				var values = jQuery.makeArray(val);
+
+				jQuery( "option", this ).each(function() {
+					this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+				});
+
+				if ( !values.length ) {
+					this.selectedIndex = -1;
+				}
+
+			} else {
+				this.value = val;
+			}
+		});
+	}
+});
+
+jQuery.extend({
+	attrFn: {
+		val: true,
+		css: true,
+		html: true,
+		text: true,
+		data: true,
+		width: true,
+		height: true,
+		offset: true
+	},
+
+	attr: function( elem, name, value, pass ) {
+		// don't get/set attributes on text, comment and attribute nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || elem.nodeType === 2 ) {
+			return undefined;
+		}
+
+		if ( pass && name in jQuery.attrFn ) {
+			return jQuery(elem)[name](value);
+		}
+
+		var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ),
+			// Whether we are setting (or getting)
+			set = value !== undefined;
+
+		// Try to normalize/fix the name
+		name = notxml && jQuery.props[ name ] || name;
+
+		// Only do all the following if this is a node (faster for style)
+		if ( elem.nodeType === 1 ) {
+			// These attributes require special treatment
+			var special = rspecialurl.test( name );
+
+			// Safari mis-reports the default selected property of an option
+			// Accessing the parent's selectedIndex property fixes it
+			if ( name === "selected" && !jQuery.support.optSelected ) {
+				var parent = elem.parentNode;
+				if ( parent ) {
+					parent.selectedIndex;
+
+					// Make sure that it also works with optgroups, see #5701
+					if ( parent.parentNode ) {
+						parent.parentNode.selectedIndex;
+					}
+				}
+			}
+
+			// If applicable, access the attribute via the DOM 0 way
+			// 'in' checks fail in Blackberry 4.7 #6931
+			if ( (name in elem || elem[ name ] !== undefined) && notxml && !special ) {
+				if ( set ) {
+					// We can't allow the type property to be changed (since it causes problems in IE)
+					if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) {
+						jQuery.error( "type property can't be changed" );
+					}
+
+					if ( value === null ) {
+						if ( elem.nodeType === 1 ) {
+							elem.removeAttribute( name );
+						}
+
+					} else {
+						elem[ name ] = value;
+					}
+				}
+
+				// browsers index elements by id/name on forms, give priority to attributes.
+				if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) {
+					return elem.getAttributeNode( name ).nodeValue;
+				}
+
+				// elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+				// http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+				if ( name === "tabIndex" ) {
+					var attributeNode = elem.getAttributeNode( "tabIndex" );
+
+					return attributeNode && attributeNode.specified ?
+						attributeNode.value :
+						rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+							0 :
+							undefined;
+				}
+
+				return elem[ name ];
+			}
+
+			if ( !jQuery.support.style && notxml && name === "style" ) {
+				if ( set ) {
+					elem.style.cssText = "" + value;
+				}
+
+				return elem.style.cssText;
+			}
+
+			if ( set ) {
+				// convert the value to a string (all browsers do this but IE) see #1070
+				elem.setAttribute( name, "" + value );
+			}
+
+			// Ensure that missing attributes return undefined
+			// Blackberry 4.7 returns "" from getAttribute #6938
+			if ( !elem.attributes[ name ] && (elem.hasAttribute && !elem.hasAttribute( name )) ) {
+				return undefined;
+			}
+
+			var attr = !jQuery.support.hrefNormalized && notxml && special ?
+					// Some attributes require a special call on IE
+					elem.getAttribute( name, 2 ) :
+					elem.getAttribute( name );
+
+			// Non-existent attributes return null, we normalize to undefined
+			return attr === null ? undefined : attr;
+		}
+		// Handle everything which isn't a DOM element node
+		if ( set ) {
+			elem[ name ] = value;
+		}
+		return elem[ name ];
+	}
+});
+
+
+
+
+var rnamespaces = /\.(.*)$/,
+	rformElems = /^(?:textarea|input|select)$/i,
+	rperiod = /\./g,
+	rspace = / /g,
+	rescape = /[^\w\s.|`]/g,
+	fcleanup = function( nm ) {
+		return nm.replace(rescape, "\\$&");
+	};
+
+/*
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code originated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+
+	// Bind an event to an element
+	// Original by Dean Edwards
+	add: function( elem, types, handler, data ) {
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		// TODO :: Use a try/catch until it's safe to pull this out (likely 1.6)
+		// Minor release fix for bug #8018
+		try {
+			// For whatever reason, IE has trouble passing the window object
+			// around, causing it to be cloned in the process
+			if ( jQuery.isWindow( elem ) && ( elem !== window && !elem.frameElement ) ) {
+				elem = window;
+			}
+		}
+		catch ( e ) {}
+
+		if ( handler === false ) {
+			handler = returnFalse;
+		} else if ( !handler ) {
+			// Fixes bug #7229. Fix recommended by jdalton
+			return;
+		}
+
+		var handleObjIn, handleObj;
+
+		if ( handler.handler ) {
+			handleObjIn = handler;
+			handler = handleObjIn.handler;
+		}
+
+		// Make sure that the function being executed has a unique ID
+		if ( !handler.guid ) {
+			handler.guid = jQuery.guid++;
+		}
+
+		// Init the element's event structure
+		var elemData = jQuery._data( elem );
+
+		// If no elemData is found then we must be trying to bind to one of the
+		// banned noData elements
+		if ( !elemData ) {
+			return;
+		}
+
+		var events = elemData.events,
+			eventHandle = elemData.handle;
+
+		if ( !events ) {
+			elemData.events = events = {};
+		}
+
+		if ( !eventHandle ) {
+			elemData.handle = eventHandle = function() {
+				// Handle the second event of a trigger and when
+				// an event is called after a page has unloaded
+				return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
+					jQuery.event.handle.apply( eventHandle.elem, arguments ) :
+					undefined;
+			};
+		}
+
+		// Add elem as a property of the handle function
+		// This is to prevent a memory leak with non-native events in IE.
+		eventHandle.elem = elem;
+
+		// Handle multiple events separated by a space
+		// jQuery(...).bind("mouseover mouseout", fn);
+		types = types.split(" ");
+
+		var type, i = 0, namespaces;
+
+		while ( (type = types[ i++ ]) ) {
+			handleObj = handleObjIn ?
+				jQuery.extend({}, handleObjIn) :
+				{ handler: handler, data: data };
+
+			// Namespaced event handlers
+			if ( type.indexOf(".") > -1 ) {
+				namespaces = type.split(".");
+				type = namespaces.shift();
+				handleObj.namespace = namespaces.slice(0).sort().join(".");
+
+			} else {
+				namespaces = [];
+				handleObj.namespace = "";
+			}
+
+			handleObj.type = type;
+			if ( !handleObj.guid ) {
+				handleObj.guid = handler.guid;
+			}
+
+			// Get the current list of functions bound to this event
+			var handlers = events[ type ],
+				special = jQuery.event.special[ type ] || {};
+
+			// Init the event handler queue
+			if ( !handlers ) {
+				handlers = events[ type ] = [];
+
+				// Check for a special event handler
+				// Only use addEventListener/attachEvent if the special
+				// events handler returns false
+				if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+					// Bind the global event handler to the element
+					if ( elem.addEventListener ) {
+						elem.addEventListener( type, eventHandle, false );
+
+					} else if ( elem.attachEvent ) {
+						elem.attachEvent( "on" + type, eventHandle );
+					}
+				}
+			}
+
+			if ( special.add ) {
+				special.add.call( elem, handleObj );
+
+				if ( !handleObj.handler.guid ) {
+					handleObj.handler.guid = handler.guid;
+				}
+			}
+
+			// Add the function to the element's handler list
+			handlers.push( handleObj );
+
+			// Keep track of which events have been used, for global triggering
+			jQuery.event.global[ type ] = true;
+		}
+
+		// Nullify elem to prevent memory leaks in IE
+		elem = null;
+	},
+
+	global: {},
+
+	// Detach an event or set of events from an element
+	remove: function( elem, types, handler, pos ) {
+		// don't do events on text and comment nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		if ( handler === false ) {
+			handler = returnFalse;
+		}
+
+		var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
+			elemData = jQuery.hasData( elem ) && jQuery._data( elem ),
+			events = elemData && elemData.events;
+
+		if ( !elemData || !events ) {
+			return;
+		}
+
+		// types is actually an event object here
+		if ( types && types.type ) {
+			handler = types.handler;
+			types = types.type;
+		}
+
+		// Unbind all events for the element
+		if ( !types || typeof types === "string" && types.charAt(0) === "." ) {
+			types = types || "";
+
+			for ( type in events ) {
+				jQuery.event.remove( elem, type + types );
+			}
+
+			return;
+		}
+
+		// Handle multiple events separated by a space
+		// jQuery(...).unbind("mouseover mouseout", fn);
+		types = types.split(" ");
+
+		while ( (type = types[ i++ ]) ) {
+			origType = type;
+			handleObj = null;
+			all = type.indexOf(".") < 0;
+			namespaces = [];
+
+			if ( !all ) {
+				// Namespaced event handlers
+				namespaces = type.split(".");
+				type = namespaces.shift();
+
+				namespace = new RegExp("(^|\\.)" +
+					jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)");
+			}
+
+			eventType = events[ type ];
+
+			if ( !eventType ) {
+				continue;
+			}
+
+			if ( !handler ) {
+				for ( j = 0; j < eventType.length; j++ ) {
+					handleObj = eventType[ j ];
+
+					if ( all || namespace.test( handleObj.namespace ) ) {
+						jQuery.event.remove( elem, origType, handleObj.handler, j );
+						eventType.splice( j--, 1 );
+					}
+				}
+
+				continue;
+			}
+
+			special = jQuery.event.special[ type ] || {};
+
+			for ( j = pos || 0; j < eventType.length; j++ ) {
+				handleObj = eventType[ j ];
+
+				if ( handler.guid === handleObj.guid ) {
+					// remove the given handler for the given type
+					if ( all || namespace.test( handleObj.namespace ) ) {
+						if ( pos == null ) {
+							eventType.splice( j--, 1 );
+						}
+
+						if ( special.remove ) {
+							special.remove.call( elem, handleObj );
+						}
+					}
+
+					if ( pos != null ) {
+						break;
+					}
+				}
+			}
+
+			// remove generic event handler if no more handlers exist
+			if ( eventType.length === 0 || pos != null && eventType.length === 1 ) {
+				if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
+					jQuery.removeEvent( elem, type, elemData.handle );
+				}
+
+				ret = null;
+				delete events[ type ];
+			}
+		}
+
+		// Remove the expando if it's no longer used
+		if ( jQuery.isEmptyObject( events ) ) {
+			var handle = elemData.handle;
+			if ( handle ) {
+				handle.elem = null;
+			}
+
+			delete elemData.events;
+			delete elemData.handle;
+
+			if ( jQuery.isEmptyObject( elemData ) ) {
+				jQuery.removeData( elem, undefined, true );
+			}
+		}
+	},
+
+	// bubbling is internal
+	trigger: function( event, data, elem /*, bubbling */ ) {
+		// Event object or event type
+		var type = event.type || event,
+			bubbling = arguments[3];
+
+		if ( !bubbling ) {
+			event = typeof event === "object" ?
+				// jQuery.Event object
+				event[ jQuery.expando ] ? event :
+				// Object literal
+				jQuery.extend( jQuery.Event(type), event ) :
+				// Just the event type (string)
+				jQuery.Event(type);
+
+			if ( type.indexOf("!") >= 0 ) {
+				event.type = type = type.slice(0, -1);
+				event.exclusive = true;
+			}
+
+			// Handle a global trigger
+			if ( !elem ) {
+				// Don't bubble custom events when global (to avoid too much overhead)
+				event.stopPropagation();
+
+				// Only trigger if we've ever bound an event for it
+				if ( jQuery.event.global[ type ] ) {
+					// XXX This code smells terrible. event.js should not be directly
+					// inspecting the data cache
+					jQuery.each( jQuery.cache, function() {
+						// internalKey variable is just used to make it easier to find
+						// and potentially change this stuff later; currently it just
+						// points to jQuery.expando
+						var internalKey = jQuery.expando,
+							internalCache = this[ internalKey ];
+						if ( internalCache && internalCache.events && internalCache.events[ type ] ) {
+							jQuery.event.trigger( event, data, internalCache.handle.elem );
+						}
+					});
+				}
+			}
+
+			// Handle triggering a single element
+
+			// don't do events on text and comment nodes
+			if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+				return undefined;
+			}
+
+			// Clean up in case it is reused
+			event.result = undefined;
+			event.target = elem;
+
+			// Clone the incoming data, if any
+			data = jQuery.makeArray( data );
+			data.unshift( event );
+		}
+
+		event.currentTarget = elem;
+
+		// Trigger the event, it is assumed that "handle" is a function
+		var handle = jQuery._data( elem, "handle" );
+
+		if ( handle ) {
+			handle.apply( elem, data );
+		}
+
+		var parent = elem.parentNode || elem.ownerDocument;
+
+		// Trigger an inline bound script
+		try {
+			if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) {
+				if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) {
+					event.result = false;
+					event.preventDefault();
+				}
+			}
+
+		// prevent IE from throwing an error for some elements with some event types, see #3533
+		} catch (inlineError) {}
+
+		if ( !event.isPropagationStopped() && parent ) {
+			jQuery.event.trigger( event, data, parent, true );
+
+		} else if ( !event.isDefaultPrevented() ) {
+			var old,
+				target = event.target,
+				targetType = type.replace( rnamespaces, "" ),
+				isClick = jQuery.nodeName( target, "a" ) && targetType === "click",
+				special = jQuery.event.special[ targetType ] || {};
+
+			if ( (!special._default || special._default.call( elem, event ) === false) &&
+				!isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) {
+
+				try {
+					if ( target[ targetType ] ) {
+						// Make sure that we don't accidentally re-trigger the onFOO events
+						old = target[ "on" + targetType ];
+
+						if ( old ) {
+							target[ "on" + targetType ] = null;
+						}
+
+						jQuery.event.triggered = true;
+						target[ targetType ]();
+					}
+
+				// prevent IE from throwing an error for some elements with some event types, see #3533
+				} catch (triggerError) {}
+
+				if ( old ) {
+					target[ "on" + targetType ] = old;
+				}
+
+				jQuery.event.triggered = false;
+			}
+		}
+	},
+
+	handle: function( event ) {
+		var all, handlers, namespaces, namespace_re, events,
+			namespace_sort = [],
+			args = jQuery.makeArray( arguments );
+
+		event = args[0] = jQuery.event.fix( event || window.event );
+		event.currentTarget = this;
+
+		// Namespaced event handlers
+		all = event.type.indexOf(".") < 0 && !event.exclusive;
+
+		if ( !all ) {
+			namespaces = event.type.split(".");
+			event.type = namespaces.shift();
+			namespace_sort = namespaces.slice(0).sort();
+			namespace_re = new RegExp("(^|\\.)" + namespace_sort.join("\\.(?:.*\\.)?") + "(\\.|$)");
+		}
+
+		event.namespace = event.namespace || namespace_sort.join(".");
+
+		events = jQuery._data(this, "events");
+
+		handlers = (events || {})[ event.type ];
+
+		if ( events && handlers ) {
+			// Clone the handlers to prevent manipulation
+			handlers = handlers.slice(0);
+
+			for ( var j = 0, l = handlers.length; j < l; j++ ) {
+				var handleObj = handlers[ j ];
+
+				// Filter the functions by class
+				if ( all || namespace_re.test( handleObj.namespace ) ) {
+					// Pass in a reference to the handler function itself
+					// So that we can later remove it
+					event.handler = handleObj.handler;
+					event.data = handleObj.data;
+					event.handleObj = handleObj;
+
+					var ret = handleObj.handler.apply( this, args );
+
+					if ( ret !== undefined ) {
+						event.result = ret;
+						if ( ret === false ) {
+							event.preventDefault();
+							event.stopPropagation();
+						}
+					}
+
+					if ( event.isImmediatePropagationStopped() ) {
+						break;
+					}
+				}
+			}
+		}
+
+		return event.result;
+	},
+
+	props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+
+	fix: function( event ) {
+		if ( event[ jQuery.expando ] ) {
+			return event;
+		}
+
+		// store a copy of the original event object
+		// and "clone" to set read-only properties
+		var originalEvent = event;
+		event = jQuery.Event( originalEvent );
+
+		for ( var i = this.props.length, prop; i; ) {
+			prop = this.props[ --i ];
+			event[ prop ] = originalEvent[ prop ];
+		}
+
+		// Fix target property, if necessary
+		if ( !event.target ) {
+			// Fixes #1925 where srcElement might not be defined either
+			event.target = event.srcElement || document;
+		}
+
+		// check if target is a textnode (safari)
+		if ( event.target.nodeType === 3 ) {
+			event.target = event.target.parentNode;
+		}
+
+		// Add relatedTarget, if necessary
+		if ( !event.relatedTarget && event.fromElement ) {
+			event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement;
+		}
+
+		// Calculate pageX/Y if missing and clientX/Y available
+		if ( event.pageX == null && event.clientX != null ) {
+			var doc = document.documentElement,
+				body = document.body;
+
+			event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
+			event.pageY = event.clientY + (doc && doc.scrollTop  || body && body.scrollTop  || 0) - (doc && doc.clientTop  || body && body.clientTop  || 0);
+		}
+
+		// Add which for key events
+		if ( event.which == null && (event.charCode != null || event.keyCode != null) ) {
+			event.which = event.charCode != null ? event.charCode : event.keyCode;
+		}
+
+		// Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+		if ( !event.metaKey && event.ctrlKey ) {
+			event.metaKey = event.ctrlKey;
+		}
+
+		// Add which for click: 1 === left; 2 === middle; 3 === right
+		// Note: button is not normalized, so don't use it
+		if ( !event.which && event.button !== undefined ) {
+			event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+		}
+
+		return event;
+	},
+
+	// Deprecated, use jQuery.guid instead
+	guid: 1E8,
+
+	// Deprecated, use jQuery.proxy instead
+	proxy: jQuery.proxy,
+
+	special: {
+		ready: {
+			// Make sure the ready event is setup
+			setup: jQuery.bindReady,
+			teardown: jQuery.noop
+		},
+
+		live: {
+			add: function( handleObj ) {
+				jQuery.event.add( this,
+					liveConvert( handleObj.origType, handleObj.selector ),
+					jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) );
+			},
+
+			remove: function( handleObj ) {
+				jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj );
+			}
+		},
+
+		beforeunload: {
+			setup: function( data, namespaces, eventHandle ) {
+				// We only want to do this special case on windows
+				if ( jQuery.isWindow( this ) ) {
+					this.onbeforeunload = eventHandle;
+				}
+			},
+
+			teardown: function( namespaces, eventHandle ) {
+				if ( this.onbeforeunload === eventHandle ) {
+					this.onbeforeunload = null;
+				}
+			}
+		}
+	}
+};
+
+jQuery.removeEvent = document.removeEventListener ?
+	function( elem, type, handle ) {
+		if ( elem.removeEventListener ) {
+			elem.removeEventListener( type, handle, false );
+		}
+	} :
+	function( elem, type, handle ) {
+		if ( elem.detachEvent ) {
+			elem.detachEvent( "on" + type, handle );
+		}
+	};
+
+jQuery.Event = function( src ) {
+	// Allow instantiation without the 'new' keyword
+	if ( !this.preventDefault ) {
+		return new jQuery.Event( src );
+	}
+
+	// Event object
+	if ( src && src.type ) {
+		this.originalEvent = src;
+		this.type = src.type;
+
+		// Events bubbling up the document may have been marked as prevented
+		// by a handler lower down the tree; reflect the correct value.
+		this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false ||
+			src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse;
+
+	// Event type
+	} else {
+		this.type = src;
+	}
+
+	// timeStamp is buggy for some events on Firefox(#3843)
+	// So we won't rely on the native value
+	this.timeStamp = jQuery.now();
+
+	// Mark it as fixed
+	this[ jQuery.expando ] = true;
+};
+
+function returnFalse() {
+	return false;
+}
+function returnTrue() {
+	return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+	preventDefault: function() {
+		this.isDefaultPrevented = returnTrue;
+
+		var e = this.originalEvent;
+		if ( !e ) {
+			return;
+		}
+
+		// if preventDefault exists run it on the original event
+		if ( e.preventDefault ) {
+			e.preventDefault();
+
+		// otherwise set the returnValue property of the original event to false (IE)
+		} else {
+			e.returnValue = false;
+		}
+	},
+	stopPropagation: function() {
+		this.isPropagationStopped = returnTrue;
+
+		var e = this.originalEvent;
+		if ( !e ) {
+			return;
+		}
+		// if stopPropagation exists run it on the original event
+		if ( e.stopPropagation ) {
+			e.stopPropagation();
+		}
+		// otherwise set the cancelBubble property of the original event to true (IE)
+		e.cancelBubble = true;
+	},
+	stopImmediatePropagation: function() {
+		this.isImmediatePropagationStopped = returnTrue;
+		this.stopPropagation();
+	},
+	isDefaultPrevented: returnFalse,
+	isPropagationStopped: returnFalse,
+	isImmediatePropagationStopped: returnFalse
+};
+
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function( event ) {
+	// Check if mouse(over|out) are still within the same parent element
+	var parent = event.relatedTarget;
+
+	// Firefox sometimes assigns relatedTarget a XUL element
+	// which we cannot access the parentNode property of
+	try {
+
+		// Chrome does something similar, the parentNode property
+		// can be accessed but is null.
+		if ( parent !== document && !parent.parentNode ) {
+			return;
+		}
+		// Traverse up the tree
+		while ( parent && parent !== this ) {
+			parent = parent.parentNode;
+		}
+
+		if ( parent !== this ) {
+			// set the correct event type
+			event.type = event.data;
+
+			// handle event if we actually just moused on to a non sub-element
+			jQuery.event.handle.apply( this, arguments );
+		}
+
+	// assuming we've left the element since we most likely mousedover a xul element
+	} catch(e) { }
+},
+
+// In case of event delegation, we only need to rename the event.type,
+// liveHandler will take care of the rest.
+delegate = function( event ) {
+	event.type = event.data;
+	jQuery.event.handle.apply( this, arguments );
+};
+
+// Create mouseenter and mouseleave events
+jQuery.each({
+	mouseenter: "mouseover",
+	mouseleave: "mouseout"
+}, function( orig, fix ) {
+	jQuery.event.special[ orig ] = {
+		setup: function( data ) {
+			jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig );
+		},
+		teardown: function( data ) {
+			jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement );
+		}
+	};
+});
+
+// submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+	jQuery.event.special.submit = {
+		setup: function( data, namespaces ) {
+			if ( this.nodeName && this.nodeName.toLowerCase() !== "form" ) {
+				jQuery.event.add(this, "click.specialSubmit", function( e ) {
+					var elem = e.target,
+						type = elem.type;
+
+					if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) {
+						trigger( "submit", this, arguments );
+					}
+				});
+
+				jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
+					var elem = e.target,
+						type = elem.type;
+
+					if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
+						trigger( "submit", this, arguments );
+					}
+				});
+
+			} else {
+				return false;
+			}
+		},
+
+		teardown: function( namespaces ) {
+			jQuery.event.remove( this, ".specialSubmit" );
+		}
+	};
+
+}
+
+// change delegation, happens here so we have bind.
+if ( !jQuery.support.changeBubbles ) {
+
+	var changeFilters,
+
+	getVal = function( elem ) {
+		var type = elem.type, val = elem.value;
+
+		if ( type === "radio" || type === "checkbox" ) {
+			val = elem.checked;
+
+		} else if ( type === "select-multiple" ) {
+			val = elem.selectedIndex > -1 ?
+				jQuery.map( elem.options, function( elem ) {
+					return elem.selected;
+				}).join("-") :
+				"";
+
+		} else if ( elem.nodeName.toLowerCase() === "select" ) {
+			val = elem.selectedIndex;
+		}
+
+		return val;
+	},
+
+	testChange = function testChange( e ) {
+		var elem = e.target, data, val;
+
+		if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) {
+			return;
+		}
+
+		data = jQuery._data( elem, "_change_data" );
+		val = getVal(elem);
+
+		// the current data will be also retrieved by beforeactivate
+		if ( e.type !== "focusout" || elem.type !== "radio" ) {
+			jQuery._data( elem, "_change_data", val );
+		}
+
+		if ( data === undefined || val === data ) {
+			return;
+		}
+
+		if ( data != null || val ) {
+			e.type = "change";
+			e.liveFired = undefined;
+			jQuery.event.trigger( e, arguments[1], elem );
+		}
+	};
+
+	jQuery.event.special.change = {
+		filters: {
+			focusout: testChange,
+
+			beforedeactivate: testChange,
+
+			click: function( e ) {
+				var elem = e.target, type = elem.type;
+
+				if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) {
+					testChange.call( this, e );
+				}
+			},
+
+			// Change has to be called before submit
+			// Keydown will be called before keypress, which is used in submit-event delegation
+			keydown: function( e ) {
+				var elem = e.target, type = elem.type;
+
+				if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") ||
+					(e.keyCode === 32 && (type === "checkbox" || type === "radio")) ||
+					type === "select-multiple" ) {
+					testChange.call( this, e );
+				}
+			},
+
+			// Beforeactivate happens also before the previous element is blurred
+			// with this event you can't trigger a change event, but you can store
+			// information
+			beforeactivate: function( e ) {
+				var elem = e.target;
+				jQuery._data( elem, "_change_data", getVal(elem) );
+			}
+		},
+
+		setup: function( data, namespaces ) {
+			if ( this.type === "file" ) {
+				return false;
+			}
+
+			for ( var type in changeFilters ) {
+				jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
+			}
+
+			return rformElems.test( this.nodeName );
+		},
+
+		teardown: function( namespaces ) {
+			jQuery.event.remove( this, ".specialChange" );
+
+			return rformElems.test( this.nodeName );
+		}
+	};
+
+	changeFilters = jQuery.event.special.change.filters;
+
+	// Handle when the input is .focus()'d
+	changeFilters.focus = changeFilters.beforeactivate;
+}
+
+function trigger( type, elem, args ) {
+	// Piggyback on a donor event to simulate a different one.
+	// Fake originalEvent to avoid donor's stopPropagation, but if the
+	// simulated event prevents default then we do the same on the donor.
+	// Don't pass args or remember liveFired; they apply to the donor event.
+	var event = jQuery.extend( {}, args[ 0 ] );
+	event.type = type;
+	event.originalEvent = {};
+	event.liveFired = undefined;
+	jQuery.event.handle.call( elem, event );
+	if ( event.isDefaultPrevented() ) {
+		args[ 0 ].preventDefault();
+	}
+}
+
+// Create "bubbling" focus and blur events
+if ( document.addEventListener ) {
+	jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+		jQuery.event.special[ fix ] = {
+			setup: function() {
+				this.addEventListener( orig, handler, true );
+			},
+			teardown: function() {
+				this.removeEventListener( orig, handler, true );
+			}
+		};
+
+		function handler( e ) {
+			e = jQuery.event.fix( e );
+			e.type = fix;
+			return jQuery.event.handle.call( this, e );
+		}
+	});
+}
+
+jQuery.each(["bind", "one"], function( i, name ) {
+	jQuery.fn[ name ] = function( type, data, fn ) {
+		// Handle object literals
+		if ( typeof type === "object" ) {
+			for ( var key in type ) {
+				this[ name ](key, data, type[key], fn);
+			}
+			return this;
+		}
+
+		if ( jQuery.isFunction( data ) || data === false ) {
+			fn = data;
+			data = undefined;
+		}
+
+		var handler = name === "one" ? jQuery.proxy( fn, function( event ) {
+			jQuery( this ).unbind( event, handler );
+			return fn.apply( this, arguments );
+		}) : fn;
+
+		if ( type === "unload" && name !== "one" ) {
+			this.one( type, data, fn );
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				jQuery.event.add( this[i], type, handler, data );
+			}
+		}
+
+		return this;
+	};
+});
+
+jQuery.fn.extend({
+	unbind: function( type, fn ) {
+		// Handle object literals
+		if ( typeof type === "object" && !type.preventDefault ) {
+			for ( var key in type ) {
+				this.unbind(key, type[key]);
+			}
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				jQuery.event.remove( this[i], type, fn );
+			}
+		}
+
+		return this;
+	},
+
+	delegate: function( selector, types, data, fn ) {
+		return this.live( types, data, fn, selector );
+	},
+
+	undelegate: function( selector, types, fn ) {
+		if ( arguments.length === 0 ) {
+				return this.unbind( "live" );
+
+		} else {
+			return this.die( types, null, fn, selector );
+		}
+	},
+
+	trigger: function( type, data ) {
+		return this.each(function() {
+			jQuery.event.trigger( type, data, this );
+		});
+	},
+
+	triggerHandler: function( type, data ) {
+		if ( this[0] ) {
+			var event = jQuery.Event( type );
+			event.preventDefault();
+			event.stopPropagation();
+			jQuery.event.trigger( event, data, this[0] );
+			return event.result;
+		}
+	},
+
+	toggle: function( fn ) {
+		// Save reference to arguments for access in closure
+		var args = arguments,
+			i = 1;
+
+		// link all the functions, so any of them can unbind this click handler
+		while ( i < args.length ) {
+			jQuery.proxy( fn, args[ i++ ] );
+		}
+
+		return this.click( jQuery.proxy( fn, function( event ) {
+			// Figure out which function to execute
+			var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+			jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+			// Make sure that clicks stop
+			event.preventDefault();
+
+			// and execute the function
+			return args[ lastToggle ].apply( this, arguments ) || false;
+		}));
+	},
+
+	hover: function( fnOver, fnOut ) {
+		return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+	}
+});
+
+var liveMap = {
+	focus: "focusin",
+	blur: "focusout",
+	mouseenter: "mouseover",
+	mouseleave: "mouseout"
+};
+
+jQuery.each(["live", "die"], function( i, name ) {
+	jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) {
+		var type, i = 0, match, namespaces, preType,
+			selector = origSelector || this.selector,
+			context = origSelector ? this : jQuery( this.context );
+
+		if ( typeof types === "object" && !types.preventDefault ) {
+			for ( var key in types ) {
+				context[ name ]( key, data, types[key], selector );
+			}
+
+			return this;
+		}
+
+		if ( jQuery.isFunction( data ) ) {
+			fn = data;
+			data = undefined;
+		}
+
+		types = (types || "").split(" ");
+
+		while ( (type = types[ i++ ]) != null ) {
+			match = rnamespaces.exec( type );
+			namespaces = "";
+
+			if ( match )  {
+				namespaces = match[0];
+				type = type.replace( rnamespaces, "" );
+			}
+
+			if ( type === "hover" ) {
+				types.push( "mouseenter" + namespaces, "mouseleave" + namespaces );
+				continue;
+			}
+
+			preType = type;
+
+			if ( type === "focus" || type === "blur" ) {
+				types.push( liveMap[ type ] + namespaces );
+				type = type + namespaces;
+
+			} else {
+				type = (liveMap[ type ] || type) + namespaces;
+			}
+
+			if ( name === "live" ) {
+				// bind live handler
+				for ( var j = 0, l = context.length; j < l; j++ ) {
+					jQuery.event.add( context[j], "live." + liveConvert( type, selector ),
+						{ data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
+				}
+
+			} else {
+				// unbind live handler
+				context.unbind( "live." + liveConvert( type, selector ), fn );
+			}
+		}
+
+		return this;
+	};
+});
+
+function liveHandler( event ) {
+	var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret,
+		elems = [],
+		selectors = [],
+		events = jQuery._data( this, "events" );
+
+	// Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911)
+	if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) {
+		return;
+	}
+
+	if ( event.namespace ) {
+		namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)");
+	}
+
+	event.liveFired = this;
+
+	var live = events.live.slice(0);
+
+	for ( j = 0; j < live.length; j++ ) {
+		handleObj = live[j];
+
+		if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) {
+			selectors.push( handleObj.selector );
+
+		} else {
+			live.splice( j--, 1 );
+		}
+	}
+
+	match = jQuery( event.target ).closest( selectors, event.currentTarget );
+
+	for ( i = 0, l = match.length; i < l; i++ ) {
+		close = match[i];
+
+		for ( j = 0; j < live.length; j++ ) {
+			handleObj = live[j];
+
+			if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) {
+				elem = close.elem;
+				related = null;
+
+				// Those two events require additional checking
+				if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) {
+					event.type = handleObj.preType;
+					related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
+				}
+
+				if ( !related || related !== elem ) {
+					elems.push({ elem: elem, handleObj: handleObj, level: close.level });
+				}
+			}
+		}
+	}
+
+	for ( i = 0, l = elems.length; i < l; i++ ) {
+		match = elems[i];
+
+		if ( maxLevel && match.level > maxLevel ) {
+			break;
+		}
+
+		event.currentTarget = match.elem;
+		event.data = match.handleObj.data;
+		event.handleObj = match.handleObj;
+
+		ret = match.handleObj.origHandler.apply( match.elem, arguments );
+
+		if ( ret === false || event.isPropagationStopped() ) {
+			maxLevel = match.level;
+
+			if ( ret === false ) {
+				stop = false;
+			}
+			if ( event.isImmediatePropagationStopped() ) {
+				break;
+			}
+		}
+	}
+
+	return stop;
+}
+
+function liveConvert( type, selector ) {
+	return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspace, "&");
+}
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup error").split(" "), function( i, name ) {
+
+	// Handle event binding
+	jQuery.fn[ name ] = function( data, fn ) {
+		if ( fn == null ) {
+			fn = data;
+			data = null;
+		}
+
+		return arguments.length > 0 ?
+			this.bind( name, data, fn ) :
+			this.trigger( name );
+	};
+
+	if ( jQuery.attrFn ) {
+		jQuery.attrFn[ name ] = true;
+	}
+});
+
+
+/*!
+ * Sizzle CSS Selector Engine
+ *  Copyright 2011, The Dojo Foundation
+ *  Released under the MIT, BSD, and GPL Licenses.
+ *  More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+	done = 0,
+	toString = Object.prototype.toString,
+	hasDuplicate = false,
+	baseHasDuplicate = true,
+	rBackslash = /\\/g,
+	rNonWord = /\W/;
+
+// Here we check if the JavaScript engine is using some sort of
+// optimization where it does not always call our comparision
+// function. If that is the case, discard the hasDuplicate value.
+//   Thus far that includes Google Chrome.
+[0, 0].sort(function() {
+	baseHasDuplicate = false;
+	return 0;
+});
+
+var Sizzle = function( selector, context, results, seed ) {
+	results = results || [];
+	context = context || document;
+
+	var origContext = context;
+
+	if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
+		return [];
+	}
+	
+	if ( !selector || typeof selector !== "string" ) {
+		return results;
+	}
+
+	var m, set, checkSet, extra, ret, cur, pop, i,
+		prune = true,
+		contextXML = Sizzle.isXML( context ),
+		parts = [],
+		soFar = selector;
+	
+	// Reset the position of the chunker regexp (start from head)
+	do {
+		chunker.exec( "" );
+		m = chunker.exec( soFar );
+
+		if ( m ) {
+			soFar = m[3];
+		
+			parts.push( m[1] );
+		
+			if ( m[2] ) {
+				extra = m[3];
+				break;
+			}
+		}
+	} while ( m );
+
+	if ( parts.length > 1 && origPOS.exec( selector ) ) {
+
+		if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+			set = posProcess( parts[0] + parts[1], context );
+
+		} else {
+			set = Expr.relative[ parts[0] ] ?
+				[ context ] :
+				Sizzle( parts.shift(), context );
+
+			while ( parts.length ) {
+				selector = parts.shift();
+
+				if ( Expr.relative[ selector ] ) {
+					selector += parts.shift();
+				}
+				
+				set = posProcess( selector, set );
+			}
+		}
+
+	} else {
+		// Take a shortcut and set the context if the root selector is an ID
+		// (but not if it'll be faster if the inner selector is an ID)
+		if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
+				Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+
+			ret = Sizzle.find( parts.shift(), context, contextXML );
+			context = ret.expr ?
+				Sizzle.filter( ret.expr, ret.set )[0] :
+				ret.set[0];
+		}
+
+		if ( context ) {
+			ret = seed ?
+				{ expr: parts.pop(), set: makeArray(seed) } :
+				Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+
+			set = ret.expr ?
+				Sizzle.filter( ret.expr, ret.set ) :
+				ret.set;
+
+			if ( parts.length > 0 ) {
+				checkSet = makeArray( set );
+
+			} else {
+				prune = false;
+			}
+
+			while ( parts.length ) {
+				cur = parts.pop();
+				pop = cur;
+
+				if ( !Expr.relative[ cur ] ) {
+					cur = "";
+				} else {
+					pop = parts.pop();
+				}
+
+				if ( pop == null ) {
+					pop = context;
+				}
+
+				Expr.relative[ cur ]( checkSet, pop, contextXML );
+			}
+
+		} else {
+			checkSet = parts = [];
+		}
+	}
+
+	if ( !checkSet ) {
+		checkSet = set;
+	}
+
+	if ( !checkSet ) {
+		Sizzle.error( cur || selector );
+	}
+
+	if ( toString.call(checkSet) === "[object Array]" ) {
+		if ( !prune ) {
+			results.push.apply( results, checkSet );
+
+		} else if ( context && context.nodeType === 1 ) {
+			for ( i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) {
+					results.push( set[i] );
+				}
+			}
+
+		} else {
+			for ( i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+					results.push( set[i] );
+				}
+			}
+		}
+
+	} else {
+		makeArray( checkSet, results );
+	}
+
+	if ( extra ) {
+		Sizzle( extra, origContext, results, seed );
+		Sizzle.uniqueSort( results );
+	}
+
+	return results;
+};
+
+Sizzle.uniqueSort = function( results ) {
+	if ( sortOrder ) {
+		hasDuplicate = baseHasDuplicate;
+		results.sort( sortOrder );
+
+		if ( hasDuplicate ) {
+			for ( var i = 1; i < results.length; i++ ) {
+				if ( results[i] === results[ i - 1 ] ) {
+					results.splice( i--, 1 );
+				}
+			}
+		}
+	}
+
+	return results;
+};
+
+Sizzle.matches = function( expr, set ) {
+	return Sizzle( expr, null, null, set );
+};
+
+Sizzle.matchesSelector = function( node, expr ) {
+	return Sizzle( expr, null, null, [node] ).length > 0;
+};
+
+Sizzle.find = function( expr, context, isXML ) {
+	var set;
+
+	if ( !expr ) {
+		return [];
+	}
+
+	for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
+		var match,
+			type = Expr.order[i];
+		
+		if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
+			var left = match[1];
+			match.splice( 1, 1 );
+
+			if ( left.substr( left.length - 1 ) !== "\\" ) {
+				match[1] = (match[1] || "").replace( rBackslash, "" );
+				set = Expr.find[ type ]( match, context, isXML );
+
+				if ( set != null ) {
+					expr = expr.replace( Expr.match[ type ], "" );
+					break;
+				}
+			}
+		}
+	}
+
+	if ( !set ) {
+		set = typeof context.getElementsByTagName !== "undefined" ?
+			context.getElementsByTagName( "*" ) :
+			[];
+	}
+
+	return { set: set, expr: expr };
+};
+
+Sizzle.filter = function( expr, set, inplace, not ) {
+	var match, anyFound,
+		old = expr,
+		result = [],
+		curLoop = set,
+		isXMLFilter = set && set[0] && Sizzle.isXML( set[0] );
+
+	while ( expr && set.length ) {
+		for ( var type in Expr.filter ) {
+			if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
+				var found, item,
+					filter = Expr.filter[ type ],
+					left = match[1];
+
+				anyFound = false;
+
+				match.splice(1,1);
+
+				if ( left.substr( left.length - 1 ) === "\\" ) {
+					continue;
+				}
+
+				if ( curLoop === result ) {
+					result = [];
+				}
+
+				if ( Expr.preFilter[ type ] ) {
+					match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+
+					if ( !match ) {
+						anyFound = found = true;
+
+					} else if ( match === true ) {
+						continue;
+					}
+				}
+
+				if ( match ) {
+					for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
+						if ( item ) {
+							found = filter( item, match, i, curLoop );
+							var pass = not ^ !!found;
+
+							if ( inplace && found != null ) {
+								if ( pass ) {
+									anyFound = true;
+
+								} else {
+									curLoop[i] = false;
+								}
+
+							} else if ( pass ) {
+								result.push( item );
+								anyFound = true;
+							}
+						}
+					}
+				}
+
+				if ( found !== undefined ) {
+					if ( !inplace ) {
+						curLoop = result;
+					}
+
+					expr = expr.replace( Expr.match[ type ], "" );
+
+					if ( !anyFound ) {
+						return [];
+					}
+
+					break;
+				}
+			}
+		}
+
+		// Improper expression
+		if ( expr === old ) {
+			if ( anyFound == null ) {
+				Sizzle.error( expr );
+
+			} else {
+				break;
+			}
+		}
+
+		old = expr;
+	}
+
+	return curLoop;
+};
+
+Sizzle.error = function( msg ) {
+	throw "Syntax error, unrecognized expression: " + msg;
+};
+
+var Expr = Sizzle.selectors = {
+	order: [ "ID", "NAME", "TAG" ],
+
+	match: {
+		ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+		CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+		NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,
+		ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,
+		TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,
+		CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,
+		POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,
+		PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
+	},
+
+	leftMatch: {},
+
+	attrMap: {
+		"class": "className",
+		"for": "htmlFor"
+	},
+
+	attrHandle: {
+		href: function( elem ) {
+			return elem.getAttribute( "href" );
+		},
+		type: function( elem ) {
+			return elem.getAttribute( "type" );
+		}
+	},
+
+	relative: {
+		"+": function(checkSet, part){
+			var isPartStr = typeof part === "string",
+				isTag = isPartStr && !rNonWord.test( part ),
+				isPartStrNotTag = isPartStr && !isTag;
+
+			if ( isTag ) {
+				part = part.toLowerCase();
+			}
+
+			for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
+				if ( (elem = checkSet[i]) ) {
+					while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+
+					checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
+						elem || false :
+						elem === part;
+				}
+			}
+
+			if ( isPartStrNotTag ) {
+				Sizzle.filter( part, checkSet, true );
+			}
+		},
+
+		">": function( checkSet, part ) {
+			var elem,
+				isPartStr = typeof part === "string",
+				i = 0,
+				l = checkSet.length;
+
+			if ( isPartStr && !rNonWord.test( part ) ) {
+				part = part.toLowerCase();
+
+				for ( ; i < l; i++ ) {
+					elem = checkSet[i];
+
+					if ( elem ) {
+						var parent = elem.parentNode;
+						checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
+					}
+				}
+
+			} else {
+				for ( ; i < l; i++ ) {
+					elem = checkSet[i];
+
+					if ( elem ) {
+						checkSet[i] = isPartStr ?
+							elem.parentNode :
+							elem.parentNode === part;
+					}
+				}
+
+				if ( isPartStr ) {
+					Sizzle.filter( part, checkSet, true );
+				}
+			}
+		},
+
+		"": function(checkSet, part, isXML){
+			var nodeCheck,
+				doneName = done++,
+				checkFn = dirCheck;
+
+			if ( typeof part === "string" && !rNonWord.test( part ) ) {
+				part = part.toLowerCase();
+				nodeCheck = part;
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML );
+		},
+
+		"~": function( checkSet, part, isXML ) {
+			var nodeCheck,
+				doneName = done++,
+				checkFn = dirCheck;
+
+			if ( typeof part === "string" && !rNonWord.test( part ) ) {
+				part = part.toLowerCase();
+				nodeCheck = part;
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML );
+		}
+	},
+
+	find: {
+		ID: function( match, context, isXML ) {
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+				// Check parentNode to catch when Blackberry 4.6 returns
+				// nodes that are no longer in the document #6963
+				return m && m.parentNode ? [m] : [];
+			}
+		},
+
+		NAME: function( match, context ) {
+			if ( typeof context.getElementsByName !== "undefined" ) {
+				var ret = [],
+					results = context.getElementsByName( match[1] );
+
+				for ( var i = 0, l = results.length; i < l; i++ ) {
+					if ( results[i].getAttribute("name") === match[1] ) {
+						ret.push( results[i] );
+					}
+				}
+
+				return ret.length === 0 ? null : ret;
+			}
+		},
+
+		TAG: function( match, context ) {
+			if ( typeof context.getElementsByTagName !== "undefined" ) {
+				return context.getElementsByTagName( match[1] );
+			}
+		}
+	},
+	preFilter: {
+		CLASS: function( match, curLoop, inplace, result, not, isXML ) {
+			match = " " + match[1].replace( rBackslash, "" ) + " ";
+
+			if ( isXML ) {
+				return match;
+			}
+
+			for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
+				if ( elem ) {
+					if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) {
+						if ( !inplace ) {
+							result.push( elem );
+						}
+
+					} else if ( inplace ) {
+						curLoop[i] = false;
+					}
+				}
+			}
+
+			return false;
+		},
+
+		ID: function( match ) {
+			return match[1].replace( rBackslash, "" );
+		},
+
+		TAG: function( match, curLoop ) {
+			return match[1].replace( rBackslash, "" ).toLowerCase();
+		},
+
+		CHILD: function( match ) {
+			if ( match[1] === "nth" ) {
+				if ( !match[2] ) {
+					Sizzle.error( match[0] );
+				}
+
+				match[2] = match[2].replace(/^\+|\s*/g, '');
+
+				// parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+				var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec(
+					match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
+					!/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+				// calculate the numbers (first)n+(last) including if they are negative
+				match[2] = (test[1] + (test[2] || 1)) - 0;
+				match[3] = test[3] - 0;
+			}
+			else if ( match[2] ) {
+				Sizzle.error( match[0] );
+			}
+
+			// TODO: Move to normal caching system
+			match[0] = done++;
+
+			return match;
+		},
+
+		ATTR: function( match, curLoop, inplace, result, not, isXML ) {
+			var name = match[1] = match[1].replace( rBackslash, "" );
+			
+			if ( !isXML && Expr.attrMap[name] ) {
+				match[1] = Expr.attrMap[name];
+			}
+
+			// Handle if an un-quoted value was used
+			match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" );
+
+			if ( match[2] === "~=" ) {
+				match[4] = " " + match[4] + " ";
+			}
+
+			return match;
+		},
+
+		PSEUDO: function( match, curLoop, inplace, result, not ) {
+			if ( match[1] === "not" ) {
+				// If we're dealing with a complex expression, or a simple one
+				if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
+					match[3] = Sizzle(match[3], null, null, curLoop);
+
+				} else {
+					var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+
+					if ( !inplace ) {
+						result.push.apply( result, ret );
+					}
+
+					return false;
+				}
+
+			} else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
+				return true;
+			}
+			
+			return match;
+		},
+
+		POS: function( match ) {
+			match.unshift( true );
+
+			return match;
+		}
+	},
+	
+	filters: {
+		enabled: function( elem ) {
+			return elem.disabled === false && elem.type !== "hidden";
+		},
+
+		disabled: function( elem ) {
+			return elem.disabled === true;
+		},
+
+		checked: function( elem ) {
+			return elem.checked === true;
+		},
+		
+		selected: function( elem ) {
+			// Accessing this property makes selected-by-default
+			// options in Safari work properly
+			if ( elem.parentNode ) {
+				elem.parentNode.selectedIndex;
+			}
+			
+			return elem.selected === true;
+		},
+
+		parent: function( elem ) {
+			return !!elem.firstChild;
+		},
+
+		empty: function( elem ) {
+			return !elem.firstChild;
+		},
+
+		has: function( elem, i, match ) {
+			return !!Sizzle( match[3], elem ).length;
+		},
+
+		header: function( elem ) {
+			return (/h\d/i).test( elem.nodeName );
+		},
+
+		text: function( elem ) {
+			// IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) 
+			// use getAttribute instead to test this case
+			return "text" === elem.getAttribute( 'type' );
+		},
+		radio: function( elem ) {
+			return "radio" === elem.type;
+		},
+
+		checkbox: function( elem ) {
+			return "checkbox" === elem.type;
+		},
+
+		file: function( elem ) {
+			return "file" === elem.type;
+		},
+		password: function( elem ) {
+			return "password" === elem.type;
+		},
+
+		submit: function( elem ) {
+			return "submit" === elem.type;
+		},
+
+		image: function( elem ) {
+			return "image" === elem.type;
+		},
+
+		reset: function( elem ) {
+			return "reset" === elem.type;
+		},
+
+		button: function( elem ) {
+			return "button" === elem.type || elem.nodeName.toLowerCase() === "button";
+		},
+
+		input: function( elem ) {
+			return (/input|select|textarea|button/i).test( elem.nodeName );
+		}
+	},
+	setFilters: {
+		first: function( elem, i ) {
+			return i === 0;
+		},
+
+		last: function( elem, i, match, array ) {
+			return i === array.length - 1;
+		},
+
+		even: function( elem, i ) {
+			return i % 2 === 0;
+		},
+
+		odd: function( elem, i ) {
+			return i % 2 === 1;
+		},
+
+		lt: function( elem, i, match ) {
+			return i < match[3] - 0;
+		},
+
+		gt: function( elem, i, match ) {
+			return i > match[3] - 0;
+		},
+
+		nth: function( elem, i, match ) {
+			return match[3] - 0 === i;
+		},
+
+		eq: function( elem, i, match ) {
+			return match[3] - 0 === i;
+		}
+	},
+	filter: {
+		PSEUDO: function( elem, match, i, array ) {
+			var name = match[1],
+				filter = Expr.filters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+
+			} else if ( name === "contains" ) {
+				return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0;
+
+			} else if ( name === "not" ) {
+				var not = match[3];
+
+				for ( var j = 0, l = not.length; j < l; j++ ) {
+					if ( not[j] === elem ) {
+						return false;
+					}
+				}
+
+				return true;
+
+			} else {
+				Sizzle.error( name );
+			}
+		},
+
+		CHILD: function( elem, match ) {
+			var type = match[1],
+				node = elem;
+
+			switch ( type ) {
+				case "only":
+				case "first":
+					while ( (node = node.previousSibling) )	 {
+						if ( node.nodeType === 1 ) { 
+							return false; 
+						}
+					}
+
+					if ( type === "first" ) { 
+						return true; 
+					}
+
+					node = elem;
+
+				case "last":
+					while ( (node = node.nextSibling) )	 {
+						if ( node.nodeType === 1 ) { 
+							return false; 
+						}
+					}
+
+					return true;
+
+				case "nth":
+					var first = match[2],
+						last = match[3];
+
+					if ( first === 1 && last === 0 ) {
+						return true;
+					}
+					
+					var doneName = match[0],
+						parent = elem.parentNode;
+	
+					if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
+						var count = 0;
+						
+						for ( node = parent.firstChild; node; node = node.nextSibling ) {
+							if ( node.nodeType === 1 ) {
+								node.nodeIndex = ++count;
+							}
+						} 
+
+						parent.sizcache = doneName;
+					}
+					
+					var diff = elem.nodeIndex - last;
+
+					if ( first === 0 ) {
+						return diff === 0;
+
+					} else {
+						return ( diff % first === 0 && diff / first >= 0 );
+					}
+			}
+		},
+
+		ID: function( elem, match ) {
+			return elem.nodeType === 1 && elem.getAttribute("id") === match;
+		},
+
+		TAG: function( elem, match ) {
+			return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match;
+		},
+		
+		CLASS: function( elem, match ) {
+			return (" " + (elem.className || elem.getAttribute("class")) + " ")
+				.indexOf( match ) > -1;
+		},
+
+		ATTR: function( elem, match ) {
+			var name = match[1],
+				result = Expr.attrHandle[ name ] ?
+					Expr.attrHandle[ name ]( elem ) :
+					elem[ name ] != null ?
+						elem[ name ] :
+						elem.getAttribute( name ),
+				value = result + "",
+				type = match[2],
+				check = match[4];
+
+			return result == null ?
+				type === "!=" :
+				type === "=" ?
+				value === check :
+				type === "*=" ?
+				value.indexOf(check) >= 0 :
+				type === "~=" ?
+				(" " + value + " ").indexOf(check) >= 0 :
+				!check ?
+				value && result !== false :
+				type === "!=" ?
+				value !== check :
+				type === "^=" ?
+				value.indexOf(check) === 0 :
+				type === "$=" ?
+				value.substr(value.length - check.length) === check :
+				type === "|=" ?
+				value === check || value.substr(0, check.length + 1) === check + "-" :
+				false;
+		},
+
+		POS: function( elem, match, i, array ) {
+			var name = match[2],
+				filter = Expr.setFilters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+			}
+		}
+	}
+};
+
+var origPOS = Expr.match.POS,
+	fescape = function(all, num){
+		return "\\" + (num - 0 + 1);
+	};
+
+for ( var type in Expr.match ) {
+	Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) );
+	Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) );
+}
+
+var makeArray = function( array, results ) {
+	array = Array.prototype.slice.call( array, 0 );
+
+	if ( results ) {
+		results.push.apply( results, array );
+		return results;
+	}
+	
+	return array;
+};
+
+// Perform a simple check to determine if the browser is capable of
+// converting a NodeList to an array using builtin methods.
+// Also verifies that the returned array holds DOM nodes
+// (which is not the case in the Blackberry browser)
+try {
+	Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
+
+// Provide a fallback method if it does not work
+} catch( e ) {
+	makeArray = function( array, results ) {
+		var i = 0,
+			ret = results || [];
+
+		if ( toString.call(array) === "[object Array]" ) {
+			Array.prototype.push.apply( ret, array );
+
+		} else {
+			if ( typeof array.length === "number" ) {
+				for ( var l = array.length; i < l; i++ ) {
+					ret.push( array[i] );
+				}
+
+			} else {
+				for ( ; array[i]; i++ ) {
+					ret.push( array[i] );
+				}
+			}
+		}
+
+		return ret;
+	};
+}
+
+var sortOrder, siblingCheck;
+
+if ( document.documentElement.compareDocumentPosition ) {
+	sortOrder = function( a, b ) {
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
+		}
+
+		if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
+			return a.compareDocumentPosition ? -1 : 1;
+		}
+
+		return a.compareDocumentPosition(b) & 4 ? -1 : 1;
+	};
+
+} else {
+	sortOrder = function( a, b ) {
+		var al, bl,
+			ap = [],
+			bp = [],
+			aup = a.parentNode,
+			bup = b.parentNode,
+			cur = aup;
+
+		// The nodes are identical, we can exit early
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
+
+		// If the nodes are siblings (or identical) we can do a quick check
+		} else if ( aup === bup ) {
+			return siblingCheck( a, b );
+
+		// If no parents were found then the nodes are disconnected
+		} else if ( !aup ) {
+			return -1;
+
+		} else if ( !bup ) {
+			return 1;
+		}
+
+		// Otherwise they're somewhere else in the tree so we need
+		// to build up a full list of the parentNodes for comparison
+		while ( cur ) {
+			ap.unshift( cur );
+			cur = cur.parentNode;
+		}
+
+		cur = bup;
+
+		while ( cur ) {
+			bp.unshift( cur );
+			cur = cur.parentNode;
+		}
+
+		al = ap.length;
+		bl = bp.length;
+
+		// Start walking down the tree looking for a discrepancy
+		for ( var i = 0; i < al && i < bl; i++ ) {
+			if ( ap[i] !== bp[i] ) {
+				return siblingCheck( ap[i], bp[i] );
+			}
+		}
+
+		// We ended someplace up the tree so do a sibling check
+		return i === al ?
+			siblingCheck( a, bp[i], -1 ) :
+			siblingCheck( ap[i], b, 1 );
+	};
+
+	siblingCheck = function( a, b, ret ) {
+		if ( a === b ) {
+			return ret;
+		}
+
+		var cur = a.nextSibling;
+
+		while ( cur ) {
+			if ( cur === b ) {
+				return -1;
+			}
+
+			cur = cur.nextSibling;
+		}
+
+		return 1;
+	};
+}
+
+// Utility function for retreiving the text value of an array of DOM nodes
+Sizzle.getText = function( elems ) {
+	var ret = "", elem;
+
+	for ( var i = 0; elems[i]; i++ ) {
+		elem = elems[i];
+
+		// Get the text from text nodes and CDATA nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 4 ) {
+			ret += elem.nodeValue;
+
+		// Traverse everything else, except comment nodes
+		} else if ( elem.nodeType !== 8 ) {
+			ret += Sizzle.getText( elem.childNodes );
+		}
+	}
+
+	return ret;
+};
+
+// Check to see if the browser returns elements by name when
+// querying by getElementById (and provide a workaround)
+(function(){
+	// We're going to inject a fake input element with a specified name
+	var form = document.createElement("div"),
+		id = "script" + (new Date()).getTime(),
+		root = document.documentElement;
+
+	form.innerHTML = "<a name='" + id + "'/>";
+
+	// Inject it into the root element, check its status, and remove it quickly
+	root.insertBefore( form, root.firstChild );
+
+	// The workaround has to do additional checks after a getElementById
+	// Which slows things down for other browsers (hence the branching)
+	if ( document.getElementById( id ) ) {
+		Expr.find.ID = function( match, context, isXML ) {
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+
+				return m ?
+					m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ?
+						[m] :
+						undefined :
+					[];
+			}
+		};
+
+		Expr.filter.ID = function( elem, match ) {
+			var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+
+			return elem.nodeType === 1 && node && node.nodeValue === match;
+		};
+	}
+
+	root.removeChild( form );
+
+	// release memory in IE
+	root = form = null;
+})();
+
+(function(){
+	// Check to see if the browser returns only elements
+	// when doing getElementsByTagName("*")
+
+	// Create a fake element
+	var div = document.createElement("div");
+	div.appendChild( document.createComment("") );
+
+	// Make sure no comments are found
+	if ( div.getElementsByTagName("*").length > 0 ) {
+		Expr.find.TAG = function( match, context ) {
+			var results = context.getElementsByTagName( match[1] );
+
+			// Filter out possible comments
+			if ( match[1] === "*" ) {
+				var tmp = [];
+
+				for ( var i = 0; results[i]; i++ ) {
+					if ( results[i].nodeType === 1 ) {
+						tmp.push( results[i] );
+					}
+				}
+
+				results = tmp;
+			}
+
+			return results;
+		};
+	}
+
+	// Check to see if an attribute returns normalized href attributes
+	div.innerHTML = "<a href='#'></a>";
+
+	if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
+			div.firstChild.getAttribute("href") !== "#" ) {
+
+		Expr.attrHandle.href = function( elem ) {
+			return elem.getAttribute( "href", 2 );
+		};
+	}
+
+	// release memory in IE
+	div = null;
+})();
+
+if ( document.querySelectorAll ) {
+	(function(){
+		var oldSizzle = Sizzle,
+			div = document.createElement("div"),
+			id = "__sizzle__";
+
+		div.innerHTML = "<p class='TEST'></p>";
+
+		// Safari can't handle uppercase or unicode characters when
+		// in quirks mode.
+		if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+			return;
+		}
+	
+		Sizzle = function( query, context, extra, seed ) {
+			context = context || document;
+
+			// Only use querySelectorAll on non-XML documents
+			// (ID selectors don't work in non-HTML documents)
+			if ( !seed && !Sizzle.isXML(context) ) {
+				// See if we find a selector to speed up
+				var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query );
+				
+				if ( match && (context.nodeType === 1 || context.nodeType === 9) ) {
+					// Speed-up: Sizzle("TAG")
+					if ( match[1] ) {
+						return makeArray( context.getElementsByTagName( query ), extra );
+					
+					// Speed-up: Sizzle(".CLASS")
+					} else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) {
+						return makeArray( context.getElementsByClassName( match[2] ), extra );
+					}
+				}
+				
+				if ( context.nodeType === 9 ) {
+					// Speed-up: Sizzle("body")
+					// The body element only exists once, optimize finding it
+					if ( query === "body" && context.body ) {
+						return makeArray( [ context.body ], extra );
+						
+					// Speed-up: Sizzle("#ID")
+					} else if ( match && match[3] ) {
+						var elem = context.getElementById( match[3] );
+
+						// Check parentNode to catch when Blackberry 4.6 returns
+						// nodes that are no longer in the document #6963
+						if ( elem && elem.parentNode ) {
+							// Handle the case where IE and Opera return items
+							// by name instead of ID
+							if ( elem.id === match[3] ) {
+								return makeArray( [ elem ], extra );
+							}
+							
+						} else {
+							return makeArray( [], extra );
+						}
+					}
+					
+					try {
+						return makeArray( context.querySelectorAll(query), extra );
+					} catch(qsaError) {}
+
+				// qSA works strangely on Element-rooted queries
+				// We can work around this by specifying an extra ID on the root
+				// and working up from there (Thanks to Andrew Dupont for the technique)
+				// IE 8 doesn't work on object elements
+				} else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+					var oldContext = context,
+						old = context.getAttribute( "id" ),
+						nid = old || id,
+						hasParent = context.parentNode,
+						relativeHierarchySelector = /^\s*[+~]/.test( query );
+
+					if ( !old ) {
+						context.setAttribute( "id", nid );
+					} else {
+						nid = nid.replace( /'/g, "\\$&" );
+					}
+					if ( relativeHierarchySelector && hasParent ) {
+						context = context.parentNode;
+					}
+
+					try {
+						if ( !relativeHierarchySelector || hasParent ) {
+							return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra );
+						}
+
+					} catch(pseudoError) {
+					} finally {
+						if ( !old ) {
+							oldContext.removeAttribute( "id" );
+						}
+					}
+				}
+			}
+		
+			return oldSizzle(query, context, extra, seed);
+		};
+
+		for ( var prop in oldSizzle ) {
+			Sizzle[ prop ] = oldSizzle[ prop ];
+		}
+
+		// release memory in IE
+		div = null;
+	})();
+}
+
+(function(){
+	var html = document.documentElement,
+		matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector,
+		pseudoWorks = false;
+
+	try {
+		// This should fail with an exception
+		// Gecko does not error, returns false instead
+		matches.call( document.documentElement, "[test!='']:sizzle" );
+	
+	} catch( pseudoError ) {
+		pseudoWorks = true;
+	}
+
+	if ( matches ) {
+		Sizzle.matchesSelector = function( node, expr ) {
+			// Make sure that attribute selectors are quoted
+			expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']");
+
+			if ( !Sizzle.isXML( node ) ) {
+				try { 
+					if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) {
+						return matches.call( node, expr );
+					}
+				} catch(e) {}
+			}
+
+			return Sizzle(expr, null, null, [node]).length > 0;
+		};
+	}
+})();
+
+(function(){
+	var div = document.createElement("div");
+
+	div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+
+	// Opera can't find a second classname (in 9.6)
+	// Also, make sure that getElementsByClassName actually exists
+	if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
+		return;
+	}
+
+	// Safari caches class attributes, doesn't catch changes (in 3.2)
+	div.lastChild.className = "e";
+
+	if ( div.getElementsByClassName("e").length === 1 ) {
+		return;
+	}
+	
+	Expr.order.splice(1, 0, "CLASS");
+	Expr.find.CLASS = function( match, context, isXML ) {
+		if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
+			return context.getElementsByClassName(match[1]);
+		}
+	};
+
+	// release memory in IE
+	div = null;
+})();
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+
+		if ( elem ) {
+			var match = false;
+
+			elem = elem[dir];
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 && !isXML ){
+					elem.sizcache = doneName;
+					elem.sizset = i;
+				}
+
+				if ( elem.nodeName.toLowerCase() === cur ) {
+					match = elem;
+					break;
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+
+		if ( elem ) {
+			var match = false;
+			
+			elem = elem[dir];
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 ) {
+					if ( !isXML ) {
+						elem.sizcache = doneName;
+						elem.sizset = i;
+					}
+
+					if ( typeof cur !== "string" ) {
+						if ( elem === cur ) {
+							match = true;
+							break;
+						}
+
+					} else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+						match = elem;
+						break;
+					}
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+if ( document.documentElement.contains ) {
+	Sizzle.contains = function( a, b ) {
+		return a !== b && (a.contains ? a.contains(b) : true);
+	};
+
+} else if ( document.documentElement.compareDocumentPosition ) {
+	Sizzle.contains = function( a, b ) {
+		return !!(a.compareDocumentPosition(b) & 16);
+	};
+
+} else {
+	Sizzle.contains = function() {
+		return false;
+	};
+}
+
+Sizzle.isXML = function( elem ) {
+	// documentElement is verified for cases where it doesn't yet exist
+	// (such as loading iframes in IE - #4833) 
+	var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+
+	return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+var posProcess = function( selector, context ) {
+	var match,
+		tmpSet = [],
+		later = "",
+		root = context.nodeType ? [context] : context;
+
+	// Position selectors must be done after the filter
+	// And so must :not(positional) so we move all PSEUDOs to the end
+	while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+		later += match[0];
+		selector = selector.replace( Expr.match.PSEUDO, "" );
+	}
+
+	selector = Expr.relative[selector] ? selector + "*" : selector;
+
+	for ( var i = 0, l = root.length; i < l; i++ ) {
+		Sizzle( selector, root[i], tmpSet );
+	}
+
+	return Sizzle.filter( later, tmpSet );
+};
+
+// EXPOSE
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.filters;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+
+
+})();
+
+
+var runtil = /Until$/,
+	rparentsprev = /^(?:parents|prevUntil|prevAll)/,
+	// Note: This RegExp should be improved, or likely pulled from Sizzle
+	rmultiselector = /,/,
+	isSimple = /^.[^:#\[\.,]*$/,
+	slice = Array.prototype.slice,
+	POS = jQuery.expr.match.POS,
+	// methods guaranteed to produce a unique set when starting from a unique set
+	guaranteedUnique = {
+		children: true,
+		contents: true,
+		next: true,
+		prev: true
+	};
+
+jQuery.fn.extend({
+	find: function( selector ) {
+		var ret = this.pushStack( "", "find", selector ),
+			length = 0;
+
+		for ( var i = 0, l = this.length; i < l; i++ ) {
+			length = ret.length;
+			jQuery.find( selector, this[i], ret );
+
+			if ( i > 0 ) {
+				// Make sure that the results are unique
+				for ( var n = length; n < ret.length; n++ ) {
+					for ( var r = 0; r < length; r++ ) {
+						if ( ret[r] === ret[n] ) {
+							ret.splice(n--, 1);
+							break;
+						}
+					}
+				}
+			}
+		}
+
+		return ret;
+	},
+
+	has: function( target ) {
+		var targets = jQuery( target );
+		return this.filter(function() {
+			for ( var i = 0, l = targets.length; i < l; i++ ) {
+				if ( jQuery.contains( this, targets[i] ) ) {
+					return true;
+				}
+			}
+		});
+	},
+
+	not: function( selector ) {
+		return this.pushStack( winnow(this, selector, false), "not", selector);
+	},
+
+	filter: function( selector ) {
+		return this.pushStack( winnow(this, selector, true), "filter", selector );
+	},
+
+	is: function( selector ) {
+		return !!selector && jQuery.filter( selector, this ).length > 0;
+	},
+
+	closest: function( selectors, context ) {
+		var ret = [], i, l, cur = this[0];
+
+		if ( jQuery.isArray( selectors ) ) {
+			var match, selector,
+				matches = {},
+				level = 1;
+
+			if ( cur && selectors.length ) {
+				for ( i = 0, l = selectors.length; i < l; i++ ) {
+					selector = selectors[i];
+
+					if ( !matches[selector] ) {
+						matches[selector] = jQuery.expr.match.POS.test( selector ) ?
+							jQuery( selector, context || this.context ) :
+							selector;
+					}
+				}
+
+				while ( cur && cur.ownerDocument && cur !== context ) {
+					for ( selector in matches ) {
+						match = matches[selector];
+
+						if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) {
+							ret.push({ selector: selector, elem: cur, level: level });
+						}
+					}
+
+					cur = cur.parentNode;
+					level++;
+				}
+			}
+
+			return ret;
+		}
+
+		var pos = POS.test( selectors ) ?
+			jQuery( selectors, context || this.context ) : null;
+
+		for ( i = 0, l = this.length; i < l; i++ ) {
+			cur = this[i];
+
+			while ( cur ) {
+				if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
+					ret.push( cur );
+					break;
+
+				} else {
+					cur = cur.parentNode;
+					if ( !cur || !cur.ownerDocument || cur === context ) {
+						break;
+					}
+				}
+			}
+		}
+
+		ret = ret.length > 1 ? jQuery.unique(ret) : ret;
+
+		return this.pushStack( ret, "closest", selectors );
+	},
+
+	// Determine the position of an element within
+	// the matched set of elements
+	index: function( elem ) {
+		if ( !elem || typeof elem === "string" ) {
+			return jQuery.inArray( this[0],
+				// If it receives a string, the selector is used
+				// If it receives nothing, the siblings are used
+				elem ? jQuery( elem ) : this.parent().children() );
+		}
+		// Locate the position of the desired element
+		return jQuery.inArray(
+			// If it receives a jQuery object, the first element is used
+			elem.jquery ? elem[0] : elem, this );
+	},
+
+	add: function( selector, context ) {
+		var set = typeof selector === "string" ?
+				jQuery( selector, context ) :
+				jQuery.makeArray( selector ),
+			all = jQuery.merge( this.get(), set );
+
+		return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
+			all :
+			jQuery.unique( all ) );
+	},
+
+	andSelf: function() {
+		return this.add( this.prevObject );
+	}
+});
+
+// A painfully simple check to see if an element is disconnected
+// from a document (should be improved, where feasible).
+function isDisconnected( node ) {
+	return !node || !node.parentNode || node.parentNode.nodeType === 11;
+}
+
+jQuery.each({
+	parent: function( elem ) {
+		var parent = elem.parentNode;
+		return parent && parent.nodeType !== 11 ? parent : null;
+	},
+	parents: function( elem ) {
+		return jQuery.dir( elem, "parentNode" );
+	},
+	parentsUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "parentNode", until );
+	},
+	next: function( elem ) {
+		return jQuery.nth( elem, 2, "nextSibling" );
+	},
+	prev: function( elem ) {
+		return jQuery.nth( elem, 2, "previousSibling" );
+	},
+	nextAll: function( elem ) {
+		return jQuery.dir( elem, "nextSibling" );
+	},
+	prevAll: function( elem ) {
+		return jQuery.dir( elem, "previousSibling" );
+	},
+	nextUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "nextSibling", until );
+	},
+	prevUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "previousSibling", until );
+	},
+	siblings: function( elem ) {
+		return jQuery.sibling( elem.parentNode.firstChild, elem );
+	},
+	children: function( elem ) {
+		return jQuery.sibling( elem.firstChild );
+	},
+	contents: function( elem ) {
+		return jQuery.nodeName( elem, "iframe" ) ?
+			elem.contentDocument || elem.contentWindow.document :
+			jQuery.makeArray( elem.childNodes );
+	}
+}, function( name, fn ) {
+	jQuery.fn[ name ] = function( until, selector ) {
+		var ret = jQuery.map( this, fn, until ),
+			// The variable 'args' was introduced in
+			// https://github.com/jquery/jquery/commit/52a0238
+			// to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed.
+			// http://code.google.com/p/v8/issues/detail?id=1050
+			args = slice.call(arguments);
+
+		if ( !runtil.test( name ) ) {
+			selector = until;
+		}
+
+		if ( selector && typeof selector === "string" ) {
+			ret = jQuery.filter( selector, ret );
+		}
+
+		ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
+
+		if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
+			ret = ret.reverse();
+		}
+
+		return this.pushStack( ret, name, args.join(",") );
+	};
+});
+
+jQuery.extend({
+	filter: function( expr, elems, not ) {
+		if ( not ) {
+			expr = ":not(" + expr + ")";
+		}
+
+		return elems.length === 1 ?
+			jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
+			jQuery.find.matches(expr, elems);
+	},
+
+	dir: function( elem, dir, until ) {
+		var matched = [],
+			cur = elem[ dir ];
+
+		while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+			if ( cur.nodeType === 1 ) {
+				matched.push( cur );
+			}
+			cur = cur[dir];
+		}
+		return matched;
+	},
+
+	nth: function( cur, result, dir, elem ) {
+		result = result || 1;
+		var num = 0;
+
+		for ( ; cur; cur = cur[dir] ) {
+			if ( cur.nodeType === 1 && ++num === result ) {
+				break;
+			}
+		}
+
+		return cur;
+	},
+
+	sibling: function( n, elem ) {
+		var r = [];
+
+		for ( ; n; n = n.nextSibling ) {
+			if ( n.nodeType === 1 && n !== elem ) {
+				r.push( n );
+			}
+		}
+
+		return r;
+	}
+});
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, keep ) {
+	if ( jQuery.isFunction( qualifier ) ) {
+		return jQuery.grep(elements, function( elem, i ) {
+			var retVal = !!qualifier.call( elem, i, elem );
+			return retVal === keep;
+		});
+
+	} else if ( qualifier.nodeType ) {
+		return jQuery.grep(elements, function( elem, i ) {
+			return (elem === qualifier) === keep;
+		});
+
+	} else if ( typeof qualifier === "string" ) {
+		var filtered = jQuery.grep(elements, function( elem ) {
+			return elem.nodeType === 1;
+		});
+
+		if ( isSimple.test( qualifier ) ) {
+			return jQuery.filter(qualifier, filtered, !keep);
+		} else {
+			qualifier = jQuery.filter( qualifier, filtered );
+		}
+	}
+
+	return jQuery.grep(elements, function( elem, i ) {
+		return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
+	});
+}
+
+
+
+
+var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
+	rleadingWhitespace = /^\s+/,
+	rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,
+	rtagName = /<([\w:]+)/,
+	rtbody = /<tbody/i,
+	rhtml = /<|&#?\w+;/,
+	rnocache = /<(?:script|object|embed|option|style)/i,
+	// checked="checked" or checked
+	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+	wrapMap = {
+		option: [ 1, "<select multiple='multiple'>", "</select>" ],
+		legend: [ 1, "<fieldset>", "</fieldset>" ],
+		thead: [ 1, "<table>", "</table>" ],
+		tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+		td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+		col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+		area: [ 1, "<map>", "</map>" ],
+		_default: [ 0, "", "" ]
+	};
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// IE can't serialize <link> and <script> tags normally
+if ( !jQuery.support.htmlSerialize ) {
+	wrapMap._default = [ 1, "div<div>", "</div>" ];
+}
+
+jQuery.fn.extend({
+	text: function( text ) {
+		if ( jQuery.isFunction(text) ) {
+			return this.each(function(i) {
+				var self = jQuery( this );
+
+				self.text( text.call(this, i, self.text()) );
+			});
+		}
+
+		if ( typeof text !== "object" && text !== undefined ) {
+			return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+		}
+
+		return jQuery.text( this );
+	},
+
+	wrapAll: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each(function(i) {
+				jQuery(this).wrapAll( html.call(this, i) );
+			});
+		}
+
+		if ( this[0] ) {
+			// The elements to wrap the target around
+			var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+			if ( this[0].parentNode ) {
+				wrap.insertBefore( this[0] );
+			}
+
+			wrap.map(function() {
+				var elem = this;
+
+				while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+					elem = elem.firstChild;
+				}
+
+				return elem;
+			}).append(this);
+		}
+
+		return this;
+	},
+
+	wrapInner: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each(function(i) {
+				jQuery(this).wrapInner( html.call(this, i) );
+			});
+		}
+
+		return this.each(function() {
+			var self = jQuery( this ),
+				contents = self.contents();
+
+			if ( contents.length ) {
+				contents.wrapAll( html );
+
+			} else {
+				self.append( html );
+			}
+		});
+	},
+
+	wrap: function( html ) {
+		return this.each(function() {
+			jQuery( this ).wrapAll( html );
+		});
+	},
+
+	unwrap: function() {
+		return this.parent().each(function() {
+			if ( !jQuery.nodeName( this, "body" ) ) {
+				jQuery( this ).replaceWith( this.childNodes );
+			}
+		}).end();
+	},
+
+	append: function() {
+		return this.domManip(arguments, true, function( elem ) {
+			if ( this.nodeType === 1 ) {
+				this.appendChild( elem );
+			}
+		});
+	},
+
+	prepend: function() {
+		return this.domManip(arguments, true, function( elem ) {
+			if ( this.nodeType === 1 ) {
+				this.insertBefore( elem, this.firstChild );
+			}
+		});
+	},
+
+	before: function() {
+		if ( this[0] && this[0].parentNode ) {
+			return this.domManip(arguments, false, function( elem ) {
+				this.parentNode.insertBefore( elem, this );
+			});
+		} else if ( arguments.length ) {
+			var set = jQuery(arguments[0]);
+			set.push.apply( set, this.toArray() );
+			return this.pushStack( set, "before", arguments );
+		}
+	},
+
+	after: function() {
+		if ( this[0] && this[0].parentNode ) {
+			return this.domManip(arguments, false, function( elem ) {
+				this.parentNode.insertBefore( elem, this.nextSibling );
+			});
+		} else if ( arguments.length ) {
+			var set = this.pushStack( this, "after", arguments );
+			set.push.apply( set, jQuery(arguments[0]).toArray() );
+			return set;
+		}
+	},
+
+	// keepData is for internal use only--do not document
+	remove: function( selector, keepData ) {
+		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+			if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
+				if ( !keepData && elem.nodeType === 1 ) {
+					jQuery.cleanData( elem.getElementsByTagName("*") );
+					jQuery.cleanData( [ elem ] );
+				}
+
+				if ( elem.parentNode ) {
+					elem.parentNode.removeChild( elem );
+				}
+			}
+		}
+
+		return this;
+	},
+
+	empty: function() {
+		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+			// Remove element nodes and prevent memory leaks
+			if ( elem.nodeType === 1 ) {
+				jQuery.cleanData( elem.getElementsByTagName("*") );
+			}
+
+			// Remove any remaining nodes
+			while ( elem.firstChild ) {
+				elem.removeChild( elem.firstChild );
+			}
+		}
+
+		return this;
+	},
+
+	clone: function( dataAndEvents, deepDataAndEvents ) {
+		dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+		deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+		return this.map( function () {
+			return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+		});
+	},
+
+	html: function( value ) {
+		if ( value === undefined ) {
+			return this[0] && this[0].nodeType === 1 ?
+				this[0].innerHTML.replace(rinlinejQuery, "") :
+				null;
+
+		// See if we can take a shortcut and just use innerHTML
+		} else if ( typeof value === "string" && !rnocache.test( value ) &&
+			(jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
+			!wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
+
+			value = value.replace(rxhtmlTag, "<$1></$2>");
+
+			try {
+				for ( var i = 0, l = this.length; i < l; i++ ) {
+					// Remove element nodes and prevent memory leaks
+					if ( this[i].nodeType === 1 ) {
+						jQuery.cleanData( this[i].getElementsByTagName("*") );
+						this[i].innerHTML = value;
+					}
+				}
+
+			// If using innerHTML throws an exception, use the fallback method
+			} catch(e) {
+				this.empty().append( value );
+			}
+
+		} else if ( jQuery.isFunction( value ) ) {
+			this.each(function(i){
+				var self = jQuery( this );
+
+				self.html( value.call(this, i, self.html()) );
+			});
+
+		} else {
+			this.empty().append( value );
+		}
+
+		return this;
+	},
+
+	replaceWith: function( value ) {
+		if ( this[0] && this[0].parentNode ) {
+			// Make sure that the elements are removed from the DOM before they are inserted
+			// this can help fix replacing a parent with child elements
+			if ( jQuery.isFunction( value ) ) {
+				return this.each(function(i) {
+					var self = jQuery(this), old = self.html();
+					self.replaceWith( value.call( this, i, old ) );
+				});
+			}
+
+			if ( typeof value !== "string" ) {
+				value = jQuery( value ).detach();
+			}
+
+			return this.each(function() {
+				var next = this.nextSibling,
+					parent = this.parentNode;
+
+				jQuery( this ).remove();
+
+				if ( next ) {
+					jQuery(next).before( value );
+				} else {
+					jQuery(parent).append( value );
+				}
+			});
+		} else {
+			return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value );
+		}
+	},
+
+	detach: function( selector ) {
+		return this.remove( selector, true );
+	},
+
+	domManip: function( args, table, callback ) {
+		var results, first, fragment, parent,
+			value = args[0],
+			scripts = [];
+
+		// We can't cloneNode fragments that contain checked, in WebKit
+		if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
+			return this.each(function() {
+				jQuery(this).domManip( args, table, callback, true );
+			});
+		}
+
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				args[0] = value.call(this, i, table ? self.html() : undefined);
+				self.domManip( args, table, callback );
+			});
+		}
+
+		if ( this[0] ) {
+			parent = value && value.parentNode;
+
+			// If we're in a fragment, just use that instead of building a new one
+			if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
+				results = { fragment: parent };
+
+			} else {
+				results = jQuery.buildFragment( args, this, scripts );
+			}
+
+			fragment = results.fragment;
+
+			if ( fragment.childNodes.length === 1 ) {
+				first = fragment = fragment.firstChild;
+			} else {
+				first = fragment.firstChild;
+			}
+
+			if ( first ) {
+				table = table && jQuery.nodeName( first, "tr" );
+
+				for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) {
+					callback.call(
+						table ?
+							root(this[i], first) :
+							this[i],
+						// Make sure that we do not leak memory by inadvertently discarding
+						// the original fragment (which might have attached data) instead of
+						// using it; in addition, use the original fragment object for the last
+						// item instead of first because it can end up being emptied incorrectly
+						// in certain situations (Bug #8070).
+						// Fragments from the fragment cache must always be cloned and never used
+						// in place.
+						results.cacheable || (l > 1 && i < lastIndex) ?
+							jQuery.clone( fragment, true, true ) :
+							fragment
+					);
+				}
+			}
+
+			if ( scripts.length ) {
+				jQuery.each( scripts, evalScript );
+			}
+		}
+
+		return this;
+	}
+});
+
+function root( elem, cur ) {
+	return jQuery.nodeName(elem, "table") ?
+		(elem.getElementsByTagName("tbody")[0] ||
+		elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+		elem;
+}
+
+function cloneCopyEvent( src, dest ) {
+
+	if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+		return;
+	}
+
+	var internalKey = jQuery.expando,
+		oldData = jQuery.data( src ),
+		curData = jQuery.data( dest, oldData );
+
+	// Switch to use the internal data object, if it exists, for the next
+	// stage of data copying
+	if ( (oldData = oldData[ internalKey ]) ) {
+		var events = oldData.events;
+				curData = curData[ internalKey ] = jQuery.extend({}, oldData);
+
+		if ( events ) {
+			delete curData.handle;
+			curData.events = {};
+
+			for ( var type in events ) {
+				for ( var i = 0, l = events[ type ].length; i < l; i++ ) {
+					jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data );
+				}
+			}
+		}
+	}
+}
+
+function cloneFixAttributes(src, dest) {
+	// We do not need to do anything for non-Elements
+	if ( dest.nodeType !== 1 ) {
+		return;
+	}
+
+	var nodeName = dest.nodeName.toLowerCase();
+
+	// clearAttributes removes the attributes, which we don't want,
+	// but also removes the attachEvent events, which we *do* want
+	dest.clearAttributes();
+
+	// mergeAttributes, in contrast, only merges back on the
+	// original attributes, not the events
+	dest.mergeAttributes(src);
+
+	// IE6-8 fail to clone children inside object elements that use
+	// the proprietary classid attribute value (rather than the type
+	// attribute) to identify the type of content to display
+	if ( nodeName === "object" ) {
+		dest.outerHTML = src.outerHTML;
+
+	} else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) {
+		// IE6-8 fails to persist the checked state of a cloned checkbox
+		// or radio button. Worse, IE6-7 fail to give the cloned element
+		// a checked appearance if the defaultChecked value isn't also set
+		if ( src.checked ) {
+			dest.defaultChecked = dest.checked = src.checked;
+		}
+
+		// IE6-7 get confused and end up setting the value of a cloned
+		// checkbox/radio button to an empty string instead of "on"
+		if ( dest.value !== src.value ) {
+			dest.value = src.value;
+		}
+
+	// IE6-8 fails to return the selected option to the default selected
+	// state when cloning options
+	} else if ( nodeName === "option" ) {
+		dest.selected = src.defaultSelected;
+
+	// IE6-8 fails to set the defaultValue to the correct value when
+	// cloning other types of input fields
+	} else if ( nodeName === "input" || nodeName === "textarea" ) {
+		dest.defaultValue = src.defaultValue;
+	}
+
+	// Event data gets referenced instead of copied if the expando
+	// gets copied too
+	dest.removeAttribute( jQuery.expando );
+}
+
+jQuery.buildFragment = function( args, nodes, scripts ) {
+	var fragment, cacheable, cacheresults,
+		doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document);
+
+	// Only cache "small" (1/2 KB) HTML strings that are associated with the main document
+	// Cloning options loses the selected state, so don't cache them
+	// IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
+	// Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
+	if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
+		args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
+
+		cacheable = true;
+		cacheresults = jQuery.fragments[ args[0] ];
+		if ( cacheresults ) {
+			if ( cacheresults !== 1 ) {
+				fragment = cacheresults;
+			}
+		}
+	}
+
+	if ( !fragment ) {
+		fragment = doc.createDocumentFragment();
+		jQuery.clean( args, doc, fragment, scripts );
+	}
+
+	if ( cacheable ) {
+		jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1;
+	}
+
+	return { fragment: fragment, cacheable: cacheable };
+};
+
+jQuery.fragments = {};
+
+jQuery.each({
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function( name, original ) {
+	jQuery.fn[ name ] = function( selector ) {
+		var ret = [],
+			insert = jQuery( selector ),
+			parent = this.length === 1 && this[0].parentNode;
+
+		if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
+			insert[ original ]( this[0] );
+			return this;
+
+		} else {
+			for ( var i = 0, l = insert.length; i < l; i++ ) {
+				var elems = (i > 0 ? this.clone(true) : this).get();
+				jQuery( insert[i] )[ original ]( elems );
+				ret = ret.concat( elems );
+			}
+
+			return this.pushStack( ret, name, insert.selector );
+		}
+	};
+});
+
+function getAll( elem ) {
+	if ( "getElementsByTagName" in elem ) {
+		return elem.getElementsByTagName( "*" );
+	
+	} else if ( "querySelectorAll" in elem ) {
+		return elem.querySelectorAll( "*" );
+
+	} else {
+		return [];
+	}
+}
+
+jQuery.extend({
+	clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+		var clone = elem.cloneNode(true),
+				srcElements,
+				destElements,
+				i;
+
+		if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
+				(elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
+			// IE copies events bound via attachEvent when using cloneNode.
+			// Calling detachEvent on the clone will also remove the events
+			// from the original. In order to get around this, we use some
+			// proprietary methods to clear the events. Thanks to MooTools
+			// guys for this hotness.
+
+			cloneFixAttributes( elem, clone );
+
+			// Using Sizzle here is crazy slow, so we use getElementsByTagName
+			// instead
+			srcElements = getAll( elem );
+			destElements = getAll( clone );
+
+			// Weird iteration because IE will replace the length property
+			// with an element if you are cloning the body and one of the
+			// elements on the page has a name or id of "length"
+			for ( i = 0; srcElements[i]; ++i ) {
+				cloneFixAttributes( srcElements[i], destElements[i] );
+			}
+		}
+
+		// Copy the events from the original to the clone
+		if ( dataAndEvents ) {
+			cloneCopyEvent( elem, clone );
+
+			if ( deepDataAndEvents ) {
+				srcElements = getAll( elem );
+				destElements = getAll( clone );
+
+				for ( i = 0; srcElements[i]; ++i ) {
+					cloneCopyEvent( srcElements[i], destElements[i] );
+				}
+			}
+		}
+
+		// Return the cloned set
+		return clone;
+},
+	clean: function( elems, context, fragment, scripts ) {
+		context = context || document;
+
+		// !context.createElement fails in IE with an error but returns typeof 'object'
+		if ( typeof context.createElement === "undefined" ) {
+			context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+		}
+
+		var ret = [];
+
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			if ( typeof elem === "number" ) {
+				elem += "";
+			}
+
+			if ( !elem ) {
+				continue;
+			}
+
+			// Convert html string into DOM nodes
+			if ( typeof elem === "string" && !rhtml.test( elem ) ) {
+				elem = context.createTextNode( elem );
+
+			} else if ( typeof elem === "string" ) {
+				// Fix "XHTML"-style tags in all browsers
+				elem = elem.replace(rxhtmlTag, "<$1></$2>");
+
+				// Trim whitespace, otherwise indexOf won't work as expected
+				var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
+					wrap = wrapMap[ tag ] || wrapMap._default,
+					depth = wrap[0],
+					div = context.createElement("div");
+
+				// Go to html and back, then peel off extra wrappers
+				div.innerHTML = wrap[1] + elem + wrap[2];
+
+				// Move to the right depth
+				while ( depth-- ) {
+					div = div.lastChild;
+				}
+
+				// Remove IE's autoinserted <tbody> from table fragments
+				if ( !jQuery.support.tbody ) {
+
+					// String was a <table>, *may* have spurious <tbody>
+					var hasBody = rtbody.test(elem),
+						tbody = tag === "table" && !hasBody ?
+							div.firstChild && div.firstChild.childNodes :
+
+							// String was a bare <thead> or <tfoot>
+							wrap[1] === "<table>" && !hasBody ?
+								div.childNodes :
+								[];
+
+					for ( var j = tbody.length - 1; j >= 0 ; --j ) {
+						if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+							tbody[ j ].parentNode.removeChild( tbody[ j ] );
+						}
+					}
+
+				}
+
+				// IE completely kills leading whitespace when innerHTML is used
+				if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+					div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+				}
+
+				elem = div.childNodes;
+			}
+
+			if ( elem.nodeType ) {
+				ret.push( elem );
+			} else {
+				ret = jQuery.merge( ret, elem );
+			}
+		}
+
+		if ( fragment ) {
+			for ( i = 0; ret[i]; i++ ) {
+				if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+					scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+
+				} else {
+					if ( ret[i].nodeType === 1 ) {
+						ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
+					}
+					fragment.appendChild( ret[i] );
+				}
+			}
+		}
+
+		return ret;
+	},
+
+	cleanData: function( elems ) {
+		var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special,
+			deleteExpando = jQuery.support.deleteExpando;
+
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+				continue;
+			}
+
+			id = elem[ jQuery.expando ];
+
+			if ( id ) {
+				data = cache[ id ] && cache[ id ][ internalKey ];
+
+				if ( data && data.events ) {
+					for ( var type in data.events ) {
+						if ( special[ type ] ) {
+							jQuery.event.remove( elem, type );
+
+						// This is a shortcut to avoid jQuery.event.remove's overhead
+						} else {
+							jQuery.removeEvent( elem, type, data.handle );
+						}
+					}
+
+					// Null the DOM reference to avoid IE6/7/8 leak (#7054)
+					if ( data.handle ) {
+						data.handle.elem = null;
+					}
+				}
+
+				if ( deleteExpando ) {
+					delete elem[ jQuery.expando ];
+
+				} else if ( elem.removeAttribute ) {
+					elem.removeAttribute( jQuery.expando );
+				}
+
+				delete cache[ id ];
+			}
+		}
+	}
+});
+
+function evalScript( i, elem ) {
+	if ( elem.src ) {
+		jQuery.ajax({
+			url: elem.src,
+			async: false,
+			dataType: "script"
+		});
+	} else {
+		jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
+	}
+
+	if ( elem.parentNode ) {
+		elem.parentNode.removeChild( elem );
+	}
+}
+
+
+
+
+var ralpha = /alpha\([^)]*\)/i,
+	ropacity = /opacity=([^)]*)/,
+	rdashAlpha = /-([a-z])/ig,
+	rupper = /([A-Z])/g,
+	rnumpx = /^-?\d+(?:px)?$/i,
+	rnum = /^-?\d/,
+
+	cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+	cssWidth = [ "Left", "Right" ],
+	cssHeight = [ "Top", "Bottom" ],
+	curCSS,
+
+	getComputedStyle,
+	currentStyle,
+
+	fcamelCase = function( all, letter ) {
+		return letter.toUpperCase();
+	};
+
+jQuery.fn.css = function( name, value ) {
+	// Setting 'undefined' is a no-op
+	if ( arguments.length === 2 && value === undefined ) {
+		return this;
+	}
+
+	return jQuery.access( this, name, value, true, function( elem, name, value ) {
+		return value !== undefined ?
+			jQuery.style( elem, name, value ) :
+			jQuery.css( elem, name );
+	});
+};
+
+jQuery.extend({
+	// Add in style property hooks for overriding the default
+	// behavior of getting and setting a style property
+	cssHooks: {
+		opacity: {
+			get: function( elem, computed ) {
+				if ( computed ) {
+					// We should always get a number back from opacity
+					var ret = curCSS( elem, "opacity", "opacity" );
+					return ret === "" ? "1" : ret;
+
+				} else {
+					return elem.style.opacity;
+				}
+			}
+		}
+	},
+
+	// Exclude the following css properties to add px
+	cssNumber: {
+		"zIndex": true,
+		"fontWeight": true,
+		"opacity": true,
+		"zoom": true,
+		"lineHeight": true
+	},
+
+	// Add in properties whose names you wish to fix before
+	// setting or getting the value
+	cssProps: {
+		// normalize float css property
+		"float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
+	},
+
+	// Get and set the style property on a DOM Node
+	style: function( elem, name, value, extra ) {
+		// Don't set styles on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+			return;
+		}
+
+		// Make sure that we're working with the right name
+		var ret, origName = jQuery.camelCase( name ),
+			style = elem.style, hooks = jQuery.cssHooks[ origName ];
+
+		name = jQuery.cssProps[ origName ] || origName;
+
+		// Check if we're setting a value
+		if ( value !== undefined ) {
+			// Make sure that NaN and null values aren't set. See: #7116
+			if ( typeof value === "number" && isNaN( value ) || value == null ) {
+				return;
+			}
+
+			// If a number was passed in, add 'px' to the (except for certain CSS properties)
+			if ( typeof value === "number" && !jQuery.cssNumber[ origName ] ) {
+				value += "px";
+			}
+
+			// If a hook was provided, use that value, otherwise just set the specified value
+			if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) {
+				// Wrapped to prevent IE from throwing errors when 'invalid' values are provided
+				// Fixes bug #5509
+				try {
+					style[ name ] = value;
+				} catch(e) {}
+			}
+
+		} else {
+			// If a hook was provided get the non-computed value from there
+			if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
+				return ret;
+			}
+
+			// Otherwise just get the value from the style object
+			return style[ name ];
+		}
+	},
+
+	css: function( elem, name, extra ) {
+		// Make sure that we're working with the right name
+		var ret, origName = jQuery.camelCase( name ),
+			hooks = jQuery.cssHooks[ origName ];
+
+		name = jQuery.cssProps[ origName ] || origName;
+
+		// If a hook was provided get the computed value from there
+		if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) {
+			return ret;
+
+		// Otherwise, if a way to get the computed value exists, use that
+		} else if ( curCSS ) {
+			return curCSS( elem, name, origName );
+		}
+	},
+
+	// A method for quickly swapping in/out CSS properties to get correct calculations
+	swap: function( elem, options, callback ) {
+		var old = {};
+
+		// Remember the old values, and insert the new ones
+		for ( var name in options ) {
+			old[ name ] = elem.style[ name ];
+			elem.style[ name ] = options[ name ];
+		}
+
+		callback.call( elem );
+
+		// Revert the old values
+		for ( name in options ) {
+			elem.style[ name ] = old[ name ];
+		}
+	},
+
+	camelCase: function( string ) {
+		return string.replace( rdashAlpha, fcamelCase );
+	}
+});
+
+// DEPRECATED, Use jQuery.css() instead
+jQuery.curCSS = jQuery.css;
+
+jQuery.each(["height", "width"], function( i, name ) {
+	jQuery.cssHooks[ name ] = {
+		get: function( elem, computed, extra ) {
+			var val;
+
+			if ( computed ) {
+				if ( elem.offsetWidth !== 0 ) {
+					val = getWH( elem, name, extra );
+
+				} else {
+					jQuery.swap( elem, cssShow, function() {
+						val = getWH( elem, name, extra );
+					});
+				}
+
+				if ( val <= 0 ) {
+					val = curCSS( elem, name, name );
+
+					if ( val === "0px" && currentStyle ) {
+						val = currentStyle( elem, name, name );
+					}
+
+					if ( val != null ) {
+						// Should return "auto" instead of 0, use 0 for
+						// temporary backwards-compat
+						return val === "" || val === "auto" ? "0px" : val;
+					}
+				}
+
+				if ( val < 0 || val == null ) {
+					val = elem.style[ name ];
+
+					// Should return "auto" instead of 0, use 0 for
+					// temporary backwards-compat
+					return val === "" || val === "auto" ? "0px" : val;
+				}
+
+				return typeof val === "string" ? val : val + "px";
+			}
+		},
+
+		set: function( elem, value ) {
+			if ( rnumpx.test( value ) ) {
+				// ignore negative width and height values #1599
+				value = parseFloat(value);
+
+				if ( value >= 0 ) {
+					return value + "px";
+				}
+
+			} else {
+				return value;
+			}
+		}
+	};
+});
+
+if ( !jQuery.support.opacity ) {
+	jQuery.cssHooks.opacity = {
+		get: function( elem, computed ) {
+			// IE uses filters for opacity
+			return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ?
+				(parseFloat(RegExp.$1) / 100) + "" :
+				computed ? "1" : "";
+		},
+
+		set: function( elem, value ) {
+			var style = elem.style;
+
+			// IE has trouble with opacity if it does not have layout
+			// Force it by setting the zoom level
+			style.zoom = 1;
+
+			// Set the alpha filter to set the opacity
+			var opacity = jQuery.isNaN(value) ?
+				"" :
+				"alpha(opacity=" + value * 100 + ")",
+				filter = style.filter || "";
+
+			style.filter = ralpha.test(filter) ?
+				filter.replace(ralpha, opacity) :
+				style.filter + ' ' + opacity;
+		}
+	};
+}
+
+if ( document.defaultView && document.defaultView.getComputedStyle ) {
+	getComputedStyle = function( elem, newName, name ) {
+		var ret, defaultView, computedStyle;
+
+		name = name.replace( rupper, "-$1" ).toLowerCase();
+
+		if ( !(defaultView = elem.ownerDocument.defaultView) ) {
+			return undefined;
+		}
+
+		if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) {
+			ret = computedStyle.getPropertyValue( name );
+			if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
+				ret = jQuery.style( elem, name );
+			}
+		}
+
+		return ret;
+	};
+}
+
+if ( document.documentElement.currentStyle ) {
+	currentStyle = function( elem, name ) {
+		var left,
+			ret = elem.currentStyle && elem.currentStyle[ name ],
+			rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ],
+			style = elem.style;
+
+		// From the awesome hack by Dean Edwards
+		// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+		// If we're not dealing with a regular pixel number
+		// but a number that has a weird ending, we need to convert it to pixels
+		if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
+			// Remember the original values
+			left = style.left;
+
+			// Put in the new values to get a computed value out
+			if ( rsLeft ) {
+				elem.runtimeStyle.left = elem.currentStyle.left;
+			}
+			style.left = name === "fontSize" ? "1em" : (ret || 0);
+			ret = style.pixelLeft + "px";
+
+			// Revert the changed values
+			style.left = left;
+			if ( rsLeft ) {
+				elem.runtimeStyle.left = rsLeft;
+			}
+		}
+
+		return ret === "" ? "auto" : ret;
+	};
+}
+
+curCSS = getComputedStyle || currentStyle;
+
+function getWH( elem, name, extra ) {
+	var which = name === "width" ? cssWidth : cssHeight,
+		val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
+
+	if ( extra === "border" ) {
+		return val;
+	}
+
+	jQuery.each( which, function() {
+		if ( !extra ) {
+			val -= parseFloat(jQuery.css( elem, "padding" + this )) || 0;
+		}
+
+		if ( extra === "margin" ) {
+			val += parseFloat(jQuery.css( elem, "margin" + this )) || 0;
+
+		} else {
+			val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) || 0;
+		}
+	});
+
+	return val;
+}
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+	jQuery.expr.filters.hidden = function( elem ) {
+		var width = elem.offsetWidth,
+			height = elem.offsetHeight;
+
+		return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none");
+	};
+
+	jQuery.expr.filters.visible = function( elem ) {
+		return !jQuery.expr.filters.hidden( elem );
+	};
+}
+
+
+
+
+var r20 = /%20/g,
+	rbracket = /\[\]$/,
+	rCRLF = /\r?\n/g,
+	rhash = /#.*$/,
+	rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+	rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
+	// #7653, #8125, #8152: local protocol detection
+	rlocalProtocol = /(?:^file|^widget|\-extension):$/,
+	rnoContent = /^(?:GET|HEAD)$/,
+	rprotocol = /^\/\//,
+	rquery = /\?/,
+	rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
+	rselectTextarea = /^(?:select|textarea)/i,
+	rspacesAjax = /\s+/,
+	rts = /([?&])_=[^&]*/,
+	rucHeaders = /(^|\-)([a-z])/g,
+	rucHeadersFunc = function( _, $1, $2 ) {
+		return $1 + $2.toUpperCase();
+	},
+	rurl = /^([\w\+\.\-]+:)\/\/([^\/?#:]*)(?::(\d+))?/,
+
+	// Keep a copy of the old load method
+	_load = jQuery.fn.load,
+
+	/* Prefilters
+	 * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+	 * 2) These are called:
+	 *    - BEFORE asking for a transport
+	 *    - AFTER param serialization (s.data is a string if s.processData is true)
+	 * 3) key is the dataType
+	 * 4) the catchall symbol "*" can be used
+	 * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+	 */
+	prefilters = {},
+
+	/* Transports bindings
+	 * 1) key is the dataType
+	 * 2) the catchall symbol "*" can be used
+	 * 3) selection will start with transport dataType and THEN go to "*" if needed
+	 */
+	transports = {},
+
+	// Document location
+	ajaxLocation,
+
+	// Document location segments
+	ajaxLocParts;
+
+// #8138, IE may throw an exception when accessing
+// a field from document.location if document.domain has been set
+try {
+	ajaxLocation = document.location.href;
+} catch( e ) {
+	// Use the href attribute of an A element
+	// since IE will modify it given document.location
+	ajaxLocation = document.createElement( "a" );
+	ajaxLocation.href = "";
+	ajaxLocation = ajaxLocation.href;
+}
+
+// Segment location into parts
+ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() );
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+	// dataTypeExpression is optional and defaults to "*"
+	return function( dataTypeExpression, func ) {
+
+		if ( typeof dataTypeExpression !== "string" ) {
+			func = dataTypeExpression;
+			dataTypeExpression = "*";
+		}
+
+		if ( jQuery.isFunction( func ) ) {
+			var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ),
+				i = 0,
+				length = dataTypes.length,
+				dataType,
+				list,
+				placeBefore;
+
+			// For each dataType in the dataTypeExpression
+			for(; i < length; i++ ) {
+				dataType = dataTypes[ i ];
+				// We control if we're asked to add before
+				// any existing element
+				placeBefore = /^\+/.test( dataType );
+				if ( placeBefore ) {
+					dataType = dataType.substr( 1 ) || "*";
+				}
+				list = structure[ dataType ] = structure[ dataType ] || [];
+				// then we add to the structure accordingly
+				list[ placeBefore ? "unshift" : "push" ]( func );
+			}
+		}
+	};
+}
+
+//Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR,
+		dataType /* internal */, inspected /* internal */ ) {
+
+	dataType = dataType || options.dataTypes[ 0 ];
+	inspected = inspected || {};
+
+	inspected[ dataType ] = true;
+
+	var list = structure[ dataType ],
+		i = 0,
+		length = list ? list.length : 0,
+		executeOnly = ( structure === prefilters ),
+		selection;
+
+	for(; i < length && ( executeOnly || !selection ); i++ ) {
+		selection = list[ i ]( options, originalOptions, jqXHR );
+		// If we got redirected to another dataType
+		// we try there if executing only and not done already
+		if ( typeof selection === "string" ) {
+			if ( !executeOnly || inspected[ selection ] ) {
+				selection = undefined;
+			} else {
+				options.dataTypes.unshift( selection );
+				selection = inspectPrefiltersOrTransports(
+						structure, options, originalOptions, jqXHR, selection, inspected );
+			}
+		}
+	}
+	// If we're only executing or nothing was selected
+	// we try the catchall dataType if not done already
+	if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
+		selection = inspectPrefiltersOrTransports(
+				structure, options, originalOptions, jqXHR, "*", inspected );
+	}
+	// unnecessary when only executing (prefilters)
+	// but it'll be ignored by the caller in that case
+	return selection;
+}
+
+jQuery.fn.extend({
+	load: function( url, params, callback ) {
+		if ( typeof url !== "string" && _load ) {
+			return _load.apply( this, arguments );
+
+		// Don't do a request if no elements are being requested
+		} else if ( !this.length ) {
+			return this;
+		}
+
+		var off = url.indexOf( " " );
+		if ( off >= 0 ) {
+			var selector = url.slice( off, url.length );
+			url = url.slice( 0, off );
+		}
+
+		// Default to a GET request
+		var type = "GET";
+
+		// If the second parameter was provided
+		if ( params ) {
+			// If it's a function
+			if ( jQuery.isFunction( params ) ) {
+				// We assume that it's the callback
+				callback = params;
+				params = undefined;
+
+			// Otherwise, build a param string
+			} else if ( typeof params === "object" ) {
+				params = jQuery.param( params, jQuery.ajaxSettings.traditional );
+				type = "POST";
+			}
+		}
+
+		var self = this;
+
+		// Request the remote document
+		jQuery.ajax({
+			url: url,
+			type: type,
+			dataType: "html",
+			data: params,
+			// Complete callback (responseText is used internally)
+			complete: function( jqXHR, status, responseText ) {
+				// Store the response as specified by the jqXHR object
+				responseText = jqXHR.responseText;
+				// If successful, inject the HTML into all the matched elements
+				if ( jqXHR.isResolved() ) {
+					// #4825: Get the actual response in case
+					// a dataFilter is present in ajaxSettings
+					jqXHR.done(function( r ) {
+						responseText = r;
+					});
+					// See if a selector was specified
+					self.html( selector ?
+						// Create a dummy div to hold the results
+						jQuery("<div>")
+							// inject the contents of the document in, removing the scripts
+							// to avoid any 'Permission Denied' errors in IE
+							.append(responseText.replace(rscript, ""))
+
+							// Locate the specified elements
+							.find(selector) :
+
+						// If not, just inject the full result
+						responseText );
+				}
+
+				if ( callback ) {
+					self.each( callback, [ responseText, status, jqXHR ] );
+				}
+			}
+		});
+
+		return this;
+	},
+
+	serialize: function() {
+		return jQuery.param( this.serializeArray() );
+	},
+
+	serializeArray: function() {
+		return this.map(function(){
+			return this.elements ? jQuery.makeArray( this.elements ) : this;
+		})
+		.filter(function(){
+			return this.name && !this.disabled &&
+				( this.checked || rselectTextarea.test( this.nodeName ) ||
+					rinput.test( this.type ) );
+		})
+		.map(function( i, elem ){
+			var val = jQuery( this ).val();
+
+			return val == null ?
+				null :
+				jQuery.isArray( val ) ?
+					jQuery.map( val, function( val, i ){
+						return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+					}) :
+					{ name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+		}).get();
+	}
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
+	jQuery.fn[ o ] = function( f ){
+		return this.bind( o, f );
+	};
+} );
+
+jQuery.each( [ "get", "post" ], function( i, method ) {
+	jQuery[ method ] = function( url, data, callback, type ) {
+		// shift arguments if data argument was omitted
+		if ( jQuery.isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = undefined;
+		}
+
+		return jQuery.ajax({
+			type: method,
+			url: url,
+			data: data,
+			success: callback,
+			dataType: type
+		});
+	};
+} );
+
+jQuery.extend({
+
+	getScript: function( url, callback ) {
+		return jQuery.get( url, undefined, callback, "script" );
+	},
+
+	getJSON: function( url, data, callback ) {
+		return jQuery.get( url, data, callback, "json" );
+	},
+
+	// Creates a full fledged settings object into target
+	// with both ajaxSettings and settings fields.
+	// If target is omitted, writes into ajaxSettings.
+	ajaxSetup: function ( target, settings ) {
+		if ( !settings ) {
+			// Only one parameter, we extend ajaxSettings
+			settings = target;
+			target = jQuery.extend( true, jQuery.ajaxSettings, settings );
+		} else {
+			// target was provided, we extend into it
+			jQuery.extend( true, target, jQuery.ajaxSettings, settings );
+		}
+		// Flatten fields we don't want deep extended
+		for( var field in { context: 1, url: 1 } ) {
+			if ( field in settings ) {
+				target[ field ] = settings[ field ];
+			} else if( field in jQuery.ajaxSettings ) {
+				target[ field ] = jQuery.ajaxSettings[ field ];
+			}
+		}
+		return target;
+	},
+
+	ajaxSettings: {
+		url: ajaxLocation,
+		isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
+		global: true,
+		type: "GET",
+		contentType: "application/x-www-form-urlencoded",
+		processData: true,
+		async: true,
+		/*
+		timeout: 0,
+		data: null,
+		dataType: null,
+		username: null,
+		password: null,
+		cache: null,
+		traditional: false,
+		headers: {},
+		crossDomain: null,
+		*/
+
+		accepts: {
+			xml: "application/xml, text/xml",
+			html: "text/html",
+			text: "text/plain",
+			json: "application/json, text/javascript",
+			"*": "*/*"
+		},
+
+		contents: {
+			xml: /xml/,
+			html: /html/,
+			json: /json/
+		},
+
+		responseFields: {
+			xml: "responseXML",
+			text: "responseText"
+		},
+
+		// List of data converters
+		// 1) key format is "source_type destination_type" (a single space in-between)
+		// 2) the catchall symbol "*" can be used for source_type
+		converters: {
+
+			// Convert anything to text
+			"* text": window.String,
+
+			// Text to html (true = no transformation)
+			"text html": true,
+
+			// Evaluate text as a json expression
+			"text json": jQuery.parseJSON,
+
+			// Parse text as xml
+			"text xml": jQuery.parseXML
+		}
+	},
+
+	ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+	ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+	// Main method
+	ajax: function( url, options ) {
+
+		// If url is an object, simulate pre-1.5 signature
+		if ( typeof url === "object" ) {
+			options = url;
+			url = undefined;
+		}
+
+		// Force options to be an object
+		options = options || {};
+
+		var // Create the final options object
+			s = jQuery.ajaxSetup( {}, options ),
+			// Callbacks context
+			callbackContext = s.context || s,
+			// Context for global events
+			// It's the callbackContext if one was provided in the options
+			// and if it's a DOM node or a jQuery collection
+			globalEventContext = callbackContext !== s &&
+				( callbackContext.nodeType || callbackContext instanceof jQuery ) ?
+						jQuery( callbackContext ) : jQuery.event,
+			// Deferreds
+			deferred = jQuery.Deferred(),
+			completeDeferred = jQuery._Deferred(),
+			// Status-dependent callbacks
+			statusCode = s.statusCode || {},
+			// ifModified key
+			ifModifiedKey,
+			// Headers (they are sent all at once)
+			requestHeaders = {},
+			// Response headers
+			responseHeadersString,
+			responseHeaders,
+			// transport
+			transport,
+			// timeout handle
+			timeoutTimer,
+			// Cross-domain detection vars
+			parts,
+			// The jqXHR state
+			state = 0,
+			// To know if global events are to be dispatched
+			fireGlobals,
+			// Loop variable
+			i,
+			// Fake xhr
+			jqXHR = {
+
+				readyState: 0,
+
+				// Caches the header
+				setRequestHeader: function( name, value ) {
+					if ( !state ) {
+						requestHeaders[ name.toLowerCase().replace( rucHeaders, rucHeadersFunc ) ] = value;
+					}
+					return this;
+				},
+
+				// Raw string
+				getAllResponseHeaders: function() {
+					return state === 2 ? responseHeadersString : null;
+				},
+
+				// Builds headers hashtable if needed
+				getResponseHeader: function( key ) {
+					var match;
+					if ( state === 2 ) {
+						if ( !responseHeaders ) {
+							responseHeaders = {};
+							while( ( match = rheaders.exec( responseHeadersString ) ) ) {
+								responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+							}
+						}
+						match = responseHeaders[ key.toLowerCase() ];
+					}
+					return match === undefined ? null : match;
+				},
+
+				// Overrides response content-type header
+				overrideMimeType: function( type ) {
+					if ( !state ) {
+						s.mimeType = type;
+					}
+					return this;
+				},
+
+				// Cancel the request
+				abort: function( statusText ) {
+					statusText = statusText || "abort";
+					if ( transport ) {
+						transport.abort( statusText );
+					}
+					done( 0, statusText );
+					return this;
+				}
+			};
+
+		// Callback for when everything is done
+		// It is defined here because jslint complains if it is declared
+		// at the end of the function (which would be more logical and readable)
+		function done( status, statusText, responses, headers ) {
+
+			// Called once
+			if ( state === 2 ) {
+				return;
+			}
+
+			// State is "done" now
+			state = 2;
+
+			// Clear timeout if it exists
+			if ( timeoutTimer ) {
+				clearTimeout( timeoutTimer );
+			}
+
+			// Dereference transport for early garbage collection
+			// (no matter how long the jqXHR object will be used)
+			transport = undefined;
+
+			// Cache response headers
+			responseHeadersString = headers || "";
+
+			// Set readyState
+			jqXHR.readyState = status ? 4 : 0;
+
+			var isSuccess,
+				success,
+				error,
+				response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined,
+				lastModified,
+				etag;
+
+			// If successful, handle type chaining
+			if ( status >= 200 && status < 300 || status === 304 ) {
+
+				// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+				if ( s.ifModified ) {
+
+					if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) {
+						jQuery.lastModified[ ifModifiedKey ] = lastModified;
+					}
+					if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) {
+						jQuery.etag[ ifModifiedKey ] = etag;
+					}
+				}
+
+				// If not modified
+				if ( status === 304 ) {
+
+					statusText = "notmodified";
+					isSuccess = true;
+
+				// If we have data
+				} else {
+
+					try {
+						success = ajaxConvert( s, response );
+						statusText = "success";
+						isSuccess = true;
+					} catch(e) {
+						// We have a parsererror
+						statusText = "parsererror";
+						error = e;
+					}
+				}
+			} else {
+				// We extract error from statusText
+				// then normalize statusText and status for non-aborts
+				error = statusText;
+				if( !statusText || status ) {
+					statusText = "error";
+					if ( status < 0 ) {
+						status = 0;
+					}
+				}
+			}
+
+			// Set data for the fake xhr object
+			jqXHR.status = status;
+			jqXHR.statusText = statusText;
+
+			// Success/Error
+			if ( isSuccess ) {
+				deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+			} else {
+				deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+			}
+
+			// Status-dependent callbacks
+			jqXHR.statusCode( statusCode );
+			statusCode = undefined;
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
+						[ jqXHR, s, isSuccess ? success : error ] );
+			}
+
+			// Complete
+			completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] );
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxComplete", [ jqXHR, s] );
+				// Handle the global AJAX counter
+				if ( !( --jQuery.active ) ) {
+					jQuery.event.trigger( "ajaxStop" );
+				}
+			}
+		}
+
+		// Attach deferreds
+		deferred.promise( jqXHR );
+		jqXHR.success = jqXHR.done;
+		jqXHR.error = jqXHR.fail;
+		jqXHR.complete = completeDeferred.done;
+
+		// Status-dependent callbacks
+		jqXHR.statusCode = function( map ) {
+			if ( map ) {
+				var tmp;
+				if ( state < 2 ) {
+					for( tmp in map ) {
+						statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
+					}
+				} else {
+					tmp = map[ jqXHR.status ];
+					jqXHR.then( tmp, tmp );
+				}
+			}
+			return this;
+		};
+
+		// Remove hash character (#7531: and string promotion)
+		// Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+		// We also use the url parameter if available
+		s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+		// Extract dataTypes list
+		s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax );
+
+		// Determine if a cross-domain request is in order
+		if ( !s.crossDomain ) {
+			parts = rurl.exec( s.url.toLowerCase() );
+			s.crossDomain = !!( parts &&
+				( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] ||
+					( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
+						( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
+			);
+		}
+
+		// Convert data if not already a string
+		if ( s.data && s.processData && typeof s.data !== "string" ) {
+			s.data = jQuery.param( s.data, s.traditional );
+		}
+
+		// Apply prefilters
+		inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+		// If request was aborted inside a prefiler, stop there
+		if ( state === 2 ) {
+			return false;
+		}
+
+		// We can fire global events as of now if asked to
+		fireGlobals = s.global;
+
+		// Uppercase the type
+		s.type = s.type.toUpperCase();
+
+		// Determine if request has content
+		s.hasContent = !rnoContent.test( s.type );
+
+		// Watch for a new set of requests
+		if ( fireGlobals && jQuery.active++ === 0 ) {
+			jQuery.event.trigger( "ajaxStart" );
+		}
+
+		// More options handling for requests with no content
+		if ( !s.hasContent ) {
+
+			// If data is available, append data to url
+			if ( s.data ) {
+				s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
+			}
+
+			// Get ifModifiedKey before adding the anti-cache parameter
+			ifModifiedKey = s.url;
+
+			// Add anti-cache in url if needed
+			if ( s.cache === false ) {
+
+				var ts = jQuery.now(),
+					// try replacing _= if it is there
+					ret = s.url.replace( rts, "$1_=" + ts );
+
+				// if nothing was replaced, add timestamp to the end
+				s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
+			}
+		}
+
+		// Set the correct header, if data is being sent
+		if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+			requestHeaders[ "Content-Type" ] = s.contentType;
+		}
+
+		// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+		if ( s.ifModified ) {
+			ifModifiedKey = ifModifiedKey || s.url;
+			if ( jQuery.lastModified[ ifModifiedKey ] ) {
+				requestHeaders[ "If-Modified-Since" ] = jQuery.lastModified[ ifModifiedKey ];
+			}
+			if ( jQuery.etag[ ifModifiedKey ] ) {
+				requestHeaders[ "If-None-Match" ] = jQuery.etag[ ifModifiedKey ];
+			}
+		}
+
+		// Set the Accepts header for the server, depending on the dataType
+		requestHeaders.Accept = s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
+			s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) :
+			s.accepts[ "*" ];
+
+		// Check for headers option
+		for ( i in s.headers ) {
+			jqXHR.setRequestHeader( i, s.headers[ i ] );
+		}
+
+		// Allow custom headers/mimetypes and early abort
+		if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
+				// Abort if not done already
+				jqXHR.abort();
+				return false;
+
+		}
+
+		// Install callbacks on deferreds
+		for ( i in { success: 1, error: 1, complete: 1 } ) {
+			jqXHR[ i ]( s[ i ] );
+		}
+
+		// Get transport
+		transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+		// If no transport, we auto-abort
+		if ( !transport ) {
+			done( -1, "No Transport" );
+		} else {
+			jqXHR.readyState = 1;
+			// Send global event
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+			}
+			// Timeout
+			if ( s.async && s.timeout > 0 ) {
+				timeoutTimer = setTimeout( function(){
+					jqXHR.abort( "timeout" );
+				}, s.timeout );
+			}
+
+			try {
+				state = 1;
+				transport.send( requestHeaders, done );
+			} catch (e) {
+				// Propagate exception as error if not done
+				if ( status < 2 ) {
+					done( -1, e );
+				// Simply rethrow otherwise
+				} else {
+					jQuery.error( e );
+				}
+			}
+		}
+
+		return jqXHR;
+	},
+
+	// Serialize an array of form elements or a set of
+	// key/values into a query string
+	param: function( a, traditional ) {
+		var s = [],
+			add = function( key, value ) {
+				// If value is a function, invoke it and return its value
+				value = jQuery.isFunction( value ) ? value() : value;
+				s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
+			};
+
+		// Set traditional to true for jQuery <= 1.3.2 behavior.
+		if ( traditional === undefined ) {
+			traditional = jQuery.ajaxSettings.traditional;
+		}
+
+		// If an array was passed in, assume that it is an array of form elements.
+		if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+			// Serialize the form elements
+			jQuery.each( a, function() {
+				add( this.name, this.value );
+			} );
+
+		} else {
+			// If traditional, encode the "old" way (the way 1.3.2 or older
+			// did it), otherwise encode params recursively.
+			for ( var prefix in a ) {
+				buildParams( prefix, a[ prefix ], traditional, add );
+			}
+		}
+
+		// Return the resulting serialization
+		return s.join( "&" ).replace( r20, "+" );
+	}
+});
+
+function buildParams( prefix, obj, traditional, add ) {
+	if ( jQuery.isArray( obj ) && obj.length ) {
+		// Serialize array item.
+		jQuery.each( obj, function( i, v ) {
+			if ( traditional || rbracket.test( prefix ) ) {
+				// Treat each array item as a scalar.
+				add( prefix, v );
+
+			} else {
+				// If array item is non-scalar (array or object), encode its
+				// numeric index to resolve deserialization ambiguity issues.
+				// Note that rack (as of 1.0.0) can't currently deserialize
+				// nested arrays properly, and attempting to do so may cause
+				// a server error. Possible fixes are to modify rack's
+				// deserialization algorithm or to provide an option or flag
+				// to force array serialization to be shallow.
+				buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add );
+			}
+		});
+
+	} else if ( !traditional && obj != null && typeof obj === "object" ) {
+		// If we see an array here, it is empty and should be treated as an empty
+		// object
+		if ( jQuery.isArray( obj ) || jQuery.isEmptyObject( obj ) ) {
+			add( prefix, "" );
+
+		// Serialize object item.
+		} else {
+			for ( var name in obj ) {
+				buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+			}
+		}
+
+	} else {
+		// Serialize scalar item.
+		add( prefix, obj );
+	}
+}
+
+// This is still on the jQuery object... for now
+// Want to move this to jQuery.ajax some day
+jQuery.extend({
+
+	// Counter for holding the number of active queries
+	active: 0,
+
+	// Last-Modified header cache for next request
+	lastModified: {},
+	etag: {}
+
+});
+
+/* Handles responses to an ajax request:
+ * - sets all responseXXX fields accordingly
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+	var contents = s.contents,
+		dataTypes = s.dataTypes,
+		responseFields = s.responseFields,
+		ct,
+		type,
+		finalDataType,
+		firstDataType;
+
+	// Fill responseXXX fields
+	for( type in responseFields ) {
+		if ( type in responses ) {
+			jqXHR[ responseFields[type] ] = responses[ type ];
+		}
+	}
+
+	// Remove auto dataType and get content-type in the process
+	while( dataTypes[ 0 ] === "*" ) {
+		dataTypes.shift();
+		if ( ct === undefined ) {
+			ct = s.mimeType || jqXHR.getResponseHeader( "content-type" );
+		}
+	}
+
+	// Check if we're dealing with a known content-type
+	if ( ct ) {
+		for ( type in contents ) {
+			if ( contents[ type ] && contents[ type ].test( ct ) ) {
+				dataTypes.unshift( type );
+				break;
+			}
+		}
+	}
+
+	// Check to see if we have a response for the expected dataType
+	if ( dataTypes[ 0 ] in responses ) {
+		finalDataType = dataTypes[ 0 ];
+	} else {
+		// Try convertible dataTypes
+		for ( type in responses ) {
+			if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
+				finalDataType = type;
+				break;
+			}
+			if ( !firstDataType ) {
+				firstDataType = type;
+			}
+		}
+		// Or just use first one
+		finalDataType = finalDataType || firstDataType;
+	}
+
+	// If we found a dataType
+	// We add the dataType to the list if needed
+	// and return the corresponding response
+	if ( finalDataType ) {
+		if ( finalDataType !== dataTypes[ 0 ] ) {
+			dataTypes.unshift( finalDataType );
+		}
+		return responses[ finalDataType ];
+	}
+}
+
+// Chain conversions given the request and the original response
+function ajaxConvert( s, response ) {
+
+	// Apply the dataFilter if provided
+	if ( s.dataFilter ) {
+		response = s.dataFilter( response, s.dataType );
+	}
+
+	var dataTypes = s.dataTypes,
+		converters = {},
+		i,
+		key,
+		length = dataTypes.length,
+		tmp,
+		// Current and previous dataTypes
+		current = dataTypes[ 0 ],
+		prev,
+		// Conversion expression
+		conversion,
+		// Conversion function
+		conv,
+		// Conversion functions (transitive conversion)
+		conv1,
+		conv2;
+
+	// For each dataType in the chain
+	for( i = 1; i < length; i++ ) {
+
+		// Create converters map
+		// with lowercased keys
+		if ( i === 1 ) {
+			for( key in s.converters ) {
+				if( typeof key === "string" ) {
+					converters[ key.toLowerCase() ] = s.converters[ key ];
+				}
+			}
+		}
+
+		// Get the dataTypes
+		prev = current;
+		current = dataTypes[ i ];
+
+		// If current is auto dataType, update it to prev
+		if( current === "*" ) {
+			current = prev;
+		// If no auto and dataTypes are actually different
+		} else if ( prev !== "*" && prev !== current ) {
+
+			// Get the converter
+			conversion = prev + " " + current;
+			conv = converters[ conversion ] || converters[ "* " + current ];
+
+			// If there is no direct converter, search transitively
+			if ( !conv ) {
+				conv2 = undefined;
+				for( conv1 in converters ) {
+					tmp = conv1.split( " " );
+					if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) {
+						conv2 = converters[ tmp[1] + " " + current ];
+						if ( conv2 ) {
+							conv1 = converters[ conv1 ];
+							if ( conv1 === true ) {
+								conv = conv2;
+							} else if ( conv2 === true ) {
+								conv = conv1;
+							}
+							break;
+						}
+					}
+				}
+			}
+			// If we found no converter, dispatch an error
+			if ( !( conv || conv2 ) ) {
+				jQuery.error( "No conversion from " + conversion.replace(" "," to ") );
+			}
+			// If found converter is not an equivalence
+			if ( conv !== true ) {
+				// Convert with 1 or 2 converters accordingly
+				response = conv ? conv( response ) : conv2( conv1(response) );
+			}
+		}
+	}
+	return response;
+}
+
+
+
+
+var jsc = jQuery.now(),
+	jsre = /(\=)\?(&|$)|()\?\?()/i;
+
+// Default jsonp settings
+jQuery.ajaxSetup({
+	jsonp: "callback",
+	jsonpCallback: function() {
+		return jQuery.expando + "_" + ( jsc++ );
+	}
+});
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+	var dataIsString = ( typeof s.data === "string" );
+
+	if ( s.dataTypes[ 0 ] === "jsonp" ||
+		originalSettings.jsonpCallback ||
+		originalSettings.jsonp != null ||
+		s.jsonp !== false && ( jsre.test( s.url ) ||
+				dataIsString && jsre.test( s.data ) ) ) {
+
+		var responseContainer,
+			jsonpCallback = s.jsonpCallback =
+				jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback,
+			previous = window[ jsonpCallback ],
+			url = s.url,
+			data = s.data,
+			replace = "$1" + jsonpCallback + "$2",
+			cleanUp = function() {
+				// Set callback back to previous value
+				window[ jsonpCallback ] = previous;
+				// Call if it was a function and we have a response
+				if ( responseContainer && jQuery.isFunction( previous ) ) {
+					window[ jsonpCallback ]( responseContainer[ 0 ] );
+				}
+			};
+
+		if ( s.jsonp !== false ) {
+			url = url.replace( jsre, replace );
+			if ( s.url === url ) {
+				if ( dataIsString ) {
+					data = data.replace( jsre, replace );
+				}
+				if ( s.data === data ) {
+					// Add callback manually
+					url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback;
+				}
+			}
+		}
+
+		s.url = url;
+		s.data = data;
+
+		// Install callback
+		window[ jsonpCallback ] = function( response ) {
+			responseContainer = [ response ];
+		};
+
+		// Install cleanUp function
+		jqXHR.then( cleanUp, cleanUp );
+
+		// Use data converter to retrieve json after script execution
+		s.converters["script json"] = function() {
+			if ( !responseContainer ) {
+				jQuery.error( jsonpCallback + " was not called" );
+			}
+			return responseContainer[ 0 ];
+		};
+
+		// force json dataType
+		s.dataTypes[ 0 ] = "json";
+
+		// Delegate to script
+		return "script";
+	}
+} );
+
+
+
+
+// Install script dataType
+jQuery.ajaxSetup({
+	accepts: {
+		script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
+	},
+	contents: {
+		script: /javascript|ecmascript/
+	},
+	converters: {
+		"text script": function( text ) {
+			jQuery.globalEval( text );
+			return text;
+		}
+	}
+});
+
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+	if ( s.cache === undefined ) {
+		s.cache = false;
+	}
+	if ( s.crossDomain ) {
+		s.type = "GET";
+		s.global = false;
+	}
+} );
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function(s) {
+
+	// This transport only deals with cross domain requests
+	if ( s.crossDomain ) {
+
+		var script,
+			head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement;
+
+		return {
+
+			send: function( _, callback ) {
+
+				script = document.createElement( "script" );
+
+				script.async = "async";
+
+				if ( s.scriptCharset ) {
+					script.charset = s.scriptCharset;
+				}
+
+				script.src = s.url;
+
+				// Attach handlers for all browsers
+				script.onload = script.onreadystatechange = function( _, isAbort ) {
+
+					if ( !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+
+						// Handle memory leak in IE
+						script.onload = script.onreadystatechange = null;
+
+						// Remove the script
+						if ( head && script.parentNode ) {
+							head.removeChild( script );
+						}
+
+						// Dereference the script
+						script = undefined;
+
+						// Callback if not abort
+						if ( !isAbort ) {
+							callback( 200, "success" );
+						}
+					}
+				};
+				// Use insertBefore instead of appendChild  to circumvent an IE6 bug.
+				// This arises when a base node is used (#2709 and #4378).
+				head.insertBefore( script, head.firstChild );
+			},
+
+			abort: function() {
+				if ( script ) {
+					script.onload( 0, 1 );
+				}
+			}
+		};
+	}
+} );
+
+
+
+
+var // #5280: next active xhr id and list of active xhrs' callbacks
+	xhrId = jQuery.now(),
+	xhrCallbacks,
+
+	// XHR used to determine supports properties
+	testXHR;
+
+// #5280: Internet Explorer will keep connections alive if we don't abort on unload
+function xhrOnUnloadAbort() {
+	jQuery( window ).unload(function() {
+		// Abort all pending requests
+		for ( var key in xhrCallbacks ) {
+			xhrCallbacks[ key ]( 0, 1 );
+		}
+	});
+}
+
+// Functions to create xhrs
+function createStandardXHR() {
+	try {
+		return new window.XMLHttpRequest();
+	} catch( e ) {}
+}
+
+function createActiveXHR() {
+	try {
+		return new window.ActiveXObject( "Microsoft.XMLHTTP" );
+	} catch( e ) {}
+}
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+jQuery.ajaxSettings.xhr = window.ActiveXObject ?
+	/* Microsoft failed to properly
+	 * implement the XMLHttpRequest in IE7 (can't request local files),
+	 * so we use the ActiveXObject when it is available
+	 * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
+	 * we need a fallback.
+	 */
+	function() {
+		return !this.isLocal && createStandardXHR() || createActiveXHR();
+	} :
+	// For all other browsers, use the standard XMLHttpRequest object
+	createStandardXHR;
+
+// Test if we can create an xhr object
+testXHR = jQuery.ajaxSettings.xhr();
+jQuery.support.ajax = !!testXHR;
+
+// Does this browser support crossDomain XHR requests
+jQuery.support.cors = testXHR && ( "withCredentials" in testXHR );
+
+// No need for the temporary xhr anymore
+testXHR = undefined;
+
+// Create transport if the browser can provide an xhr
+if ( jQuery.support.ajax ) {
+
+	jQuery.ajaxTransport(function( s ) {
+		// Cross domain only allowed if supported through XMLHttpRequest
+		if ( !s.crossDomain || jQuery.support.cors ) {
+
+			var callback;
+
+			return {
+				send: function( headers, complete ) {
+
+					// Get a new xhr
+					var xhr = s.xhr(),
+						handle,
+						i;
+
+					// Open the socket
+					// Passing null username, generates a login popup on Opera (#2865)
+					if ( s.username ) {
+						xhr.open( s.type, s.url, s.async, s.username, s.password );
+					} else {
+						xhr.open( s.type, s.url, s.async );
+					}
+
+					// Apply custom fields if provided
+					if ( s.xhrFields ) {
+						for ( i in s.xhrFields ) {
+							xhr[ i ] = s.xhrFields[ i ];
+						}
+					}
+
+					// Override mime type if needed
+					if ( s.mimeType && xhr.overrideMimeType ) {
+						xhr.overrideMimeType( s.mimeType );
+					}
+
+					// Requested-With header
+					// Not set for crossDomain requests with no content
+					// (see why at http://trac.dojotoolkit.org/ticket/9486)
+					// Won't change header if already provided
+					if ( !( s.crossDomain && !s.hasContent ) && !headers["X-Requested-With"] ) {
+						headers[ "X-Requested-With" ] = "XMLHttpRequest";
+					}
+
+					// Need an extra try/catch for cross domain requests in Firefox 3
+					try {
+						for ( i in headers ) {
+							xhr.setRequestHeader( i, headers[ i ] );
+						}
+					} catch( _ ) {}
+
+					// Do send the request
+					// This may raise an exception which is actually
+					// handled in jQuery.ajax (so no try/catch here)
+					xhr.send( ( s.hasContent && s.data ) || null );
+
+					// Listener
+					callback = function( _, isAbort ) {
+
+						var status,
+							statusText,
+							responseHeaders,
+							responses,
+							xml;
+
+						// Firefox throws exceptions when accessing properties
+						// of an xhr when a network error occured
+						// http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
+						try {
+
+							// Was never called and is aborted or complete
+							if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+
+								// Only called once
+								callback = undefined;
+
+								// Do not keep as active anymore
+								if ( handle ) {
+									xhr.onreadystatechange = jQuery.noop;
+									delete xhrCallbacks[ handle ];
+								}
+
+								// If it's an abort
+								if ( isAbort ) {
+									// Abort it manually if needed
+									if ( xhr.readyState !== 4 ) {
+										xhr.abort();
+									}
+								} else {
+									status = xhr.status;
+									responseHeaders = xhr.getAllResponseHeaders();
+									responses = {};
+									xml = xhr.responseXML;
+
+									// Construct response list
+									if ( xml && xml.documentElement /* #4958 */ ) {
+										responses.xml = xml;
+									}
+									responses.text = xhr.responseText;
+
+									// Firefox throws an exception when accessing
+									// statusText for faulty cross-domain requests
+									try {
+										statusText = xhr.statusText;
+									} catch( e ) {
+										// We normalize with Webkit giving an empty statusText
+										statusText = "";
+									}
+
+									// Filter status for non standard behaviors
+
+									// If the request is local and we have data: assume a success
+									// (success with no data won't get notified, that's the best we
+									// can do given current implementations)
+									if ( !status && s.isLocal && !s.crossDomain ) {
+										status = responses.text ? 200 : 404;
+									// IE - #1450: sometimes returns 1223 when it should be 204
+									} else if ( status === 1223 ) {
+										status = 204;
+									}
+								}
+							}
+						} catch( firefoxAccessException ) {
+							if ( !isAbort ) {
+								complete( -1, firefoxAccessException );
+							}
+						}
+
+						// Call complete if needed
+						if ( responses ) {
+							complete( status, statusText, responses, responseHeaders );
+						}
+					};
+
+					// if we're in sync mode or it's in cache
+					// and has been retrieved directly (IE6 & IE7)
+					// we need to manually fire the callback
+					if ( !s.async || xhr.readyState === 4 ) {
+						callback();
+					} else {
+						// Create the active xhrs callbacks list if needed
+						// and attach the unload handler
+						if ( !xhrCallbacks ) {
+							xhrCallbacks = {};
+							xhrOnUnloadAbort();
+						}
+						// Add to list of active xhrs callbacks
+						handle = xhrId++;
+						xhr.onreadystatechange = xhrCallbacks[ handle ] = callback;
+					}
+				},
+
+				abort: function() {
+					if ( callback ) {
+						callback(0,1);
+					}
+				}
+			};
+		}
+	});
+}
+
+
+
+
+var elemdisplay = {},
+	rfxtypes = /^(?:toggle|show|hide)$/,
+	rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,
+	timerId,
+	fxAttrs = [
+		// height animations
+		[ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
+		// width animations
+		[ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
+		// opacity animations
+		[ "opacity" ]
+	];
+
+jQuery.fn.extend({
+	show: function( speed, easing, callback ) {
+		var elem, display;
+
+		if ( speed || speed === 0 ) {
+			return this.animate( genFx("show", 3), speed, easing, callback);
+
+		} else {
+			for ( var i = 0, j = this.length; i < j; i++ ) {
+				elem = this[i];
+				display = elem.style.display;
+
+				// Reset the inline display of this element to learn if it is
+				// being hidden by cascaded rules or not
+				if ( !jQuery._data(elem, "olddisplay") && display === "none" ) {
+					display = elem.style.display = "";
+				}
+
+				// Set elements which have been overridden with display: none
+				// in a stylesheet to whatever the default browser style is
+				// for such an element
+				if ( display === "" && jQuery.css( elem, "display" ) === "none" ) {
+					jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName));
+				}
+			}
+
+			// Set the display of most of the elements in a second loop
+			// to avoid the constant reflow
+			for ( i = 0; i < j; i++ ) {
+				elem = this[i];
+				display = elem.style.display;
+
+				if ( display === "" || display === "none" ) {
+					elem.style.display = jQuery._data(elem, "olddisplay") || "";
+				}
+			}
+
+			return this;
+		}
+	},
+
+	hide: function( speed, easing, callback ) {
+		if ( speed || speed === 0 ) {
+			return this.animate( genFx("hide", 3), speed, easing, callback);
+
+		} else {
+			for ( var i = 0, j = this.length; i < j; i++ ) {
+				var display = jQuery.css( this[i], "display" );
+
+				if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) {
+					jQuery._data( this[i], "olddisplay", display );
+				}
+			}
+
+			// Set the display of the elements in a second loop
+			// to avoid the constant reflow
+			for ( i = 0; i < j; i++ ) {
+				this[i].style.display = "none";
+			}
+
+			return this;
+		}
+	},
+
+	// Save the old toggle function
+	_toggle: jQuery.fn.toggle,
+
+	toggle: function( fn, fn2, callback ) {
+		var bool = typeof fn === "boolean";
+
+		if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
+			this._toggle.apply( this, arguments );
+
+		} else if ( fn == null || bool ) {
+			this.each(function() {
+				var state = bool ? fn : jQuery(this).is(":hidden");
+				jQuery(this)[ state ? "show" : "hide" ]();
+			});
+
+		} else {
+			this.animate(genFx("toggle", 3), fn, fn2, callback);
+		}
+
+		return this;
+	},
+
+	fadeTo: function( speed, to, easing, callback ) {
+		return this.filter(":hidden").css("opacity", 0).show().end()
+					.animate({opacity: to}, speed, easing, callback);
+	},
+
+	animate: function( prop, speed, easing, callback ) {
+		var optall = jQuery.speed(speed, easing, callback);
+
+		if ( jQuery.isEmptyObject( prop ) ) {
+			return this.each( optall.complete );
+		}
+
+		return this[ optall.queue === false ? "each" : "queue" ](function() {
+			// XXX 'this' does not always have a nodeName when running the
+			// test suite
+
+			var opt = jQuery.extend({}, optall), p,
+				isElement = this.nodeType === 1,
+				hidden = isElement && jQuery(this).is(":hidden"),
+				self = this;
+
+			for ( p in prop ) {
+				var name = jQuery.camelCase( p );
+
+				if ( p !== name ) {
+					prop[ name ] = prop[ p ];
+					delete prop[ p ];
+					p = name;
+				}
+
+				if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) {
+					return opt.complete.call(this);
+				}
+
+				if ( isElement && ( p === "height" || p === "width" ) ) {
+					// Make sure that nothing sneaks out
+					// Record all 3 overflow attributes because IE does not
+					// change the overflow attribute when overflowX and
+					// overflowY are set to the same value
+					opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ];
+
+					// Set display property to inline-block for height/width
+					// animations on inline elements that are having width/height
+					// animated
+					if ( jQuery.css( this, "display" ) === "inline" &&
+							jQuery.css( this, "float" ) === "none" ) {
+						if ( !jQuery.support.inlineBlockNeedsLayout ) {
+							this.style.display = "inline-block";
+
+						} else {
+							var display = defaultDisplay(this.nodeName);
+
+							// inline-level elements accept inline-block;
+							// block-level elements need to be inline with layout
+							if ( display === "inline" ) {
+								this.style.display = "inline-block";
+
+							} else {
+								this.style.display = "inline";
+								this.style.zoom = 1;
+							}
+						}
+					}
+				}
+
+				if ( jQuery.isArray( prop[p] ) ) {
+					// Create (if needed) and add to specialEasing
+					(opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1];
+					prop[p] = prop[p][0];
+				}
+			}
+
+			if ( opt.overflow != null ) {
+				this.style.overflow = "hidden";
+			}
+
+			opt.curAnim = jQuery.extend({}, prop);
+
+			jQuery.each( prop, function( name, val ) {
+				var e = new jQuery.fx( self, opt, name );
+
+				if ( rfxtypes.test(val) ) {
+					e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+
+				} else {
+					var parts = rfxnum.exec(val),
+						start = e.cur();
+
+					if ( parts ) {
+						var end = parseFloat( parts[2] ),
+							unit = parts[3] || ( jQuery.cssNumber[ name ] ? "" : "px" );
+
+						// We need to compute starting value
+						if ( unit !== "px" ) {
+							jQuery.style( self, name, (end || 1) + unit);
+							start = ((end || 1) / e.cur()) * start;
+							jQuery.style( self, name, start + unit);
+						}
+
+						// If a +=/-= token was provided, we're doing a relative animation
+						if ( parts[1] ) {
+							end = ((parts[1] === "-=" ? -1 : 1) * end) + start;
+						}
+
+						e.custom( start, end, unit );
+
+					} else {
+						e.custom( start, val, "" );
+					}
+				}
+			});
+
+			// For JS strict compliance
+			return true;
+		});
+	},
+
+	stop: function( clearQueue, gotoEnd ) {
+		var timers = jQuery.timers;
+
+		if ( clearQueue ) {
+			this.queue([]);
+		}
+
+		this.each(function() {
+			// go in reverse order so anything added to the queue during the loop is ignored
+			for ( var i = timers.length - 1; i >= 0; i-- ) {
+				if ( timers[i].elem === this ) {
+					if (gotoEnd) {
+						// force the next step to be the last
+						timers[i](true);
+					}
+
+					timers.splice(i, 1);
+				}
+			}
+		});
+
+		// start the next in the queue if the last step wasn't forced
+		if ( !gotoEnd ) {
+			this.dequeue();
+		}
+
+		return this;
+	}
+
+});
+
+function genFx( type, num ) {
+	var obj = {};
+
+	jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
+		obj[ this ] = type;
+	});
+
+	return obj;
+}
+
+// Generate shortcuts for custom animations
+jQuery.each({
+	slideDown: genFx("show", 1),
+	slideUp: genFx("hide", 1),
+	slideToggle: genFx("toggle", 1),
+	fadeIn: { opacity: "show" },
+	fadeOut: { opacity: "hide" },
+	fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return this.animate( props, speed, easing, callback );
+	};
+});
+
+jQuery.extend({
+	speed: function( speed, easing, fn ) {
+		var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
+			complete: fn || !fn && easing ||
+				jQuery.isFunction( speed ) && speed,
+			duration: speed,
+			easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
+		};
+
+		opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+			opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;
+
+		// Queueing
+		opt.old = opt.complete;
+		opt.complete = function() {
+			if ( opt.queue !== false ) {
+				jQuery(this).dequeue();
+			}
+			if ( jQuery.isFunction( opt.old ) ) {
+				opt.old.call( this );
+			}
+		};
+
+		return opt;
+	},
+
+	easing: {
+		linear: function( p, n, firstNum, diff ) {
+			return firstNum + diff * p;
+		},
+		swing: function( p, n, firstNum, diff ) {
+			return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
+		}
+	},
+
+	timers: [],
+
+	fx: function( elem, options, prop ) {
+		this.options = options;
+		this.elem = elem;
+		this.prop = prop;
+
+		if ( !options.orig ) {
+			options.orig = {};
+		}
+	}
+
+});
+
+jQuery.fx.prototype = {
+	// Simple function for setting a style value
+	update: function() {
+		if ( this.options.step ) {
+			this.options.step.call( this.elem, this.now, this );
+		}
+
+		(jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
+	},
+
+	// Get the current size
+	cur: function() {
+		if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) {
+			return this.elem[ this.prop ];
+		}
+
+		var parsed,
+			r = jQuery.css( this.elem, this.prop );
+		// Empty strings, null, undefined and "auto" are converted to 0,
+		// complex values such as "rotate(1rad)" are returned as is,
+		// simple values such as "10px" are parsed to Float.
+		return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed;
+	},
+
+	// Start an animation from one number to another
+	custom: function( from, to, unit ) {
+		var self = this,
+			fx = jQuery.fx;
+
+		this.startTime = jQuery.now();
+		this.start = from;
+		this.end = to;
+		this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" );
+		this.now = this.start;
+		this.pos = this.state = 0;
+
+		function t( gotoEnd ) {
+			return self.step(gotoEnd);
+		}
+
+		t.elem = this.elem;
+
+		if ( t() && jQuery.timers.push(t) && !timerId ) {
+			timerId = setInterval(fx.tick, fx.interval);
+		}
+	},
+
+	// Simple 'show' function
+	show: function() {
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+		this.options.show = true;
+
+		// Begin the animation
+		// Make sure that we start at a small width/height to avoid any
+		// flash of content
+		this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur());
+
+		// Start by showing the element
+		jQuery( this.elem ).show();
+	},
+
+	// Simple 'hide' function
+	hide: function() {
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+		this.options.hide = true;
+
+		// Begin the animation
+		this.custom(this.cur(), 0);
+	},
+
+	// Each step of an animation
+	step: function( gotoEnd ) {
+		var t = jQuery.now(), done = true;
+
+		if ( gotoEnd || t >= this.options.duration + this.startTime ) {
+			this.now = this.end;
+			this.pos = this.state = 1;
+			this.update();
+
+			this.options.curAnim[ this.prop ] = true;
+
+			for ( var i in this.options.curAnim ) {
+				if ( this.options.curAnim[i] !== true ) {
+					done = false;
+				}
+			}
+
+			if ( done ) {
+				// Reset the overflow
+				if ( this.options.overflow != null && !jQuery.support.shrinkWrapBlocks ) {
+					var elem = this.elem,
+						options = this.options;
+
+					jQuery.each( [ "", "X", "Y" ], function (index, value) {
+						elem.style[ "overflow" + value ] = options.overflow[index];
+					} );
+				}
+
+				// Hide the element if the "hide" operation was done
+				if ( this.options.hide ) {
+					jQuery(this.elem).hide();
+				}
+
+				// Reset the properties, if the item has been hidden or shown
+				if ( this.options.hide || this.options.show ) {
+					for ( var p in this.options.curAnim ) {
+						jQuery.style( this.elem, p, this.options.orig[p] );
+					}
+				}
+
+				// Execute the complete function
+				this.options.complete.call( this.elem );
+			}
+
+			return false;
+
+		} else {
+			var n = t - this.startTime;
+			this.state = n / this.options.duration;
+
+			// Perform the easing function, defaults to swing
+			var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop];
+			var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear");
+			this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration);
+			this.now = this.start + ((this.end - this.start) * this.pos);
+
+			// Perform the next step of the animation
+			this.update();
+		}
+
+		return true;
+	}
+};
+
+jQuery.extend( jQuery.fx, {
+	tick: function() {
+		var timers = jQuery.timers;
+
+		for ( var i = 0; i < timers.length; i++ ) {
+			if ( !timers[i]() ) {
+				timers.splice(i--, 1);
+			}
+		}
+
+		if ( !timers.length ) {
+			jQuery.fx.stop();
+		}
+	},
+
+	interval: 13,
+
+	stop: function() {
+		clearInterval( timerId );
+		timerId = null;
+	},
+
+	speeds: {
+		slow: 600,
+		fast: 200,
+		// Default speed
+		_default: 400
+	},
+
+	step: {
+		opacity: function( fx ) {
+			jQuery.style( fx.elem, "opacity", fx.now );
+		},
+
+		_default: function( fx ) {
+			if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
+				fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit;
+			} else {
+				fx.elem[ fx.prop ] = fx.now;
+			}
+		}
+	}
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+	jQuery.expr.filters.animated = function( elem ) {
+		return jQuery.grep(jQuery.timers, function( fn ) {
+			return elem === fn.elem;
+		}).length;
+	};
+}
+
+function defaultDisplay( nodeName ) {
+	if ( !elemdisplay[ nodeName ] ) {
+		var elem = jQuery("<" + nodeName + ">").appendTo("body"),
+			display = elem.css("display");
+
+		elem.remove();
+
+		if ( display === "none" || display === "" ) {
+			display = "block";
+		}
+
+		elemdisplay[ nodeName ] = display;
+	}
+
+	return elemdisplay[ nodeName ];
+}
+
+
+
+
+var rtable = /^t(?:able|d|h)$/i,
+	rroot = /^(?:body|html)$/i;
+
+if ( "getBoundingClientRect" in document.documentElement ) {
+	jQuery.fn.offset = function( options ) {
+		var elem = this[0], box;
+
+		if ( options ) {
+			return this.each(function( i ) {
+				jQuery.offset.setOffset( this, options, i );
+			});
+		}
+
+		if ( !elem || !elem.ownerDocument ) {
+			return null;
+		}
+
+		if ( elem === elem.ownerDocument.body ) {
+			return jQuery.offset.bodyOffset( elem );
+		}
+
+		try {
+			box = elem.getBoundingClientRect();
+		} catch(e) {}
+
+		var doc = elem.ownerDocument,
+			docElem = doc.documentElement;
+
+		// Make sure we're not dealing with a disconnected DOM node
+		if ( !box || !jQuery.contains( docElem, elem ) ) {
+			return box ? { top: box.top, left: box.left } : { top: 0, left: 0 };
+		}
+
+		var body = doc.body,
+			win = getWindow(doc),
+			clientTop  = docElem.clientTop  || body.clientTop  || 0,
+			clientLeft = docElem.clientLeft || body.clientLeft || 0,
+			scrollTop  = (win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop  || body.scrollTop ),
+			scrollLeft = (win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft),
+			top  = box.top  + scrollTop  - clientTop,
+			left = box.left + scrollLeft - clientLeft;
+
+		return { top: top, left: left };
+	};
+
+} else {
+	jQuery.fn.offset = function( options ) {
+		var elem = this[0];
+
+		if ( options ) {
+			return this.each(function( i ) {
+				jQuery.offset.setOffset( this, options, i );
+			});
+		}
+
+		if ( !elem || !elem.ownerDocument ) {
+			return null;
+		}
+
+		if ( elem === elem.ownerDocument.body ) {
+			return jQuery.offset.bodyOffset( elem );
+		}
+
+		jQuery.offset.initialize();
+
+		var computedStyle,
+			offsetParent = elem.offsetParent,
+			prevOffsetParent = elem,
+			doc = elem.ownerDocument,
+			docElem = doc.documentElement,
+			body = doc.body,
+			defaultView = doc.defaultView,
+			prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
+			top = elem.offsetTop,
+			left = elem.offsetLeft;
+
+		while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
+			if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+				break;
+			}
+
+			computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
+			top  -= elem.scrollTop;
+			left -= elem.scrollLeft;
+
+			if ( elem === offsetParent ) {
+				top  += elem.offsetTop;
+				left += elem.offsetLeft;
+
+				if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) {
+					top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
+					left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+				}
+
+				prevOffsetParent = offsetParent;
+				offsetParent = elem.offsetParent;
+			}
+
+			if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
+				top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
+				left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+			}
+
+			prevComputedStyle = computedStyle;
+		}
+
+		if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
+			top  += body.offsetTop;
+			left += body.offsetLeft;
+		}
+
+		if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+			top  += Math.max( docElem.scrollTop, body.scrollTop );
+			left += Math.max( docElem.scrollLeft, body.scrollLeft );
+		}
+
+		return { top: top, left: left };
+	};
+}
+
+jQuery.offset = {
+	initialize: function() {
+		var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0,
+			html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
+
+		jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
+
+		container.innerHTML = html;
+		body.insertBefore( container, body.firstChild );
+		innerDiv = container.firstChild;
+		checkDiv = innerDiv.firstChild;
+		td = innerDiv.nextSibling.firstChild.firstChild;
+
+		this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
+		this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
+
+		checkDiv.style.position = "fixed";
+		checkDiv.style.top = "20px";
+
+		// safari subtracts parent border width here which is 5px
+		this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15);
+		checkDiv.style.position = checkDiv.style.top = "";
+
+		innerDiv.style.overflow = "hidden";
+		innerDiv.style.position = "relative";
+
+		this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
+
+		this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
+
+		body.removeChild( container );
+		body = container = innerDiv = checkDiv = table = td = null;
+		jQuery.offset.initialize = jQuery.noop;
+	},
+
+	bodyOffset: function( body ) {
+		var top = body.offsetTop,
+			left = body.offsetLeft;
+
+		jQuery.offset.initialize();
+
+		if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
+			top  += parseFloat( jQuery.css(body, "marginTop") ) || 0;
+			left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
+		}
+
+		return { top: top, left: left };
+	},
+
+	setOffset: function( elem, options, i ) {
+		var position = jQuery.css( elem, "position" );
+
+		// set position first, in-case top/left are set even on static elem
+		if ( position === "static" ) {
+			elem.style.position = "relative";
+		}
+
+		var curElem = jQuery( elem ),
+			curOffset = curElem.offset(),
+			curCSSTop = jQuery.css( elem, "top" ),
+			curCSSLeft = jQuery.css( elem, "left" ),
+			calculatePosition = (position === "absolute" && jQuery.inArray('auto', [curCSSTop, curCSSLeft]) > -1),
+			props = {}, curPosition = {}, curTop, curLeft;
+
+		// need to be able to calculate position if either top or left is auto and position is absolute
+		if ( calculatePosition ) {
+			curPosition = curElem.position();
+		}
+
+		curTop  = calculatePosition ? curPosition.top  : parseInt( curCSSTop,  10 ) || 0;
+		curLeft = calculatePosition ? curPosition.left : parseInt( curCSSLeft, 10 ) || 0;
+
+		if ( jQuery.isFunction( options ) ) {
+			options = options.call( elem, i, curOffset );
+		}
+
+		if (options.top != null) {
+			props.top = (options.top - curOffset.top) + curTop;
+		}
+		if (options.left != null) {
+			props.left = (options.left - curOffset.left) + curLeft;
+		}
+
+		if ( "using" in options ) {
+			options.using.call( elem, props );
+		} else {
+			curElem.css( props );
+		}
+	}
+};
+
+
+jQuery.fn.extend({
+	position: function() {
+		if ( !this[0] ) {
+			return null;
+		}
+
+		var elem = this[0],
+
+		// Get *real* offsetParent
+		offsetParent = this.offsetParent(),
+
+		// Get correct offsets
+		offset       = this.offset(),
+		parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+		// Subtract element margins
+		// note: when an element has margin: auto the offsetLeft and marginLeft
+		// are the same in Safari causing offset.left to incorrectly be 0
+		offset.top  -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
+		offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
+
+		// Add offsetParent borders
+		parentOffset.top  += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
+		parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
+
+		// Subtract the two offsets
+		return {
+			top:  offset.top  - parentOffset.top,
+			left: offset.left - parentOffset.left
+		};
+	},
+
+	offsetParent: function() {
+		return this.map(function() {
+			var offsetParent = this.offsetParent || document.body;
+			while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+				offsetParent = offsetParent.offsetParent;
+			}
+			return offsetParent;
+		});
+	}
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( ["Left", "Top"], function( i, name ) {
+	var method = "scroll" + name;
+
+	jQuery.fn[ method ] = function(val) {
+		var elem = this[0], win;
+
+		if ( !elem ) {
+			return null;
+		}
+
+		if ( val !== undefined ) {
+			// Set the scroll offset
+			return this.each(function() {
+				win = getWindow( this );
+
+				if ( win ) {
+					win.scrollTo(
+						!i ? val : jQuery(win).scrollLeft(),
+						i ? val : jQuery(win).scrollTop()
+					);
+
+				} else {
+					this[ method ] = val;
+				}
+			});
+		} else {
+			win = getWindow( elem );
+
+			// Return the scroll offset
+			return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
+				jQuery.support.boxModel && win.document.documentElement[ method ] ||
+					win.document.body[ method ] :
+				elem[ method ];
+		}
+	};
+});
+
+function getWindow( elem ) {
+	return jQuery.isWindow( elem ) ?
+		elem :
+		elem.nodeType === 9 ?
+			elem.defaultView || elem.parentWindow :
+			false;
+}
+
+
+
+
+// Create innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function( i, name ) {
+
+	var type = name.toLowerCase();
+
+	// innerHeight and innerWidth
+	jQuery.fn["inner" + name] = function() {
+		return this[0] ?
+			parseFloat( jQuery.css( this[0], type, "padding" ) ) :
+			null;
+	};
+
+	// outerHeight and outerWidth
+	jQuery.fn["outer" + name] = function( margin ) {
+		return this[0] ?
+			parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) :
+			null;
+	};
+
+	jQuery.fn[ type ] = function( size ) {
+		// Get window width or height
+		var elem = this[0];
+		if ( !elem ) {
+			return size == null ? null : this;
+		}
+
+		if ( jQuery.isFunction( size ) ) {
+			return this.each(function( i ) {
+				var self = jQuery( this );
+				self[ type ]( size.call( this, i, self[ type ]() ) );
+			});
+		}
+
+		if ( jQuery.isWindow( elem ) ) {
+			// Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+			// 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat
+			var docElemProp = elem.document.documentElement[ "client" + name ];
+			return elem.document.compatMode === "CSS1Compat" && docElemProp ||
+				elem.document.body[ "client" + name ] || docElemProp;
+
+		// Get document width or height
+		} else if ( elem.nodeType === 9 ) {
+			// Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+			return Math.max(
+				elem.documentElement["client" + name],
+				elem.body["scroll" + name], elem.documentElement["scroll" + name],
+				elem.body["offset" + name], elem.documentElement["offset" + name]
+			);
+
+		// Get or set width or height on the element
+		} else if ( size === undefined ) {
+			var orig = jQuery.css( elem, type ),
+				ret = parseFloat( orig );
+
+			return jQuery.isNaN( ret ) ? orig : ret;
+
+		// Set the width or height on the element (default to pixels if value is unitless)
+		} else {
+			return this.css( type, typeof size === "string" ? size : size + "px" );
+		}
+	};
+
+});
+
+
+window.jQuery = window.$ = jQuery;
+})(window);
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_flat_75_ffffff_40x100.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_glass_75_dadada_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-icons_222222_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-icons_2e83ff_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-icons_454545_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-icons_888888_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/base/images/ui-icons_cd0a0a_256x240.png has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.accordion.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,19 @@
+/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.all.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,11 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming
+ */
+@import "jquery.ui.base.css";
+@import "jquery.ui.theme.css";
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.autocomplete.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,53 @@
+/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }	
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.11
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+	list-style:none;
+	padding: 2px;
+	margin: 0;
+	display:block;
+	float: left;
+}
+.ui-menu .ui-menu {
+	margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+	margin:0;
+	padding: 0;
+	zoom: 1;
+	float: left;
+	clear: left;
+	width: 100%;
+}
+.ui-menu .ui-menu-item a {
+	text-decoration:none;
+	display:block;
+	padding:.2em .4em;
+	line-height:1.5;
+	zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+	font-weight: normal;
+	margin: -1px;
+}
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.base.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,7 @@
+@import url("jquery.ui.core.css");
+@import url("jquery.ui.resizable.css");
+@import url("jquery.ui.selectable.css");
+@import url("jquery.ui.accordion.css");
+@import url("jquery.ui.autocomplete.css");
+@import url("jquery.ui.button.css");
+@import url("jquery.ui.dialog.css");
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.button.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,38 @@
+/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; } 
+button.ui-button-icons-only { width: 3.7em; } 
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4;  }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.core.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,41 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.dialog.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,21 @@
+/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative;  }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } 
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.resizable.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,20 @@
+/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.selectable.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,10 @@
+/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/base/jquery.ui.theme.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,252 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; }
+.ui-widget-content a { color: #222222/*{fcContent}*/; }
+.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; }
+.ui-widget-header a { color: #222222/*{fcHeader}*/; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-right {  -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; border-radius: 4px/*{cornerRadius}*/; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }
+.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_flat_10_000000_40x100.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_222222_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_228ef1_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_ef8c08_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_ffd27a_256x240.png has changed
Binary file jquery-ui/development-bundle/themes/ui-lightness/images/ui-icons_ffffff_256x240.png has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery-ui-1.8.11.custom.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,454 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right {  -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }	
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.11
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+	list-style:none;
+	padding: 2px;
+	margin: 0;
+	display:block;
+	float: left;
+}
+.ui-menu .ui-menu {
+	margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+	margin:0;
+	padding: 0;
+	zoom: 1;
+	float: left;
+	clear: left;
+	width: 100%;
+}
+.ui-menu .ui-menu-item a {
+	text-decoration:none;
+	display:block;
+	padding:.2em .4em;
+	line-height:1.5;
+	zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+	font-weight: normal;
+	margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; } 
+button.ui-button-icons-only { width: 3.7em; } 
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4;  }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative;  }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } 
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.accordion.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,19 @@
+/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.all.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,11 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming
+ */
+@import "jquery.ui.base.css";
+@import "jquery.ui.theme.css";
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.autocomplete.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,53 @@
+/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }	
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.11
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+	list-style:none;
+	padding: 2px;
+	margin: 0;
+	display:block;
+	float: left;
+}
+.ui-menu .ui-menu {
+	margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+	margin:0;
+	padding: 0;
+	zoom: 1;
+	float: left;
+	clear: left;
+	width: 100%;
+}
+.ui-menu .ui-menu-item a {
+	text-decoration:none;
+	display:block;
+	padding:.2em .4em;
+	line-height:1.5;
+	zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+	font-weight: normal;
+	margin: -1px;
+}
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.base.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,7 @@
+@import url("jquery.ui.core.css");
+@import url("jquery.ui.resizable.css");
+@import url("jquery.ui.selectable.css");
+@import url("jquery.ui.accordion.css");
+@import url("jquery.ui.autocomplete.css");
+@import url("jquery.ui.button.css");
+@import url("jquery.ui.dialog.css");
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.button.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,38 @@
+/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; } 
+button.ui-button-icons-only { width: 3.7em; } 
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4;  }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.core.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,41 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.dialog.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,21 @@
+/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative;  }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } 
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.resizable.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,20 @@
+/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.selectable.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,10 @@
+/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/themes/ui-lightness/jquery.ui.theme.css	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,254 @@
+
+
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right {  -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery-ui-1.8.11.custom.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,6680 @@
+/*!
+ * jQuery UI 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function( $, undefined ) {
+
+// prevent duplicate loading
+// this is only a problem because we proxy existing functions
+// and we don't want to double proxy them
+$.ui = $.ui || {};
+if ( $.ui.version ) {
+	return;
+}
+
+$.extend( $.ui, {
+	version: "1.8.11",
+
+	keyCode: {
+		ALT: 18,
+		BACKSPACE: 8,
+		CAPS_LOCK: 20,
+		COMMA: 188,
+		COMMAND: 91,
+		COMMAND_LEFT: 91, // COMMAND
+		COMMAND_RIGHT: 93,
+		CONTROL: 17,
+		DELETE: 46,
+		DOWN: 40,
+		END: 35,
+		ENTER: 13,
+		ESCAPE: 27,
+		HOME: 36,
+		INSERT: 45,
+		LEFT: 37,
+		MENU: 93, // COMMAND_RIGHT
+		NUMPAD_ADD: 107,
+		NUMPAD_DECIMAL: 110,
+		NUMPAD_DIVIDE: 111,
+		NUMPAD_ENTER: 108,
+		NUMPAD_MULTIPLY: 106,
+		NUMPAD_SUBTRACT: 109,
+		PAGE_DOWN: 34,
+		PAGE_UP: 33,
+		PERIOD: 190,
+		RIGHT: 39,
+		SHIFT: 16,
+		SPACE: 32,
+		TAB: 9,
+		UP: 38,
+		WINDOWS: 91 // COMMAND
+	}
+});
+
+// plugins
+$.fn.extend({
+	_focus: $.fn.focus,
+	focus: function( delay, fn ) {
+		return typeof delay === "number" ?
+			this.each(function() {
+				var elem = this;
+				setTimeout(function() {
+					$( elem ).focus();
+					if ( fn ) {
+						fn.call( elem );
+					}
+				}, delay );
+			}) :
+			this._focus.apply( this, arguments );
+	},
+
+	scrollParent: function() {
+		var scrollParent;
+		if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+			scrollParent = this.parents().filter(function() {
+				return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		} else {
+			scrollParent = this.parents().filter(function() {
+				return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		}
+
+		return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+	},
+
+	zIndex: function( zIndex ) {
+		if ( zIndex !== undefined ) {
+			return this.css( "zIndex", zIndex );
+		}
+
+		if ( this.length ) {
+			var elem = $( this[ 0 ] ), position, value;
+			while ( elem.length && elem[ 0 ] !== document ) {
+				// Ignore z-index if position is set to a value where z-index is ignored by the browser
+				// This makes behavior of this function consistent across browsers
+				// WebKit always returns auto if the element is positioned
+				position = elem.css( "position" );
+				if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+					// IE returns 0 when zIndex is not specified
+					// other browsers return a string
+					// we ignore the case of nested elements with an explicit value of 0
+					// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+					value = parseInt( elem.css( "zIndex" ), 10 );
+					if ( !isNaN( value ) && value !== 0 ) {
+						return value;
+					}
+				}
+				elem = elem.parent();
+			}
+		}
+
+		return 0;
+	},
+
+	disableSelection: function() {
+		return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+			".ui-disableSelection", function( event ) {
+				event.preventDefault();
+			});
+	},
+
+	enableSelection: function() {
+		return this.unbind( ".ui-disableSelection" );
+	}
+});
+
+$.each( [ "Width", "Height" ], function( i, name ) {
+	var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+		type = name.toLowerCase(),
+		orig = {
+			innerWidth: $.fn.innerWidth,
+			innerHeight: $.fn.innerHeight,
+			outerWidth: $.fn.outerWidth,
+			outerHeight: $.fn.outerHeight
+		};
+
+	function reduce( elem, size, border, margin ) {
+		$.each( side, function() {
+			size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
+			if ( border ) {
+				size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
+			}
+			if ( margin ) {
+				size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
+			}
+		});
+		return size;
+	}
+
+	$.fn[ "inner" + name ] = function( size ) {
+		if ( size === undefined ) {
+			return orig[ "inner" + name ].call( this );
+		}
+
+		return this.each(function() {
+			$( this ).css( type, reduce( this, size ) + "px" );
+		});
+	};
+
+	$.fn[ "outer" + name] = function( size, margin ) {
+		if ( typeof size !== "number" ) {
+			return orig[ "outer" + name ].call( this, size );
+		}
+
+		return this.each(function() {
+			$( this).css( type, reduce( this, size, true, margin ) + "px" );
+		});
+	};
+});
+
+// selectors
+function visible( element ) {
+	return !$( element ).parents().andSelf().filter(function() {
+		return $.curCSS( this, "visibility" ) === "hidden" ||
+			$.expr.filters.hidden( this );
+	}).length;
+}
+
+$.extend( $.expr[ ":" ], {
+	data: function( elem, i, match ) {
+		return !!$.data( elem, match[ 3 ] );
+	},
+
+	focusable: function( element ) {
+		var nodeName = element.nodeName.toLowerCase(),
+			tabIndex = $.attr( element, "tabindex" );
+		if ( "area" === nodeName ) {
+			var map = element.parentNode,
+				mapName = map.name,
+				img;
+			if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+				return false;
+			}
+			img = $( "img[usemap=#" + mapName + "]" )[0];
+			return !!img && visible( img );
+		}
+		return ( /input|select|textarea|button|object/.test( nodeName )
+			? !element.disabled
+			: "a" == nodeName
+				? element.href || !isNaN( tabIndex )
+				: !isNaN( tabIndex ))
+			// the element and all of its ancestors must be visible
+			&& visible( element );
+	},
+
+	tabbable: function( element ) {
+		var tabIndex = $.attr( element, "tabindex" );
+		return ( isNaN( tabIndex ) || tabIndex >= 0 ) && $( element ).is( ":focusable" );
+	}
+});
+
+// support
+$(function() {
+	var body = document.body,
+		div = body.appendChild( div = document.createElement( "div" ) );
+
+	$.extend( div.style, {
+		minHeight: "100px",
+		height: "auto",
+		padding: 0,
+		borderWidth: 0
+	});
+
+	$.support.minHeight = div.offsetHeight === 100;
+	$.support.selectstart = "onselectstart" in div;
+
+	// set display to none to avoid a layout bug in IE
+	// http://dev.jquery.com/ticket/4014
+	body.removeChild( div ).style.display = "none";
+});
+
+
+
+
+
+// deprecated
+$.extend( $.ui, {
+	// $.ui.plugin is deprecated.  Use the proxy pattern instead.
+	plugin: {
+		add: function( module, option, set ) {
+			var proto = $.ui[ module ].prototype;
+			for ( var i in set ) {
+				proto.plugins[ i ] = proto.plugins[ i ] || [];
+				proto.plugins[ i ].push( [ option, set[ i ] ] );
+			}
+		},
+		call: function( instance, name, args ) {
+			var set = instance.plugins[ name ];
+			if ( !set || !instance.element[ 0 ].parentNode ) {
+				return;
+			}
+	
+			for ( var i = 0; i < set.length; i++ ) {
+				if ( instance.options[ set[ i ][ 0 ] ] ) {
+					set[ i ][ 1 ].apply( instance.element, args );
+				}
+			}
+		}
+	},
+	
+	// will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
+	contains: function( a, b ) {
+		return document.compareDocumentPosition ?
+			a.compareDocumentPosition( b ) & 16 :
+			a !== b && a.contains( b );
+	},
+	
+	// only used by resizable
+	hasScroll: function( el, a ) {
+	
+		//If overflow is hidden, the element might have extra content, but the user wants to hide it
+		if ( $( el ).css( "overflow" ) === "hidden") {
+			return false;
+		}
+	
+		var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+			has = false;
+	
+		if ( el[ scroll ] > 0 ) {
+			return true;
+		}
+	
+		// TODO: determine which cases actually cause this to happen
+		// if the element doesn't have the scroll set, see if it's possible to
+		// set the scroll
+		el[ scroll ] = 1;
+		has = ( el[ scroll ] > 0 );
+		el[ scroll ] = 0;
+		return has;
+	},
+	
+	// these are odd functions, fix the API or move into individual plugins
+	isOverAxis: function( x, reference, size ) {
+		//Determines when x coordinate is over "b" element axis
+		return ( x > reference ) && ( x < ( reference + size ) );
+	},
+	isOver: function( y, x, top, left, height, width ) {
+		//Determines when x, y coordinates is over "b" element
+		return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
+	}
+});
+
+})( jQuery );
+/*!
+ * jQuery UI Widget 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+	var _cleanData = $.cleanData;
+	$.cleanData = function( elems ) {
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			$( elem ).triggerHandler( "remove" );
+		}
+		_cleanData( elems );
+	};
+} else {
+	var _remove = $.fn.remove;
+	$.fn.remove = function( selector, keepData ) {
+		return this.each(function() {
+			if ( !keepData ) {
+				if ( !selector || $.filter( selector, [ this ] ).length ) {
+					$( "*", this ).add( [ this ] ).each(function() {
+						$( this ).triggerHandler( "remove" );
+					});
+				}
+			}
+			return _remove.call( $(this), selector, keepData );
+		});
+	};
+}
+
+$.widget = function( name, base, prototype ) {
+	var namespace = name.split( "." )[ 0 ],
+		fullName;
+	name = name.split( "." )[ 1 ];
+	fullName = namespace + "-" + name;
+
+	if ( !prototype ) {
+		prototype = base;
+		base = $.Widget;
+	}
+
+	// create selector for plugin
+	$.expr[ ":" ][ fullName ] = function( elem ) {
+		return !!$.data( elem, name );
+	};
+
+	$[ namespace ] = $[ namespace ] || {};
+	$[ namespace ][ name ] = function( options, element ) {
+		// allow instantiation without initializing for simple inheritance
+		if ( arguments.length ) {
+			this._createWidget( options, element );
+		}
+	};
+
+	var basePrototype = new base();
+	// we need to make the options hash a property directly on the new instance
+	// otherwise we'll modify the options hash on the prototype that we're
+	// inheriting from
+//	$.each( basePrototype, function( key, val ) {
+//		if ( $.isPlainObject(val) ) {
+//			basePrototype[ key ] = $.extend( {}, val );
+//		}
+//	});
+	basePrototype.options = $.extend( true, {}, basePrototype.options );
+	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+		namespace: namespace,
+		widgetName: name,
+		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+		widgetBaseClass: fullName
+	}, prototype );
+
+	$.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+	$.fn[ name ] = function( options ) {
+		var isMethodCall = typeof options === "string",
+			args = Array.prototype.slice.call( arguments, 1 ),
+			returnValue = this;
+
+		// allow multiple hashes to be passed on init
+		options = !isMethodCall && args.length ?
+			$.extend.apply( null, [ true, options ].concat(args) ) :
+			options;
+
+		// prevent calls to internal methods
+		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+			return returnValue;
+		}
+
+		if ( isMethodCall ) {
+			this.each(function() {
+				var instance = $.data( this, name ),
+					methodValue = instance && $.isFunction( instance[options] ) ?
+						instance[ options ].apply( instance, args ) :
+						instance;
+				// TODO: add this back in 1.9 and use $.error() (see #5972)
+//				if ( !instance ) {
+//					throw "cannot call methods on " + name + " prior to initialization; " +
+//						"attempted to call method '" + options + "'";
+//				}
+//				if ( !$.isFunction( instance[options] ) ) {
+//					throw "no such method '" + options + "' for " + name + " widget instance";
+//				}
+//				var methodValue = instance[ options ].apply( instance, args );
+				if ( methodValue !== instance && methodValue !== undefined ) {
+					returnValue = methodValue;
+					return false;
+				}
+			});
+		} else {
+			this.each(function() {
+				var instance = $.data( this, name );
+				if ( instance ) {
+					instance.option( options || {} )._init();
+				} else {
+					$.data( this, name, new object( options, this ) );
+				}
+			});
+		}
+
+		return returnValue;
+	};
+};
+
+$.Widget = function( options, element ) {
+	// allow instantiation without initializing for simple inheritance
+	if ( arguments.length ) {
+		this._createWidget( options, element );
+	}
+};
+
+$.Widget.prototype = {
+	widgetName: "widget",
+	widgetEventPrefix: "",
+	options: {
+		disabled: false
+	},
+	_createWidget: function( options, element ) {
+		// $.widget.bridge stores the plugin instance, but we do it anyway
+		// so that it's stored even before the _create function runs
+		$.data( element, this.widgetName, this );
+		this.element = $( element );
+		this.options = $.extend( true, {},
+			this.options,
+			this._getCreateOptions(),
+			options );
+
+		var self = this;
+		this.element.bind( "remove." + this.widgetName, function() {
+			self.destroy();
+		});
+
+		this._create();
+		this._trigger( "create" );
+		this._init();
+	},
+	_getCreateOptions: function() {
+		return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+	},
+	_create: function() {},
+	_init: function() {},
+
+	destroy: function() {
+		this.element
+			.unbind( "." + this.widgetName )
+			.removeData( this.widgetName );
+		this.widget()
+			.unbind( "." + this.widgetName )
+			.removeAttr( "aria-disabled" )
+			.removeClass(
+				this.widgetBaseClass + "-disabled " +
+				"ui-state-disabled" );
+	},
+
+	widget: function() {
+		return this.element;
+	},
+
+	option: function( key, value ) {
+		var options = key;
+
+		if ( arguments.length === 0 ) {
+			// don't return a reference to the internal hash
+			return $.extend( {}, this.options );
+		}
+
+		if  (typeof key === "string" ) {
+			if ( value === undefined ) {
+				return this.options[ key ];
+			}
+			options = {};
+			options[ key ] = value;
+		}
+
+		this._setOptions( options );
+
+		return this;
+	},
+	_setOptions: function( options ) {
+		var self = this;
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+		});
+
+		return this;
+	},
+	_setOption: function( key, value ) {
+		this.options[ key ] = value;
+
+		if ( key === "disabled" ) {
+			this.widget()
+				[ value ? "addClass" : "removeClass"](
+					this.widgetBaseClass + "-disabled" + " " +
+					"ui-state-disabled" )
+				.attr( "aria-disabled", value );
+		}
+
+		return this;
+	},
+
+	enable: function() {
+		return this._setOption( "disabled", false );
+	},
+	disable: function() {
+		return this._setOption( "disabled", true );
+	},
+
+	_trigger: function( type, event, data ) {
+		var callback = this.options[ type ];
+
+		event = $.Event( event );
+		event.type = ( type === this.widgetEventPrefix ?
+			type :
+			this.widgetEventPrefix + type ).toLowerCase();
+		data = data || {};
+
+		// copy original event properties over to the new event
+		// this would happen if we could call $.event.fix instead of $.Event
+		// but we don't have a way to force an event to be fixed multiple times
+		if ( event.originalEvent ) {
+			for ( var i = $.event.props.length, prop; i; ) {
+				prop = $.event.props[ --i ];
+				event[ prop ] = event.originalEvent[ prop ];
+			}
+		}
+
+		this.element.trigger( event, data );
+
+		return !( $.isFunction(callback) &&
+			callback.call( this.element[0], event, data ) === false ||
+			event.isDefaultPrevented() );
+	}
+};
+
+})( jQuery );
+/*!
+ * jQuery UI Mouse 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.mouse", {
+	options: {
+		cancel: ':input,option',
+		distance: 1,
+		delay: 0
+	},
+	_mouseInit: function() {
+		var self = this;
+
+		this.element
+			.bind('mousedown.'+this.widgetName, function(event) {
+				return self._mouseDown(event);
+			})
+			.bind('click.'+this.widgetName, function(event) {
+				if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
+				    $.removeData(event.target, self.widgetName + '.preventClickEvent');
+					event.stopImmediatePropagation();
+					return false;
+				}
+			});
+
+		this.started = false;
+	},
+
+	// TODO: make sure destroying one instance of mouse doesn't mess with
+	// other instances of mouse
+	_mouseDestroy: function() {
+		this.element.unbind('.'+this.widgetName);
+	},
+
+	_mouseDown: function(event) {
+		// don't let more than one widget handle mouseStart
+		// TODO: figure out why we have to use originalEvent
+		event.originalEvent = event.originalEvent || {};
+		if (event.originalEvent.mouseHandled) { return; }
+
+		// we may have missed mouseup (out of window)
+		(this._mouseStarted && this._mouseUp(event));
+
+		this._mouseDownEvent = event;
+
+		var self = this,
+			btnIsLeft = (event.which == 1),
+			elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+			return true;
+		}
+
+		this.mouseDelayMet = !this.options.delay;
+		if (!this.mouseDelayMet) {
+			this._mouseDelayTimer = setTimeout(function() {
+				self.mouseDelayMet = true;
+			}, this.options.delay);
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted = (this._mouseStart(event) !== false);
+			if (!this._mouseStarted) {
+				event.preventDefault();
+				return true;
+			}
+		}
+
+		// Click event may never have fired (Gecko & Opera)
+		if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
+			$.removeData(event.target, this.widgetName + '.preventClickEvent');
+		}
+
+		// these delegates are required to keep context
+		this._mouseMoveDelegate = function(event) {
+			return self._mouseMove(event);
+		};
+		this._mouseUpDelegate = function(event) {
+			return self._mouseUp(event);
+		};
+		$(document)
+			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		event.preventDefault();
+		event.originalEvent.mouseHandled = true;
+		return true;
+	},
+
+	_mouseMove: function(event) {
+		// IE mouseup check - mouseup happened when mouse was out of window
+		if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
+			return this._mouseUp(event);
+		}
+
+		if (this._mouseStarted) {
+			this._mouseDrag(event);
+			return event.preventDefault();
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted =
+				(this._mouseStart(this._mouseDownEvent, event) !== false);
+			(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+		}
+
+		return !this._mouseStarted;
+	},
+
+	_mouseUp: function(event) {
+		$(document)
+			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		if (this._mouseStarted) {
+			this._mouseStarted = false;
+
+			if (event.target == this._mouseDownEvent.target) {
+			    $.data(event.target, this.widgetName + '.preventClickEvent', true);
+			}
+
+			this._mouseStop(event);
+		}
+
+		return false;
+	},
+
+	_mouseDistanceMet: function(event) {
+		return (Math.max(
+				Math.abs(this._mouseDownEvent.pageX - event.pageX),
+				Math.abs(this._mouseDownEvent.pageY - event.pageY)
+			) >= this.options.distance
+		);
+	},
+
+	_mouseDelayMet: function(event) {
+		return this.mouseDelayMet;
+	},
+
+	// These are placeholder methods, to be overriden by extending plugin
+	_mouseStart: function(event) {},
+	_mouseDrag: function(event) {},
+	_mouseStop: function(event) {},
+	_mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Position 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $, undefined ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+	verticalPositions = /top|center|bottom/,
+	center = "center",
+	_position = $.fn.position,
+	_offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+	if ( !options || !options.of ) {
+		return _position.apply( this, arguments );
+	}
+
+	// make a copy, we don't want to modify arguments
+	options = $.extend( {}, options );
+
+	var target = $( options.of ),
+		targetElem = target[0],
+		collision = ( options.collision || "flip" ).split( " " ),
+		offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+		targetWidth,
+		targetHeight,
+		basePosition;
+
+	if ( targetElem.nodeType === 9 ) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: 0, left: 0 };
+	// TODO: use $.isWindow() in 1.9
+	} else if ( targetElem.setTimeout ) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+	} else if ( targetElem.preventDefault ) {
+		// force left top to allow flipping
+		options.at = "left top";
+		targetWidth = targetHeight = 0;
+		basePosition = { top: options.of.pageY, left: options.of.pageX };
+	} else {
+		targetWidth = target.outerWidth();
+		targetHeight = target.outerHeight();
+		basePosition = target.offset();
+	}
+
+	// force my and at to have valid horizontal and veritcal positions
+	// if a value is missing or invalid, it will be converted to center 
+	$.each( [ "my", "at" ], function() {
+		var pos = ( options[this] || "" ).split( " " );
+		if ( pos.length === 1) {
+			pos = horizontalPositions.test( pos[0] ) ?
+				pos.concat( [center] ) :
+				verticalPositions.test( pos[0] ) ?
+					[ center ].concat( pos ) :
+					[ center, center ];
+		}
+		pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
+		pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
+		options[ this ] = pos;
+	});
+
+	// normalize collision option
+	if ( collision.length === 1 ) {
+		collision[ 1 ] = collision[ 0 ];
+	}
+
+	// normalize offset option
+	offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+	if ( offset.length === 1 ) {
+		offset[ 1 ] = offset[ 0 ];
+	}
+	offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+	if ( options.at[0] === "right" ) {
+		basePosition.left += targetWidth;
+	} else if ( options.at[0] === center ) {
+		basePosition.left += targetWidth / 2;
+	}
+
+	if ( options.at[1] === "bottom" ) {
+		basePosition.top += targetHeight;
+	} else if ( options.at[1] === center ) {
+		basePosition.top += targetHeight / 2;
+	}
+
+	basePosition.left += offset[ 0 ];
+	basePosition.top += offset[ 1 ];
+
+	return this.each(function() {
+		var elem = $( this ),
+			elemWidth = elem.outerWidth(),
+			elemHeight = elem.outerHeight(),
+			marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
+			marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
+			collisionWidth = elemWidth + marginLeft +
+				( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
+			collisionHeight = elemHeight + marginTop +
+				( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+			position = $.extend( {}, basePosition ),
+			collisionPosition;
+
+		if ( options.my[0] === "right" ) {
+			position.left -= elemWidth;
+		} else if ( options.my[0] === center ) {
+			position.left -= elemWidth / 2;
+		}
+
+		if ( options.my[1] === "bottom" ) {
+			position.top -= elemHeight;
+		} else if ( options.my[1] === center ) {
+			position.top -= elemHeight / 2;
+		}
+
+		// prevent fractions (see #5280)
+		position.left = Math.round( position.left );
+		position.top = Math.round( position.top );
+
+		collisionPosition = {
+			left: position.left - marginLeft,
+			top: position.top - marginTop
+		};
+
+		$.each( [ "left", "top" ], function( i, dir ) {
+			if ( $.ui.position[ collision[i] ] ) {
+				$.ui.position[ collision[i] ][ dir ]( position, {
+					targetWidth: targetWidth,
+					targetHeight: targetHeight,
+					elemWidth: elemWidth,
+					elemHeight: elemHeight,
+					collisionPosition: collisionPosition,
+					collisionWidth: collisionWidth,
+					collisionHeight: collisionHeight,
+					offset: offset,
+					my: options.my,
+					at: options.at
+				});
+			}
+		});
+
+		if ( $.fn.bgiframe ) {
+			elem.bgiframe();
+		}
+		elem.offset( $.extend( position, { using: options.using } ) );
+	});
+};
+
+$.ui.position = {
+	fit: {
+		left: function( position, data ) {
+			var win = $( window ),
+				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
+			position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+		},
+		top: function( position, data ) {
+			var win = $( window ),
+				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
+			position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+		}
+	},
+
+	flip: {
+		left: function( position, data ) {
+			if ( data.at[0] === center ) {
+				return;
+			}
+			var win = $( window ),
+				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+				myOffset = data.my[ 0 ] === "left" ?
+					-data.elemWidth :
+					data.my[ 0 ] === "right" ?
+						data.elemWidth :
+						0,
+				atOffset = data.at[ 0 ] === "left" ?
+					data.targetWidth :
+					-data.targetWidth,
+				offset = -2 * data.offset[ 0 ];
+			position.left += data.collisionPosition.left < 0 ?
+				myOffset + atOffset + offset :
+				over > 0 ?
+					myOffset + atOffset + offset :
+					0;
+		},
+		top: function( position, data ) {
+			if ( data.at[1] === center ) {
+				return;
+			}
+			var win = $( window ),
+				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
+				myOffset = data.my[ 1 ] === "top" ?
+					-data.elemHeight :
+					data.my[ 1 ] === "bottom" ?
+						data.elemHeight :
+						0,
+				atOffset = data.at[ 1 ] === "top" ?
+					data.targetHeight :
+					-data.targetHeight,
+				offset = -2 * data.offset[ 1 ];
+			position.top += data.collisionPosition.top < 0 ?
+				myOffset + atOffset + offset :
+				over > 0 ?
+					myOffset + atOffset + offset :
+					0;
+		}
+	}
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+	$.offset.setOffset = function( elem, options ) {
+		// set position first, in-case top/left are set even on static elem
+		if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+			elem.style.position = "relative";
+		}
+		var curElem   = $( elem ),
+			curOffset = curElem.offset(),
+			curTop    = parseInt( $.curCSS( elem, "top",  true ), 10 ) || 0,
+			curLeft   = parseInt( $.curCSS( elem, "left", true ), 10)  || 0,
+			props     = {
+				top:  (options.top  - curOffset.top)  + curTop,
+				left: (options.left - curOffset.left) + curLeft
+			};
+		
+		if ( 'using' in options ) {
+			options.using.call( elem, props );
+		} else {
+			curElem.css( props );
+		}
+	};
+
+	$.fn.offset = function( options ) {
+		var elem = this[ 0 ];
+		if ( !elem || !elem.ownerDocument ) { return null; }
+		if ( options ) { 
+			return this.each(function() {
+				$.offset.setOffset( this, options );
+			});
+		}
+		return _offset.call( this );
+	};
+}
+
+}( jQuery ));
+/*
+ * jQuery UI Draggable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+	widgetEventPrefix: "drag",
+	options: {
+		addClasses: true,
+		appendTo: "parent",
+		axis: false,
+		connectToSortable: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		iframeFix: false,
+		opacity: false,
+		refreshPositions: false,
+		revert: false,
+		revertDuration: 500,
+		scope: "default",
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		snap: false,
+		snapMode: "both",
+		snapTolerance: 20,
+		stack: false,
+		zIndex: false
+	},
+	_create: function() {
+
+		if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+			this.element[0].style.position = 'relative';
+
+		(this.options.addClasses && this.element.addClass("ui-draggable"));
+		(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+		if(!this.element.data('draggable')) return;
+		this.element
+			.removeData("draggable")
+			.unbind(".draggable")
+			.removeClass("ui-draggable"
+				+ " ui-draggable-dragging"
+				+ " ui-draggable-disabled");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+
+		var o = this.options;
+
+		// among others, prevent a drag on a resizable-handle
+		if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+			return false;
+
+		//Quit if we're not on a valid handle
+		this.handle = this._getHandle(event);
+		if (!this.handle)
+			return false;
+
+		return true;
+
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options;
+
+		//Create and append the visible helper
+		this.helper = this._createHelper(event);
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		//If ddmanager is used for droppables, set the global draggable
+		if($.ui.ddmanager)
+			$.ui.ddmanager.current = this;
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Store the helper's css position
+		this.cssPosition = this.helper.css("position");
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.positionAbs = this.element.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		$.extend(this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+		});
+
+		//Generate the original position
+		this.originalPosition = this.position = this._generatePosition(event);
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+		//Set a containment if given in the options
+		if(o.containment)
+			this._setContainment();
+
+		//Trigger event + callbacks
+		if(this._trigger("start", event) === false) {
+			this._clear();
+			return false;
+		}
+
+		//Recache the helper size
+		this._cacheHelperProportions();
+
+		//Prepare the droppable offsets
+		if ($.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(this, event);
+
+		this.helper.addClass("ui-draggable-dragging");
+		this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+		return true;
+	},
+
+	_mouseDrag: function(event, noPropagation) {
+
+		//Compute the helpers position
+		this.position = this._generatePosition(event);
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		//Call plugins and callbacks and use the resulting position if something is returned
+		if (!noPropagation) {
+			var ui = this._uiHash();
+			if(this._trigger('drag', event, ui) === false) {
+				this._mouseUp({});
+				return false;
+			}
+			this.position = ui.position;
+		}
+
+		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		//If we are using droppables, inform the manager about the drop
+		var dropped = false;
+		if ($.ui.ddmanager && !this.options.dropBehaviour)
+			dropped = $.ui.ddmanager.drop(this, event);
+
+		//if a drop comes from outside (a sortable)
+		if(this.dropped) {
+			dropped = this.dropped;
+			this.dropped = false;
+		}
+		
+		//if the original element is removed, don't bother to continue if helper is set to "original"
+		if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original")
+			return false;
+
+		if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+			var self = this;
+			$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+				if(self._trigger("stop", event) !== false) {
+					self._clear();
+				}
+			});
+		} else {
+			if(this._trigger("stop", event) !== false) {
+				this._clear();
+			}
+		}
+
+		return false;
+	},
+	
+	cancel: function() {
+		
+		if(this.helper.is(".ui-draggable-dragging")) {
+			this._mouseUp({});
+		} else {
+			this._clear();
+		}
+		
+		return this;
+		
+	},
+
+	_getHandle: function(event) {
+
+		var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+		$(this.options.handle, this.element)
+			.find("*")
+			.andSelf()
+			.each(function() {
+				if(this == event.target) handle = true;
+			});
+
+		return handle;
+
+	},
+
+	_createHelper: function(event) {
+
+		var o = this.options;
+		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+		if(!helper.parents('body').length)
+			helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+		if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+			helper.css("position", "absolute");
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function(obj) {
+		if (typeof obj == 'string') {
+			obj = obj.split(' ');
+		}
+		if ($.isArray(obj)) {
+			obj = {left: +obj[0], top: +obj[1] || 0};
+		}
+		if ('left' in obj) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ('right' in obj) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ('top' in obj) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ('bottom' in obj) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+			po = { top: 0, left: 0 };
+
+		return {
+			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if(this.cssPosition == "relative") {
+			var p = this.element.position();
+			return {
+				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: (parseInt(this.element.css("marginLeft"),10) || 0),
+			top: (parseInt(this.element.css("marginTop"),10) || 0),
+			right: (parseInt(this.element.css("marginRight"),10) || 0),
+			bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var o = this.options;
+		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+		if(o.containment == 'document' || o.containment == 'window') this.containment = [
+			(o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left,
+			(o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top,
+			(o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+			(o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+		];
+
+		if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+			var ce = $(o.containment)[0]; if(!ce) return;
+			var co = $(o.containment).offset();
+			var over = ($(ce).css("overflow") != 'hidden');
+
+			this.containment = [
+				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
+				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
+				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
+				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top  - this.margins.bottom
+			];
+		} else if(o.containment.constructor == Array) {
+			this.containment = o.containment;
+		}
+
+	},
+
+	_convertPositionTo: function(d, pos) {
+
+		if(!pos) pos = this.position;
+		var mod = d == "absolute" ? 1 : -1;
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		return {
+			top: (
+				pos.top																	// The absolute mouse position
+				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+			),
+			left: (
+				pos.left																// The absolute mouse position
+				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+			)
+		};
+
+	},
+
+	_generatePosition: function(event) {
+
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+		var pageX = event.pageX;
+		var pageY = event.pageY;
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+			if(this.containment) {
+				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+			}
+
+			if(o.grid) {
+				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+			}
+
+		}
+
+		return {
+			top: (
+				pageY																// The absolute mouse position
+				- this.offset.click.top													// Click offset (relative to the element)
+				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+			),
+			left: (
+				pageX																// The absolute mouse position
+				- this.offset.click.left												// Click offset (relative to the element)
+				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+			)
+		};
+
+	},
+
+	_clear: function() {
+		this.helper.removeClass("ui-draggable-dragging");
+		if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+		//if($.ui.ddmanager) $.ui.ddmanager.current = null;
+		this.helper = null;
+		this.cancelHelperRemoval = false;
+	},
+
+	// From now on bulk stuff - mainly helpers
+
+	_trigger: function(type, event, ui) {
+		ui = ui || this._uiHash();
+		$.ui.plugin.call(this, type, [event, ui]);
+		if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+		return $.Widget.prototype._trigger.call(this, type, event, ui);
+	},
+
+	plugins: {},
+
+	_uiHash: function(event) {
+		return {
+			helper: this.helper,
+			position: this.position,
+			originalPosition: this.originalPosition,
+			offset: this.positionAbs
+		};
+	}
+
+});
+
+$.extend($.ui.draggable, {
+	version: "1.8.11"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+	start: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options,
+			uiSortable = $.extend({}, ui, { item: inst.element });
+		inst.sortables = [];
+		$(o.connectToSortable).each(function() {
+			var sortable = $.data(this, 'sortable');
+			if (sortable && !sortable.options.disabled) {
+				inst.sortables.push({
+					instance: sortable,
+					shouldRevert: sortable.options.revert
+				});
+				sortable.refreshPositions();	// Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
+				sortable._trigger("activate", event, uiSortable);
+			}
+		});
+
+	},
+	stop: function(event, ui) {
+
+		//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+		var inst = $(this).data("draggable"),
+			uiSortable = $.extend({}, ui, { item: inst.element });
+
+		$.each(inst.sortables, function() {
+			if(this.instance.isOver) {
+
+				this.instance.isOver = 0;
+
+				inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+				this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+				//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+				if(this.shouldRevert) this.instance.options.revert = true;
+
+				//Trigger the stop of the sortable
+				this.instance._mouseStop(event);
+
+				this.instance.options.helper = this.instance.options._helper;
+
+				//If the helper has been the original item, restore properties in the sortable
+				if(inst.options.helper == 'original')
+					this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+			} else {
+				this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+				this.instance._trigger("deactivate", event, uiSortable);
+			}
+
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), self = this;
+
+		var checkPos = function(o) {
+			var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+			var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+			var itemHeight = o.height, itemWidth = o.width;
+			var itemTop = o.top, itemLeft = o.left;
+
+			return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+		};
+
+		$.each(inst.sortables, function(i) {
+			
+			//Copy over some variables to allow calling the sortable's native _intersectsWith
+			this.instance.positionAbs = inst.positionAbs;
+			this.instance.helperProportions = inst.helperProportions;
+			this.instance.offset.click = inst.offset.click;
+			
+			if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+				//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+				if(!this.instance.isOver) {
+
+					this.instance.isOver = 1;
+					//Now we fake the start of dragging for the sortable instance,
+					//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+					//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+					this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+					this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+					this.instance.options.helper = function() { return ui.helper[0]; };
+
+					event.target = this.instance.currentItem[0];
+					this.instance._mouseCapture(event, true);
+					this.instance._mouseStart(event, true, true);
+
+					//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+					this.instance.offset.click.top = inst.offset.click.top;
+					this.instance.offset.click.left = inst.offset.click.left;
+					this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+					this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+					inst._trigger("toSortable", event);
+					inst.dropped = this.instance.element; //draggable revert needs that
+					//hack so receive/update callbacks work (mostly)
+					inst.currentItem = inst.element;
+					this.instance.fromOutside = inst;
+
+				}
+
+				//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+				if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+			} else {
+
+				//If it doesn't intersect with the sortable, and it intersected before,
+				//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+				if(this.instance.isOver) {
+
+					this.instance.isOver = 0;
+					this.instance.cancelHelperRemoval = true;
+					
+					//Prevent reverting on this forced stop
+					this.instance.options.revert = false;
+					
+					// The out event needs to be triggered independently
+					this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+					
+					this.instance._mouseStop(event, true);
+					this.instance.options.helper = this.instance.options._helper;
+
+					//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+					this.instance.currentItem.remove();
+					if(this.instance.placeholder) this.instance.placeholder.remove();
+
+					inst._trigger("fromSortable", event);
+					inst.dropped = false; //draggable revert needs that
+				}
+
+			};
+
+		});
+
+	}
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+	start: function(event, ui) {
+		var t = $('body'), o = $(this).data('draggable').options;
+		if (t.css("cursor")) o._cursor = t.css("cursor");
+		t.css("cursor", o.cursor);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if (o._cursor) $('body').css("cursor", o._cursor);
+	}
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+	start: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+			$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+			.css({
+				width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+				position: "absolute", opacity: "0.001", zIndex: 1000
+			})
+			.css($(this).offset())
+			.appendTo("body");
+		});
+	},
+	stop: function(event, ui) {
+		$("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+	}
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data('draggable').options;
+		if(t.css("opacity")) o._opacity = t.css("opacity");
+		t.css('opacity', o.opacity);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+	}
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+	start: function(event, ui) {
+		var i = $(this).data("draggable");
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+	},
+	drag: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+			if(!o.axis || o.axis != 'x') {
+				if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+				else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+				else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+			}
+
+		} else {
+
+			if(!o.axis || o.axis != 'x') {
+				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+			}
+
+		}
+
+		if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(i, event);
+
+	}
+});
+
+$.ui.plugin.add("draggable", "snap", {
+	start: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options;
+		i.snapElements = [];
+
+		$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+			var $t = $(this); var $o = $t.offset();
+			if(this != i.element[0]) i.snapElements.push({
+				item: this,
+				width: $t.outerWidth(), height: $t.outerHeight(),
+				top: $o.top, left: $o.left
+			});
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options;
+		var d = o.snapTolerance;
+
+		var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+		for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+			var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+				t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+			//Yes, I know, this is insane ;)
+			if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+				if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+				inst.snapElements[i].snapping = false;
+				continue;
+			}
+
+			if(o.snapMode != 'inner') {
+				var ts = Math.abs(t - y2) <= d;
+				var bs = Math.abs(b - y1) <= d;
+				var ls = Math.abs(l - x2) <= d;
+				var rs = Math.abs(r - x1) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+			}
+
+			var first = (ts || bs || ls || rs);
+
+			if(o.snapMode != 'outer') {
+				var ts = Math.abs(t - y1) <= d;
+				var bs = Math.abs(b - y2) <= d;
+				var ls = Math.abs(l - x1) <= d;
+				var rs = Math.abs(r - x2) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+			}
+
+			if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+				(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+			inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+		};
+
+	}
+});
+
+$.ui.plugin.add("draggable", "stack", {
+	start: function(event, ui) {
+
+		var o = $(this).data("draggable").options;
+
+		var group = $.makeArray($(o.stack)).sort(function(a,b) {
+			return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+		});
+		if (!group.length) { return; }
+		
+		var min = parseInt(group[0].style.zIndex) || 0;
+		$(group).each(function(i) {
+			this.style.zIndex = min + i;
+		});
+
+		this[0].style.zIndex = min + group.length;
+
+	}
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data("draggable").options;
+		if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+		t.css('zIndex', o.zIndex);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data("draggable").options;
+		if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+	}
+});
+
+})(jQuery);
+/*
+ * jQuery UI Droppable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.droppable", {
+	widgetEventPrefix: "drop",
+	options: {
+		accept: '*',
+		activeClass: false,
+		addClasses: true,
+		greedy: false,
+		hoverClass: false,
+		scope: 'default',
+		tolerance: 'intersect'
+	},
+	_create: function() {
+
+		var o = this.options, accept = o.accept;
+		this.isover = 0; this.isout = 1;
+
+		this.accept = $.isFunction(accept) ? accept : function(d) {
+			return d.is(accept);
+		};
+
+		//Store the droppable's proportions
+		this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+		// Add the reference and positions to the manager
+		$.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+		$.ui.ddmanager.droppables[o.scope].push(this);
+
+		(o.addClasses && this.element.addClass("ui-droppable"));
+
+	},
+
+	destroy: function() {
+		var drop = $.ui.ddmanager.droppables[this.options.scope];
+		for ( var i = 0; i < drop.length; i++ )
+			if ( drop[i] == this )
+				drop.splice(i, 1);
+
+		this.element
+			.removeClass("ui-droppable ui-droppable-disabled")
+			.removeData("droppable")
+			.unbind(".droppable");
+
+		return this;
+	},
+
+	_setOption: function(key, value) {
+
+		if(key == 'accept') {
+			this.accept = $.isFunction(value) ? value : function(d) {
+				return d.is(value);
+			};
+		}
+		$.Widget.prototype._setOption.apply(this, arguments);
+	},
+
+	_activate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+		(draggable && this._trigger('activate', event, this.ui(draggable)));
+	},
+
+	_deactivate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+		(draggable && this._trigger('deactivate', event, this.ui(draggable)));
+	},
+
+	_over: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+			this._trigger('over', event, this.ui(draggable));
+		}
+
+	},
+
+	_out: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('out', event, this.ui(draggable));
+		}
+
+	},
+
+	_drop: function(event,custom) {
+
+		var draggable = custom || $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+		var childrenIntersection = false;
+		this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+			var inst = $.data(this, 'droppable');
+			if(
+				inst.options.greedy
+				&& !inst.options.disabled
+				&& inst.options.scope == draggable.options.scope
+				&& inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+				&& $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+			) { childrenIntersection = true; return false; }
+		});
+		if(childrenIntersection) return false;
+
+		if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('drop', event, this.ui(draggable));
+			return this.element;
+		}
+
+		return false;
+
+	},
+
+	ui: function(c) {
+		return {
+			draggable: (c.currentItem || c.element),
+			helper: c.helper,
+			position: c.position,
+			offset: c.positionAbs
+		};
+	}
+
+});
+
+$.extend($.ui.droppable, {
+	version: "1.8.11"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+	if (!droppable.offset) return false;
+
+	var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+		y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+	var l = droppable.offset.left, r = l + droppable.proportions.width,
+		t = droppable.offset.top, b = t + droppable.proportions.height;
+
+	switch (toleranceMode) {
+		case 'fit':
+			return (l <= x1 && x2 <= r
+				&& t <= y1 && y2 <= b);
+			break;
+		case 'intersect':
+			return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+				&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
+				&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+				&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+			break;
+		case 'pointer':
+			var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+				isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+			return isOver;
+			break;
+		case 'touch':
+			return (
+					(y1 >= t && y1 <= b) ||	// Top edge touching
+					(y2 >= t && y2 <= b) ||	// Bottom edge touching
+					(y1 < t && y2 > b)		// Surrounded vertically
+				) && (
+					(x1 >= l && x1 <= r) ||	// Left edge touching
+					(x2 >= l && x2 <= r) ||	// Right edge touching
+					(x1 < l && x2 > r)		// Surrounded horizontally
+				);
+			break;
+		default:
+			return false;
+			break;
+		}
+
+};
+
+/*
+	This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+	current: null,
+	droppables: { 'default': [] },
+	prepareOffsets: function(t, event) {
+
+		var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+		var type = event ? event.type : null; // workaround for #2317
+		var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+		droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+			if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue;	//No disabled and non-accepted
+			for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+			m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; 									//If the element is not visible, continue
+
+			if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+			m[i].offset = m[i].element.offset();
+			m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+		}
+
+	},
+	drop: function(draggable, event) {
+
+		var dropped = false;
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(!this.options) return;
+			if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+				dropped = dropped || this._drop.call(this, event);
+
+			if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+				this.isout = 1; this.isover = 0;
+				this._deactivate.call(this, event);
+			}
+
+		});
+		return dropped;
+
+	},
+	drag: function(draggable, event) {
+
+		//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+		if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+		//Run through all droppables and check their positions based on specific tolerance options
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(this.options.disabled || this.greedyChild || !this.visible) return;
+			var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+			var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+			if(!c) return;
+
+			var parentInstance;
+			if (this.options.greedy) {
+				var parent = this.element.parents(':data(droppable):eq(0)');
+				if (parent.length) {
+					parentInstance = $.data(parent[0], 'droppable');
+					parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+				}
+			}
+
+			// we just moved into a greedy child
+			if (parentInstance && c == 'isover') {
+				parentInstance['isover'] = 0;
+				parentInstance['isout'] = 1;
+				parentInstance._out.call(parentInstance, event);
+			}
+
+			this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+			this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+			// we just moved out of a greedy child
+			if (parentInstance && c == 'isout') {
+				parentInstance['isout'] = 0;
+				parentInstance['isover'] = 1;
+				parentInstance._over.call(parentInstance, event);
+			}
+		});
+
+	}
+};
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+	widgetEventPrefix: "resize",
+	options: {
+		alsoResize: false,
+		animate: false,
+		animateDuration: "slow",
+		animateEasing: "swing",
+		aspectRatio: false,
+		autoHide: false,
+		containment: false,
+		ghost: false,
+		grid: false,
+		handles: "e,s,se",
+		helper: false,
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 10,
+		minWidth: 10,
+		zIndex: 1000
+	},
+	_create: function() {
+
+		var self = this, o = this.options;
+		this.element.addClass("ui-resizable");
+
+		$.extend(this, {
+			_aspectRatio: !!(o.aspectRatio),
+			aspectRatio: o.aspectRatio,
+			originalElement: this.element,
+			_proportionallyResizeElements: [],
+			_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+		});
+
+		//Wrap the element if it cannot hold child nodes
+		if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+			//Opera fix for relative positioning
+			if (/relative/.test(this.element.css('position')) && $.browser.opera)
+				this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+			//Create a wrapper element and set the wrapper to the new current internal element
+			this.element.wrap(
+				$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+					position: this.element.css('position'),
+					width: this.element.outerWidth(),
+					height: this.element.outerHeight(),
+					top: this.element.css('top'),
+					left: this.element.css('left')
+				})
+			);
+
+			//Overwrite the original this.element
+			this.element = this.element.parent().data(
+				"resizable", this.element.data('resizable')
+			);
+
+			this.elementIsWrapper = true;
+
+			//Move margins to the wrapper
+			this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+			this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+			//Prevent Safari textarea resize
+			this.originalResizeStyle = this.originalElement.css('resize');
+			this.originalElement.css('resize', 'none');
+
+			//Push the actual element to our proportionallyResize internal array
+			this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+			// avoid IE jump (hard set the margin)
+			this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+			// fix handlers offset
+			this._proportionallyResize();
+
+		}
+
+		this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+		if(this.handles.constructor == String) {
+
+			if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+			var n = this.handles.split(","); this.handles = {};
+
+			for(var i = 0; i < n.length; i++) {
+
+				var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+				var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+				// increase zIndex of sw, se, ne, nw axis
+				//TODO : this modifies original option
+				if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+				//TODO : What's going on here?
+				if ('se' == handle) {
+					axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+				};
+
+				//Insert into internal handles object and append to element
+				this.handles[handle] = '.ui-resizable-'+handle;
+				this.element.append(axis);
+			}
+
+		}
+
+		this._renderAxis = function(target) {
+
+			target = target || this.element;
+
+			for(var i in this.handles) {
+
+				if(this.handles[i].constructor == String)
+					this.handles[i] = $(this.handles[i], this.element).show();
+
+				//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+				if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+					var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+					//Checking the correct pad and border
+					padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+					//The padding type i have to apply...
+					var padPos = [ 'padding',
+						/ne|nw|n/.test(i) ? 'Top' :
+						/se|sw|s/.test(i) ? 'Bottom' :
+						/^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+					target.css(padPos, padWrapper);
+
+					this._proportionallyResize();
+
+				}
+
+				//TODO: What's that good for? There's not anything to be executed left
+				if(!$(this.handles[i]).length)
+					continue;
+
+			}
+		};
+
+		//TODO: make renderAxis a prototype function
+		this._renderAxis(this.element);
+
+		this._handles = $('.ui-resizable-handle', this.element)
+			.disableSelection();
+
+		//Matching axis name
+		this._handles.mouseover(function() {
+			if (!self.resizing) {
+				if (this.className)
+					var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+				//Axis, default = se
+				self.axis = axis && axis[1] ? axis[1] : 'se';
+			}
+		});
+
+		//If we want to auto hide the elements
+		if (o.autoHide) {
+			this._handles.hide();
+			$(this.element)
+				.addClass("ui-resizable-autohide")
+				.hover(function() {
+					$(this).removeClass("ui-resizable-autohide");
+					self._handles.show();
+				},
+				function(){
+					if (!self.resizing) {
+						$(this).addClass("ui-resizable-autohide");
+						self._handles.hide();
+					}
+				});
+		}
+
+		//Initialize the mouse interaction
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+
+		this._mouseDestroy();
+
+		var _destroy = function(exp) {
+			$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+				.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+		};
+
+		//TODO: Unwrap at same DOM position
+		if (this.elementIsWrapper) {
+			_destroy(this.element);
+			var wrapper = this.element;
+			wrapper.after(
+				this.originalElement.css({
+					position: wrapper.css('position'),
+					width: wrapper.outerWidth(),
+					height: wrapper.outerHeight(),
+					top: wrapper.css('top'),
+					left: wrapper.css('left')
+				})
+			).remove();
+		}
+
+		this.originalElement.css('resize', this.originalResizeStyle);
+		_destroy(this.originalElement);
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+		var handle = false;
+		for (var i in this.handles) {
+			if ($(this.handles[i])[0] == event.target) {
+				handle = true;
+			}
+		}
+
+		return !this.options.disabled && handle;
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options, iniPos = this.element.position(), el = this.element;
+
+		this.resizing = true;
+		this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+		// bugfix for http://dev.jquery.com/ticket/1749
+		if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+			el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+		}
+
+		//Opera fixing relative position
+		if ($.browser.opera && (/relative/).test(el.css('position')))
+			el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+		this._renderProxy();
+
+		var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+		if (o.containment) {
+			curleft += $(o.containment).scrollLeft() || 0;
+			curtop += $(o.containment).scrollTop() || 0;
+		}
+
+		//Store needed variables
+		this.offset = this.helper.offset();
+		this.position = { left: curleft, top: curtop };
+		this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalPosition = { left: curleft, top: curtop };
+		this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+		this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+		//Aspect Ratio
+		this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+	    var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+	    $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+		el.addClass("ui-resizable-resizing");
+		this._propagate("start", event);
+		return true;
+	},
+
+	_mouseDrag: function(event) {
+
+		//Increase performance, avoid regex
+		var el = this.helper, o = this.options, props = {},
+			self = this, smp = this.originalMousePosition, a = this.axis;
+
+		var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+		var trigger = this._change[a];
+		if (!trigger) return false;
+
+		// Calculate the attrs that will be change
+		var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+		if (this._aspectRatio || event.shiftKey)
+			data = this._updateRatio(data, event);
+
+		data = this._respectSize(data, event);
+
+		// plugins callbacks need to be called first
+		this._propagate("resize", event);
+
+		el.css({
+			top: this.position.top + "px", left: this.position.left + "px",
+			width: this.size.width + "px", height: this.size.height + "px"
+		});
+
+		if (!this._helper && this._proportionallyResizeElements.length)
+			this._proportionallyResize();
+
+		this._updateCache(data);
+
+		// calling the user callback at the end
+		this._trigger('resize', event, this.ui());
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		this.resizing = false;
+		var o = this.options, self = this;
+
+		if(this._helper) {
+			var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+				soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+				soffsetw = ista ? 0 : self.sizeDiff.width;
+
+			var s = { width: (self.helper.width()  - soffsetw), height: (self.helper.height() - soffseth) },
+				left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+				top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+			if (!o.animate)
+				this.element.css($.extend(s, { top: top, left: left }));
+
+			self.helper.height(self.size.height);
+			self.helper.width(self.size.width);
+
+			if (this._helper && !o.animate) this._proportionallyResize();
+		}
+
+		$('body').css('cursor', 'auto');
+
+		this.element.removeClass("ui-resizable-resizing");
+
+		this._propagate("stop", event);
+
+		if (this._helper) this.helper.remove();
+		return false;
+
+	},
+
+	_updateCache: function(data) {
+		var o = this.options;
+		this.offset = this.helper.offset();
+		if (isNumber(data.left)) this.position.left = data.left;
+		if (isNumber(data.top)) this.position.top = data.top;
+		if (isNumber(data.height)) this.size.height = data.height;
+		if (isNumber(data.width)) this.size.width = data.width;
+	},
+
+	_updateRatio: function(data, event) {
+
+		var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+		if (data.height) data.width = (csize.height * this.aspectRatio);
+		else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+		if (a == 'sw') {
+			data.left = cpos.left + (csize.width - data.width);
+			data.top = null;
+		}
+		if (a == 'nw') {
+			data.top = cpos.top + (csize.height - data.height);
+			data.left = cpos.left + (csize.width - data.width);
+		}
+
+		return data;
+	},
+
+	_respectSize: function(data, event) {
+
+		var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+					isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+		if (isminw) data.width = o.minWidth;
+		if (isminh) data.height = o.minHeight;
+		if (ismaxw) data.width = o.maxWidth;
+		if (ismaxh) data.height = o.maxHeight;
+
+		var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+		var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+		if (isminw && cw) data.left = dw - o.minWidth;
+		if (ismaxw && cw) data.left = dw - o.maxWidth;
+		if (isminh && ch)	data.top = dh - o.minHeight;
+		if (ismaxh && ch)	data.top = dh - o.maxHeight;
+
+		// fixing jump error on top/left - bug #2330
+		var isNotwh = !data.width && !data.height;
+		if (isNotwh && !data.left && data.top) data.top = null;
+		else if (isNotwh && !data.top && data.left) data.left = null;
+
+		return data;
+	},
+
+	_proportionallyResize: function() {
+
+		var o = this.options;
+		if (!this._proportionallyResizeElements.length) return;
+		var element = this.helper || this.element;
+
+		for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+			var prel = this._proportionallyResizeElements[i];
+
+			if (!this.borderDif) {
+				var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+					p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+				this.borderDif = $.map(b, function(v, i) {
+					var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+					return border + padding;
+				});
+			}
+
+			if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+				continue;
+
+			prel.css({
+				height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+				width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+			});
+
+		};
+
+	},
+
+	_renderProxy: function() {
+
+		var el = this.element, o = this.options;
+		this.elementOffset = el.offset();
+
+		if(this._helper) {
+
+			this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+			// fix ie6 offset TODO: This seems broken
+			var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+			pxyoffset = ( ie6 ? 2 : -1 );
+
+			this.helper.addClass(this._helper).css({
+				width: this.element.outerWidth() + pxyoffset,
+				height: this.element.outerHeight() + pxyoffset,
+				position: 'absolute',
+				left: this.elementOffset.left - ie6offset +'px',
+				top: this.elementOffset.top - ie6offset +'px',
+				zIndex: ++o.zIndex //TODO: Don't modify option
+			});
+
+			this.helper
+				.appendTo("body")
+				.disableSelection();
+
+		} else {
+			this.helper = this.element;
+		}
+
+	},
+
+	_change: {
+		e: function(event, dx, dy) {
+			return { width: this.originalSize.width + dx };
+		},
+		w: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { left: sp.left + dx, width: cs.width - dx };
+		},
+		n: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { top: sp.top + dy, height: cs.height - dy };
+		},
+		s: function(event, dx, dy) {
+			return { height: this.originalSize.height + dy };
+		},
+		se: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		sw: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		},
+		ne: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		nw: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		}
+	},
+
+	_propagate: function(n, event) {
+		$.ui.plugin.call(this, n, [event, this.ui()]);
+		(n != "resize" && this._trigger(n, event, this.ui()));
+	},
+
+	plugins: {},
+
+	ui: function() {
+		return {
+			originalElement: this.originalElement,
+			element: this.element,
+			helper: this.helper,
+			position: this.position,
+			size: this.size,
+			originalSize: this.originalSize,
+			originalPosition: this.originalPosition
+		};
+	}
+
+});
+
+$.extend($.ui.resizable, {
+	version: "1.8.11"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+	start: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var _store = function (exp) {
+			$(exp).each(function() {
+				var el = $(this);
+				el.data("resizable-alsoresize", {
+					width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+					left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10),
+					position: el.css('position') // to reset Opera on stop()
+				});
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+			if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+			else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
+		}else{
+			_store(o.alsoResize);
+		}
+	},
+
+	resize: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+		var delta = {
+			height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+			top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+		},
+
+		_alsoResize = function (exp, c) {
+			$(exp).each(function() {
+				var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, 
+					css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
+
+				$.each(css, function (i, prop) {
+					var sum = (start[prop]||0) + (delta[prop]||0);
+					if (sum && sum >= 0)
+						style[prop] = sum || null;
+				});
+
+				// Opera fixing relative position
+				if ($.browser.opera && /relative/.test(el.css('position'))) {
+					self._revertToRelativePosition = true;
+					el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+				}
+
+				el.css(style);
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+			$.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
+		}else{
+			_alsoResize(o.alsoResize);
+		}
+	},
+
+	stop: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var _reset = function (exp) {
+			$(exp).each(function() {
+				var el = $(this);
+				// reset position for Opera - no need to verify it was changed
+				el.css({ position: el.data("resizable-alsoresize").position });
+			});
+		};
+
+		if (self._revertToRelativePosition) {
+			self._revertToRelativePosition = false;
+			if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+				$.each(o.alsoResize, function (exp) { _reset(exp); });
+			}else{
+				_reset(o.alsoResize);
+			}
+		}
+
+		$(this).removeData("resizable-alsoresize");
+	}
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+	stop: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+					soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+						soffsetw = ista ? 0 : self.sizeDiff.width;
+
+		var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+					left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+						top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+		self.element.animate(
+			$.extend(style, top && left ? { top: top, left: left } : {}), {
+				duration: o.animateDuration,
+				easing: o.animateEasing,
+				step: function() {
+
+					var data = {
+						width: parseInt(self.element.css('width'), 10),
+						height: parseInt(self.element.css('height'), 10),
+						top: parseInt(self.element.css('top'), 10),
+						left: parseInt(self.element.css('left'), 10)
+					};
+
+					if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+					// propagating resize, and updating values for each animation step
+					self._updateCache(data);
+					self._propagate("resize", event);
+
+				}
+			}
+		);
+	}
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+	start: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, el = self.element;
+		var oc = o.containment,	ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+		if (!ce) return;
+
+		self.containerElement = $(ce);
+
+		if (/document/.test(oc) || oc == document) {
+			self.containerOffset = { left: 0, top: 0 };
+			self.containerPosition = { left: 0, top: 0 };
+
+			self.parentData = {
+				element: $(document), left: 0, top: 0,
+				width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+			};
+		}
+
+		// i'm a node, so compute top, left, right, bottom
+		else {
+			var element = $(ce), p = [];
+			$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+			self.containerOffset = element.offset();
+			self.containerPosition = element.position();
+			self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+			var co = self.containerOffset, ch = self.containerSize.height,	cw = self.containerSize.width,
+						width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+			self.parentData = {
+				element: ce, left: co.left, top: co.top, width: width, height: height
+			};
+		}
+	},
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options,
+				ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+				pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+		if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+		if (cp.left < (self._helper ? co.left : 0)) {
+			self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+			if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+			self.position.left = o.helper ? co.left : 0;
+		}
+
+		if (cp.top < (self._helper ? co.top : 0)) {
+			self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+			if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+			self.position.top = self._helper ? co.top : 0;
+		}
+
+		self.offset.left = self.parentData.left+self.position.left;
+		self.offset.top = self.parentData.top+self.position.top;
+
+		var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+					hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+		var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+		    isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+		if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+		if (woset + self.size.width >= self.parentData.width) {
+			self.size.width = self.parentData.width - woset;
+			if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+		}
+
+		if (hoset + self.size.height >= self.parentData.height) {
+			self.size.height = self.parentData.height - hoset;
+			if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+		}
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options, cp = self.position,
+				co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+		var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+		if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+		if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+	}
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+	start: function(event, ui) {
+
+		var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+		self.ghost = self.originalElement.clone();
+		self.ghost
+			.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+			.addClass('ui-resizable-ghost')
+			.addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+		self.ghost.appendTo(self.helper);
+
+	},
+
+	resize: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+	}
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+		o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+		var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+		if (/^(se|s|e)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+		}
+		else if (/^(ne)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+		}
+		else if (/^(sw)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.left = op.left - ox;
+		}
+		else {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+			self.position.left = op.left - ox;
+		}
+	}
+
+});
+
+var num = function(v) {
+	return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+	return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+	options: {
+		appendTo: 'body',
+		autoRefresh: true,
+		distance: 0,
+		filter: '*',
+		tolerance: 'touch'
+	},
+	_create: function() {
+		var self = this;
+
+		this.element.addClass("ui-selectable");
+
+		this.dragged = false;
+
+		// cache selectee children based on filter
+		var selectees;
+		this.refresh = function() {
+			selectees = $(self.options.filter, self.element[0]);
+			selectees.each(function() {
+				var $this = $(this);
+				var pos = $this.offset();
+				$.data(this, "selectable-item", {
+					element: this,
+					$element: $this,
+					left: pos.left,
+					top: pos.top,
+					right: pos.left + $this.outerWidth(),
+					bottom: pos.top + $this.outerHeight(),
+					startselected: false,
+					selected: $this.hasClass('ui-selected'),
+					selecting: $this.hasClass('ui-selecting'),
+					unselecting: $this.hasClass('ui-unselecting')
+				});
+			});
+		};
+		this.refresh();
+
+		this.selectees = selectees.addClass("ui-selectee");
+
+		this._mouseInit();
+
+		this.helper = $("<div class='ui-selectable-helper'></div>");
+	},
+
+	destroy: function() {
+		this.selectees
+			.removeClass("ui-selectee")
+			.removeData("selectable-item");
+		this.element
+			.removeClass("ui-selectable ui-selectable-disabled")
+			.removeData("selectable")
+			.unbind(".selectable");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseStart: function(event) {
+		var self = this;
+
+		this.opos = [event.pageX, event.pageY];
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		this.selectees = $(options.filter, this.element[0]);
+
+		this._trigger("start", event);
+
+		$(options.appendTo).append(this.helper);
+		// position helper (lasso)
+		this.helper.css({
+			"left": event.clientX,
+			"top": event.clientY,
+			"width": 0,
+			"height": 0
+		});
+
+		if (options.autoRefresh) {
+			this.refresh();
+		}
+
+		this.selectees.filter('.ui-selected').each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.startselected = true;
+			if (!event.metaKey) {
+				selectee.$element.removeClass('ui-selected');
+				selectee.selected = false;
+				selectee.$element.addClass('ui-unselecting');
+				selectee.unselecting = true;
+				// selectable UNSELECTING callback
+				self._trigger("unselecting", event, {
+					unselecting: selectee.element
+				});
+			}
+		});
+
+		$(event.target).parents().andSelf().each(function() {
+			var selectee = $.data(this, "selectable-item");
+			if (selectee) {
+				var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected');
+				selectee.$element
+					.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+					.addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+				selectee.unselecting = !doSelect;
+				selectee.selecting = doSelect;
+				selectee.selected = doSelect;
+				// selectable (UN)SELECTING callback
+				if (doSelect) {
+					self._trigger("selecting", event, {
+						selecting: selectee.element
+					});
+				} else {
+					self._trigger("unselecting", event, {
+						unselecting: selectee.element
+					});
+				}
+				return false;
+			}
+		});
+
+	},
+
+	_mouseDrag: function(event) {
+		var self = this;
+		this.dragged = true;
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+		if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+		if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+		this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+		this.selectees.each(function() {
+			var selectee = $.data(this, "selectable-item");
+			//prevent helper from being selected if appendTo: selectable
+			if (!selectee || selectee.element == self.element[0])
+				return;
+			var hit = false;
+			if (options.tolerance == 'touch') {
+				hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+			} else if (options.tolerance == 'fit') {
+				hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+			}
+
+			if (hit) {
+				// SELECT
+				if (selectee.selected) {
+					selectee.$element.removeClass('ui-selected');
+					selectee.selected = false;
+				}
+				if (selectee.unselecting) {
+					selectee.$element.removeClass('ui-unselecting');
+					selectee.unselecting = false;
+				}
+				if (!selectee.selecting) {
+					selectee.$element.addClass('ui-selecting');
+					selectee.selecting = true;
+					// selectable SELECTING callback
+					self._trigger("selecting", event, {
+						selecting: selectee.element
+					});
+				}
+			} else {
+				// UNSELECT
+				if (selectee.selecting) {
+					if (event.metaKey && selectee.startselected) {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						selectee.$element.addClass('ui-selected');
+						selectee.selected = true;
+					} else {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						if (selectee.startselected) {
+							selectee.$element.addClass('ui-unselecting');
+							selectee.unselecting = true;
+						}
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+				if (selectee.selected) {
+					if (!event.metaKey && !selectee.startselected) {
+						selectee.$element.removeClass('ui-selected');
+						selectee.selected = false;
+
+						selectee.$element.addClass('ui-unselecting');
+						selectee.unselecting = true;
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+			}
+		});
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+		var self = this;
+
+		this.dragged = false;
+
+		var options = this.options;
+
+		$('.ui-unselecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-unselecting');
+			selectee.unselecting = false;
+			selectee.startselected = false;
+			self._trigger("unselected", event, {
+				unselected: selectee.element
+			});
+		});
+		$('.ui-selecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+			selectee.selecting = false;
+			selectee.selected = true;
+			selectee.startselected = true;
+			self._trigger("selected", event, {
+				selected: selectee.element
+			});
+		});
+		this._trigger("stop", event);
+
+		this.helper.remove();
+
+		return false;
+	}
+
+});
+
+$.extend($.ui.selectable, {
+	version: "1.8.11"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Sortable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+	widgetEventPrefix: "sort",
+	options: {
+		appendTo: "parent",
+		axis: false,
+		connectWith: false,
+		containment: false,
+		cursor: 'auto',
+		cursorAt: false,
+		dropOnEmpty: true,
+		forcePlaceholderSize: false,
+		forceHelperSize: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		items: '> *',
+		opacity: false,
+		placeholder: false,
+		revert: false,
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		scope: "default",
+		tolerance: "intersect",
+		zIndex: 1000
+	},
+	_create: function() {
+
+		var o = this.options;
+		this.containerCache = {};
+		this.element.addClass("ui-sortable");
+
+		//Get the items
+		this.refresh();
+
+		//Let's determine if the items are being displayed horizontally
+		this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
+
+		//Let's determine the parent's offset
+		this.offset = this.element.offset();
+
+		//Initialize mouse events for interaction
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass("ui-sortable ui-sortable-disabled")
+			.removeData("sortable")
+			.unbind(".sortable");
+		this._mouseDestroy();
+
+		for ( var i = this.items.length - 1; i >= 0; i-- )
+			this.items[i].item.removeData("sortable-item");
+
+		return this;
+	},
+
+	_setOption: function(key, value){
+		if ( key === "disabled" ) {
+			this.options[ key ] = value;
+	
+			this.widget()
+				[ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+		} else {
+			// Don't call widget base _setOption for disable as it adds ui-state-disabled class
+			$.Widget.prototype._setOption.apply(this, arguments);
+		}
+	},
+
+	_mouseCapture: function(event, overrideHandle) {
+
+		if (this.reverting) {
+			return false;
+		}
+
+		if(this.options.disabled || this.options.type == 'static') return false;
+
+		//We have to refresh the items data once first
+		this._refreshItems(event);
+
+		//Find out if the clicked node (or one of its parents) is a actual item in this.items
+		var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+			if($.data(this, 'sortable-item') == self) {
+				currentItem = $(this);
+				return false;
+			}
+		});
+		if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+		if(!currentItem) return false;
+		if(this.options.handle && !overrideHandle) {
+			var validHandle = false;
+
+			$(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+			if(!validHandle) return false;
+		}
+
+		this.currentItem = currentItem;
+		this._removeCurrentsFromItems();
+		return true;
+
+	},
+
+	_mouseStart: function(event, overrideHandle, noActivation) {
+
+		var o = this.options, self = this;
+		this.currentContainer = this;
+
+		//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+		this.refreshPositions();
+
+		//Create and append the visible helper
+		this.helper = this._createHelper(event);
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Get the next scrolling parent
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.currentItem.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		// Only after we got the offset, we can change the helper's position to absolute
+		// TODO: Still need to figure out a way to make relative sorting possible
+		this.helper.css("position", "absolute");
+		this.cssPosition = this.helper.css("position");
+
+		$.extend(this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+		});
+
+		//Generate the original position
+		this.originalPosition = this._generatePosition(event);
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+		//Cache the former DOM position
+		this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+		//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+		if(this.helper[0] != this.currentItem[0]) {
+			this.currentItem.hide();
+		}
+
+		//Create the placeholder
+		this._createPlaceholder();
+
+		//Set a containment if given in the options
+		if(o.containment)
+			this._setContainment();
+
+		if(o.cursor) { // cursor option
+			if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+			$('body').css("cursor", o.cursor);
+		}
+
+		if(o.opacity) { // opacity option
+			if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+			this.helper.css("opacity", o.opacity);
+		}
+
+		if(o.zIndex) { // zIndex option
+			if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+			this.helper.css("zIndex", o.zIndex);
+		}
+
+		//Prepare scrolling
+		if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+			this.overflowOffset = this.scrollParent.offset();
+
+		//Call callbacks
+		this._trigger("start", event, this._uiHash());
+
+		//Recache the helper size
+		if(!this._preserveHelperProportions)
+			this._cacheHelperProportions();
+
+
+		//Post 'activate' events to possible containers
+		if(!noActivation) {
+			 for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+		}
+
+		//Prepare possible droppables
+		if($.ui.ddmanager)
+			$.ui.ddmanager.current = this;
+
+		if ($.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(this, event);
+
+		this.dragging = true;
+
+		this.helper.addClass("ui-sortable-helper");
+		this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+		return true;
+
+	},
+
+	_mouseDrag: function(event) {
+
+		//Compute the helpers position
+		this.position = this._generatePosition(event);
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		if (!this.lastPositionAbs) {
+			this.lastPositionAbs = this.positionAbs;
+		}
+
+		//Do scrolling
+		if(this.options.scroll) {
+			var o = this.options, scrolled = false;
+			if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+				if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+				else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+				if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+				else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+			} else {
+
+				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+			}
+
+			if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+				$.ui.ddmanager.prepareOffsets(this, event);
+		}
+
+		//Regenerate the absolute position used for position checks
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		//Set the helper position
+		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+		//Rearrange
+		for (var i = this.items.length - 1; i >= 0; i--) {
+
+			//Cache variables and intersection, continue if no intersection
+			var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+			if (!intersection) continue;
+
+			if(itemElement != this.currentItem[0] //cannot intersect with itself
+				&&	this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+				&&	!$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+				&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+				//&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+			) {
+
+				this.direction = intersection == 1 ? "down" : "up";
+
+				if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+					this._rearrange(event, item);
+				} else {
+					break;
+				}
+
+				this._trigger("change", event, this._uiHash());
+				break;
+			}
+		}
+
+		//Post events to containers
+		this._contactContainers(event);
+
+		//Interconnect with droppables
+		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+		//Call callbacks
+		this._trigger('sort', event, this._uiHash());
+
+		this.lastPositionAbs = this.positionAbs;
+		return false;
+
+	},
+
+	_mouseStop: function(event, noPropagation) {
+
+		if(!event) return;
+
+		//If we are using droppables, inform the manager about the drop
+		if ($.ui.ddmanager && !this.options.dropBehaviour)
+			$.ui.ddmanager.drop(this, event);
+
+		if(this.options.revert) {
+			var self = this;
+			var cur = self.placeholder.offset();
+
+			self.reverting = true;
+
+			$(this.helper).animate({
+				left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+				top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+			}, parseInt(this.options.revert, 10) || 500, function() {
+				self._clear(event);
+			});
+		} else {
+			this._clear(event, noPropagation);
+		}
+
+		return false;
+
+	},
+
+	cancel: function() {
+
+		var self = this;
+
+		if(this.dragging) {
+
+			this._mouseUp({ target: null });
+
+			if(this.options.helper == "original")
+				this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+			else
+				this.currentItem.show();
+
+			//Post deactivating events to containers
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+				if(this.containers[i].containerCache.over) {
+					this.containers[i]._trigger("out", null, self._uiHash(this));
+					this.containers[i].containerCache.over = 0;
+				}
+			}
+
+		}
+
+		if (this.placeholder) {
+			//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+			if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+			if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+			$.extend(this, {
+				helper: null,
+				dragging: false,
+				reverting: false,
+				_noFinalSort: null
+			});
+
+			if(this.domPosition.prev) {
+				$(this.domPosition.prev).after(this.currentItem);
+			} else {
+				$(this.domPosition.parent).prepend(this.currentItem);
+			}
+		}
+
+		return this;
+
+	},
+
+	serialize: function(o) {
+
+		var items = this._getItemsAsjQuery(o && o.connected);
+		var str = []; o = o || {};
+
+		$(items).each(function() {
+			var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+			if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+		});
+
+		if(!str.length && o.key) {
+			str.push(o.key + '=');
+		}
+
+		return str.join('&');
+
+	},
+
+	toArray: function(o) {
+
+		var items = this._getItemsAsjQuery(o && o.connected);
+		var ret = []; o = o || {};
+
+		items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+		return ret;
+
+	},
+
+	/* Be careful with the following core functions */
+	_intersectsWith: function(item) {
+
+		var x1 = this.positionAbs.left,
+			x2 = x1 + this.helperProportions.width,
+			y1 = this.positionAbs.top,
+			y2 = y1 + this.helperProportions.height;
+
+		var l = item.left,
+			r = l + item.width,
+			t = item.top,
+			b = t + item.height;
+
+		var dyClick = this.offset.click.top,
+			dxClick = this.offset.click.left;
+
+		var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+		if(	   this.options.tolerance == "pointer"
+			|| this.options.forcePointerForContainers
+			|| (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+		) {
+			return isOverElement;
+		} else {
+
+			return (l < x1 + (this.helperProportions.width / 2) // Right Half
+				&& x2 - (this.helperProportions.width / 2) < r // Left Half
+				&& t < y1 + (this.helperProportions.height / 2) // Bottom Half
+				&& y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+		}
+	},
+
+	_intersectsWithPointer: function(item) {
+
+		var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+			isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+			isOverElement = isOverElementHeight && isOverElementWidth,
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if (!isOverElement)
+			return false;
+
+		return this.floating ?
+			( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+			: ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+	},
+
+	_intersectsWithSides: function(item) {
+
+		var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+			isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if (this.floating && horizontalDirection) {
+			return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+		} else {
+			return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+		}
+
+	},
+
+	_getDragVerticalDirection: function() {
+		var delta = this.positionAbs.top - this.lastPositionAbs.top;
+		return delta != 0 && (delta > 0 ? "down" : "up");
+	},
+
+	_getDragHorizontalDirection: function() {
+		var delta = this.positionAbs.left - this.lastPositionAbs.left;
+		return delta != 0 && (delta > 0 ? "right" : "left");
+	},
+
+	refresh: function(event) {
+		this._refreshItems(event);
+		this.refreshPositions();
+		return this;
+	},
+
+	_connectWith: function() {
+		var options = this.options;
+		return options.connectWith.constructor == String
+			? [options.connectWith]
+			: options.connectWith;
+	},
+	
+	_getItemsAsjQuery: function(connected) {
+
+		var self = this;
+		var items = [];
+		var queries = [];
+		var connectWith = this._connectWith();
+
+		if(connectWith && connected) {
+			for (var i = connectWith.length - 1; i >= 0; i--){
+				var cur = $(connectWith[i]);
+				for (var j = cur.length - 1; j >= 0; j--){
+					var inst = $.data(cur[j], 'sortable');
+					if(inst && inst != this && !inst.options.disabled) {
+						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+					}
+				};
+			};
+		}
+
+		queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+		for (var i = queries.length - 1; i >= 0; i--){
+			queries[i][0].each(function() {
+				items.push(this);
+			});
+		};
+
+		return $(items);
+
+	},
+
+	_removeCurrentsFromItems: function() {
+
+		var list = this.currentItem.find(":data(sortable-item)");
+
+		for (var i=0; i < this.items.length; i++) {
+
+			for (var j=0; j < list.length; j++) {
+				if(list[j] == this.items[i].item[0])
+					this.items.splice(i,1);
+			};
+
+		};
+
+	},
+
+	_refreshItems: function(event) {
+
+		this.items = [];
+		this.containers = [this];
+		var items = this.items;
+		var self = this;
+		var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+		var connectWith = this._connectWith();
+
+		if(connectWith) {
+			for (var i = connectWith.length - 1; i >= 0; i--){
+				var cur = $(connectWith[i]);
+				for (var j = cur.length - 1; j >= 0; j--){
+					var inst = $.data(cur[j], 'sortable');
+					if(inst && inst != this && !inst.options.disabled) {
+						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+						this.containers.push(inst);
+					}
+				};
+			};
+		}
+
+		for (var i = queries.length - 1; i >= 0; i--) {
+			var targetData = queries[i][1];
+			var _queries = queries[i][0];
+
+			for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+				var item = $(_queries[j]);
+
+				item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+				items.push({
+					item: item,
+					instance: targetData,
+					width: 0, height: 0,
+					left: 0, top: 0
+				});
+			};
+		};
+
+	},
+
+	refreshPositions: function(fast) {
+
+		//This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+		if(this.offsetParent && this.helper) {
+			this.offset.parent = this._getParentOffset();
+		}
+
+		for (var i = this.items.length - 1; i >= 0; i--){
+			var item = this.items[i];
+
+			var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+			if (!fast) {
+				item.width = t.outerWidth();
+				item.height = t.outerHeight();
+			}
+
+			var p = t.offset();
+			item.left = p.left;
+			item.top = p.top;
+		};
+
+		if(this.options.custom && this.options.custom.refreshContainers) {
+			this.options.custom.refreshContainers.call(this);
+		} else {
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				var p = this.containers[i].element.offset();
+				this.containers[i].containerCache.left = p.left;
+				this.containers[i].containerCache.top = p.top;
+				this.containers[i].containerCache.width	= this.containers[i].element.outerWidth();
+				this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+			};
+		}
+
+		return this;
+	},
+
+	_createPlaceholder: function(that) {
+
+		var self = that || this, o = self.options;
+
+		if(!o.placeholder || o.placeholder.constructor == String) {
+			var className = o.placeholder;
+			o.placeholder = {
+				element: function() {
+
+					var el = $(document.createElement(self.currentItem[0].nodeName))
+						.addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+						.removeClass("ui-sortable-helper")[0];
+
+					if(!className)
+						el.style.visibility = "hidden";
+
+					return el;
+				},
+				update: function(container, p) {
+
+					// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+					if(className && !o.forcePlaceholderSize) return;
+
+					//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+					if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+					if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+				}
+			};
+		}
+
+		//Create the placeholder
+		self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+		//Append it after the actual current item
+		self.currentItem.after(self.placeholder);
+
+		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+		o.placeholder.update(self, self.placeholder);
+
+	},
+
+	_contactContainers: function(event) {
+		
+		// get innermost container that intersects with item 
+		var innermostContainer = null, innermostIndex = null;		
+		
+		
+		for (var i = this.containers.length - 1; i >= 0; i--){
+
+			// never consider a container that's located within the item itself 
+			if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+				continue;
+
+			if(this._intersectsWith(this.containers[i].containerCache)) {
+
+				// if we've already found a container and it's more "inner" than this, then continue 
+				if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+					continue;
+
+				innermostContainer = this.containers[i]; 
+				innermostIndex = i;
+					
+			} else {
+				// container doesn't intersect. trigger "out" event if necessary 
+				if(this.containers[i].containerCache.over) {
+					this.containers[i]._trigger("out", event, this._uiHash(this));
+					this.containers[i].containerCache.over = 0;
+				}
+			}
+
+		}
+		
+		// if no intersecting containers found, return 
+		if(!innermostContainer) return; 
+
+		// move the item into the container if it's not there already
+		if(this.containers.length === 1) {
+			this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+			this.containers[innermostIndex].containerCache.over = 1;
+		} else if(this.currentContainer != this.containers[innermostIndex]) { 
+
+			//When entering a new container, we will find the item with the least distance and append our item near it 
+			var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; 
+			for (var j = this.items.length - 1; j >= 0; j--) { 
+				if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; 
+				var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; 
+				if(Math.abs(cur - base) < dist) { 
+					dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; 
+				} 
+			} 
+
+			if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled 
+				return; 
+
+			this.currentContainer = this.containers[innermostIndex]; 
+			itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); 
+			this._trigger("change", event, this._uiHash()); 
+			this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); 
+
+			//Update the placeholder 
+			this.options.placeholder.update(this.currentContainer, this.placeholder); 
+		
+			this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); 
+			this.containers[innermostIndex].containerCache.over = 1;
+		} 
+	
+		
+	},
+
+	_createHelper: function(event) {
+
+		var o = this.options;
+		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+		if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+			$(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+		if(helper[0] == this.currentItem[0])
+			this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+		if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+		if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function(obj) {
+		if (typeof obj == 'string') {
+			obj = obj.split(' ');
+		}
+		if ($.isArray(obj)) {
+			obj = {left: +obj[0], top: +obj[1] || 0};
+		}
+		if ('left' in obj) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ('right' in obj) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ('top' in obj) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ('bottom' in obj) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+			po = { top: 0, left: 0 };
+
+		return {
+			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if(this.cssPosition == "relative") {
+			var p = this.currentItem.position();
+			return {
+				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+			top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var o = this.options;
+		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+		if(o.containment == 'document' || o.containment == 'window') this.containment = [
+			0 - this.offset.relative.left - this.offset.parent.left,
+			0 - this.offset.relative.top - this.offset.parent.top,
+			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+		];
+
+		if(!(/^(document|window|parent)$/).test(o.containment)) {
+			var ce = $(o.containment)[0];
+			var co = $(o.containment).offset();
+			var over = ($(ce).css("overflow") != 'hidden');
+
+			this.containment = [
+				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+			];
+		}
+
+	},
+
+	_convertPositionTo: function(d, pos) {
+
+		if(!pos) pos = this.position;
+		var mod = d == "absolute" ? 1 : -1;
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		return {
+			top: (
+				pos.top																	// The absolute mouse position
+				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+			),
+			left: (
+				pos.left																// The absolute mouse position
+				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+			)
+		};
+
+	},
+
+	_generatePosition: function(event) {
+
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		// This is another very weird special case that only happens for relative elements:
+		// 1. If the css position is relative
+		// 2. and the scroll parent is the document or similar to the offset parent
+		// we have to refresh the relative offset during the scroll so there are no jumps
+		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+			this.offset.relative = this._getRelativeOffset();
+		}
+
+		var pageX = event.pageX;
+		var pageY = event.pageY;
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+			if(this.containment) {
+				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+			}
+
+			if(o.grid) {
+				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+			}
+
+		}
+
+		return {
+			top: (
+				pageY																// The absolute mouse position
+				- this.offset.click.top													// Click offset (relative to the element)
+				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+			),
+			left: (
+				pageX																// The absolute mouse position
+				- this.offset.click.left												// Click offset (relative to the element)
+				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+			)
+		};
+
+	},
+
+	_rearrange: function(event, i, a, hardRefresh) {
+
+		a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+		//Various things done here to improve the performance:
+		// 1. we create a setTimeout, that calls refreshPositions
+		// 2. on the instance, we have a counter variable, that get's higher after every append
+		// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+		// 4. this lets only the last addition to the timeout stack through
+		this.counter = this.counter ? ++this.counter : 1;
+		var self = this, counter = this.counter;
+
+		window.setTimeout(function() {
+			if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+		},0);
+
+	},
+
+	_clear: function(event, noPropagation) {
+
+		this.reverting = false;
+		// We delay all events that have to be triggered to after the point where the placeholder has been removed and
+		// everything else normalized again
+		var delayedTriggers = [], self = this;
+
+		// We first have to update the dom position of the actual currentItem
+		// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+		if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+		this._noFinalSort = null;
+
+		if(this.helper[0] == this.currentItem[0]) {
+			for(var i in this._storedCSS) {
+				if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+			}
+			this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+		} else {
+			this.currentItem.show();
+		}
+
+		if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+		if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+		if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+			if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+					delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+					delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this));  }; }).call(this, this.containers[i]));
+				}
+			};
+		};
+
+		//Post events to containers
+		for (var i = this.containers.length - 1; i >= 0; i--){
+			if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+			if(this.containers[i].containerCache.over) {
+				delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+				this.containers[i].containerCache.over = 0;
+			}
+		}
+
+		//Do what was originally in plugins
+		if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+		if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+		if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+		this.dragging = false;
+		if(this.cancelHelperRemoval) {
+			if(!noPropagation) {
+				this._trigger("beforeStop", event, this._uiHash());
+				for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+				this._trigger("stop", event, this._uiHash());
+			}
+			return false;
+		}
+
+		if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+		this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+		if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+		if(!noPropagation) {
+			for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+			this._trigger("stop", event, this._uiHash());
+		}
+
+		this.fromOutside = false;
+		return true;
+
+	},
+
+	_trigger: function() {
+		if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+			this.cancel();
+		}
+	},
+
+	_uiHash: function(inst) {
+		var self = inst || this;
+		return {
+			helper: self.helper,
+			placeholder: self.placeholder || $([]),
+			position: self.position,
+			originalPosition: self.originalPosition,
+			offset: self.positionAbs,
+			item: self.currentItem,
+			sender: inst ? inst.element : null
+		};
+	}
+
+});
+
+$.extend($.ui.sortable, {
+	version: "1.8.11"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.accordion", {
+	options: {
+		active: 0,
+		animated: "slide",
+		autoHeight: true,
+		clearStyle: false,
+		collapsible: false,
+		event: "click",
+		fillSpace: false,
+		header: "> li > :first-child,> :not(li):even",
+		icons: {
+			header: "ui-icon-triangle-1-e",
+			headerSelected: "ui-icon-triangle-1-s"
+		},
+		navigation: false,
+		navigationFilter: function() {
+			return this.href.toLowerCase() === location.href.toLowerCase();
+		}
+	},
+
+	_create: function() {
+		var self = this,
+			options = self.options;
+
+		self.running = 0;
+
+		self.element
+			.addClass( "ui-accordion ui-widget ui-helper-reset" )
+			// in lack of child-selectors in CSS
+			// we need to mark top-LIs in a UL-accordion for some IE-fix
+			.children( "li" )
+				.addClass( "ui-accordion-li-fix" );
+
+		self.headers = self.element.find( options.header )
+			.addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
+			.bind( "mouseenter.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-hover" );
+			})
+			.bind( "mouseleave.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( "ui-state-hover" );
+			})
+			.bind( "focus.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-focus" );
+			})
+			.bind( "blur.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( "ui-state-focus" );
+			});
+
+		self.headers.next()
+			.addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
+
+		if ( options.navigation ) {
+			var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
+			if ( current.length ) {
+				var header = current.closest( ".ui-accordion-header" );
+				if ( header.length ) {
+					// anchor within header
+					self.active = header;
+				} else {
+					// anchor within content
+					self.active = current.closest( ".ui-accordion-content" ).prev();
+				}
+			}
+		}
+
+		self.active = self._findActive( self.active || options.active )
+			.addClass( "ui-state-default ui-state-active" )
+			.toggleClass( "ui-corner-all" )
+			.toggleClass( "ui-corner-top" );
+		self.active.next().addClass( "ui-accordion-content-active" );
+
+		self._createIcons();
+		self.resize();
+		
+		// ARIA
+		self.element.attr( "role", "tablist" );
+
+		self.headers
+			.attr( "role", "tab" )
+			.bind( "keydown.accordion", function( event ) {
+				return self._keydown( event );
+			})
+			.next()
+				.attr( "role", "tabpanel" );
+
+		self.headers
+			.not( self.active || "" )
+			.attr({
+				"aria-expanded": "false",
+				"aria-selected": "false",
+				tabIndex: -1
+			})
+			.next()
+				.hide();
+
+		// make sure at least one header is in the tab order
+		if ( !self.active.length ) {
+			self.headers.eq( 0 ).attr( "tabIndex", 0 );
+		} else {
+			self.active
+				.attr({
+					"aria-expanded": "true",
+					"aria-selected": "true",
+					tabIndex: 0
+				});
+		}
+
+		// only need links in tab order for Safari
+		if ( !$.browser.safari ) {
+			self.headers.find( "a" ).attr( "tabIndex", -1 );
+		}
+
+		if ( options.event ) {
+			self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
+				self._clickHandler.call( self, event, this );
+				event.preventDefault();
+			});
+		}
+	},
+
+	_createIcons: function() {
+		var options = this.options;
+		if ( options.icons ) {
+			$( "<span></span>" )
+				.addClass( "ui-icon " + options.icons.header )
+				.prependTo( this.headers );
+			this.active.children( ".ui-icon" )
+				.toggleClass(options.icons.header)
+				.toggleClass(options.icons.headerSelected);
+			this.element.addClass( "ui-accordion-icons" );
+		}
+	},
+
+	_destroyIcons: function() {
+		this.headers.children( ".ui-icon" ).remove();
+		this.element.removeClass( "ui-accordion-icons" );
+	},
+
+	destroy: function() {
+		var options = this.options;
+
+		this.element
+			.removeClass( "ui-accordion ui-widget ui-helper-reset" )
+			.removeAttr( "role" );
+
+		this.headers
+			.unbind( ".accordion" )
+			.removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+			.removeAttr( "role" )
+			.removeAttr( "aria-expanded" )
+			.removeAttr( "aria-selected" )
+			.removeAttr( "tabIndex" );
+
+		this.headers.find( "a" ).removeAttr( "tabIndex" );
+		this._destroyIcons();
+		var contents = this.headers.next()
+			.css( "display", "" )
+			.removeAttr( "role" )
+			.removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
+		if ( options.autoHeight || options.fillHeight ) {
+			contents.css( "height", "" );
+		}
+
+		return $.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+			
+		if ( key == "active" ) {
+			this.activate( value );
+		}
+		if ( key == "icons" ) {
+			this._destroyIcons();
+			if ( value ) {
+				this._createIcons();
+			}
+		}
+		// #5332 - opacity doesn't cascade to positioned elements in IE
+		// so we need to add the disabled class to the headers and panels
+		if ( key == "disabled" ) {
+			this.headers.add(this.headers.next())
+				[ value ? "addClass" : "removeClass" ](
+					"ui-accordion-disabled ui-state-disabled" );
+		}
+	},
+
+	_keydown: function( event ) {
+		if ( this.options.disabled || event.altKey || event.ctrlKey ) {
+			return;
+		}
+
+		var keyCode = $.ui.keyCode,
+			length = this.headers.length,
+			currentIndex = this.headers.index( event.target ),
+			toFocus = false;
+
+		switch ( event.keyCode ) {
+			case keyCode.RIGHT:
+			case keyCode.DOWN:
+				toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+				break;
+			case keyCode.LEFT:
+			case keyCode.UP:
+				toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+				break;
+			case keyCode.SPACE:
+			case keyCode.ENTER:
+				this._clickHandler( { target: event.target }, event.target );
+				event.preventDefault();
+		}
+
+		if ( toFocus ) {
+			$( event.target ).attr( "tabIndex", -1 );
+			$( toFocus ).attr( "tabIndex", 0 );
+			toFocus.focus();
+			return false;
+		}
+
+		return true;
+	},
+
+	resize: function() {
+		var options = this.options,
+			maxHeight;
+
+		if ( options.fillSpace ) {
+			if ( $.browser.msie ) {
+				var defOverflow = this.element.parent().css( "overflow" );
+				this.element.parent().css( "overflow", "hidden");
+			}
+			maxHeight = this.element.parent().height();
+			if ($.browser.msie) {
+				this.element.parent().css( "overflow", defOverflow );
+			}
+
+			this.headers.each(function() {
+				maxHeight -= $( this ).outerHeight( true );
+			});
+
+			this.headers.next()
+				.each(function() {
+					$( this ).height( Math.max( 0, maxHeight -
+						$( this ).innerHeight() + $( this ).height() ) );
+				})
+				.css( "overflow", "auto" );
+		} else if ( options.autoHeight ) {
+			maxHeight = 0;
+			this.headers.next()
+				.each(function() {
+					maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+				})
+				.height( maxHeight );
+		}
+
+		return this;
+	},
+
+	activate: function( index ) {
+		// TODO this gets called on init, changing the option without an explicit call for that
+		this.options.active = index;
+		// call clickHandler with custom event
+		var active = this._findActive( index )[ 0 ];
+		this._clickHandler( { target: active }, active );
+
+		return this;
+	},
+
+	_findActive: function( selector ) {
+		return selector
+			? typeof selector === "number"
+				? this.headers.filter( ":eq(" + selector + ")" )
+				: this.headers.not( this.headers.not( selector ) )
+			: selector === false
+				? $( [] )
+				: this.headers.filter( ":eq(0)" );
+	},
+
+	// TODO isn't event.target enough? why the separate target argument?
+	_clickHandler: function( event, target ) {
+		var options = this.options;
+		if ( options.disabled ) {
+			return;
+		}
+
+		// called only when using activate(false) to close all parts programmatically
+		if ( !event.target ) {
+			if ( !options.collapsible ) {
+				return;
+			}
+			this.active
+				.removeClass( "ui-state-active ui-corner-top" )
+				.addClass( "ui-state-default ui-corner-all" )
+				.children( ".ui-icon" )
+					.removeClass( options.icons.headerSelected )
+					.addClass( options.icons.header );
+			this.active.next().addClass( "ui-accordion-content-active" );
+			var toHide = this.active.next(),
+				data = {
+					options: options,
+					newHeader: $( [] ),
+					oldHeader: options.active,
+					newContent: $( [] ),
+					oldContent: toHide
+				},
+				toShow = ( this.active = $( [] ) );
+			this._toggle( toShow, toHide, data );
+			return;
+		}
+
+		// get the click target
+		var clicked = $( event.currentTarget || target ),
+			clickedIsActive = clicked[0] === this.active[0];
+
+		// TODO the option is changed, is that correct?
+		// TODO if it is correct, shouldn't that happen after determining that the click is valid?
+		options.active = options.collapsible && clickedIsActive ?
+			false :
+			this.headers.index( clicked );
+
+		// if animations are still active, or the active header is the target, ignore click
+		if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+			return;
+		}
+
+		// find elements to show and hide
+		var active = this.active,
+			toShow = clicked.next(),
+			toHide = this.active.next(),
+			data = {
+				options: options,
+				newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
+				oldHeader: this.active,
+				newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
+				oldContent: toHide
+			},
+			down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+		// when the call to ._toggle() comes after the class changes
+		// it causes a very odd bug in IE 8 (see #6720)
+		this.active = clickedIsActive ? $([]) : clicked;
+		this._toggle( toShow, toHide, data, clickedIsActive, down );
+
+		// switch classes
+		active
+			.removeClass( "ui-state-active ui-corner-top" )
+			.addClass( "ui-state-default ui-corner-all" )
+			.children( ".ui-icon" )
+				.removeClass( options.icons.headerSelected )
+				.addClass( options.icons.header );
+		if ( !clickedIsActive ) {
+			clicked
+				.removeClass( "ui-state-default ui-corner-all" )
+				.addClass( "ui-state-active ui-corner-top" )
+				.children( ".ui-icon" )
+					.removeClass( options.icons.header )
+					.addClass( options.icons.headerSelected );
+			clicked
+				.next()
+				.addClass( "ui-accordion-content-active" );
+		}
+
+		return;
+	},
+
+	_toggle: function( toShow, toHide, data, clickedIsActive, down ) {
+		var self = this,
+			options = self.options;
+
+		self.toShow = toShow;
+		self.toHide = toHide;
+		self.data = data;
+
+		var complete = function() {
+			if ( !self ) {
+				return;
+			}
+			return self._completed.apply( self, arguments );
+		};
+
+		// trigger changestart event
+		self._trigger( "changestart", null, self.data );
+
+		// count elements to animate
+		self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+		if ( options.animated ) {
+			var animOptions = {};
+
+			if ( options.collapsible && clickedIsActive ) {
+				animOptions = {
+					toShow: $( [] ),
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: options.autoHeight || options.fillSpace
+				};
+			} else {
+				animOptions = {
+					toShow: toShow,
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: options.autoHeight || options.fillSpace
+				};
+			}
+
+			if ( !options.proxied ) {
+				options.proxied = options.animated;
+			}
+
+			if ( !options.proxiedDuration ) {
+				options.proxiedDuration = options.duration;
+			}
+
+			options.animated = $.isFunction( options.proxied ) ?
+				options.proxied( animOptions ) :
+				options.proxied;
+
+			options.duration = $.isFunction( options.proxiedDuration ) ?
+				options.proxiedDuration( animOptions ) :
+				options.proxiedDuration;
+
+			var animations = $.ui.accordion.animations,
+				duration = options.duration,
+				easing = options.animated;
+
+			if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
+				easing = "slide";
+			}
+			if ( !animations[ easing ] ) {
+				animations[ easing ] = function( options ) {
+					this.slide( options, {
+						easing: easing,
+						duration: duration || 700
+					});
+				};
+			}
+
+			animations[ easing ]( animOptions );
+		} else {
+			if ( options.collapsible && clickedIsActive ) {
+				toShow.toggle();
+			} else {
+				toHide.hide();
+				toShow.show();
+			}
+
+			complete( true );
+		}
+
+		// TODO assert that the blur and focus triggers are really necessary, remove otherwise
+		toHide.prev()
+			.attr({
+				"aria-expanded": "false",
+				"aria-selected": "false",
+				tabIndex: -1
+			})
+			.blur();
+		toShow.prev()
+			.attr({
+				"aria-expanded": "true",
+				"aria-selected": "true",
+				tabIndex: 0
+			})
+			.focus();
+	},
+
+	_completed: function( cancel ) {
+		this.running = cancel ? 0 : --this.running;
+		if ( this.running ) {
+			return;
+		}
+
+		if ( this.options.clearStyle ) {
+			this.toShow.add( this.toHide ).css({
+				height: "",
+				overflow: ""
+			});
+		}
+
+		// other classes are removed before the animation; this one needs to stay until completed
+		this.toHide.removeClass( "ui-accordion-content-active" );
+		// Work around for rendering bug in IE (#5421)
+		if ( this.toHide.length ) {
+			this.toHide.parent()[0].className = this.toHide.parent()[0].className;
+		}
+
+		this._trigger( "change", null, this.data );
+	}
+});
+
+$.extend( $.ui.accordion, {
+	version: "1.8.11",
+	animations: {
+		slide: function( options, additions ) {
+			options = $.extend({
+				easing: "swing",
+				duration: 300
+			}, options, additions );
+			if ( !options.toHide.size() ) {
+				options.toShow.animate({
+					height: "show",
+					paddingTop: "show",
+					paddingBottom: "show"
+				}, options );
+				return;
+			}
+			if ( !options.toShow.size() ) {
+				options.toHide.animate({
+					height: "hide",
+					paddingTop: "hide",
+					paddingBottom: "hide"
+				}, options );
+				return;
+			}
+			var overflow = options.toShow.css( "overflow" ),
+				percentDone = 0,
+				showProps = {},
+				hideProps = {},
+				fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+				originalWidth;
+			// fix width before calculating height of hidden element
+			var s = options.toShow;
+			originalWidth = s[0].style.width;
+			s.width( parseInt( s.parent().width(), 10 )
+				- parseInt( s.css( "paddingLeft" ), 10 )
+				- parseInt( s.css( "paddingRight" ), 10 )
+				- ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 )
+				- ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) );
+
+			$.each( fxAttrs, function( i, prop ) {
+				hideProps[ prop ] = "hide";
+
+				var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
+				showProps[ prop ] = {
+					value: parts[ 1 ],
+					unit: parts[ 2 ] || "px"
+				};
+			});
+			options.toShow.css({ height: 0, overflow: "hidden" }).show();
+			options.toHide
+				.filter( ":hidden" )
+					.each( options.complete )
+				.end()
+				.filter( ":visible" )
+				.animate( hideProps, {
+				step: function( now, settings ) {
+					// only calculate the percent when animating height
+					// IE gets very inconsistent results when animating elements
+					// with small values, which is common for padding
+					if ( settings.prop == "height" ) {
+						percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+							( settings.now - settings.start ) / ( settings.end - settings.start );
+					}
+
+					options.toShow[ 0 ].style[ settings.prop ] =
+						( percentDone * showProps[ settings.prop ].value )
+						+ showProps[ settings.prop ].unit;
+				},
+				duration: options.duration,
+				easing: options.easing,
+				complete: function() {
+					if ( !options.autoHeight ) {
+						options.toShow.css( "height", "" );
+					}
+					options.toShow.css({
+						width: originalWidth,
+						overflow: overflow
+					});
+					options.complete();
+				}
+			});
+		},
+		bounceslide: function( options ) {
+			this.slide( options, {
+				easing: options.down ? "easeOutBounce" : "swing",
+				duration: options.down ? 1000 : 200
+			});
+		}
+	}
+});
+
+})( jQuery );
+/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function( $, undefined ) {
+
+// used to prevent race conditions with remote data sources
+var requestIndex = 0;
+
+$.widget( "ui.autocomplete", {
+	options: {
+		appendTo: "body",
+		autoFocus: false,
+		delay: 300,
+		minLength: 1,
+		position: {
+			my: "left top",
+			at: "left bottom",
+			collision: "none"
+		},
+		source: null
+	},
+
+	pending: 0,
+
+	_create: function() {
+		var self = this,
+			doc = this.element[ 0 ].ownerDocument,
+			suppressKeyPress;
+
+		this.element
+			.addClass( "ui-autocomplete-input" )
+			.attr( "autocomplete", "off" )
+			// TODO verify these actually work as intended
+			.attr({
+				role: "textbox",
+				"aria-autocomplete": "list",
+				"aria-haspopup": "true"
+			})
+			.bind( "keydown.autocomplete", function( event ) {
+				if ( self.options.disabled || self.element.attr( "readonly" ) ) {
+					return;
+				}
+
+				suppressKeyPress = false;
+				var keyCode = $.ui.keyCode;
+				switch( event.keyCode ) {
+				case keyCode.PAGE_UP:
+					self._move( "previousPage", event );
+					break;
+				case keyCode.PAGE_DOWN:
+					self._move( "nextPage", event );
+					break;
+				case keyCode.UP:
+					self._move( "previous", event );
+					// prevent moving cursor to beginning of text field in some browsers
+					event.preventDefault();
+					break;
+				case keyCode.DOWN:
+					self._move( "next", event );
+					// prevent moving cursor to end of text field in some browsers
+					event.preventDefault();
+					break;
+				case keyCode.ENTER:
+				case keyCode.NUMPAD_ENTER:
+					// when menu is open and has focus
+					if ( self.menu.active ) {
+						// #6055 - Opera still allows the keypress to occur
+						// which causes forms to submit
+						suppressKeyPress = true;
+						event.preventDefault();
+					}
+					//passthrough - ENTER and TAB both select the current element
+				case keyCode.TAB:
+					if ( !self.menu.active ) {
+						return;
+					}
+					self.menu.select( event );
+					break;
+				case keyCode.ESCAPE:
+					self.element.val( self.term );
+					self.close( event );
+					break;
+				default:
+					// keypress is triggered before the input value is changed
+					clearTimeout( self.searching );
+					self.searching = setTimeout(function() {
+						// only search if the value has changed
+						if ( self.term != self.element.val() ) {
+							self.selectedItem = null;
+							self.search( null, event );
+						}
+					}, self.options.delay );
+					break;
+				}
+			})
+			.bind( "keypress.autocomplete", function( event ) {
+				if ( suppressKeyPress ) {
+					suppressKeyPress = false;
+					event.preventDefault();
+				}
+			})
+			.bind( "focus.autocomplete", function() {
+				if ( self.options.disabled ) {
+					return;
+				}
+
+				self.selectedItem = null;
+				self.previous = self.element.val();
+			})
+			.bind( "blur.autocomplete", function( event ) {
+				if ( self.options.disabled ) {
+					return;
+				}
+
+				clearTimeout( self.searching );
+				// clicks on the menu (or a button to trigger a search) will cause a blur event
+				self.closing = setTimeout(function() {
+					self.close( event );
+					self._change( event );
+				}, 150 );
+			});
+		this._initSource();
+		this.response = function() {
+			return self._response.apply( self, arguments );
+		};
+		this.menu = $( "<ul></ul>" )
+			.addClass( "ui-autocomplete" )
+			.appendTo( $( this.options.appendTo || "body", doc )[0] )
+			// prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
+			.mousedown(function( event ) {
+				// clicking on the scrollbar causes focus to shift to the body
+				// but we can't detect a mouseup or a click immediately afterward
+				// so we have to track the next mousedown and close the menu if
+				// the user clicks somewhere outside of the autocomplete
+				var menuElement = self.menu.element[ 0 ];
+				if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
+					setTimeout(function() {
+						$( document ).one( 'mousedown', function( event ) {
+							if ( event.target !== self.element[ 0 ] &&
+								event.target !== menuElement &&
+								!$.ui.contains( menuElement, event.target ) ) {
+								self.close();
+							}
+						});
+					}, 1 );
+				}
+
+				// use another timeout to make sure the blur-event-handler on the input was already triggered
+				setTimeout(function() {
+					clearTimeout( self.closing );
+				}, 13);
+			})
+			.menu({
+				focus: function( event, ui ) {
+					var item = ui.item.data( "item.autocomplete" );
+					if ( false !== self._trigger( "focus", event, { item: item } ) ) {
+						// use value to match what will end up in the input, if it was a key event
+						if ( /^key/.test(event.originalEvent.type) ) {
+							self.element.val( item.value );
+						}
+					}
+				},
+				selected: function( event, ui ) {
+					var item = ui.item.data( "item.autocomplete" ),
+						previous = self.previous;
+
+					// only trigger when focus was lost (click on menu)
+					if ( self.element[0] !== doc.activeElement ) {
+						self.element.focus();
+						self.previous = previous;
+						// #6109 - IE triggers two focus events and the second
+						// is asynchronous, so we need to reset the previous
+						// term synchronously and asynchronously :-(
+						setTimeout(function() {
+							self.previous = previous;
+							self.selectedItem = item;
+						}, 1);
+					}
+
+					if ( false !== self._trigger( "select", event, { item: item } ) ) {
+						self.element.val( item.value );
+					}
+					// reset the term after the select event
+					// this allows custom select handling to work properly
+					self.term = self.element.val();
+
+					self.close( event );
+					self.selectedItem = item;
+				},
+				blur: function( event, ui ) {
+					// don't set the value of the text field if it's already correct
+					// this prevents moving the cursor unnecessarily
+					if ( self.menu.element.is(":visible") &&
+						( self.element.val() !== self.term ) ) {
+						self.element.val( self.term );
+					}
+				}
+			})
+			.zIndex( this.element.zIndex() + 1 )
+			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+			.css({ top: 0, left: 0 })
+			.hide()
+			.data( "menu" );
+		if ( $.fn.bgiframe ) {
+			 this.menu.element.bgiframe();
+		}
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass( "ui-autocomplete-input" )
+			.removeAttr( "autocomplete" )
+			.removeAttr( "role" )
+			.removeAttr( "aria-autocomplete" )
+			.removeAttr( "aria-haspopup" );
+		this.menu.element.remove();
+		$.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+		if ( key === "source" ) {
+			this._initSource();
+		}
+		if ( key === "appendTo" ) {
+			this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+		}
+		if ( key === "disabled" && value && this.xhr ) {
+			this.xhr.abort();
+		}
+	},
+
+	_initSource: function() {
+		var self = this,
+			array,
+			url;
+		if ( $.isArray(this.options.source) ) {
+			array = this.options.source;
+			this.source = function( request, response ) {
+				response( $.ui.autocomplete.filter(array, request.term) );
+			};
+		} else if ( typeof this.options.source === "string" ) {
+			url = this.options.source;
+			this.source = function( request, response ) {
+				if ( self.xhr ) {
+					self.xhr.abort();
+				}
+				self.xhr = $.ajax({
+					url: url,
+					data: request,
+					dataType: "json",
+					autocompleteRequest: ++requestIndex,
+					success: function( data, status ) {
+						if ( this.autocompleteRequest === requestIndex ) {
+							response( data );
+						}
+					},
+					error: function() {
+						if ( this.autocompleteRequest === requestIndex ) {
+							response( [] );
+						}
+					}
+				});
+			};
+		} else {
+			this.source = this.options.source;
+		}
+	},
+
+	search: function( value, event ) {
+		value = value != null ? value : this.element.val();
+
+		// always save the actual value, not the one passed as an argument
+		this.term = this.element.val();
+
+		if ( value.length < this.options.minLength ) {
+			return this.close( event );
+		}
+
+		clearTimeout( this.closing );
+		if ( this._trigger( "search", event ) === false ) {
+			return;
+		}
+
+		return this._search( value );
+	},
+
+	_search: function( value ) {
+		this.pending++;
+		this.element.addClass( "ui-autocomplete-loading" );
+
+		this.source( { term: value }, this.response );
+	},
+
+	_response: function( content ) {
+		if ( !this.options.disabled && content && content.length ) {
+			content = this._normalize( content );
+			this._suggest( content );
+			this._trigger( "open" );
+		} else {
+			this.close();
+		}
+		this.pending--;
+		if ( !this.pending ) {
+			this.element.removeClass( "ui-autocomplete-loading" );
+		}
+	},
+
+	close: function( event ) {
+		clearTimeout( this.closing );
+		if ( this.menu.element.is(":visible") ) {
+			this.menu.element.hide();
+			this.menu.deactivate();
+			this._trigger( "close", event );
+		}
+	},
+	
+	_change: function( event ) {
+		if ( this.previous !== this.element.val() ) {
+			this._trigger( "change", event, { item: this.selectedItem } );
+		}
+	},
+
+	_normalize: function( items ) {
+		// assume all items have the right format when the first item is complete
+		if ( items.length && items[0].label && items[0].value ) {
+			return items;
+		}
+		return $.map( items, function(item) {
+			if ( typeof item === "string" ) {
+				return {
+					label: item,
+					value: item
+				};
+			}
+			return $.extend({
+				label: item.label || item.value,
+				value: item.value || item.label
+			}, item );
+		});
+	},
+
+	_suggest: function( items ) {
+		var ul = this.menu.element
+			.empty()
+			.zIndex( this.element.zIndex() + 1 );
+		this._renderMenu( ul, items );
+		// TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+		this.menu.deactivate();
+		this.menu.refresh();
+
+		// size and position menu
+		ul.show();
+		this._resizeMenu();
+		ul.position( $.extend({
+			of: this.element
+		}, this.options.position ));
+
+		if ( this.options.autoFocus ) {
+			this.menu.next( new $.Event("mouseover") );
+		}
+	},
+
+	_resizeMenu: function() {
+		var ul = this.menu.element;
+		ul.outerWidth( Math.max(
+			ul.width( "" ).outerWidth(),
+			this.element.outerWidth()
+		) );
+	},
+
+	_renderMenu: function( ul, items ) {
+		var self = this;
+		$.each( items, function( index, item ) {
+			self._renderItem( ul, item );
+		});
+	},
+
+	_renderItem: function( ul, item) {
+		return $( "<li></li>" )
+			.data( "item.autocomplete", item )
+			.append( $( "<a></a>" ).text( item.label ) )
+			.appendTo( ul );
+	},
+
+	_move: function( direction, event ) {
+		if ( !this.menu.element.is(":visible") ) {
+			this.search( null, event );
+			return;
+		}
+		if ( this.menu.first() && /^previous/.test(direction) ||
+				this.menu.last() && /^next/.test(direction) ) {
+			this.element.val( this.term );
+			this.menu.deactivate();
+			return;
+		}
+		this.menu[ direction ]( event );
+	},
+
+	widget: function() {
+		return this.menu.element;
+	}
+});
+
+$.extend( $.ui.autocomplete, {
+	escapeRegex: function( value ) {
+		return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+	},
+	filter: function(array, term) {
+		var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+		return $.grep( array, function(value) {
+			return matcher.test( value.label || value.value || value );
+		});
+	}
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ * 
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *  jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+	_create: function() {
+		var self = this;
+		this.element
+			.addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+			.attr({
+				role: "listbox",
+				"aria-activedescendant": "ui-active-menuitem"
+			})
+			.click(function( event ) {
+				if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+					return;
+				}
+				// temporary
+				event.preventDefault();
+				self.select( event );
+			});
+		this.refresh();
+	},
+	
+	refresh: function() {
+		var self = this;
+
+		// don't refresh list items that are already adapted
+		var items = this.element.children("li:not(.ui-menu-item):has(a)")
+			.addClass("ui-menu-item")
+			.attr("role", "menuitem");
+		
+		items.children("a")
+			.addClass("ui-corner-all")
+			.attr("tabindex", -1)
+			// mouseenter doesn't work with event delegation
+			.mouseenter(function( event ) {
+				self.activate( event, $(this).parent() );
+			})
+			.mouseleave(function() {
+				self.deactivate();
+			});
+	},
+
+	activate: function( event, item ) {
+		this.deactivate();
+		if (this.hasScroll()) {
+			var offset = item.offset().top - this.element.offset().top,
+				scroll = this.element.attr("scrollTop"),
+				elementHeight = this.element.height();
+			if (offset < 0) {
+				this.element.attr("scrollTop", scroll + offset);
+			} else if (offset >= elementHeight) {
+				this.element.attr("scrollTop", scroll + offset - elementHeight + item.height());
+			}
+		}
+		this.active = item.eq(0)
+			.children("a")
+				.addClass("ui-state-hover")
+				.attr("id", "ui-active-menuitem")
+			.end();
+		this._trigger("focus", event, { item: item });
+	},
+
+	deactivate: function() {
+		if (!this.active) { return; }
+
+		this.active.children("a")
+			.removeClass("ui-state-hover")
+			.removeAttr("id");
+		this._trigger("blur");
+		this.active = null;
+	},
+
+	next: function(event) {
+		this.move("next", ".ui-menu-item:first", event);
+	},
+
+	previous: function(event) {
+		this.move("prev", ".ui-menu-item:last", event);
+	},
+
+	first: function() {
+		return this.active && !this.active.prevAll(".ui-menu-item").length;
+	},
+
+	last: function() {
+		return this.active && !this.active.nextAll(".ui-menu-item").length;
+	},
+
+	move: function(direction, edge, event) {
+		if (!this.active) {
+			this.activate(event, this.element.children(edge));
+			return;
+		}
+		var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+		if (next.length) {
+			this.activate(event, next);
+		} else {
+			this.activate(event, this.element.children(edge));
+		}
+	},
+
+	// TODO merge with previousPage
+	nextPage: function(event) {
+		if (this.hasScroll()) {
+			// TODO merge with no-scroll-else
+			if (!this.active || this.last()) {
+				this.activate(event, this.element.children(".ui-menu-item:first"));
+				return;
+			}
+			var base = this.active.offset().top,
+				height = this.element.height(),
+				result = this.element.children(".ui-menu-item").filter(function() {
+					var close = $(this).offset().top - base - height + $(this).height();
+					// TODO improve approximation
+					return close < 10 && close > -10;
+				});
+
+			// TODO try to catch this earlier when scrollTop indicates the last page anyway
+			if (!result.length) {
+				result = this.element.children(".ui-menu-item:last");
+			}
+			this.activate(event, result);
+		} else {
+			this.activate(event, this.element.children(".ui-menu-item")
+				.filter(!this.active || this.last() ? ":first" : ":last"));
+		}
+	},
+
+	// TODO merge with nextPage
+	previousPage: function(event) {
+		if (this.hasScroll()) {
+			// TODO merge with no-scroll-else
+			if (!this.active || this.first()) {
+				this.activate(event, this.element.children(".ui-menu-item:last"));
+				return;
+			}
+
+			var base = this.active.offset().top,
+				height = this.element.height();
+				result = this.element.children(".ui-menu-item").filter(function() {
+					var close = $(this).offset().top - base + height - $(this).height();
+					// TODO improve approximation
+					return close < 10 && close > -10;
+				});
+
+			// TODO try to catch this earlier when scrollTop indicates the last page anyway
+			if (!result.length) {
+				result = this.element.children(".ui-menu-item:first");
+			}
+			this.activate(event, result);
+		} else {
+			this.activate(event, this.element.children(".ui-menu-item")
+				.filter(!this.active || this.first() ? ":last" : ":first"));
+		}
+	},
+
+	hasScroll: function() {
+		return this.element.height() < this.element.attr("scrollHeight");
+	},
+
+	select: function( event ) {
+		this._trigger("selected", event, { item: this.active });
+	}
+});
+
+}(jQuery));
+/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var lastActive,
+	baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+	stateClasses = "ui-state-hover ui-state-active ",
+	typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+	formResetHandler = function( event ) {
+		$( ":ui-button", event.target.form ).each(function() {
+			var inst = $( this ).data( "button" );
+			setTimeout(function() {
+				inst.refresh();
+			}, 1 );
+		});
+	},
+	radioGroup = function( radio ) {
+		var name = radio.name,
+			form = radio.form,
+			radios = $( [] );
+		if ( name ) {
+			if ( form ) {
+				radios = $( form ).find( "[name='" + name + "']" );
+			} else {
+				radios = $( "[name='" + name + "']", radio.ownerDocument )
+					.filter(function() {
+						return !this.form;
+					});
+			}
+		}
+		return radios;
+	};
+
+$.widget( "ui.button", {
+	options: {
+		disabled: null,
+		text: true,
+		label: null,
+		icons: {
+			primary: null,
+			secondary: null
+		}
+	},
+	_create: function() {
+		this.element.closest( "form" )
+			.unbind( "reset.button" )
+			.bind( "reset.button", formResetHandler );
+
+		if ( typeof this.options.disabled !== "boolean" ) {
+			this.options.disabled = this.element.attr( "disabled" );
+		}
+
+		this._determineButtonType();
+		this.hasTitle = !!this.buttonElement.attr( "title" );
+
+		var self = this,
+			options = this.options,
+			toggleButton = this.type === "checkbox" || this.type === "radio",
+			hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+			focusClass = "ui-state-focus";
+
+		if ( options.label === null ) {
+			options.label = this.buttonElement.html();
+		}
+
+		if ( this.element.is( ":disabled" ) ) {
+			options.disabled = true;
+		}
+
+		this.buttonElement
+			.addClass( baseClasses )
+			.attr( "role", "button" )
+			.bind( "mouseenter.button", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-hover" );
+				if ( this === lastActive ) {
+					$( this ).addClass( "ui-state-active" );
+				}
+			})
+			.bind( "mouseleave.button", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( hoverClass );
+			})
+			.bind( "focus.button", function() {
+				// no need to check disabled, focus won't be triggered anyway
+				$( this ).addClass( focusClass );
+			})
+			.bind( "blur.button", function() {
+				$( this ).removeClass( focusClass );
+			});
+
+		if ( toggleButton ) {
+			this.element.bind( "change.button", function() {
+				self.refresh();
+			});
+		}
+
+		if ( this.type === "checkbox" ) {
+			this.buttonElement.bind( "click.button", function() {
+				if ( options.disabled ) {
+					return false;
+				}
+				$( this ).toggleClass( "ui-state-active" );
+				self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+			});
+		} else if ( this.type === "radio" ) {
+			this.buttonElement.bind( "click.button", function() {
+				if ( options.disabled ) {
+					return false;
+				}
+				$( this ).addClass( "ui-state-active" );
+				self.buttonElement.attr( "aria-pressed", true );
+
+				var radio = self.element[ 0 ];
+				radioGroup( radio )
+					.not( radio )
+					.map(function() {
+						return $( this ).button( "widget" )[ 0 ];
+					})
+					.removeClass( "ui-state-active" )
+					.attr( "aria-pressed", false );
+			});
+		} else {
+			this.buttonElement
+				.bind( "mousedown.button", function() {
+					if ( options.disabled ) {
+						return false;
+					}
+					$( this ).addClass( "ui-state-active" );
+					lastActive = this;
+					$( document ).one( "mouseup", function() {
+						lastActive = null;
+					});
+				})
+				.bind( "mouseup.button", function() {
+					if ( options.disabled ) {
+						return false;
+					}
+					$( this ).removeClass( "ui-state-active" );
+				})
+				.bind( "keydown.button", function(event) {
+					if ( options.disabled ) {
+						return false;
+					}
+					if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+						$( this ).addClass( "ui-state-active" );
+					}
+				})
+				.bind( "keyup.button", function() {
+					$( this ).removeClass( "ui-state-active" );
+				});
+
+			if ( this.buttonElement.is("a") ) {
+				this.buttonElement.keyup(function(event) {
+					if ( event.keyCode === $.ui.keyCode.SPACE ) {
+						// TODO pass through original event correctly (just as 2nd argument doesn't work)
+						$( this ).click();
+					}
+				});
+			}
+		}
+
+		// TODO: pull out $.Widget's handling for the disabled option into
+		// $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+		// be overridden by individual plugins
+		this._setOption( "disabled", options.disabled );
+	},
+
+	_determineButtonType: function() {
+		
+		if ( this.element.is(":checkbox") ) {
+			this.type = "checkbox";
+		} else {
+			if ( this.element.is(":radio") ) {
+				this.type = "radio";
+			} else {
+				if ( this.element.is("input") ) {
+					this.type = "input";
+				} else {
+					this.type = "button";
+				}
+			}
+		}
+		
+		if ( this.type === "checkbox" || this.type === "radio" ) {
+			// we don't search against the document in case the element
+			// is disconnected from the DOM
+			var ancestor = this.element.parents().filter(":last"),
+				labelSelector = "label[for=" + this.element.attr("id") + "]";
+			this.buttonElement = ancestor.find( labelSelector );
+			if ( !this.buttonElement.length ) {
+				ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+				this.buttonElement = ancestor.filter( labelSelector );
+				if ( !this.buttonElement.length ) {
+					this.buttonElement = ancestor.find( labelSelector );
+				}
+			}
+			this.element.addClass( "ui-helper-hidden-accessible" );
+
+			var checked = this.element.is( ":checked" );
+			if ( checked ) {
+				this.buttonElement.addClass( "ui-state-active" );
+			}
+			this.buttonElement.attr( "aria-pressed", checked );
+		} else {
+			this.buttonElement = this.element;
+		}
+	},
+
+	widget: function() {
+		return this.buttonElement;
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass( "ui-helper-hidden-accessible" );
+		this.buttonElement
+			.removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
+			.removeAttr( "role" )
+			.removeAttr( "aria-pressed" )
+			.html( this.buttonElement.find(".ui-button-text").html() );
+
+		if ( !this.hasTitle ) {
+			this.buttonElement.removeAttr( "title" );
+		}
+
+		$.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+		if ( key === "disabled" ) {
+			if ( value ) {
+				this.element.attr( "disabled", true );
+			} else {
+				this.element.removeAttr( "disabled" );
+			}
+		}
+		this._resetButton();
+	},
+
+	refresh: function() {
+		var isDisabled = this.element.is( ":disabled" );
+		if ( isDisabled !== this.options.disabled ) {
+			this._setOption( "disabled", isDisabled );
+		}
+		if ( this.type === "radio" ) {
+			radioGroup( this.element[0] ).each(function() {
+				if ( $( this ).is( ":checked" ) ) {
+					$( this ).button( "widget" )
+						.addClass( "ui-state-active" )
+						.attr( "aria-pressed", true );
+				} else {
+					$( this ).button( "widget" )
+						.removeClass( "ui-state-active" )
+						.attr( "aria-pressed", false );
+				}
+			});
+		} else if ( this.type === "checkbox" ) {
+			if ( this.element.is( ":checked" ) ) {
+				this.buttonElement
+					.addClass( "ui-state-active" )
+					.attr( "aria-pressed", true );
+			} else {
+				this.buttonElement
+					.removeClass( "ui-state-active" )
+					.attr( "aria-pressed", false );
+			}
+		}
+	},
+
+	_resetButton: function() {
+		if ( this.type === "input" ) {
+			if ( this.options.label ) {
+				this.element.val( this.options.label );
+			}
+			return;
+		}
+		var buttonElement = this.buttonElement.removeClass( typeClasses ),
+			buttonText = $( "<span></span>" )
+				.addClass( "ui-button-text" )
+				.html( this.options.label )
+				.appendTo( buttonElement.empty() )
+				.text(),
+			icons = this.options.icons,
+			multipleIcons = icons.primary && icons.secondary,
+			buttonClasses = [];  
+
+		if ( icons.primary || icons.secondary ) {
+			if ( this.options.text ) {
+				buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
+			}
+
+			if ( icons.primary ) {
+				buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+			}
+
+			if ( icons.secondary ) {
+				buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+			}
+
+			if ( !this.options.text ) {
+				buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+
+				if ( !this.hasTitle ) {
+					buttonElement.attr( "title", buttonText );
+				}
+			}
+		} else {
+			buttonClasses.push( "ui-button-text-only" );
+		}
+		buttonElement.addClass( buttonClasses.join( " " ) );
+	}
+});
+
+$.widget( "ui.buttonset", {
+	options: {
+		items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
+	},
+
+	_create: function() {
+		this.element.addClass( "ui-buttonset" );
+	},
+	
+	_init: function() {
+		this.refresh();
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "disabled" ) {
+			this.buttons.button( "option", key, value );
+		}
+
+		$.Widget.prototype._setOption.apply( this, arguments );
+	},
+	
+	refresh: function() {
+		this.buttons = this.element.find( this.options.items )
+			.filter( ":ui-button" )
+				.button( "refresh" )
+			.end()
+			.not( ":ui-button" )
+				.button()
+			.end()
+			.map(function() {
+				return $( this ).button( "widget" )[ 0 ];
+			})
+				.removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+				.filter( ":first" )
+					.addClass( "ui-corner-left" )
+				.end()
+				.filter( ":last" )
+					.addClass( "ui-corner-right" )
+				.end()
+			.end();
+	},
+
+	destroy: function() {
+		this.element.removeClass( "ui-buttonset" );
+		this.buttons
+			.map(function() {
+				return $( this ).button( "widget" )[ 0 ];
+			})
+				.removeClass( "ui-corner-left ui-corner-right" )
+			.end()
+			.button( "destroy" );
+
+		$.Widget.prototype.destroy.call( this );
+	}
+});
+
+}( jQuery ) );
+/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *  jquery.ui.button.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function( $, undefined ) {
+
+var uiDialogClasses =
+		'ui-dialog ' +
+		'ui-widget ' +
+		'ui-widget-content ' +
+		'ui-corner-all ',
+	sizeRelatedOptions = {
+		buttons: true,
+		height: true,
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true,
+		width: true
+	},
+	resizableRelatedOptions = {
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true
+	};
+
+$.widget("ui.dialog", {
+	options: {
+		autoOpen: true,
+		buttons: {},
+		closeOnEscape: true,
+		closeText: 'close',
+		dialogClass: '',
+		draggable: true,
+		hide: null,
+		height: 'auto',
+		maxHeight: false,
+		maxWidth: false,
+		minHeight: 150,
+		minWidth: 150,
+		modal: false,
+		position: {
+			my: 'center',
+			at: 'center',
+			collision: 'fit',
+			// ensure that the titlebar is never outside the document
+			using: function(pos) {
+				var topOffset = $(this).css(pos).offset().top;
+				if (topOffset < 0) {
+					$(this).css('top', pos.top - topOffset);
+				}
+			}
+		},
+		resizable: true,
+		show: null,
+		stack: true,
+		title: '',
+		width: 300,
+		zIndex: 1000
+	},
+
+	_create: function() {
+		this.originalTitle = this.element.attr('title');
+		// #5742 - .attr() might return a DOMElement
+		if ( typeof this.originalTitle !== "string" ) {
+			this.originalTitle = "";
+		}
+
+		this.options.title = this.options.title || this.originalTitle;
+		var self = this,
+			options = self.options,
+
+			title = options.title || '&#160;',
+			titleId = $.ui.dialog.getTitleId(self.element),
+
+			uiDialog = (self.uiDialog = $('<div></div>'))
+				.appendTo(document.body)
+				.hide()
+				.addClass(uiDialogClasses + options.dialogClass)
+				.css({
+					zIndex: options.zIndex
+				})
+				// setting tabIndex makes the div focusable
+				// setting outline to 0 prevents a border on focus in Mozilla
+				.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+					if (options.closeOnEscape && event.keyCode &&
+						event.keyCode === $.ui.keyCode.ESCAPE) {
+						
+						self.close(event);
+						event.preventDefault();
+					}
+				})
+				.attr({
+					role: 'dialog',
+					'aria-labelledby': titleId
+				})
+				.mousedown(function(event) {
+					self.moveToTop(false, event);
+				}),
+
+			uiDialogContent = self.element
+				.show()
+				.removeAttr('title')
+				.addClass(
+					'ui-dialog-content ' +
+					'ui-widget-content')
+				.appendTo(uiDialog),
+
+			uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+				.addClass(
+					'ui-dialog-titlebar ' +
+					'ui-widget-header ' +
+					'ui-corner-all ' +
+					'ui-helper-clearfix'
+				)
+				.prependTo(uiDialog),
+
+			uiDialogTitlebarClose = $('<a href="#"></a>')
+				.addClass(
+					'ui-dialog-titlebar-close ' +
+					'ui-corner-all'
+				)
+				.attr('role', 'button')
+				.hover(
+					function() {
+						uiDialogTitlebarClose.addClass('ui-state-hover');
+					},
+					function() {
+						uiDialogTitlebarClose.removeClass('ui-state-hover');
+					}
+				)
+				.focus(function() {
+					uiDialogTitlebarClose.addClass('ui-state-focus');
+				})
+				.blur(function() {
+					uiDialogTitlebarClose.removeClass('ui-state-focus');
+				})
+				.click(function(event) {
+					self.close(event);
+					return false;
+				})
+				.appendTo(uiDialogTitlebar),
+
+			uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+				.addClass(
+					'ui-icon ' +
+					'ui-icon-closethick'
+				)
+				.text(options.closeText)
+				.appendTo(uiDialogTitlebarClose),
+
+			uiDialogTitle = $('<span></span>')
+				.addClass('ui-dialog-title')
+				.attr('id', titleId)
+				.html(title)
+				.prependTo(uiDialogTitlebar);
+
+		//handling of deprecated beforeclose (vs beforeClose) option
+		//Ticket #4669 http://dev.jqueryui.com/ticket/4669
+		//TODO: remove in 1.9pre
+		if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+			options.beforeClose = options.beforeclose;
+		}
+
+		uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+		if (options.draggable && $.fn.draggable) {
+			self._makeDraggable();
+		}
+		if (options.resizable && $.fn.resizable) {
+			self._makeResizable();
+		}
+
+		self._createButtons(options.buttons);
+		self._isOpen = false;
+
+		if ($.fn.bgiframe) {
+			uiDialog.bgiframe();
+		}
+	},
+
+	_init: function() {
+		if ( this.options.autoOpen ) {
+			this.open();
+		}
+	},
+
+	destroy: function() {
+		var self = this;
+		
+		if (self.overlay) {
+			self.overlay.destroy();
+		}
+		self.uiDialog.hide();
+		self.element
+			.unbind('.dialog')
+			.removeData('dialog')
+			.removeClass('ui-dialog-content ui-widget-content')
+			.hide().appendTo('body');
+		self.uiDialog.remove();
+
+		if (self.originalTitle) {
+			self.element.attr('title', self.originalTitle);
+		}
+
+		return self;
+	},
+
+	widget: function() {
+		return this.uiDialog;
+	},
+
+	close: function(event) {
+		var self = this,
+			maxZ, thisZ;
+		
+		if (false === self._trigger('beforeClose', event)) {
+			return;
+		}
+
+		if (self.overlay) {
+			self.overlay.destroy();
+		}
+		self.uiDialog.unbind('keypress.ui-dialog');
+
+		self._isOpen = false;
+
+		if (self.options.hide) {
+			self.uiDialog.hide(self.options.hide, function() {
+				self._trigger('close', event);
+			});
+		} else {
+			self.uiDialog.hide();
+			self._trigger('close', event);
+		}
+
+		$.ui.dialog.overlay.resize();
+
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		if (self.options.modal) {
+			maxZ = 0;
+			$('.ui-dialog').each(function() {
+				if (this !== self.uiDialog[0]) {
+					thisZ = $(this).css('z-index');
+					if(!isNaN(thisZ)) {
+						maxZ = Math.max(maxZ, thisZ);
+					}
+				}
+			});
+			$.ui.dialog.maxZ = maxZ;
+		}
+
+		return self;
+	},
+
+	isOpen: function() {
+		return this._isOpen;
+	},
+
+	// the force parameter allows us to move modal dialogs to their correct
+	// position on open
+	moveToTop: function(force, event) {
+		var self = this,
+			options = self.options,
+			saveScroll;
+
+		if ((options.modal && !force) ||
+			(!options.stack && !options.modal)) {
+			return self._trigger('focus', event);
+		}
+
+		if (options.zIndex > $.ui.dialog.maxZ) {
+			$.ui.dialog.maxZ = options.zIndex;
+		}
+		if (self.overlay) {
+			$.ui.dialog.maxZ += 1;
+			self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+		}
+
+		//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+		//  http://ui.jquery.com/bugs/ticket/3193
+		saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+		$.ui.dialog.maxZ += 1;
+		self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+		self.element.attr(saveScroll);
+		self._trigger('focus', event);
+
+		return self;
+	},
+
+	open: function() {
+		if (this._isOpen) { return; }
+
+		var self = this,
+			options = self.options,
+			uiDialog = self.uiDialog;
+
+		self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+		self._size();
+		self._position(options.position);
+		uiDialog.show(options.show);
+		self.moveToTop(true);
+
+		// prevent tabbing out of modal dialogs
+		if (options.modal) {
+			uiDialog.bind('keypress.ui-dialog', function(event) {
+				if (event.keyCode !== $.ui.keyCode.TAB) {
+					return;
+				}
+
+				var tabbables = $(':tabbable', this),
+					first = tabbables.filter(':first'),
+					last  = tabbables.filter(':last');
+
+				if (event.target === last[0] && !event.shiftKey) {
+					first.focus(1);
+					return false;
+				} else if (event.target === first[0] && event.shiftKey) {
+					last.focus(1);
+					return false;
+				}
+			});
+		}
+
+		// set focus to the first tabbable element in the content area or the first button
+		// if there are no tabbable elements, set focus on the dialog itself
+		$(self.element.find(':tabbable').get().concat(
+			uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
+				uiDialog.get()))).eq(0).focus();
+
+		self._isOpen = true;
+		self._trigger('open');
+
+		return self;
+	},
+
+	_createButtons: function(buttons) {
+		var self = this,
+			hasButtons = false,
+			uiDialogButtonPane = $('<div></div>')
+				.addClass(
+					'ui-dialog-buttonpane ' +
+					'ui-widget-content ' +
+					'ui-helper-clearfix'
+				),
+			uiButtonSet = $( "<div></div>" )
+				.addClass( "ui-dialog-buttonset" )
+				.appendTo( uiDialogButtonPane );
+
+		// if we already have a button pane, remove it
+		self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+		if (typeof buttons === 'object' && buttons !== null) {
+			$.each(buttons, function() {
+				return !(hasButtons = true);
+			});
+		}
+		if (hasButtons) {
+			$.each(buttons, function(name, props) {
+				props = $.isFunction( props ) ?
+					{ click: props, text: name } :
+					props;
+				var button = $('<button type="button"></button>')
+					.attr( props, true )
+					.unbind('click')
+					.click(function() {
+						props.click.apply(self.element[0], arguments);
+					})
+					.appendTo(uiButtonSet);
+				if ($.fn.button) {
+					button.button();
+				}
+			});
+			uiDialogButtonPane.appendTo(self.uiDialog);
+		}
+	},
+
+	_makeDraggable: function() {
+		var self = this,
+			options = self.options,
+			doc = $(document),
+			heightBeforeDrag;
+
+		function filteredUi(ui) {
+			return {
+				position: ui.position,
+				offset: ui.offset
+			};
+		}
+
+		self.uiDialog.draggable({
+			cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+			handle: '.ui-dialog-titlebar',
+			containment: 'document',
+			start: function(event, ui) {
+				heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+				$(this).height($(this).height()).addClass("ui-dialog-dragging");
+				self._trigger('dragStart', event, filteredUi(ui));
+			},
+			drag: function(event, ui) {
+				self._trigger('drag', event, filteredUi(ui));
+			},
+			stop: function(event, ui) {
+				options.position = [ui.position.left - doc.scrollLeft(),
+					ui.position.top - doc.scrollTop()];
+				$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+				self._trigger('dragStop', event, filteredUi(ui));
+				$.ui.dialog.overlay.resize();
+			}
+		});
+	},
+
+	_makeResizable: function(handles) {
+		handles = (handles === undefined ? this.options.resizable : handles);
+		var self = this,
+			options = self.options,
+			// .ui-resizable has position: relative defined in the stylesheet
+			// but dialogs have to use absolute or fixed positioning
+			position = self.uiDialog.css('position'),
+			resizeHandles = (typeof handles === 'string' ?
+				handles	:
+				'n,e,s,w,se,sw,ne,nw'
+			);
+
+		function filteredUi(ui) {
+			return {
+				originalPosition: ui.originalPosition,
+				originalSize: ui.originalSize,
+				position: ui.position,
+				size: ui.size
+			};
+		}
+
+		self.uiDialog.resizable({
+			cancel: '.ui-dialog-content',
+			containment: 'document',
+			alsoResize: self.element,
+			maxWidth: options.maxWidth,
+			maxHeight: options.maxHeight,
+			minWidth: options.minWidth,
+			minHeight: self._minHeight(),
+			handles: resizeHandles,
+			start: function(event, ui) {
+				$(this).addClass("ui-dialog-resizing");
+				self._trigger('resizeStart', event, filteredUi(ui));
+			},
+			resize: function(event, ui) {
+				self._trigger('resize', event, filteredUi(ui));
+			},
+			stop: function(event, ui) {
+				$(this).removeClass("ui-dialog-resizing");
+				options.height = $(this).height();
+				options.width = $(this).width();
+				self._trigger('resizeStop', event, filteredUi(ui));
+				$.ui.dialog.overlay.resize();
+			}
+		})
+		.css('position', position)
+		.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+	},
+
+	_minHeight: function() {
+		var options = this.options;
+
+		if (options.height === 'auto') {
+			return options.minHeight;
+		} else {
+			return Math.min(options.minHeight, options.height);
+		}
+	},
+
+	_position: function(position) {
+		var myAt = [],
+			offset = [0, 0],
+			isVisible;
+
+		if (position) {
+			// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+	//		if (typeof position == 'string' || $.isArray(position)) {
+	//			myAt = $.isArray(position) ? position : position.split(' ');
+
+			if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+				myAt = position.split ? position.split(' ') : [position[0], position[1]];
+				if (myAt.length === 1) {
+					myAt[1] = myAt[0];
+				}
+
+				$.each(['left', 'top'], function(i, offsetPosition) {
+					if (+myAt[i] === myAt[i]) {
+						offset[i] = myAt[i];
+						myAt[i] = offsetPosition;
+					}
+				});
+
+				position = {
+					my: myAt.join(" "),
+					at: myAt.join(" "),
+					offset: offset.join(" ")
+				};
+			} 
+
+			position = $.extend({}, $.ui.dialog.prototype.options.position, position);
+		} else {
+			position = $.ui.dialog.prototype.options.position;
+		}
+
+		// need to show the dialog to get the actual offset in the position plugin
+		isVisible = this.uiDialog.is(':visible');
+		if (!isVisible) {
+			this.uiDialog.show();
+		}
+		this.uiDialog
+			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+			.css({ top: 0, left: 0 })
+			.position($.extend({ of: window }, position));
+		if (!isVisible) {
+			this.uiDialog.hide();
+		}
+	},
+
+	_setOptions: function( options ) {
+		var self = this,
+			resizableOptions = {},
+			resize = false;
+
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+			
+			if ( key in sizeRelatedOptions ) {
+				resize = true;
+			}
+			if ( key in resizableRelatedOptions ) {
+				resizableOptions[ key ] = value;
+			}
+		});
+
+		if ( resize ) {
+			this._size();
+		}
+		if ( this.uiDialog.is( ":data(resizable)" ) ) {
+			this.uiDialog.resizable( "option", resizableOptions );
+		}
+	},
+
+	_setOption: function(key, value){
+		var self = this,
+			uiDialog = self.uiDialog;
+
+		switch (key) {
+			//handling of deprecated beforeclose (vs beforeClose) option
+			//Ticket #4669 http://dev.jqueryui.com/ticket/4669
+			//TODO: remove in 1.9pre
+			case "beforeclose":
+				key = "beforeClose";
+				break;
+			case "buttons":
+				self._createButtons(value);
+				break;
+			case "closeText":
+				// ensure that we always pass a string
+				self.uiDialogTitlebarCloseText.text("" + value);
+				break;
+			case "dialogClass":
+				uiDialog
+					.removeClass(self.options.dialogClass)
+					.addClass(uiDialogClasses + value);
+				break;
+			case "disabled":
+				if (value) {
+					uiDialog.addClass('ui-dialog-disabled');
+				} else {
+					uiDialog.removeClass('ui-dialog-disabled');
+				}
+				break;
+			case "draggable":
+				var isDraggable = uiDialog.is( ":data(draggable)" );
+				if ( isDraggable && !value ) {
+					uiDialog.draggable( "destroy" );
+				}
+				
+				if ( !isDraggable && value ) {
+					self._makeDraggable();
+				}
+				break;
+			case "position":
+				self._position(value);
+				break;
+			case "resizable":
+				// currently resizable, becoming non-resizable
+				var isResizable = uiDialog.is( ":data(resizable)" );
+				if (isResizable && !value) {
+					uiDialog.resizable('destroy');
+				}
+
+				// currently resizable, changing handles
+				if (isResizable && typeof value === 'string') {
+					uiDialog.resizable('option', 'handles', value);
+				}
+
+				// currently non-resizable, becoming resizable
+				if (!isResizable && value !== false) {
+					self._makeResizable(value);
+				}
+				break;
+			case "title":
+				// convert whatever was passed in o a string, for html() to not throw up
+				$(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || '&#160;'));
+				break;
+		}
+
+		$.Widget.prototype._setOption.apply(self, arguments);
+	},
+
+	_size: function() {
+		/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+		 * divs will both have width and height set, so we need to reset them
+		 */
+		var options = this.options,
+			nonContentHeight,
+			minContentHeight,
+			isVisible = this.uiDialog.is( ":visible" );
+
+		// reset content sizing
+		this.element.show().css({
+			width: 'auto',
+			minHeight: 0,
+			height: 0
+		});
+
+		if (options.minWidth > options.width) {
+			options.width = options.minWidth;
+		}
+
+		// reset wrapper sizing
+		// determine the height of all the non-content elements
+		nonContentHeight = this.uiDialog.css({
+				height: 'auto',
+				width: options.width
+			})
+			.height();
+		minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+		
+		if ( options.height === "auto" ) {
+			// only needed for IE6 support
+			if ( $.support.minHeight ) {
+				this.element.css({
+					minHeight: minContentHeight,
+					height: "auto"
+				});
+			} else {
+				this.uiDialog.show();
+				var autoHeight = this.element.css( "height", "auto" ).height();
+				if ( !isVisible ) {
+					this.uiDialog.hide();
+				}
+				this.element.height( Math.max( autoHeight, minContentHeight ) );
+			}
+		} else {
+			this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+		}
+
+		if (this.uiDialog.is(':data(resizable)')) {
+			this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+		}
+	}
+});
+
+$.extend($.ui.dialog, {
+	version: "1.8.11",
+
+	uuid: 0,
+	maxZ: 0,
+
+	getTitleId: function($el) {
+		var id = $el.attr('id');
+		if (!id) {
+			this.uuid += 1;
+			id = this.uuid;
+		}
+		return 'ui-dialog-title-' + id;
+	},
+
+	overlay: function(dialog) {
+		this.$el = $.ui.dialog.overlay.create(dialog);
+	}
+});
+
+$.extend($.ui.dialog.overlay, {
+	instances: [],
+	// reuse old instances due to IE memory leak with alpha transparency (see #5185)
+	oldInstances: [],
+	maxZ: 0,
+	events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+		function(event) { return event + '.dialog-overlay'; }).join(' '),
+	create: function(dialog) {
+		if (this.instances.length === 0) {
+			// prevent use of anchors and inputs
+			// we use a setTimeout in case the overlay is created from an
+			// event that we're going to be cancelling (see #2804)
+			setTimeout(function() {
+				// handle $(el).dialog().dialog('close') (see #4065)
+				if ($.ui.dialog.overlay.instances.length) {
+					$(document).bind($.ui.dialog.overlay.events, function(event) {
+						// stop events if the z-index of the target is < the z-index of the overlay
+						// we cannot return true when we don't want to cancel the event (#3523)
+						if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
+							return false;
+						}
+					});
+				}
+			}, 1);
+
+			// allow closing by pressing the escape key
+			$(document).bind('keydown.dialog-overlay', function(event) {
+				if (dialog.options.closeOnEscape && event.keyCode &&
+					event.keyCode === $.ui.keyCode.ESCAPE) {
+					
+					dialog.close(event);
+					event.preventDefault();
+				}
+			});
+
+			// handle window resize
+			$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+		}
+
+		var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+			.appendTo(document.body)
+			.css({
+				width: this.width(),
+				height: this.height()
+			});
+
+		if ($.fn.bgiframe) {
+			$el.bgiframe();
+		}
+
+		this.instances.push($el);
+		return $el;
+	},
+
+	destroy: function($el) {
+		var indexOf = $.inArray($el, this.instances);
+		if (indexOf != -1){
+			this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+		}
+
+		if (this.instances.length === 0) {
+			$([document, window]).unbind('.dialog-overlay');
+		}
+
+		$el.remove();
+		
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		var maxZ = 0;
+		$.each(this.instances, function() {
+			maxZ = Math.max(maxZ, this.css('z-index'));
+		});
+		this.maxZ = maxZ;
+	},
+
+	height: function() {
+		var scrollHeight,
+			offsetHeight;
+		// handle IE 6
+		if ($.browser.msie && $.browser.version < 7) {
+			scrollHeight = Math.max(
+				document.documentElement.scrollHeight,
+				document.body.scrollHeight
+			);
+			offsetHeight = Math.max(
+				document.documentElement.offsetHeight,
+				document.body.offsetHeight
+			);
+
+			if (scrollHeight < offsetHeight) {
+				return $(window).height() + 'px';
+			} else {
+				return scrollHeight + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).height() + 'px';
+		}
+	},
+
+	width: function() {
+		var scrollWidth,
+			offsetWidth;
+		// handle IE 6
+		if ($.browser.msie && $.browser.version < 7) {
+			scrollWidth = Math.max(
+				document.documentElement.scrollWidth,
+				document.body.scrollWidth
+			);
+			offsetWidth = Math.max(
+				document.documentElement.offsetWidth,
+				document.body.offsetWidth
+			);
+
+			if (scrollWidth < offsetWidth) {
+				return $(window).width() + 'px';
+			} else {
+				return scrollWidth + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).width() + 'px';
+		}
+	},
+
+	resize: function() {
+		/* If the dialog is draggable and the user drags it past the
+		 * right edge of the window, the document becomes wider so we
+		 * need to stretch the overlay. If the user then drags the
+		 * dialog back to the left, the document will become narrower,
+		 * so we need to shrink the overlay to the appropriate size.
+		 * This is handled by shrinking the overlay before setting it
+		 * to the full document size.
+		 */
+		var $overlays = $([]);
+		$.each($.ui.dialog.overlay.instances, function() {
+			$overlays = $overlays.add(this);
+		});
+
+		$overlays.css({
+			width: 0,
+			height: 0
+		}).css({
+			width: $.ui.dialog.overlay.width(),
+			height: $.ui.dialog.overlay.height()
+		});
+	}
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+	destroy: function() {
+		$.ui.dialog.overlay.destroy(this.$el);
+	}
+});
+
+}(jQuery));
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.accordion.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,611 @@
+/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.accordion", {
+	options: {
+		active: 0,
+		animated: "slide",
+		autoHeight: true,
+		clearStyle: false,
+		collapsible: false,
+		event: "click",
+		fillSpace: false,
+		header: "> li > :first-child,> :not(li):even",
+		icons: {
+			header: "ui-icon-triangle-1-e",
+			headerSelected: "ui-icon-triangle-1-s"
+		},
+		navigation: false,
+		navigationFilter: function() {
+			return this.href.toLowerCase() === location.href.toLowerCase();
+		}
+	},
+
+	_create: function() {
+		var self = this,
+			options = self.options;
+
+		self.running = 0;
+
+		self.element
+			.addClass( "ui-accordion ui-widget ui-helper-reset" )
+			// in lack of child-selectors in CSS
+			// we need to mark top-LIs in a UL-accordion for some IE-fix
+			.children( "li" )
+				.addClass( "ui-accordion-li-fix" );
+
+		self.headers = self.element.find( options.header )
+			.addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
+			.bind( "mouseenter.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-hover" );
+			})
+			.bind( "mouseleave.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( "ui-state-hover" );
+			})
+			.bind( "focus.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-focus" );
+			})
+			.bind( "blur.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( "ui-state-focus" );
+			});
+
+		self.headers.next()
+			.addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
+
+		if ( options.navigation ) {
+			var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
+			if ( current.length ) {
+				var header = current.closest( ".ui-accordion-header" );
+				if ( header.length ) {
+					// anchor within header
+					self.active = header;
+				} else {
+					// anchor within content
+					self.active = current.closest( ".ui-accordion-content" ).prev();
+				}
+			}
+		}
+
+		self.active = self._findActive( self.active || options.active )
+			.addClass( "ui-state-default ui-state-active" )
+			.toggleClass( "ui-corner-all" )
+			.toggleClass( "ui-corner-top" );
+		self.active.next().addClass( "ui-accordion-content-active" );
+
+		self._createIcons();
+		self.resize();
+		
+		// ARIA
+		self.element.attr( "role", "tablist" );
+
+		self.headers
+			.attr( "role", "tab" )
+			.bind( "keydown.accordion", function( event ) {
+				return self._keydown( event );
+			})
+			.next()
+				.attr( "role", "tabpanel" );
+
+		self.headers
+			.not( self.active || "" )
+			.attr({
+				"aria-expanded": "false",
+				"aria-selected": "false",
+				tabIndex: -1
+			})
+			.next()
+				.hide();
+
+		// make sure at least one header is in the tab order
+		if ( !self.active.length ) {
+			self.headers.eq( 0 ).attr( "tabIndex", 0 );
+		} else {
+			self.active
+				.attr({
+					"aria-expanded": "true",
+					"aria-selected": "true",
+					tabIndex: 0
+				});
+		}
+
+		// only need links in tab order for Safari
+		if ( !$.browser.safari ) {
+			self.headers.find( "a" ).attr( "tabIndex", -1 );
+		}
+
+		if ( options.event ) {
+			self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
+				self._clickHandler.call( self, event, this );
+				event.preventDefault();
+			});
+		}
+	},
+
+	_createIcons: function() {
+		var options = this.options;
+		if ( options.icons ) {
+			$( "<span></span>" )
+				.addClass( "ui-icon " + options.icons.header )
+				.prependTo( this.headers );
+			this.active.children( ".ui-icon" )
+				.toggleClass(options.icons.header)
+				.toggleClass(options.icons.headerSelected);
+			this.element.addClass( "ui-accordion-icons" );
+		}
+	},
+
+	_destroyIcons: function() {
+		this.headers.children( ".ui-icon" ).remove();
+		this.element.removeClass( "ui-accordion-icons" );
+	},
+
+	destroy: function() {
+		var options = this.options;
+
+		this.element
+			.removeClass( "ui-accordion ui-widget ui-helper-reset" )
+			.removeAttr( "role" );
+
+		this.headers
+			.unbind( ".accordion" )
+			.removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+			.removeAttr( "role" )
+			.removeAttr( "aria-expanded" )
+			.removeAttr( "aria-selected" )
+			.removeAttr( "tabIndex" );
+
+		this.headers.find( "a" ).removeAttr( "tabIndex" );
+		this._destroyIcons();
+		var contents = this.headers.next()
+			.css( "display", "" )
+			.removeAttr( "role" )
+			.removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
+		if ( options.autoHeight || options.fillHeight ) {
+			contents.css( "height", "" );
+		}
+
+		return $.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+			
+		if ( key == "active" ) {
+			this.activate( value );
+		}
+		if ( key == "icons" ) {
+			this._destroyIcons();
+			if ( value ) {
+				this._createIcons();
+			}
+		}
+		// #5332 - opacity doesn't cascade to positioned elements in IE
+		// so we need to add the disabled class to the headers and panels
+		if ( key == "disabled" ) {
+			this.headers.add(this.headers.next())
+				[ value ? "addClass" : "removeClass" ](
+					"ui-accordion-disabled ui-state-disabled" );
+		}
+	},
+
+	_keydown: function( event ) {
+		if ( this.options.disabled || event.altKey || event.ctrlKey ) {
+			return;
+		}
+
+		var keyCode = $.ui.keyCode,
+			length = this.headers.length,
+			currentIndex = this.headers.index( event.target ),
+			toFocus = false;
+
+		switch ( event.keyCode ) {
+			case keyCode.RIGHT:
+			case keyCode.DOWN:
+				toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+				break;
+			case keyCode.LEFT:
+			case keyCode.UP:
+				toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+				break;
+			case keyCode.SPACE:
+			case keyCode.ENTER:
+				this._clickHandler( { target: event.target }, event.target );
+				event.preventDefault();
+		}
+
+		if ( toFocus ) {
+			$( event.target ).attr( "tabIndex", -1 );
+			$( toFocus ).attr( "tabIndex", 0 );
+			toFocus.focus();
+			return false;
+		}
+
+		return true;
+	},
+
+	resize: function() {
+		var options = this.options,
+			maxHeight;
+
+		if ( options.fillSpace ) {
+			if ( $.browser.msie ) {
+				var defOverflow = this.element.parent().css( "overflow" );
+				this.element.parent().css( "overflow", "hidden");
+			}
+			maxHeight = this.element.parent().height();
+			if ($.browser.msie) {
+				this.element.parent().css( "overflow", defOverflow );
+			}
+
+			this.headers.each(function() {
+				maxHeight -= $( this ).outerHeight( true );
+			});
+
+			this.headers.next()
+				.each(function() {
+					$( this ).height( Math.max( 0, maxHeight -
+						$( this ).innerHeight() + $( this ).height() ) );
+				})
+				.css( "overflow", "auto" );
+		} else if ( options.autoHeight ) {
+			maxHeight = 0;
+			this.headers.next()
+				.each(function() {
+					maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+				})
+				.height( maxHeight );
+		}
+
+		return this;
+	},
+
+	activate: function( index ) {
+		// TODO this gets called on init, changing the option without an explicit call for that
+		this.options.active = index;
+		// call clickHandler with custom event
+		var active = this._findActive( index )[ 0 ];
+		this._clickHandler( { target: active }, active );
+
+		return this;
+	},
+
+	_findActive: function( selector ) {
+		return selector
+			? typeof selector === "number"
+				? this.headers.filter( ":eq(" + selector + ")" )
+				: this.headers.not( this.headers.not( selector ) )
+			: selector === false
+				? $( [] )
+				: this.headers.filter( ":eq(0)" );
+	},
+
+	// TODO isn't event.target enough? why the separate target argument?
+	_clickHandler: function( event, target ) {
+		var options = this.options;
+		if ( options.disabled ) {
+			return;
+		}
+
+		// called only when using activate(false) to close all parts programmatically
+		if ( !event.target ) {
+			if ( !options.collapsible ) {
+				return;
+			}
+			this.active
+				.removeClass( "ui-state-active ui-corner-top" )
+				.addClass( "ui-state-default ui-corner-all" )
+				.children( ".ui-icon" )
+					.removeClass( options.icons.headerSelected )
+					.addClass( options.icons.header );
+			this.active.next().addClass( "ui-accordion-content-active" );
+			var toHide = this.active.next(),
+				data = {
+					options: options,
+					newHeader: $( [] ),
+					oldHeader: options.active,
+					newContent: $( [] ),
+					oldContent: toHide
+				},
+				toShow = ( this.active = $( [] ) );
+			this._toggle( toShow, toHide, data );
+			return;
+		}
+
+		// get the click target
+		var clicked = $( event.currentTarget || target ),
+			clickedIsActive = clicked[0] === this.active[0];
+
+		// TODO the option is changed, is that correct?
+		// TODO if it is correct, shouldn't that happen after determining that the click is valid?
+		options.active = options.collapsible && clickedIsActive ?
+			false :
+			this.headers.index( clicked );
+
+		// if animations are still active, or the active header is the target, ignore click
+		if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+			return;
+		}
+
+		// find elements to show and hide
+		var active = this.active,
+			toShow = clicked.next(),
+			toHide = this.active.next(),
+			data = {
+				options: options,
+				newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
+				oldHeader: this.active,
+				newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
+				oldContent: toHide
+			},
+			down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+		// when the call to ._toggle() comes after the class changes
+		// it causes a very odd bug in IE 8 (see #6720)
+		this.active = clickedIsActive ? $([]) : clicked;
+		this._toggle( toShow, toHide, data, clickedIsActive, down );
+
+		// switch classes
+		active
+			.removeClass( "ui-state-active ui-corner-top" )
+			.addClass( "ui-state-default ui-corner-all" )
+			.children( ".ui-icon" )
+				.removeClass( options.icons.headerSelected )
+				.addClass( options.icons.header );
+		if ( !clickedIsActive ) {
+			clicked
+				.removeClass( "ui-state-default ui-corner-all" )
+				.addClass( "ui-state-active ui-corner-top" )
+				.children( ".ui-icon" )
+					.removeClass( options.icons.header )
+					.addClass( options.icons.headerSelected );
+			clicked
+				.next()
+				.addClass( "ui-accordion-content-active" );
+		}
+
+		return;
+	},
+
+	_toggle: function( toShow, toHide, data, clickedIsActive, down ) {
+		var self = this,
+			options = self.options;
+
+		self.toShow = toShow;
+		self.toHide = toHide;
+		self.data = data;
+
+		var complete = function() {
+			if ( !self ) {
+				return;
+			}
+			return self._completed.apply( self, arguments );
+		};
+
+		// trigger changestart event
+		self._trigger( "changestart", null, self.data );
+
+		// count elements to animate
+		self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+		if ( options.animated ) {
+			var animOptions = {};
+
+			if ( options.collapsible && clickedIsActive ) {
+				animOptions = {
+					toShow: $( [] ),
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: options.autoHeight || options.fillSpace
+				};
+			} else {
+				animOptions = {
+					toShow: toShow,
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: options.autoHeight || options.fillSpace
+				};
+			}
+
+			if ( !options.proxied ) {
+				options.proxied = options.animated;
+			}
+
+			if ( !options.proxiedDuration ) {
+				options.proxiedDuration = options.duration;
+			}
+
+			options.animated = $.isFunction( options.proxied ) ?
+				options.proxied( animOptions ) :
+				options.proxied;
+
+			options.duration = $.isFunction( options.proxiedDuration ) ?
+				options.proxiedDuration( animOptions ) :
+				options.proxiedDuration;
+
+			var animations = $.ui.accordion.animations,
+				duration = options.duration,
+				easing = options.animated;
+
+			if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
+				easing = "slide";
+			}
+			if ( !animations[ easing ] ) {
+				animations[ easing ] = function( options ) {
+					this.slide( options, {
+						easing: easing,
+						duration: duration || 700
+					});
+				};
+			}
+
+			animations[ easing ]( animOptions );
+		} else {
+			if ( options.collapsible && clickedIsActive ) {
+				toShow.toggle();
+			} else {
+				toHide.hide();
+				toShow.show();
+			}
+
+			complete( true );
+		}
+
+		// TODO assert that the blur and focus triggers are really necessary, remove otherwise
+		toHide.prev()
+			.attr({
+				"aria-expanded": "false",
+				"aria-selected": "false",
+				tabIndex: -1
+			})
+			.blur();
+		toShow.prev()
+			.attr({
+				"aria-expanded": "true",
+				"aria-selected": "true",
+				tabIndex: 0
+			})
+			.focus();
+	},
+
+	_completed: function( cancel ) {
+		this.running = cancel ? 0 : --this.running;
+		if ( this.running ) {
+			return;
+		}
+
+		if ( this.options.clearStyle ) {
+			this.toShow.add( this.toHide ).css({
+				height: "",
+				overflow: ""
+			});
+		}
+
+		// other classes are removed before the animation; this one needs to stay until completed
+		this.toHide.removeClass( "ui-accordion-content-active" );
+		// Work around for rendering bug in IE (#5421)
+		if ( this.toHide.length ) {
+			this.toHide.parent()[0].className = this.toHide.parent()[0].className;
+		}
+
+		this._trigger( "change", null, this.data );
+	}
+});
+
+$.extend( $.ui.accordion, {
+	version: "1.8.11",
+	animations: {
+		slide: function( options, additions ) {
+			options = $.extend({
+				easing: "swing",
+				duration: 300
+			}, options, additions );
+			if ( !options.toHide.size() ) {
+				options.toShow.animate({
+					height: "show",
+					paddingTop: "show",
+					paddingBottom: "show"
+				}, options );
+				return;
+			}
+			if ( !options.toShow.size() ) {
+				options.toHide.animate({
+					height: "hide",
+					paddingTop: "hide",
+					paddingBottom: "hide"
+				}, options );
+				return;
+			}
+			var overflow = options.toShow.css( "overflow" ),
+				percentDone = 0,
+				showProps = {},
+				hideProps = {},
+				fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+				originalWidth;
+			// fix width before calculating height of hidden element
+			var s = options.toShow;
+			originalWidth = s[0].style.width;
+			s.width( parseInt( s.parent().width(), 10 )
+				- parseInt( s.css( "paddingLeft" ), 10 )
+				- parseInt( s.css( "paddingRight" ), 10 )
+				- ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 )
+				- ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) );
+
+			$.each( fxAttrs, function( i, prop ) {
+				hideProps[ prop ] = "hide";
+
+				var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
+				showProps[ prop ] = {
+					value: parts[ 1 ],
+					unit: parts[ 2 ] || "px"
+				};
+			});
+			options.toShow.css({ height: 0, overflow: "hidden" }).show();
+			options.toHide
+				.filter( ":hidden" )
+					.each( options.complete )
+				.end()
+				.filter( ":visible" )
+				.animate( hideProps, {
+				step: function( now, settings ) {
+					// only calculate the percent when animating height
+					// IE gets very inconsistent results when animating elements
+					// with small values, which is common for padding
+					if ( settings.prop == "height" ) {
+						percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+							( settings.now - settings.start ) / ( settings.end - settings.start );
+					}
+
+					options.toShow[ 0 ].style[ settings.prop ] =
+						( percentDone * showProps[ settings.prop ].value )
+						+ showProps[ settings.prop ].unit;
+				},
+				duration: options.duration,
+				easing: options.easing,
+				complete: function() {
+					if ( !options.autoHeight ) {
+						options.toShow.css( "height", "" );
+					}
+					options.toShow.css({
+						width: originalWidth,
+						overflow: overflow
+					});
+					options.complete();
+				}
+			});
+		},
+		bounceslide: function( options ) {
+			this.slide( options, {
+				easing: options.down ? "easeOutBounce" : "swing",
+				duration: options.down ? 1000 : 200
+			});
+		}
+	}
+});
+
+})( jQuery );
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.autocomplete.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,612 @@
+/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function( $, undefined ) {
+
+// used to prevent race conditions with remote data sources
+var requestIndex = 0;
+
+$.widget( "ui.autocomplete", {
+	options: {
+		appendTo: "body",
+		autoFocus: false,
+		delay: 300,
+		minLength: 1,
+		position: {
+			my: "left top",
+			at: "left bottom",
+			collision: "none"
+		},
+		source: null
+	},
+
+	pending: 0,
+
+	_create: function() {
+		var self = this,
+			doc = this.element[ 0 ].ownerDocument,
+			suppressKeyPress;
+
+		this.element
+			.addClass( "ui-autocomplete-input" )
+			.attr( "autocomplete", "off" )
+			// TODO verify these actually work as intended
+			.attr({
+				role: "textbox",
+				"aria-autocomplete": "list",
+				"aria-haspopup": "true"
+			})
+			.bind( "keydown.autocomplete", function( event ) {
+				if ( self.options.disabled || self.element.attr( "readonly" ) ) {
+					return;
+				}
+
+				suppressKeyPress = false;
+				var keyCode = $.ui.keyCode;
+				switch( event.keyCode ) {
+				case keyCode.PAGE_UP:
+					self._move( "previousPage", event );
+					break;
+				case keyCode.PAGE_DOWN:
+					self._move( "nextPage", event );
+					break;
+				case keyCode.UP:
+					self._move( "previous", event );
+					// prevent moving cursor to beginning of text field in some browsers
+					event.preventDefault();
+					break;
+				case keyCode.DOWN:
+					self._move( "next", event );
+					// prevent moving cursor to end of text field in some browsers
+					event.preventDefault();
+					break;
+				case keyCode.ENTER:
+				case keyCode.NUMPAD_ENTER:
+					// when menu is open and has focus
+					if ( self.menu.active ) {
+						// #6055 - Opera still allows the keypress to occur
+						// which causes forms to submit
+						suppressKeyPress = true;
+						event.preventDefault();
+					}
+					//passthrough - ENTER and TAB both select the current element
+				case keyCode.TAB:
+					if ( !self.menu.active ) {
+						return;
+					}
+					self.menu.select( event );
+					break;
+				case keyCode.ESCAPE:
+					self.element.val( self.term );
+					self.close( event );
+					break;
+				default:
+					// keypress is triggered before the input value is changed
+					clearTimeout( self.searching );
+					self.searching = setTimeout(function() {
+						// only search if the value has changed
+						if ( self.term != self.element.val() ) {
+							self.selectedItem = null;
+							self.search( null, event );
+						}
+					}, self.options.delay );
+					break;
+				}
+			})
+			.bind( "keypress.autocomplete", function( event ) {
+				if ( suppressKeyPress ) {
+					suppressKeyPress = false;
+					event.preventDefault();
+				}
+			})
+			.bind( "focus.autocomplete", function() {
+				if ( self.options.disabled ) {
+					return;
+				}
+
+				self.selectedItem = null;
+				self.previous = self.element.val();
+			})
+			.bind( "blur.autocomplete", function( event ) {
+				if ( self.options.disabled ) {
+					return;
+				}
+
+				clearTimeout( self.searching );
+				// clicks on the menu (or a button to trigger a search) will cause a blur event
+				self.closing = setTimeout(function() {
+					self.close( event );
+					self._change( event );
+				}, 150 );
+			});
+		this._initSource();
+		this.response = function() {
+			return self._response.apply( self, arguments );
+		};
+		this.menu = $( "<ul></ul>" )
+			.addClass( "ui-autocomplete" )
+			.appendTo( $( this.options.appendTo || "body", doc )[0] )
+			// prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
+			.mousedown(function( event ) {
+				// clicking on the scrollbar causes focus to shift to the body
+				// but we can't detect a mouseup or a click immediately afterward
+				// so we have to track the next mousedown and close the menu if
+				// the user clicks somewhere outside of the autocomplete
+				var menuElement = self.menu.element[ 0 ];
+				if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
+					setTimeout(function() {
+						$( document ).one( 'mousedown', function( event ) {
+							if ( event.target !== self.element[ 0 ] &&
+								event.target !== menuElement &&
+								!$.ui.contains( menuElement, event.target ) ) {
+								self.close();
+							}
+						});
+					}, 1 );
+				}
+
+				// use another timeout to make sure the blur-event-handler on the input was already triggered
+				setTimeout(function() {
+					clearTimeout( self.closing );
+				}, 13);
+			})
+			.menu({
+				focus: function( event, ui ) {
+					var item = ui.item.data( "item.autocomplete" );
+					if ( false !== self._trigger( "focus", event, { item: item } ) ) {
+						// use value to match what will end up in the input, if it was a key event
+						if ( /^key/.test(event.originalEvent.type) ) {
+							self.element.val( item.value );
+						}
+					}
+				},
+				selected: function( event, ui ) {
+					var item = ui.item.data( "item.autocomplete" ),
+						previous = self.previous;
+
+					// only trigger when focus was lost (click on menu)
+					if ( self.element[0] !== doc.activeElement ) {
+						self.element.focus();
+						self.previous = previous;
+						// #6109 - IE triggers two focus events and the second
+						// is asynchronous, so we need to reset the previous
+						// term synchronously and asynchronously :-(
+						setTimeout(function() {
+							self.previous = previous;
+							self.selectedItem = item;
+						}, 1);
+					}
+
+					if ( false !== self._trigger( "select", event, { item: item } ) ) {
+						self.element.val( item.value );
+					}
+					// reset the term after the select event
+					// this allows custom select handling to work properly
+					self.term = self.element.val();
+
+					self.close( event );
+					self.selectedItem = item;
+				},
+				blur: function( event, ui ) {
+					// don't set the value of the text field if it's already correct
+					// this prevents moving the cursor unnecessarily
+					if ( self.menu.element.is(":visible") &&
+						( self.element.val() !== self.term ) ) {
+						self.element.val( self.term );
+					}
+				}
+			})
+			.zIndex( this.element.zIndex() + 1 )
+			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+			.css({ top: 0, left: 0 })
+			.hide()
+			.data( "menu" );
+		if ( $.fn.bgiframe ) {
+			 this.menu.element.bgiframe();
+		}
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass( "ui-autocomplete-input" )
+			.removeAttr( "autocomplete" )
+			.removeAttr( "role" )
+			.removeAttr( "aria-autocomplete" )
+			.removeAttr( "aria-haspopup" );
+		this.menu.element.remove();
+		$.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+		if ( key === "source" ) {
+			this._initSource();
+		}
+		if ( key === "appendTo" ) {
+			this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+		}
+		if ( key === "disabled" && value && this.xhr ) {
+			this.xhr.abort();
+		}
+	},
+
+	_initSource: function() {
+		var self = this,
+			array,
+			url;
+		if ( $.isArray(this.options.source) ) {
+			array = this.options.source;
+			this.source = function( request, response ) {
+				response( $.ui.autocomplete.filter(array, request.term) );
+			};
+		} else if ( typeof this.options.source === "string" ) {
+			url = this.options.source;
+			this.source = function( request, response ) {
+				if ( self.xhr ) {
+					self.xhr.abort();
+				}
+				self.xhr = $.ajax({
+					url: url,
+					data: request,
+					dataType: "json",
+					autocompleteRequest: ++requestIndex,
+					success: function( data, status ) {
+						if ( this.autocompleteRequest === requestIndex ) {
+							response( data );
+						}
+					},
+					error: function() {
+						if ( this.autocompleteRequest === requestIndex ) {
+							response( [] );
+						}
+					}
+				});
+			};
+		} else {
+			this.source = this.options.source;
+		}
+	},
+
+	search: function( value, event ) {
+		value = value != null ? value : this.element.val();
+
+		// always save the actual value, not the one passed as an argument
+		this.term = this.element.val();
+
+		if ( value.length < this.options.minLength ) {
+			return this.close( event );
+		}
+
+		clearTimeout( this.closing );
+		if ( this._trigger( "search", event ) === false ) {
+			return;
+		}
+
+		return this._search( value );
+	},
+
+	_search: function( value ) {
+		this.pending++;
+		this.element.addClass( "ui-autocomplete-loading" );
+
+		this.source( { term: value }, this.response );
+	},
+
+	_response: function( content ) {
+		if ( !this.options.disabled && content && content.length ) {
+			content = this._normalize( content );
+			this._suggest( content );
+			this._trigger( "open" );
+		} else {
+			this.close();
+		}
+		this.pending--;
+		if ( !this.pending ) {
+			this.element.removeClass( "ui-autocomplete-loading" );
+		}
+	},
+
+	close: function( event ) {
+		clearTimeout( this.closing );
+		if ( this.menu.element.is(":visible") ) {
+			this.menu.element.hide();
+			this.menu.deactivate();
+			this._trigger( "close", event );
+		}
+	},
+	
+	_change: function( event ) {
+		if ( this.previous !== this.element.val() ) {
+			this._trigger( "change", event, { item: this.selectedItem } );
+		}
+	},
+
+	_normalize: function( items ) {
+		// assume all items have the right format when the first item is complete
+		if ( items.length && items[0].label && items[0].value ) {
+			return items;
+		}
+		return $.map( items, function(item) {
+			if ( typeof item === "string" ) {
+				return {
+					label: item,
+					value: item
+				};
+			}
+			return $.extend({
+				label: item.label || item.value,
+				value: item.value || item.label
+			}, item );
+		});
+	},
+
+	_suggest: function( items ) {
+		var ul = this.menu.element
+			.empty()
+			.zIndex( this.element.zIndex() + 1 );
+		this._renderMenu( ul, items );
+		// TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+		this.menu.deactivate();
+		this.menu.refresh();
+
+		// size and position menu
+		ul.show();
+		this._resizeMenu();
+		ul.position( $.extend({
+			of: this.element
+		}, this.options.position ));
+
+		if ( this.options.autoFocus ) {
+			this.menu.next( new $.Event("mouseover") );
+		}
+	},
+
+	_resizeMenu: function() {
+		var ul = this.menu.element;
+		ul.outerWidth( Math.max(
+			ul.width( "" ).outerWidth(),
+			this.element.outerWidth()
+		) );
+	},
+
+	_renderMenu: function( ul, items ) {
+		var self = this;
+		$.each( items, function( index, item ) {
+			self._renderItem( ul, item );
+		});
+	},
+
+	_renderItem: function( ul, item) {
+		return $( "<li></li>" )
+			.data( "item.autocomplete", item )
+			.append( $( "<a></a>" ).text( item.label ) )
+			.appendTo( ul );
+	},
+
+	_move: function( direction, event ) {
+		if ( !this.menu.element.is(":visible") ) {
+			this.search( null, event );
+			return;
+		}
+		if ( this.menu.first() && /^previous/.test(direction) ||
+				this.menu.last() && /^next/.test(direction) ) {
+			this.element.val( this.term );
+			this.menu.deactivate();
+			return;
+		}
+		this.menu[ direction ]( event );
+	},
+
+	widget: function() {
+		return this.menu.element;
+	}
+});
+
+$.extend( $.ui.autocomplete, {
+	escapeRegex: function( value ) {
+		return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+	},
+	filter: function(array, term) {
+		var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+		return $.grep( array, function(value) {
+			return matcher.test( value.label || value.value || value );
+		});
+	}
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ * 
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *  jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+	_create: function() {
+		var self = this;
+		this.element
+			.addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+			.attr({
+				role: "listbox",
+				"aria-activedescendant": "ui-active-menuitem"
+			})
+			.click(function( event ) {
+				if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+					return;
+				}
+				// temporary
+				event.preventDefault();
+				self.select( event );
+			});
+		this.refresh();
+	},
+	
+	refresh: function() {
+		var self = this;
+
+		// don't refresh list items that are already adapted
+		var items = this.element.children("li:not(.ui-menu-item):has(a)")
+			.addClass("ui-menu-item")
+			.attr("role", "menuitem");
+		
+		items.children("a")
+			.addClass("ui-corner-all")
+			.attr("tabindex", -1)
+			// mouseenter doesn't work with event delegation
+			.mouseenter(function( event ) {
+				self.activate( event, $(this).parent() );
+			})
+			.mouseleave(function() {
+				self.deactivate();
+			});
+	},
+
+	activate: function( event, item ) {
+		this.deactivate();
+		if (this.hasScroll()) {
+			var offset = item.offset().top - this.element.offset().top,
+				scroll = this.element.attr("scrollTop"),
+				elementHeight = this.element.height();
+			if (offset < 0) {
+				this.element.attr("scrollTop", scroll + offset);
+			} else if (offset >= elementHeight) {
+				this.element.attr("scrollTop", scroll + offset - elementHeight + item.height());
+			}
+		}
+		this.active = item.eq(0)
+			.children("a")
+				.addClass("ui-state-hover")
+				.attr("id", "ui-active-menuitem")
+			.end();
+		this._trigger("focus", event, { item: item });
+	},
+
+	deactivate: function() {
+		if (!this.active) { return; }
+
+		this.active.children("a")
+			.removeClass("ui-state-hover")
+			.removeAttr("id");
+		this._trigger("blur");
+		this.active = null;
+	},
+
+	next: function(event) {
+		this.move("next", ".ui-menu-item:first", event);
+	},
+
+	previous: function(event) {
+		this.move("prev", ".ui-menu-item:last", event);
+	},
+
+	first: function() {
+		return this.active && !this.active.prevAll(".ui-menu-item").length;
+	},
+
+	last: function() {
+		return this.active && !this.active.nextAll(".ui-menu-item").length;
+	},
+
+	move: function(direction, edge, event) {
+		if (!this.active) {
+			this.activate(event, this.element.children(edge));
+			return;
+		}
+		var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+		if (next.length) {
+			this.activate(event, next);
+		} else {
+			this.activate(event, this.element.children(edge));
+		}
+	},
+
+	// TODO merge with previousPage
+	nextPage: function(event) {
+		if (this.hasScroll()) {
+			// TODO merge with no-scroll-else
+			if (!this.active || this.last()) {
+				this.activate(event, this.element.children(".ui-menu-item:first"));
+				return;
+			}
+			var base = this.active.offset().top,
+				height = this.element.height(),
+				result = this.element.children(".ui-menu-item").filter(function() {
+					var close = $(this).offset().top - base - height + $(this).height();
+					// TODO improve approximation
+					return close < 10 && close > -10;
+				});
+
+			// TODO try to catch this earlier when scrollTop indicates the last page anyway
+			if (!result.length) {
+				result = this.element.children(".ui-menu-item:last");
+			}
+			this.activate(event, result);
+		} else {
+			this.activate(event, this.element.children(".ui-menu-item")
+				.filter(!this.active || this.last() ? ":first" : ":last"));
+		}
+	},
+
+	// TODO merge with nextPage
+	previousPage: function(event) {
+		if (this.hasScroll()) {
+			// TODO merge with no-scroll-else
+			if (!this.active || this.first()) {
+				this.activate(event, this.element.children(".ui-menu-item:last"));
+				return;
+			}
+
+			var base = this.active.offset().top,
+				height = this.element.height();
+				result = this.element.children(".ui-menu-item").filter(function() {
+					var close = $(this).offset().top - base + height - $(this).height();
+					// TODO improve approximation
+					return close < 10 && close > -10;
+				});
+
+			// TODO try to catch this earlier when scrollTop indicates the last page anyway
+			if (!result.length) {
+				result = this.element.children(".ui-menu-item:first");
+			}
+			this.activate(event, result);
+		} else {
+			this.activate(event, this.element.children(".ui-menu-item")
+				.filter(!this.active || this.first() ? ":last" : ":first"));
+		}
+	},
+
+	hasScroll: function() {
+		return this.element.height() < this.element.attr("scrollHeight");
+	},
+
+	select: function( event ) {
+		this._trigger("selected", event, { item: this.active });
+	}
+});
+
+}(jQuery));
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.button.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,387 @@
+/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var lastActive,
+	baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+	stateClasses = "ui-state-hover ui-state-active ",
+	typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+	formResetHandler = function( event ) {
+		$( ":ui-button", event.target.form ).each(function() {
+			var inst = $( this ).data( "button" );
+			setTimeout(function() {
+				inst.refresh();
+			}, 1 );
+		});
+	},
+	radioGroup = function( radio ) {
+		var name = radio.name,
+			form = radio.form,
+			radios = $( [] );
+		if ( name ) {
+			if ( form ) {
+				radios = $( form ).find( "[name='" + name + "']" );
+			} else {
+				radios = $( "[name='" + name + "']", radio.ownerDocument )
+					.filter(function() {
+						return !this.form;
+					});
+			}
+		}
+		return radios;
+	};
+
+$.widget( "ui.button", {
+	options: {
+		disabled: null,
+		text: true,
+		label: null,
+		icons: {
+			primary: null,
+			secondary: null
+		}
+	},
+	_create: function() {
+		this.element.closest( "form" )
+			.unbind( "reset.button" )
+			.bind( "reset.button", formResetHandler );
+
+		if ( typeof this.options.disabled !== "boolean" ) {
+			this.options.disabled = this.element.attr( "disabled" );
+		}
+
+		this._determineButtonType();
+		this.hasTitle = !!this.buttonElement.attr( "title" );
+
+		var self = this,
+			options = this.options,
+			toggleButton = this.type === "checkbox" || this.type === "radio",
+			hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+			focusClass = "ui-state-focus";
+
+		if ( options.label === null ) {
+			options.label = this.buttonElement.html();
+		}
+
+		if ( this.element.is( ":disabled" ) ) {
+			options.disabled = true;
+		}
+
+		this.buttonElement
+			.addClass( baseClasses )
+			.attr( "role", "button" )
+			.bind( "mouseenter.button", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-hover" );
+				if ( this === lastActive ) {
+					$( this ).addClass( "ui-state-active" );
+				}
+			})
+			.bind( "mouseleave.button", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( hoverClass );
+			})
+			.bind( "focus.button", function() {
+				// no need to check disabled, focus won't be triggered anyway
+				$( this ).addClass( focusClass );
+			})
+			.bind( "blur.button", function() {
+				$( this ).removeClass( focusClass );
+			});
+
+		if ( toggleButton ) {
+			this.element.bind( "change.button", function() {
+				self.refresh();
+			});
+		}
+
+		if ( this.type === "checkbox" ) {
+			this.buttonElement.bind( "click.button", function() {
+				if ( options.disabled ) {
+					return false;
+				}
+				$( this ).toggleClass( "ui-state-active" );
+				self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+			});
+		} else if ( this.type === "radio" ) {
+			this.buttonElement.bind( "click.button", function() {
+				if ( options.disabled ) {
+					return false;
+				}
+				$( this ).addClass( "ui-state-active" );
+				self.buttonElement.attr( "aria-pressed", true );
+
+				var radio = self.element[ 0 ];
+				radioGroup( radio )
+					.not( radio )
+					.map(function() {
+						return $( this ).button( "widget" )[ 0 ];
+					})
+					.removeClass( "ui-state-active" )
+					.attr( "aria-pressed", false );
+			});
+		} else {
+			this.buttonElement
+				.bind( "mousedown.button", function() {
+					if ( options.disabled ) {
+						return false;
+					}
+					$( this ).addClass( "ui-state-active" );
+					lastActive = this;
+					$( document ).one( "mouseup", function() {
+						lastActive = null;
+					});
+				})
+				.bind( "mouseup.button", function() {
+					if ( options.disabled ) {
+						return false;
+					}
+					$( this ).removeClass( "ui-state-active" );
+				})
+				.bind( "keydown.button", function(event) {
+					if ( options.disabled ) {
+						return false;
+					}
+					if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+						$( this ).addClass( "ui-state-active" );
+					}
+				})
+				.bind( "keyup.button", function() {
+					$( this ).removeClass( "ui-state-active" );
+				});
+
+			if ( this.buttonElement.is("a") ) {
+				this.buttonElement.keyup(function(event) {
+					if ( event.keyCode === $.ui.keyCode.SPACE ) {
+						// TODO pass through original event correctly (just as 2nd argument doesn't work)
+						$( this ).click();
+					}
+				});
+			}
+		}
+
+		// TODO: pull out $.Widget's handling for the disabled option into
+		// $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+		// be overridden by individual plugins
+		this._setOption( "disabled", options.disabled );
+	},
+
+	_determineButtonType: function() {
+		
+		if ( this.element.is(":checkbox") ) {
+			this.type = "checkbox";
+		} else {
+			if ( this.element.is(":radio") ) {
+				this.type = "radio";
+			} else {
+				if ( this.element.is("input") ) {
+					this.type = "input";
+				} else {
+					this.type = "button";
+				}
+			}
+		}
+		
+		if ( this.type === "checkbox" || this.type === "radio" ) {
+			// we don't search against the document in case the element
+			// is disconnected from the DOM
+			var ancestor = this.element.parents().filter(":last"),
+				labelSelector = "label[for=" + this.element.attr("id") + "]";
+			this.buttonElement = ancestor.find( labelSelector );
+			if ( !this.buttonElement.length ) {
+				ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+				this.buttonElement = ancestor.filter( labelSelector );
+				if ( !this.buttonElement.length ) {
+					this.buttonElement = ancestor.find( labelSelector );
+				}
+			}
+			this.element.addClass( "ui-helper-hidden-accessible" );
+
+			var checked = this.element.is( ":checked" );
+			if ( checked ) {
+				this.buttonElement.addClass( "ui-state-active" );
+			}
+			this.buttonElement.attr( "aria-pressed", checked );
+		} else {
+			this.buttonElement = this.element;
+		}
+	},
+
+	widget: function() {
+		return this.buttonElement;
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass( "ui-helper-hidden-accessible" );
+		this.buttonElement
+			.removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
+			.removeAttr( "role" )
+			.removeAttr( "aria-pressed" )
+			.html( this.buttonElement.find(".ui-button-text").html() );
+
+		if ( !this.hasTitle ) {
+			this.buttonElement.removeAttr( "title" );
+		}
+
+		$.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+		if ( key === "disabled" ) {
+			if ( value ) {
+				this.element.attr( "disabled", true );
+			} else {
+				this.element.removeAttr( "disabled" );
+			}
+		}
+		this._resetButton();
+	},
+
+	refresh: function() {
+		var isDisabled = this.element.is( ":disabled" );
+		if ( isDisabled !== this.options.disabled ) {
+			this._setOption( "disabled", isDisabled );
+		}
+		if ( this.type === "radio" ) {
+			radioGroup( this.element[0] ).each(function() {
+				if ( $( this ).is( ":checked" ) ) {
+					$( this ).button( "widget" )
+						.addClass( "ui-state-active" )
+						.attr( "aria-pressed", true );
+				} else {
+					$( this ).button( "widget" )
+						.removeClass( "ui-state-active" )
+						.attr( "aria-pressed", false );
+				}
+			});
+		} else if ( this.type === "checkbox" ) {
+			if ( this.element.is( ":checked" ) ) {
+				this.buttonElement
+					.addClass( "ui-state-active" )
+					.attr( "aria-pressed", true );
+			} else {
+				this.buttonElement
+					.removeClass( "ui-state-active" )
+					.attr( "aria-pressed", false );
+			}
+		}
+	},
+
+	_resetButton: function() {
+		if ( this.type === "input" ) {
+			if ( this.options.label ) {
+				this.element.val( this.options.label );
+			}
+			return;
+		}
+		var buttonElement = this.buttonElement.removeClass( typeClasses ),
+			buttonText = $( "<span></span>" )
+				.addClass( "ui-button-text" )
+				.html( this.options.label )
+				.appendTo( buttonElement.empty() )
+				.text(),
+			icons = this.options.icons,
+			multipleIcons = icons.primary && icons.secondary,
+			buttonClasses = [];  
+
+		if ( icons.primary || icons.secondary ) {
+			if ( this.options.text ) {
+				buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
+			}
+
+			if ( icons.primary ) {
+				buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+			}
+
+			if ( icons.secondary ) {
+				buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+			}
+
+			if ( !this.options.text ) {
+				buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+
+				if ( !this.hasTitle ) {
+					buttonElement.attr( "title", buttonText );
+				}
+			}
+		} else {
+			buttonClasses.push( "ui-button-text-only" );
+		}
+		buttonElement.addClass( buttonClasses.join( " " ) );
+	}
+});
+
+$.widget( "ui.buttonset", {
+	options: {
+		items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
+	},
+
+	_create: function() {
+		this.element.addClass( "ui-buttonset" );
+	},
+	
+	_init: function() {
+		this.refresh();
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "disabled" ) {
+			this.buttons.button( "option", key, value );
+		}
+
+		$.Widget.prototype._setOption.apply( this, arguments );
+	},
+	
+	refresh: function() {
+		this.buttons = this.element.find( this.options.items )
+			.filter( ":ui-button" )
+				.button( "refresh" )
+			.end()
+			.not( ":ui-button" )
+				.button()
+			.end()
+			.map(function() {
+				return $( this ).button( "widget" )[ 0 ];
+			})
+				.removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+				.filter( ":first" )
+					.addClass( "ui-corner-left" )
+				.end()
+				.filter( ":last" )
+					.addClass( "ui-corner-right" )
+				.end()
+			.end();
+	},
+
+	destroy: function() {
+		this.element.removeClass( "ui-buttonset" );
+		this.buttons
+			.map(function() {
+				return $( this ).button( "widget" )[ 0 ];
+			})
+				.removeClass( "ui-corner-left ui-corner-right" )
+			.end()
+			.button( "destroy" );
+
+		$.Widget.prototype.destroy.call( this );
+	}
+});
+
+}( jQuery ) );
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.core.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,308 @@
+/*!
+ * jQuery UI 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function( $, undefined ) {
+
+// prevent duplicate loading
+// this is only a problem because we proxy existing functions
+// and we don't want to double proxy them
+$.ui = $.ui || {};
+if ( $.ui.version ) {
+	return;
+}
+
+$.extend( $.ui, {
+	version: "1.8.11",
+
+	keyCode: {
+		ALT: 18,
+		BACKSPACE: 8,
+		CAPS_LOCK: 20,
+		COMMA: 188,
+		COMMAND: 91,
+		COMMAND_LEFT: 91, // COMMAND
+		COMMAND_RIGHT: 93,
+		CONTROL: 17,
+		DELETE: 46,
+		DOWN: 40,
+		END: 35,
+		ENTER: 13,
+		ESCAPE: 27,
+		HOME: 36,
+		INSERT: 45,
+		LEFT: 37,
+		MENU: 93, // COMMAND_RIGHT
+		NUMPAD_ADD: 107,
+		NUMPAD_DECIMAL: 110,
+		NUMPAD_DIVIDE: 111,
+		NUMPAD_ENTER: 108,
+		NUMPAD_MULTIPLY: 106,
+		NUMPAD_SUBTRACT: 109,
+		PAGE_DOWN: 34,
+		PAGE_UP: 33,
+		PERIOD: 190,
+		RIGHT: 39,
+		SHIFT: 16,
+		SPACE: 32,
+		TAB: 9,
+		UP: 38,
+		WINDOWS: 91 // COMMAND
+	}
+});
+
+// plugins
+$.fn.extend({
+	_focus: $.fn.focus,
+	focus: function( delay, fn ) {
+		return typeof delay === "number" ?
+			this.each(function() {
+				var elem = this;
+				setTimeout(function() {
+					$( elem ).focus();
+					if ( fn ) {
+						fn.call( elem );
+					}
+				}, delay );
+			}) :
+			this._focus.apply( this, arguments );
+	},
+
+	scrollParent: function() {
+		var scrollParent;
+		if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+			scrollParent = this.parents().filter(function() {
+				return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		} else {
+			scrollParent = this.parents().filter(function() {
+				return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		}
+
+		return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+	},
+
+	zIndex: function( zIndex ) {
+		if ( zIndex !== undefined ) {
+			return this.css( "zIndex", zIndex );
+		}
+
+		if ( this.length ) {
+			var elem = $( this[ 0 ] ), position, value;
+			while ( elem.length && elem[ 0 ] !== document ) {
+				// Ignore z-index if position is set to a value where z-index is ignored by the browser
+				// This makes behavior of this function consistent across browsers
+				// WebKit always returns auto if the element is positioned
+				position = elem.css( "position" );
+				if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+					// IE returns 0 when zIndex is not specified
+					// other browsers return a string
+					// we ignore the case of nested elements with an explicit value of 0
+					// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+					value = parseInt( elem.css( "zIndex" ), 10 );
+					if ( !isNaN( value ) && value !== 0 ) {
+						return value;
+					}
+				}
+				elem = elem.parent();
+			}
+		}
+
+		return 0;
+	},
+
+	disableSelection: function() {
+		return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+			".ui-disableSelection", function( event ) {
+				event.preventDefault();
+			});
+	},
+
+	enableSelection: function() {
+		return this.unbind( ".ui-disableSelection" );
+	}
+});
+
+$.each( [ "Width", "Height" ], function( i, name ) {
+	var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+		type = name.toLowerCase(),
+		orig = {
+			innerWidth: $.fn.innerWidth,
+			innerHeight: $.fn.innerHeight,
+			outerWidth: $.fn.outerWidth,
+			outerHeight: $.fn.outerHeight
+		};
+
+	function reduce( elem, size, border, margin ) {
+		$.each( side, function() {
+			size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
+			if ( border ) {
+				size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
+			}
+			if ( margin ) {
+				size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
+			}
+		});
+		return size;
+	}
+
+	$.fn[ "inner" + name ] = function( size ) {
+		if ( size === undefined ) {
+			return orig[ "inner" + name ].call( this );
+		}
+
+		return this.each(function() {
+			$( this ).css( type, reduce( this, size ) + "px" );
+		});
+	};
+
+	$.fn[ "outer" + name] = function( size, margin ) {
+		if ( typeof size !== "number" ) {
+			return orig[ "outer" + name ].call( this, size );
+		}
+
+		return this.each(function() {
+			$( this).css( type, reduce( this, size, true, margin ) + "px" );
+		});
+	};
+});
+
+// selectors
+function visible( element ) {
+	return !$( element ).parents().andSelf().filter(function() {
+		return $.curCSS( this, "visibility" ) === "hidden" ||
+			$.expr.filters.hidden( this );
+	}).length;
+}
+
+$.extend( $.expr[ ":" ], {
+	data: function( elem, i, match ) {
+		return !!$.data( elem, match[ 3 ] );
+	},
+
+	focusable: function( element ) {
+		var nodeName = element.nodeName.toLowerCase(),
+			tabIndex = $.attr( element, "tabindex" );
+		if ( "area" === nodeName ) {
+			var map = element.parentNode,
+				mapName = map.name,
+				img;
+			if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+				return false;
+			}
+			img = $( "img[usemap=#" + mapName + "]" )[0];
+			return !!img && visible( img );
+		}
+		return ( /input|select|textarea|button|object/.test( nodeName )
+			? !element.disabled
+			: "a" == nodeName
+				? element.href || !isNaN( tabIndex )
+				: !isNaN( tabIndex ))
+			// the element and all of its ancestors must be visible
+			&& visible( element );
+	},
+
+	tabbable: function( element ) {
+		var tabIndex = $.attr( element, "tabindex" );
+		return ( isNaN( tabIndex ) || tabIndex >= 0 ) && $( element ).is( ":focusable" );
+	}
+});
+
+// support
+$(function() {
+	var body = document.body,
+		div = body.appendChild( div = document.createElement( "div" ) );
+
+	$.extend( div.style, {
+		minHeight: "100px",
+		height: "auto",
+		padding: 0,
+		borderWidth: 0
+	});
+
+	$.support.minHeight = div.offsetHeight === 100;
+	$.support.selectstart = "onselectstart" in div;
+
+	// set display to none to avoid a layout bug in IE
+	// http://dev.jquery.com/ticket/4014
+	body.removeChild( div ).style.display = "none";
+});
+
+
+
+
+
+// deprecated
+$.extend( $.ui, {
+	// $.ui.plugin is deprecated.  Use the proxy pattern instead.
+	plugin: {
+		add: function( module, option, set ) {
+			var proto = $.ui[ module ].prototype;
+			for ( var i in set ) {
+				proto.plugins[ i ] = proto.plugins[ i ] || [];
+				proto.plugins[ i ].push( [ option, set[ i ] ] );
+			}
+		},
+		call: function( instance, name, args ) {
+			var set = instance.plugins[ name ];
+			if ( !set || !instance.element[ 0 ].parentNode ) {
+				return;
+			}
+	
+			for ( var i = 0; i < set.length; i++ ) {
+				if ( instance.options[ set[ i ][ 0 ] ] ) {
+					set[ i ][ 1 ].apply( instance.element, args );
+				}
+			}
+		}
+	},
+	
+	// will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
+	contains: function( a, b ) {
+		return document.compareDocumentPosition ?
+			a.compareDocumentPosition( b ) & 16 :
+			a !== b && a.contains( b );
+	},
+	
+	// only used by resizable
+	hasScroll: function( el, a ) {
+	
+		//If overflow is hidden, the element might have extra content, but the user wants to hide it
+		if ( $( el ).css( "overflow" ) === "hidden") {
+			return false;
+		}
+	
+		var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+			has = false;
+	
+		if ( el[ scroll ] > 0 ) {
+			return true;
+		}
+	
+		// TODO: determine which cases actually cause this to happen
+		// if the element doesn't have the scroll set, see if it's possible to
+		// set the scroll
+		el[ scroll ] = 1;
+		has = ( el[ scroll ] > 0 );
+		el[ scroll ] = 0;
+		return has;
+	},
+	
+	// these are odd functions, fix the API or move into individual plugins
+	isOverAxis: function( x, reference, size ) {
+		//Determines when x coordinate is over "b" element axis
+		return ( x > reference ) && ( x < ( reference + size ) );
+	},
+	isOver: function( y, x, top, left, height, width ) {
+		//Determines when x, y coordinates is over "b" element
+		return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
+	}
+});
+
+})( jQuery );
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.dialog.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,857 @@
+/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *  jquery.ui.button.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function( $, undefined ) {
+
+var uiDialogClasses =
+		'ui-dialog ' +
+		'ui-widget ' +
+		'ui-widget-content ' +
+		'ui-corner-all ',
+	sizeRelatedOptions = {
+		buttons: true,
+		height: true,
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true,
+		width: true
+	},
+	resizableRelatedOptions = {
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true
+	};
+
+$.widget("ui.dialog", {
+	options: {
+		autoOpen: true,
+		buttons: {},
+		closeOnEscape: true,
+		closeText: 'close',
+		dialogClass: '',
+		draggable: true,
+		hide: null,
+		height: 'auto',
+		maxHeight: false,
+		maxWidth: false,
+		minHeight: 150,
+		minWidth: 150,
+		modal: false,
+		position: {
+			my: 'center',
+			at: 'center',
+			collision: 'fit',
+			// ensure that the titlebar is never outside the document
+			using: function(pos) {
+				var topOffset = $(this).css(pos).offset().top;
+				if (topOffset < 0) {
+					$(this).css('top', pos.top - topOffset);
+				}
+			}
+		},
+		resizable: true,
+		show: null,
+		stack: true,
+		title: '',
+		width: 300,
+		zIndex: 1000
+	},
+
+	_create: function() {
+		this.originalTitle = this.element.attr('title');
+		// #5742 - .attr() might return a DOMElement
+		if ( typeof this.originalTitle !== "string" ) {
+			this.originalTitle = "";
+		}
+
+		this.options.title = this.options.title || this.originalTitle;
+		var self = this,
+			options = self.options,
+
+			title = options.title || '&#160;',
+			titleId = $.ui.dialog.getTitleId(self.element),
+
+			uiDialog = (self.uiDialog = $('<div></div>'))
+				.appendTo(document.body)
+				.hide()
+				.addClass(uiDialogClasses + options.dialogClass)
+				.css({
+					zIndex: options.zIndex
+				})
+				// setting tabIndex makes the div focusable
+				// setting outline to 0 prevents a border on focus in Mozilla
+				.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+					if (options.closeOnEscape && event.keyCode &&
+						event.keyCode === $.ui.keyCode.ESCAPE) {
+						
+						self.close(event);
+						event.preventDefault();
+					}
+				})
+				.attr({
+					role: 'dialog',
+					'aria-labelledby': titleId
+				})
+				.mousedown(function(event) {
+					self.moveToTop(false, event);
+				}),
+
+			uiDialogContent = self.element
+				.show()
+				.removeAttr('title')
+				.addClass(
+					'ui-dialog-content ' +
+					'ui-widget-content')
+				.appendTo(uiDialog),
+
+			uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+				.addClass(
+					'ui-dialog-titlebar ' +
+					'ui-widget-header ' +
+					'ui-corner-all ' +
+					'ui-helper-clearfix'
+				)
+				.prependTo(uiDialog),
+
+			uiDialogTitlebarClose = $('<a href="#"></a>')
+				.addClass(
+					'ui-dialog-titlebar-close ' +
+					'ui-corner-all'
+				)
+				.attr('role', 'button')
+				.hover(
+					function() {
+						uiDialogTitlebarClose.addClass('ui-state-hover');
+					},
+					function() {
+						uiDialogTitlebarClose.removeClass('ui-state-hover');
+					}
+				)
+				.focus(function() {
+					uiDialogTitlebarClose.addClass('ui-state-focus');
+				})
+				.blur(function() {
+					uiDialogTitlebarClose.removeClass('ui-state-focus');
+				})
+				.click(function(event) {
+					self.close(event);
+					return false;
+				})
+				.appendTo(uiDialogTitlebar),
+
+			uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+				.addClass(
+					'ui-icon ' +
+					'ui-icon-closethick'
+				)
+				.text(options.closeText)
+				.appendTo(uiDialogTitlebarClose),
+
+			uiDialogTitle = $('<span></span>')
+				.addClass('ui-dialog-title')
+				.attr('id', titleId)
+				.html(title)
+				.prependTo(uiDialogTitlebar);
+
+		//handling of deprecated beforeclose (vs beforeClose) option
+		//Ticket #4669 http://dev.jqueryui.com/ticket/4669
+		//TODO: remove in 1.9pre
+		if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+			options.beforeClose = options.beforeclose;
+		}
+
+		uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+		if (options.draggable && $.fn.draggable) {
+			self._makeDraggable();
+		}
+		if (options.resizable && $.fn.resizable) {
+			self._makeResizable();
+		}
+
+		self._createButtons(options.buttons);
+		self._isOpen = false;
+
+		if ($.fn.bgiframe) {
+			uiDialog.bgiframe();
+		}
+	},
+
+	_init: function() {
+		if ( this.options.autoOpen ) {
+			this.open();
+		}
+	},
+
+	destroy: function() {
+		var self = this;
+		
+		if (self.overlay) {
+			self.overlay.destroy();
+		}
+		self.uiDialog.hide();
+		self.element
+			.unbind('.dialog')
+			.removeData('dialog')
+			.removeClass('ui-dialog-content ui-widget-content')
+			.hide().appendTo('body');
+		self.uiDialog.remove();
+
+		if (self.originalTitle) {
+			self.element.attr('title', self.originalTitle);
+		}
+
+		return self;
+	},
+
+	widget: function() {
+		return this.uiDialog;
+	},
+
+	close: function(event) {
+		var self = this,
+			maxZ, thisZ;
+		
+		if (false === self._trigger('beforeClose', event)) {
+			return;
+		}
+
+		if (self.overlay) {
+			self.overlay.destroy();
+		}
+		self.uiDialog.unbind('keypress.ui-dialog');
+
+		self._isOpen = false;
+
+		if (self.options.hide) {
+			self.uiDialog.hide(self.options.hide, function() {
+				self._trigger('close', event);
+			});
+		} else {
+			self.uiDialog.hide();
+			self._trigger('close', event);
+		}
+
+		$.ui.dialog.overlay.resize();
+
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		if (self.options.modal) {
+			maxZ = 0;
+			$('.ui-dialog').each(function() {
+				if (this !== self.uiDialog[0]) {
+					thisZ = $(this).css('z-index');
+					if(!isNaN(thisZ)) {
+						maxZ = Math.max(maxZ, thisZ);
+					}
+				}
+			});
+			$.ui.dialog.maxZ = maxZ;
+		}
+
+		return self;
+	},
+
+	isOpen: function() {
+		return this._isOpen;
+	},
+
+	// the force parameter allows us to move modal dialogs to their correct
+	// position on open
+	moveToTop: function(force, event) {
+		var self = this,
+			options = self.options,
+			saveScroll;
+
+		if ((options.modal && !force) ||
+			(!options.stack && !options.modal)) {
+			return self._trigger('focus', event);
+		}
+
+		if (options.zIndex > $.ui.dialog.maxZ) {
+			$.ui.dialog.maxZ = options.zIndex;
+		}
+		if (self.overlay) {
+			$.ui.dialog.maxZ += 1;
+			self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+		}
+
+		//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+		//  http://ui.jquery.com/bugs/ticket/3193
+		saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+		$.ui.dialog.maxZ += 1;
+		self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+		self.element.attr(saveScroll);
+		self._trigger('focus', event);
+
+		return self;
+	},
+
+	open: function() {
+		if (this._isOpen) { return; }
+
+		var self = this,
+			options = self.options,
+			uiDialog = self.uiDialog;
+
+		self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+		self._size();
+		self._position(options.position);
+		uiDialog.show(options.show);
+		self.moveToTop(true);
+
+		// prevent tabbing out of modal dialogs
+		if (options.modal) {
+			uiDialog.bind('keypress.ui-dialog', function(event) {
+				if (event.keyCode !== $.ui.keyCode.TAB) {
+					return;
+				}
+
+				var tabbables = $(':tabbable', this),
+					first = tabbables.filter(':first'),
+					last  = tabbables.filter(':last');
+
+				if (event.target === last[0] && !event.shiftKey) {
+					first.focus(1);
+					return false;
+				} else if (event.target === first[0] && event.shiftKey) {
+					last.focus(1);
+					return false;
+				}
+			});
+		}
+
+		// set focus to the first tabbable element in the content area or the first button
+		// if there are no tabbable elements, set focus on the dialog itself
+		$(self.element.find(':tabbable').get().concat(
+			uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
+				uiDialog.get()))).eq(0).focus();
+
+		self._isOpen = true;
+		self._trigger('open');
+
+		return self;
+	},
+
+	_createButtons: function(buttons) {
+		var self = this,
+			hasButtons = false,
+			uiDialogButtonPane = $('<div></div>')
+				.addClass(
+					'ui-dialog-buttonpane ' +
+					'ui-widget-content ' +
+					'ui-helper-clearfix'
+				),
+			uiButtonSet = $( "<div></div>" )
+				.addClass( "ui-dialog-buttonset" )
+				.appendTo( uiDialogButtonPane );
+
+		// if we already have a button pane, remove it
+		self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+		if (typeof buttons === 'object' && buttons !== null) {
+			$.each(buttons, function() {
+				return !(hasButtons = true);
+			});
+		}
+		if (hasButtons) {
+			$.each(buttons, function(name, props) {
+				props = $.isFunction( props ) ?
+					{ click: props, text: name } :
+					props;
+				var button = $('<button type="button"></button>')
+					.attr( props, true )
+					.unbind('click')
+					.click(function() {
+						props.click.apply(self.element[0], arguments);
+					})
+					.appendTo(uiButtonSet);
+				if ($.fn.button) {
+					button.button();
+				}
+			});
+			uiDialogButtonPane.appendTo(self.uiDialog);
+		}
+	},
+
+	_makeDraggable: function() {
+		var self = this,
+			options = self.options,
+			doc = $(document),
+			heightBeforeDrag;
+
+		function filteredUi(ui) {
+			return {
+				position: ui.position,
+				offset: ui.offset
+			};
+		}
+
+		self.uiDialog.draggable({
+			cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+			handle: '.ui-dialog-titlebar',
+			containment: 'document',
+			start: function(event, ui) {
+				heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+				$(this).height($(this).height()).addClass("ui-dialog-dragging");
+				self._trigger('dragStart', event, filteredUi(ui));
+			},
+			drag: function(event, ui) {
+				self._trigger('drag', event, filteredUi(ui));
+			},
+			stop: function(event, ui) {
+				options.position = [ui.position.left - doc.scrollLeft(),
+					ui.position.top - doc.scrollTop()];
+				$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+				self._trigger('dragStop', event, filteredUi(ui));
+				$.ui.dialog.overlay.resize();
+			}
+		});
+	},
+
+	_makeResizable: function(handles) {
+		handles = (handles === undefined ? this.options.resizable : handles);
+		var self = this,
+			options = self.options,
+			// .ui-resizable has position: relative defined in the stylesheet
+			// but dialogs have to use absolute or fixed positioning
+			position = self.uiDialog.css('position'),
+			resizeHandles = (typeof handles === 'string' ?
+				handles	:
+				'n,e,s,w,se,sw,ne,nw'
+			);
+
+		function filteredUi(ui) {
+			return {
+				originalPosition: ui.originalPosition,
+				originalSize: ui.originalSize,
+				position: ui.position,
+				size: ui.size
+			};
+		}
+
+		self.uiDialog.resizable({
+			cancel: '.ui-dialog-content',
+			containment: 'document',
+			alsoResize: self.element,
+			maxWidth: options.maxWidth,
+			maxHeight: options.maxHeight,
+			minWidth: options.minWidth,
+			minHeight: self._minHeight(),
+			handles: resizeHandles,
+			start: function(event, ui) {
+				$(this).addClass("ui-dialog-resizing");
+				self._trigger('resizeStart', event, filteredUi(ui));
+			},
+			resize: function(event, ui) {
+				self._trigger('resize', event, filteredUi(ui));
+			},
+			stop: function(event, ui) {
+				$(this).removeClass("ui-dialog-resizing");
+				options.height = $(this).height();
+				options.width = $(this).width();
+				self._trigger('resizeStop', event, filteredUi(ui));
+				$.ui.dialog.overlay.resize();
+			}
+		})
+		.css('position', position)
+		.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+	},
+
+	_minHeight: function() {
+		var options = this.options;
+
+		if (options.height === 'auto') {
+			return options.minHeight;
+		} else {
+			return Math.min(options.minHeight, options.height);
+		}
+	},
+
+	_position: function(position) {
+		var myAt = [],
+			offset = [0, 0],
+			isVisible;
+
+		if (position) {
+			// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+	//		if (typeof position == 'string' || $.isArray(position)) {
+	//			myAt = $.isArray(position) ? position : position.split(' ');
+
+			if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+				myAt = position.split ? position.split(' ') : [position[0], position[1]];
+				if (myAt.length === 1) {
+					myAt[1] = myAt[0];
+				}
+
+				$.each(['left', 'top'], function(i, offsetPosition) {
+					if (+myAt[i] === myAt[i]) {
+						offset[i] = myAt[i];
+						myAt[i] = offsetPosition;
+					}
+				});
+
+				position = {
+					my: myAt.join(" "),
+					at: myAt.join(" "),
+					offset: offset.join(" ")
+				};
+			} 
+
+			position = $.extend({}, $.ui.dialog.prototype.options.position, position);
+		} else {
+			position = $.ui.dialog.prototype.options.position;
+		}
+
+		// need to show the dialog to get the actual offset in the position plugin
+		isVisible = this.uiDialog.is(':visible');
+		if (!isVisible) {
+			this.uiDialog.show();
+		}
+		this.uiDialog
+			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+			.css({ top: 0, left: 0 })
+			.position($.extend({ of: window }, position));
+		if (!isVisible) {
+			this.uiDialog.hide();
+		}
+	},
+
+	_setOptions: function( options ) {
+		var self = this,
+			resizableOptions = {},
+			resize = false;
+
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+			
+			if ( key in sizeRelatedOptions ) {
+				resize = true;
+			}
+			if ( key in resizableRelatedOptions ) {
+				resizableOptions[ key ] = value;
+			}
+		});
+
+		if ( resize ) {
+			this._size();
+		}
+		if ( this.uiDialog.is( ":data(resizable)" ) ) {
+			this.uiDialog.resizable( "option", resizableOptions );
+		}
+	},
+
+	_setOption: function(key, value){
+		var self = this,
+			uiDialog = self.uiDialog;
+
+		switch (key) {
+			//handling of deprecated beforeclose (vs beforeClose) option
+			//Ticket #4669 http://dev.jqueryui.com/ticket/4669
+			//TODO: remove in 1.9pre
+			case "beforeclose":
+				key = "beforeClose";
+				break;
+			case "buttons":
+				self._createButtons(value);
+				break;
+			case "closeText":
+				// ensure that we always pass a string
+				self.uiDialogTitlebarCloseText.text("" + value);
+				break;
+			case "dialogClass":
+				uiDialog
+					.removeClass(self.options.dialogClass)
+					.addClass(uiDialogClasses + value);
+				break;
+			case "disabled":
+				if (value) {
+					uiDialog.addClass('ui-dialog-disabled');
+				} else {
+					uiDialog.removeClass('ui-dialog-disabled');
+				}
+				break;
+			case "draggable":
+				var isDraggable = uiDialog.is( ":data(draggable)" );
+				if ( isDraggable && !value ) {
+					uiDialog.draggable( "destroy" );
+				}
+				
+				if ( !isDraggable && value ) {
+					self._makeDraggable();
+				}
+				break;
+			case "position":
+				self._position(value);
+				break;
+			case "resizable":
+				// currently resizable, becoming non-resizable
+				var isResizable = uiDialog.is( ":data(resizable)" );
+				if (isResizable && !value) {
+					uiDialog.resizable('destroy');
+				}
+
+				// currently resizable, changing handles
+				if (isResizable && typeof value === 'string') {
+					uiDialog.resizable('option', 'handles', value);
+				}
+
+				// currently non-resizable, becoming resizable
+				if (!isResizable && value !== false) {
+					self._makeResizable(value);
+				}
+				break;
+			case "title":
+				// convert whatever was passed in o a string, for html() to not throw up
+				$(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || '&#160;'));
+				break;
+		}
+
+		$.Widget.prototype._setOption.apply(self, arguments);
+	},
+
+	_size: function() {
+		/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+		 * divs will both have width and height set, so we need to reset them
+		 */
+		var options = this.options,
+			nonContentHeight,
+			minContentHeight,
+			isVisible = this.uiDialog.is( ":visible" );
+
+		// reset content sizing
+		this.element.show().css({
+			width: 'auto',
+			minHeight: 0,
+			height: 0
+		});
+
+		if (options.minWidth > options.width) {
+			options.width = options.minWidth;
+		}
+
+		// reset wrapper sizing
+		// determine the height of all the non-content elements
+		nonContentHeight = this.uiDialog.css({
+				height: 'auto',
+				width: options.width
+			})
+			.height();
+		minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+		
+		if ( options.height === "auto" ) {
+			// only needed for IE6 support
+			if ( $.support.minHeight ) {
+				this.element.css({
+					minHeight: minContentHeight,
+					height: "auto"
+				});
+			} else {
+				this.uiDialog.show();
+				var autoHeight = this.element.css( "height", "auto" ).height();
+				if ( !isVisible ) {
+					this.uiDialog.hide();
+				}
+				this.element.height( Math.max( autoHeight, minContentHeight ) );
+			}
+		} else {
+			this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+		}
+
+		if (this.uiDialog.is(':data(resizable)')) {
+			this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+		}
+	}
+});
+
+$.extend($.ui.dialog, {
+	version: "1.8.11",
+
+	uuid: 0,
+	maxZ: 0,
+
+	getTitleId: function($el) {
+		var id = $el.attr('id');
+		if (!id) {
+			this.uuid += 1;
+			id = this.uuid;
+		}
+		return 'ui-dialog-title-' + id;
+	},
+
+	overlay: function(dialog) {
+		this.$el = $.ui.dialog.overlay.create(dialog);
+	}
+});
+
+$.extend($.ui.dialog.overlay, {
+	instances: [],
+	// reuse old instances due to IE memory leak with alpha transparency (see #5185)
+	oldInstances: [],
+	maxZ: 0,
+	events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+		function(event) { return event + '.dialog-overlay'; }).join(' '),
+	create: function(dialog) {
+		if (this.instances.length === 0) {
+			// prevent use of anchors and inputs
+			// we use a setTimeout in case the overlay is created from an
+			// event that we're going to be cancelling (see #2804)
+			setTimeout(function() {
+				// handle $(el).dialog().dialog('close') (see #4065)
+				if ($.ui.dialog.overlay.instances.length) {
+					$(document).bind($.ui.dialog.overlay.events, function(event) {
+						// stop events if the z-index of the target is < the z-index of the overlay
+						// we cannot return true when we don't want to cancel the event (#3523)
+						if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
+							return false;
+						}
+					});
+				}
+			}, 1);
+
+			// allow closing by pressing the escape key
+			$(document).bind('keydown.dialog-overlay', function(event) {
+				if (dialog.options.closeOnEscape && event.keyCode &&
+					event.keyCode === $.ui.keyCode.ESCAPE) {
+					
+					dialog.close(event);
+					event.preventDefault();
+				}
+			});
+
+			// handle window resize
+			$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+		}
+
+		var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+			.appendTo(document.body)
+			.css({
+				width: this.width(),
+				height: this.height()
+			});
+
+		if ($.fn.bgiframe) {
+			$el.bgiframe();
+		}
+
+		this.instances.push($el);
+		return $el;
+	},
+
+	destroy: function($el) {
+		var indexOf = $.inArray($el, this.instances);
+		if (indexOf != -1){
+			this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+		}
+
+		if (this.instances.length === 0) {
+			$([document, window]).unbind('.dialog-overlay');
+		}
+
+		$el.remove();
+		
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		var maxZ = 0;
+		$.each(this.instances, function() {
+			maxZ = Math.max(maxZ, this.css('z-index'));
+		});
+		this.maxZ = maxZ;
+	},
+
+	height: function() {
+		var scrollHeight,
+			offsetHeight;
+		// handle IE 6
+		if ($.browser.msie && $.browser.version < 7) {
+			scrollHeight = Math.max(
+				document.documentElement.scrollHeight,
+				document.body.scrollHeight
+			);
+			offsetHeight = Math.max(
+				document.documentElement.offsetHeight,
+				document.body.offsetHeight
+			);
+
+			if (scrollHeight < offsetHeight) {
+				return $(window).height() + 'px';
+			} else {
+				return scrollHeight + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).height() + 'px';
+		}
+	},
+
+	width: function() {
+		var scrollWidth,
+			offsetWidth;
+		// handle IE 6
+		if ($.browser.msie && $.browser.version < 7) {
+			scrollWidth = Math.max(
+				document.documentElement.scrollWidth,
+				document.body.scrollWidth
+			);
+			offsetWidth = Math.max(
+				document.documentElement.offsetWidth,
+				document.body.offsetWidth
+			);
+
+			if (scrollWidth < offsetWidth) {
+				return $(window).width() + 'px';
+			} else {
+				return scrollWidth + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).width() + 'px';
+		}
+	},
+
+	resize: function() {
+		/* If the dialog is draggable and the user drags it past the
+		 * right edge of the window, the document becomes wider so we
+		 * need to stretch the overlay. If the user then drags the
+		 * dialog back to the left, the document will become narrower,
+		 * so we need to shrink the overlay to the appropriate size.
+		 * This is handled by shrinking the overlay before setting it
+		 * to the full document size.
+		 */
+		var $overlays = $([]);
+		$.each($.ui.dialog.overlay.instances, function() {
+			$overlays = $overlays.add(this);
+		});
+
+		$overlays.css({
+			width: 0,
+			height: 0
+		}).css({
+			width: $.ui.dialog.overlay.width(),
+			height: $.ui.dialog.overlay.height()
+		});
+	}
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+	destroy: function() {
+		$.ui.dialog.overlay.destroy(this.$el);
+	}
+});
+
+}(jQuery));
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.draggable.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,799 @@
+/*
+ * jQuery UI Draggable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+	widgetEventPrefix: "drag",
+	options: {
+		addClasses: true,
+		appendTo: "parent",
+		axis: false,
+		connectToSortable: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		iframeFix: false,
+		opacity: false,
+		refreshPositions: false,
+		revert: false,
+		revertDuration: 500,
+		scope: "default",
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		snap: false,
+		snapMode: "both",
+		snapTolerance: 20,
+		stack: false,
+		zIndex: false
+	},
+	_create: function() {
+
+		if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+			this.element[0].style.position = 'relative';
+
+		(this.options.addClasses && this.element.addClass("ui-draggable"));
+		(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+		if(!this.element.data('draggable')) return;
+		this.element
+			.removeData("draggable")
+			.unbind(".draggable")
+			.removeClass("ui-draggable"
+				+ " ui-draggable-dragging"
+				+ " ui-draggable-disabled");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+
+		var o = this.options;
+
+		// among others, prevent a drag on a resizable-handle
+		if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+			return false;
+
+		//Quit if we're not on a valid handle
+		this.handle = this._getHandle(event);
+		if (!this.handle)
+			return false;
+
+		return true;
+
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options;
+
+		//Create and append the visible helper
+		this.helper = this._createHelper(event);
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		//If ddmanager is used for droppables, set the global draggable
+		if($.ui.ddmanager)
+			$.ui.ddmanager.current = this;
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Store the helper's css position
+		this.cssPosition = this.helper.css("position");
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.positionAbs = this.element.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		$.extend(this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+		});
+
+		//Generate the original position
+		this.originalPosition = this.position = this._generatePosition(event);
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+		//Set a containment if given in the options
+		if(o.containment)
+			this._setContainment();
+
+		//Trigger event + callbacks
+		if(this._trigger("start", event) === false) {
+			this._clear();
+			return false;
+		}
+
+		//Recache the helper size
+		this._cacheHelperProportions();
+
+		//Prepare the droppable offsets
+		if ($.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(this, event);
+
+		this.helper.addClass("ui-draggable-dragging");
+		this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+		return true;
+	},
+
+	_mouseDrag: function(event, noPropagation) {
+
+		//Compute the helpers position
+		this.position = this._generatePosition(event);
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		//Call plugins and callbacks and use the resulting position if something is returned
+		if (!noPropagation) {
+			var ui = this._uiHash();
+			if(this._trigger('drag', event, ui) === false) {
+				this._mouseUp({});
+				return false;
+			}
+			this.position = ui.position;
+		}
+
+		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		//If we are using droppables, inform the manager about the drop
+		var dropped = false;
+		if ($.ui.ddmanager && !this.options.dropBehaviour)
+			dropped = $.ui.ddmanager.drop(this, event);
+
+		//if a drop comes from outside (a sortable)
+		if(this.dropped) {
+			dropped = this.dropped;
+			this.dropped = false;
+		}
+		
+		//if the original element is removed, don't bother to continue if helper is set to "original"
+		if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original")
+			return false;
+
+		if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+			var self = this;
+			$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+				if(self._trigger("stop", event) !== false) {
+					self._clear();
+				}
+			});
+		} else {
+			if(this._trigger("stop", event) !== false) {
+				this._clear();
+			}
+		}
+
+		return false;
+	},
+	
+	cancel: function() {
+		
+		if(this.helper.is(".ui-draggable-dragging")) {
+			this._mouseUp({});
+		} else {
+			this._clear();
+		}
+		
+		return this;
+		
+	},
+
+	_getHandle: function(event) {
+
+		var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+		$(this.options.handle, this.element)
+			.find("*")
+			.andSelf()
+			.each(function() {
+				if(this == event.target) handle = true;
+			});
+
+		return handle;
+
+	},
+
+	_createHelper: function(event) {
+
+		var o = this.options;
+		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+		if(!helper.parents('body').length)
+			helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+		if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+			helper.css("position", "absolute");
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function(obj) {
+		if (typeof obj == 'string') {
+			obj = obj.split(' ');
+		}
+		if ($.isArray(obj)) {
+			obj = {left: +obj[0], top: +obj[1] || 0};
+		}
+		if ('left' in obj) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ('right' in obj) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ('top' in obj) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ('bottom' in obj) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+			po = { top: 0, left: 0 };
+
+		return {
+			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if(this.cssPosition == "relative") {
+			var p = this.element.position();
+			return {
+				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: (parseInt(this.element.css("marginLeft"),10) || 0),
+			top: (parseInt(this.element.css("marginTop"),10) || 0),
+			right: (parseInt(this.element.css("marginRight"),10) || 0),
+			bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var o = this.options;
+		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+		if(o.containment == 'document' || o.containment == 'window') this.containment = [
+			(o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left,
+			(o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top,
+			(o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+			(o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+		];
+
+		if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+			var ce = $(o.containment)[0]; if(!ce) return;
+			var co = $(o.containment).offset();
+			var over = ($(ce).css("overflow") != 'hidden');
+
+			this.containment = [
+				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
+				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
+				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
+				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top  - this.margins.bottom
+			];
+		} else if(o.containment.constructor == Array) {
+			this.containment = o.containment;
+		}
+
+	},
+
+	_convertPositionTo: function(d, pos) {
+
+		if(!pos) pos = this.position;
+		var mod = d == "absolute" ? 1 : -1;
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		return {
+			top: (
+				pos.top																	// The absolute mouse position
+				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+			),
+			left: (
+				pos.left																// The absolute mouse position
+				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+			)
+		};
+
+	},
+
+	_generatePosition: function(event) {
+
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+		var pageX = event.pageX;
+		var pageY = event.pageY;
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+			if(this.containment) {
+				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+			}
+
+			if(o.grid) {
+				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+			}
+
+		}
+
+		return {
+			top: (
+				pageY																// The absolute mouse position
+				- this.offset.click.top													// Click offset (relative to the element)
+				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+			),
+			left: (
+				pageX																// The absolute mouse position
+				- this.offset.click.left												// Click offset (relative to the element)
+				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+			)
+		};
+
+	},
+
+	_clear: function() {
+		this.helper.removeClass("ui-draggable-dragging");
+		if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+		//if($.ui.ddmanager) $.ui.ddmanager.current = null;
+		this.helper = null;
+		this.cancelHelperRemoval = false;
+	},
+
+	// From now on bulk stuff - mainly helpers
+
+	_trigger: function(type, event, ui) {
+		ui = ui || this._uiHash();
+		$.ui.plugin.call(this, type, [event, ui]);
+		if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+		return $.Widget.prototype._trigger.call(this, type, event, ui);
+	},
+
+	plugins: {},
+
+	_uiHash: function(event) {
+		return {
+			helper: this.helper,
+			position: this.position,
+			originalPosition: this.originalPosition,
+			offset: this.positionAbs
+		};
+	}
+
+});
+
+$.extend($.ui.draggable, {
+	version: "1.8.11"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+	start: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options,
+			uiSortable = $.extend({}, ui, { item: inst.element });
+		inst.sortables = [];
+		$(o.connectToSortable).each(function() {
+			var sortable = $.data(this, 'sortable');
+			if (sortable && !sortable.options.disabled) {
+				inst.sortables.push({
+					instance: sortable,
+					shouldRevert: sortable.options.revert
+				});
+				sortable.refreshPositions();	// Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
+				sortable._trigger("activate", event, uiSortable);
+			}
+		});
+
+	},
+	stop: function(event, ui) {
+
+		//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+		var inst = $(this).data("draggable"),
+			uiSortable = $.extend({}, ui, { item: inst.element });
+
+		$.each(inst.sortables, function() {
+			if(this.instance.isOver) {
+
+				this.instance.isOver = 0;
+
+				inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+				this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+				//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+				if(this.shouldRevert) this.instance.options.revert = true;
+
+				//Trigger the stop of the sortable
+				this.instance._mouseStop(event);
+
+				this.instance.options.helper = this.instance.options._helper;
+
+				//If the helper has been the original item, restore properties in the sortable
+				if(inst.options.helper == 'original')
+					this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+			} else {
+				this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+				this.instance._trigger("deactivate", event, uiSortable);
+			}
+
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), self = this;
+
+		var checkPos = function(o) {
+			var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+			var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+			var itemHeight = o.height, itemWidth = o.width;
+			var itemTop = o.top, itemLeft = o.left;
+
+			return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+		};
+
+		$.each(inst.sortables, function(i) {
+			
+			//Copy over some variables to allow calling the sortable's native _intersectsWith
+			this.instance.positionAbs = inst.positionAbs;
+			this.instance.helperProportions = inst.helperProportions;
+			this.instance.offset.click = inst.offset.click;
+			
+			if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+				//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+				if(!this.instance.isOver) {
+
+					this.instance.isOver = 1;
+					//Now we fake the start of dragging for the sortable instance,
+					//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+					//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+					this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+					this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+					this.instance.options.helper = function() { return ui.helper[0]; };
+
+					event.target = this.instance.currentItem[0];
+					this.instance._mouseCapture(event, true);
+					this.instance._mouseStart(event, true, true);
+
+					//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+					this.instance.offset.click.top = inst.offset.click.top;
+					this.instance.offset.click.left = inst.offset.click.left;
+					this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+					this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+					inst._trigger("toSortable", event);
+					inst.dropped = this.instance.element; //draggable revert needs that
+					//hack so receive/update callbacks work (mostly)
+					inst.currentItem = inst.element;
+					this.instance.fromOutside = inst;
+
+				}
+
+				//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+				if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+			} else {
+
+				//If it doesn't intersect with the sortable, and it intersected before,
+				//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+				if(this.instance.isOver) {
+
+					this.instance.isOver = 0;
+					this.instance.cancelHelperRemoval = true;
+					
+					//Prevent reverting on this forced stop
+					this.instance.options.revert = false;
+					
+					// The out event needs to be triggered independently
+					this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+					
+					this.instance._mouseStop(event, true);
+					this.instance.options.helper = this.instance.options._helper;
+
+					//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+					this.instance.currentItem.remove();
+					if(this.instance.placeholder) this.instance.placeholder.remove();
+
+					inst._trigger("fromSortable", event);
+					inst.dropped = false; //draggable revert needs that
+				}
+
+			};
+
+		});
+
+	}
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+	start: function(event, ui) {
+		var t = $('body'), o = $(this).data('draggable').options;
+		if (t.css("cursor")) o._cursor = t.css("cursor");
+		t.css("cursor", o.cursor);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if (o._cursor) $('body').css("cursor", o._cursor);
+	}
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+	start: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+			$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+			.css({
+				width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+				position: "absolute", opacity: "0.001", zIndex: 1000
+			})
+			.css($(this).offset())
+			.appendTo("body");
+		});
+	},
+	stop: function(event, ui) {
+		$("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+	}
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data('draggable').options;
+		if(t.css("opacity")) o._opacity = t.css("opacity");
+		t.css('opacity', o.opacity);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+	}
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+	start: function(event, ui) {
+		var i = $(this).data("draggable");
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+	},
+	drag: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+			if(!o.axis || o.axis != 'x') {
+				if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+				else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+				else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+			}
+
+		} else {
+
+			if(!o.axis || o.axis != 'x') {
+				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+			}
+
+		}
+
+		if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(i, event);
+
+	}
+});
+
+$.ui.plugin.add("draggable", "snap", {
+	start: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options;
+		i.snapElements = [];
+
+		$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+			var $t = $(this); var $o = $t.offset();
+			if(this != i.element[0]) i.snapElements.push({
+				item: this,
+				width: $t.outerWidth(), height: $t.outerHeight(),
+				top: $o.top, left: $o.left
+			});
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options;
+		var d = o.snapTolerance;
+
+		var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+		for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+			var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+				t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+			//Yes, I know, this is insane ;)
+			if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+				if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+				inst.snapElements[i].snapping = false;
+				continue;
+			}
+
+			if(o.snapMode != 'inner') {
+				var ts = Math.abs(t - y2) <= d;
+				var bs = Math.abs(b - y1) <= d;
+				var ls = Math.abs(l - x2) <= d;
+				var rs = Math.abs(r - x1) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+			}
+
+			var first = (ts || bs || ls || rs);
+
+			if(o.snapMode != 'outer') {
+				var ts = Math.abs(t - y1) <= d;
+				var bs = Math.abs(b - y2) <= d;
+				var ls = Math.abs(l - x1) <= d;
+				var rs = Math.abs(r - x2) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+			}
+
+			if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+				(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+			inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+		};
+
+	}
+});
+
+$.ui.plugin.add("draggable", "stack", {
+	start: function(event, ui) {
+
+		var o = $(this).data("draggable").options;
+
+		var group = $.makeArray($(o.stack)).sort(function(a,b) {
+			return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+		});
+		if (!group.length) { return; }
+		
+		var min = parseInt(group[0].style.zIndex) || 0;
+		$(group).each(function(i) {
+			this.style.zIndex = min + i;
+		});
+
+		this[0].style.zIndex = min + group.length;
+
+	}
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data("draggable").options;
+		if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+		t.css('zIndex', o.zIndex);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data("draggable").options;
+		if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+	}
+});
+
+})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.droppable.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,285 @@
+/*
+ * jQuery UI Droppable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.droppable", {
+	widgetEventPrefix: "drop",
+	options: {
+		accept: '*',
+		activeClass: false,
+		addClasses: true,
+		greedy: false,
+		hoverClass: false,
+		scope: 'default',
+		tolerance: 'intersect'
+	},
+	_create: function() {
+
+		var o = this.options, accept = o.accept;
+		this.isover = 0; this.isout = 1;
+
+		this.accept = $.isFunction(accept) ? accept : function(d) {
+			return d.is(accept);
+		};
+
+		//Store the droppable's proportions
+		this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+		// Add the reference and positions to the manager
+		$.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+		$.ui.ddmanager.droppables[o.scope].push(this);
+
+		(o.addClasses && this.element.addClass("ui-droppable"));
+
+	},
+
+	destroy: function() {
+		var drop = $.ui.ddmanager.droppables[this.options.scope];
+		for ( var i = 0; i < drop.length; i++ )
+			if ( drop[i] == this )
+				drop.splice(i, 1);
+
+		this.element
+			.removeClass("ui-droppable ui-droppable-disabled")
+			.removeData("droppable")
+			.unbind(".droppable");
+
+		return this;
+	},
+
+	_setOption: function(key, value) {
+
+		if(key == 'accept') {
+			this.accept = $.isFunction(value) ? value : function(d) {
+				return d.is(value);
+			};
+		}
+		$.Widget.prototype._setOption.apply(this, arguments);
+	},
+
+	_activate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+		(draggable && this._trigger('activate', event, this.ui(draggable)));
+	},
+
+	_deactivate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+		(draggable && this._trigger('deactivate', event, this.ui(draggable)));
+	},
+
+	_over: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+			this._trigger('over', event, this.ui(draggable));
+		}
+
+	},
+
+	_out: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('out', event, this.ui(draggable));
+		}
+
+	},
+
+	_drop: function(event,custom) {
+
+		var draggable = custom || $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+		var childrenIntersection = false;
+		this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+			var inst = $.data(this, 'droppable');
+			if(
+				inst.options.greedy
+				&& !inst.options.disabled
+				&& inst.options.scope == draggable.options.scope
+				&& inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+				&& $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+			) { childrenIntersection = true; return false; }
+		});
+		if(childrenIntersection) return false;
+
+		if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('drop', event, this.ui(draggable));
+			return this.element;
+		}
+
+		return false;
+
+	},
+
+	ui: function(c) {
+		return {
+			draggable: (c.currentItem || c.element),
+			helper: c.helper,
+			position: c.position,
+			offset: c.positionAbs
+		};
+	}
+
+});
+
+$.extend($.ui.droppable, {
+	version: "1.8.11"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+	if (!droppable.offset) return false;
+
+	var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+		y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+	var l = droppable.offset.left, r = l + droppable.proportions.width,
+		t = droppable.offset.top, b = t + droppable.proportions.height;
+
+	switch (toleranceMode) {
+		case 'fit':
+			return (l <= x1 && x2 <= r
+				&& t <= y1 && y2 <= b);
+			break;
+		case 'intersect':
+			return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+				&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
+				&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+				&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+			break;
+		case 'pointer':
+			var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+				isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+			return isOver;
+			break;
+		case 'touch':
+			return (
+					(y1 >= t && y1 <= b) ||	// Top edge touching
+					(y2 >= t && y2 <= b) ||	// Bottom edge touching
+					(y1 < t && y2 > b)		// Surrounded vertically
+				) && (
+					(x1 >= l && x1 <= r) ||	// Left edge touching
+					(x2 >= l && x2 <= r) ||	// Right edge touching
+					(x1 < l && x2 > r)		// Surrounded horizontally
+				);
+			break;
+		default:
+			return false;
+			break;
+		}
+
+};
+
+/*
+	This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+	current: null,
+	droppables: { 'default': [] },
+	prepareOffsets: function(t, event) {
+
+		var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+		var type = event ? event.type : null; // workaround for #2317
+		var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+		droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+			if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue;	//No disabled and non-accepted
+			for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+			m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; 									//If the element is not visible, continue
+
+			if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+			m[i].offset = m[i].element.offset();
+			m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+		}
+
+	},
+	drop: function(draggable, event) {
+
+		var dropped = false;
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(!this.options) return;
+			if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+				dropped = dropped || this._drop.call(this, event);
+
+			if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+				this.isout = 1; this.isover = 0;
+				this._deactivate.call(this, event);
+			}
+
+		});
+		return dropped;
+
+	},
+	drag: function(draggable, event) {
+
+		//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+		if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+		//Run through all droppables and check their positions based on specific tolerance options
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(this.options.disabled || this.greedyChild || !this.visible) return;
+			var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+			var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+			if(!c) return;
+
+			var parentInstance;
+			if (this.options.greedy) {
+				var parent = this.element.parents(':data(droppable):eq(0)');
+				if (parent.length) {
+					parentInstance = $.data(parent[0], 'droppable');
+					parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+				}
+			}
+
+			// we just moved into a greedy child
+			if (parentInstance && c == 'isover') {
+				parentInstance['isover'] = 0;
+				parentInstance['isout'] = 1;
+				parentInstance._out.call(parentInstance, event);
+			}
+
+			this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+			this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+			// we just moved out of a greedy child
+			if (parentInstance && c == 'isout') {
+				parentInstance['isout'] = 0;
+				parentInstance['isover'] = 1;
+				parentInstance._over.call(parentInstance, event);
+			}
+		});
+
+	}
+};
+
+})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.mouse.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,156 @@
+/*!
+ * jQuery UI Mouse 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.mouse", {
+	options: {
+		cancel: ':input,option',
+		distance: 1,
+		delay: 0
+	},
+	_mouseInit: function() {
+		var self = this;
+
+		this.element
+			.bind('mousedown.'+this.widgetName, function(event) {
+				return self._mouseDown(event);
+			})
+			.bind('click.'+this.widgetName, function(event) {
+				if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
+				    $.removeData(event.target, self.widgetName + '.preventClickEvent');
+					event.stopImmediatePropagation();
+					return false;
+				}
+			});
+
+		this.started = false;
+	},
+
+	// TODO: make sure destroying one instance of mouse doesn't mess with
+	// other instances of mouse
+	_mouseDestroy: function() {
+		this.element.unbind('.'+this.widgetName);
+	},
+
+	_mouseDown: function(event) {
+		// don't let more than one widget handle mouseStart
+		// TODO: figure out why we have to use originalEvent
+		event.originalEvent = event.originalEvent || {};
+		if (event.originalEvent.mouseHandled) { return; }
+
+		// we may have missed mouseup (out of window)
+		(this._mouseStarted && this._mouseUp(event));
+
+		this._mouseDownEvent = event;
+
+		var self = this,
+			btnIsLeft = (event.which == 1),
+			elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+			return true;
+		}
+
+		this.mouseDelayMet = !this.options.delay;
+		if (!this.mouseDelayMet) {
+			this._mouseDelayTimer = setTimeout(function() {
+				self.mouseDelayMet = true;
+			}, this.options.delay);
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted = (this._mouseStart(event) !== false);
+			if (!this._mouseStarted) {
+				event.preventDefault();
+				return true;
+			}
+		}
+
+		// Click event may never have fired (Gecko & Opera)
+		if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
+			$.removeData(event.target, this.widgetName + '.preventClickEvent');
+		}
+
+		// these delegates are required to keep context
+		this._mouseMoveDelegate = function(event) {
+			return self._mouseMove(event);
+		};
+		this._mouseUpDelegate = function(event) {
+			return self._mouseUp(event);
+		};
+		$(document)
+			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		event.preventDefault();
+		event.originalEvent.mouseHandled = true;
+		return true;
+	},
+
+	_mouseMove: function(event) {
+		// IE mouseup check - mouseup happened when mouse was out of window
+		if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
+			return this._mouseUp(event);
+		}
+
+		if (this._mouseStarted) {
+			this._mouseDrag(event);
+			return event.preventDefault();
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted =
+				(this._mouseStart(this._mouseDownEvent, event) !== false);
+			(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+		}
+
+		return !this._mouseStarted;
+	},
+
+	_mouseUp: function(event) {
+		$(document)
+			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		if (this._mouseStarted) {
+			this._mouseStarted = false;
+
+			if (event.target == this._mouseDownEvent.target) {
+			    $.data(event.target, this.widgetName + '.preventClickEvent', true);
+			}
+
+			this._mouseStop(event);
+		}
+
+		return false;
+	},
+
+	_mouseDistanceMet: function(event) {
+		return (Math.max(
+				Math.abs(this._mouseDownEvent.pageX - event.pageX),
+				Math.abs(this._mouseDownEvent.pageY - event.pageY)
+			) >= this.options.distance
+		);
+	},
+
+	_mouseDelayMet: function(event) {
+		return this.mouseDelayMet;
+	},
+
+	// These are placeholder methods, to be overriden by extending plugin
+	_mouseStart: function(event) {},
+	_mouseDrag: function(event) {},
+	_mouseStop: function(event) {},
+	_mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.position.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,252 @@
+/*
+ * jQuery UI Position 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $, undefined ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+	verticalPositions = /top|center|bottom/,
+	center = "center",
+	_position = $.fn.position,
+	_offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+	if ( !options || !options.of ) {
+		return _position.apply( this, arguments );
+	}
+
+	// make a copy, we don't want to modify arguments
+	options = $.extend( {}, options );
+
+	var target = $( options.of ),
+		targetElem = target[0],
+		collision = ( options.collision || "flip" ).split( " " ),
+		offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+		targetWidth,
+		targetHeight,
+		basePosition;
+
+	if ( targetElem.nodeType === 9 ) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: 0, left: 0 };
+	// TODO: use $.isWindow() in 1.9
+	} else if ( targetElem.setTimeout ) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+	} else if ( targetElem.preventDefault ) {
+		// force left top to allow flipping
+		options.at = "left top";
+		targetWidth = targetHeight = 0;
+		basePosition = { top: options.of.pageY, left: options.of.pageX };
+	} else {
+		targetWidth = target.outerWidth();
+		targetHeight = target.outerHeight();
+		basePosition = target.offset();
+	}
+
+	// force my and at to have valid horizontal and veritcal positions
+	// if a value is missing or invalid, it will be converted to center 
+	$.each( [ "my", "at" ], function() {
+		var pos = ( options[this] || "" ).split( " " );
+		if ( pos.length === 1) {
+			pos = horizontalPositions.test( pos[0] ) ?
+				pos.concat( [center] ) :
+				verticalPositions.test( pos[0] ) ?
+					[ center ].concat( pos ) :
+					[ center, center ];
+		}
+		pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
+		pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
+		options[ this ] = pos;
+	});
+
+	// normalize collision option
+	if ( collision.length === 1 ) {
+		collision[ 1 ] = collision[ 0 ];
+	}
+
+	// normalize offset option
+	offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+	if ( offset.length === 1 ) {
+		offset[ 1 ] = offset[ 0 ];
+	}
+	offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+	if ( options.at[0] === "right" ) {
+		basePosition.left += targetWidth;
+	} else if ( options.at[0] === center ) {
+		basePosition.left += targetWidth / 2;
+	}
+
+	if ( options.at[1] === "bottom" ) {
+		basePosition.top += targetHeight;
+	} else if ( options.at[1] === center ) {
+		basePosition.top += targetHeight / 2;
+	}
+
+	basePosition.left += offset[ 0 ];
+	basePosition.top += offset[ 1 ];
+
+	return this.each(function() {
+		var elem = $( this ),
+			elemWidth = elem.outerWidth(),
+			elemHeight = elem.outerHeight(),
+			marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
+			marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
+			collisionWidth = elemWidth + marginLeft +
+				( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
+			collisionHeight = elemHeight + marginTop +
+				( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+			position = $.extend( {}, basePosition ),
+			collisionPosition;
+
+		if ( options.my[0] === "right" ) {
+			position.left -= elemWidth;
+		} else if ( options.my[0] === center ) {
+			position.left -= elemWidth / 2;
+		}
+
+		if ( options.my[1] === "bottom" ) {
+			position.top -= elemHeight;
+		} else if ( options.my[1] === center ) {
+			position.top -= elemHeight / 2;
+		}
+
+		// prevent fractions (see #5280)
+		position.left = Math.round( position.left );
+		position.top = Math.round( position.top );
+
+		collisionPosition = {
+			left: position.left - marginLeft,
+			top: position.top - marginTop
+		};
+
+		$.each( [ "left", "top" ], function( i, dir ) {
+			if ( $.ui.position[ collision[i] ] ) {
+				$.ui.position[ collision[i] ][ dir ]( position, {
+					targetWidth: targetWidth,
+					targetHeight: targetHeight,
+					elemWidth: elemWidth,
+					elemHeight: elemHeight,
+					collisionPosition: collisionPosition,
+					collisionWidth: collisionWidth,
+					collisionHeight: collisionHeight,
+					offset: offset,
+					my: options.my,
+					at: options.at
+				});
+			}
+		});
+
+		if ( $.fn.bgiframe ) {
+			elem.bgiframe();
+		}
+		elem.offset( $.extend( position, { using: options.using } ) );
+	});
+};
+
+$.ui.position = {
+	fit: {
+		left: function( position, data ) {
+			var win = $( window ),
+				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
+			position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+		},
+		top: function( position, data ) {
+			var win = $( window ),
+				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
+			position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+		}
+	},
+
+	flip: {
+		left: function( position, data ) {
+			if ( data.at[0] === center ) {
+				return;
+			}
+			var win = $( window ),
+				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+				myOffset = data.my[ 0 ] === "left" ?
+					-data.elemWidth :
+					data.my[ 0 ] === "right" ?
+						data.elemWidth :
+						0,
+				atOffset = data.at[ 0 ] === "left" ?
+					data.targetWidth :
+					-data.targetWidth,
+				offset = -2 * data.offset[ 0 ];
+			position.left += data.collisionPosition.left < 0 ?
+				myOffset + atOffset + offset :
+				over > 0 ?
+					myOffset + atOffset + offset :
+					0;
+		},
+		top: function( position, data ) {
+			if ( data.at[1] === center ) {
+				return;
+			}
+			var win = $( window ),
+				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
+				myOffset = data.my[ 1 ] === "top" ?
+					-data.elemHeight :
+					data.my[ 1 ] === "bottom" ?
+						data.elemHeight :
+						0,
+				atOffset = data.at[ 1 ] === "top" ?
+					data.targetHeight :
+					-data.targetHeight,
+				offset = -2 * data.offset[ 1 ];
+			position.top += data.collisionPosition.top < 0 ?
+				myOffset + atOffset + offset :
+				over > 0 ?
+					myOffset + atOffset + offset :
+					0;
+		}
+	}
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+	$.offset.setOffset = function( elem, options ) {
+		// set position first, in-case top/left are set even on static elem
+		if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+			elem.style.position = "relative";
+		}
+		var curElem   = $( elem ),
+			curOffset = curElem.offset(),
+			curTop    = parseInt( $.curCSS( elem, "top",  true ), 10 ) || 0,
+			curLeft   = parseInt( $.curCSS( elem, "left", true ), 10)  || 0,
+			props     = {
+				top:  (options.top  - curOffset.top)  + curTop,
+				left: (options.left - curOffset.left) + curLeft
+			};
+		
+		if ( 'using' in options ) {
+			options.using.call( elem, props );
+		} else {
+			curElem.css( props );
+		}
+	};
+
+	$.fn.offset = function( options ) {
+		var elem = this[ 0 ];
+		if ( !elem || !elem.ownerDocument ) { return null; }
+		if ( options ) { 
+			return this.each(function() {
+				$.offset.setOffset( this, options );
+			});
+		}
+		return _offset.call( this );
+	};
+}
+
+}( jQuery ));
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.resizable.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,812 @@
+/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+	widgetEventPrefix: "resize",
+	options: {
+		alsoResize: false,
+		animate: false,
+		animateDuration: "slow",
+		animateEasing: "swing",
+		aspectRatio: false,
+		autoHide: false,
+		containment: false,
+		ghost: false,
+		grid: false,
+		handles: "e,s,se",
+		helper: false,
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 10,
+		minWidth: 10,
+		zIndex: 1000
+	},
+	_create: function() {
+
+		var self = this, o = this.options;
+		this.element.addClass("ui-resizable");
+
+		$.extend(this, {
+			_aspectRatio: !!(o.aspectRatio),
+			aspectRatio: o.aspectRatio,
+			originalElement: this.element,
+			_proportionallyResizeElements: [],
+			_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+		});
+
+		//Wrap the element if it cannot hold child nodes
+		if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+			//Opera fix for relative positioning
+			if (/relative/.test(this.element.css('position')) && $.browser.opera)
+				this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+			//Create a wrapper element and set the wrapper to the new current internal element
+			this.element.wrap(
+				$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+					position: this.element.css('position'),
+					width: this.element.outerWidth(),
+					height: this.element.outerHeight(),
+					top: this.element.css('top'),
+					left: this.element.css('left')
+				})
+			);
+
+			//Overwrite the original this.element
+			this.element = this.element.parent().data(
+				"resizable", this.element.data('resizable')
+			);
+
+			this.elementIsWrapper = true;
+
+			//Move margins to the wrapper
+			this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+			this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+			//Prevent Safari textarea resize
+			this.originalResizeStyle = this.originalElement.css('resize');
+			this.originalElement.css('resize', 'none');
+
+			//Push the actual element to our proportionallyResize internal array
+			this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+			// avoid IE jump (hard set the margin)
+			this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+			// fix handlers offset
+			this._proportionallyResize();
+
+		}
+
+		this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+		if(this.handles.constructor == String) {
+
+			if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+			var n = this.handles.split(","); this.handles = {};
+
+			for(var i = 0; i < n.length; i++) {
+
+				var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+				var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+				// increase zIndex of sw, se, ne, nw axis
+				//TODO : this modifies original option
+				if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+				//TODO : What's going on here?
+				if ('se' == handle) {
+					axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+				};
+
+				//Insert into internal handles object and append to element
+				this.handles[handle] = '.ui-resizable-'+handle;
+				this.element.append(axis);
+			}
+
+		}
+
+		this._renderAxis = function(target) {
+
+			target = target || this.element;
+
+			for(var i in this.handles) {
+
+				if(this.handles[i].constructor == String)
+					this.handles[i] = $(this.handles[i], this.element).show();
+
+				//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+				if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+					var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+					//Checking the correct pad and border
+					padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+					//The padding type i have to apply...
+					var padPos = [ 'padding',
+						/ne|nw|n/.test(i) ? 'Top' :
+						/se|sw|s/.test(i) ? 'Bottom' :
+						/^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+					target.css(padPos, padWrapper);
+
+					this._proportionallyResize();
+
+				}
+
+				//TODO: What's that good for? There's not anything to be executed left
+				if(!$(this.handles[i]).length)
+					continue;
+
+			}
+		};
+
+		//TODO: make renderAxis a prototype function
+		this._renderAxis(this.element);
+
+		this._handles = $('.ui-resizable-handle', this.element)
+			.disableSelection();
+
+		//Matching axis name
+		this._handles.mouseover(function() {
+			if (!self.resizing) {
+				if (this.className)
+					var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+				//Axis, default = se
+				self.axis = axis && axis[1] ? axis[1] : 'se';
+			}
+		});
+
+		//If we want to auto hide the elements
+		if (o.autoHide) {
+			this._handles.hide();
+			$(this.element)
+				.addClass("ui-resizable-autohide")
+				.hover(function() {
+					$(this).removeClass("ui-resizable-autohide");
+					self._handles.show();
+				},
+				function(){
+					if (!self.resizing) {
+						$(this).addClass("ui-resizable-autohide");
+						self._handles.hide();
+					}
+				});
+		}
+
+		//Initialize the mouse interaction
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+
+		this._mouseDestroy();
+
+		var _destroy = function(exp) {
+			$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+				.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+		};
+
+		//TODO: Unwrap at same DOM position
+		if (this.elementIsWrapper) {
+			_destroy(this.element);
+			var wrapper = this.element;
+			wrapper.after(
+				this.originalElement.css({
+					position: wrapper.css('position'),
+					width: wrapper.outerWidth(),
+					height: wrapper.outerHeight(),
+					top: wrapper.css('top'),
+					left: wrapper.css('left')
+				})
+			).remove();
+		}
+
+		this.originalElement.css('resize', this.originalResizeStyle);
+		_destroy(this.originalElement);
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+		var handle = false;
+		for (var i in this.handles) {
+			if ($(this.handles[i])[0] == event.target) {
+				handle = true;
+			}
+		}
+
+		return !this.options.disabled && handle;
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options, iniPos = this.element.position(), el = this.element;
+
+		this.resizing = true;
+		this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+		// bugfix for http://dev.jquery.com/ticket/1749
+		if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+			el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+		}
+
+		//Opera fixing relative position
+		if ($.browser.opera && (/relative/).test(el.css('position')))
+			el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+		this._renderProxy();
+
+		var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+		if (o.containment) {
+			curleft += $(o.containment).scrollLeft() || 0;
+			curtop += $(o.containment).scrollTop() || 0;
+		}
+
+		//Store needed variables
+		this.offset = this.helper.offset();
+		this.position = { left: curleft, top: curtop };
+		this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalPosition = { left: curleft, top: curtop };
+		this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+		this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+		//Aspect Ratio
+		this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+	    var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+	    $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+		el.addClass("ui-resizable-resizing");
+		this._propagate("start", event);
+		return true;
+	},
+
+	_mouseDrag: function(event) {
+
+		//Increase performance, avoid regex
+		var el = this.helper, o = this.options, props = {},
+			self = this, smp = this.originalMousePosition, a = this.axis;
+
+		var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+		var trigger = this._change[a];
+		if (!trigger) return false;
+
+		// Calculate the attrs that will be change
+		var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+		if (this._aspectRatio || event.shiftKey)
+			data = this._updateRatio(data, event);
+
+		data = this._respectSize(data, event);
+
+		// plugins callbacks need to be called first
+		this._propagate("resize", event);
+
+		el.css({
+			top: this.position.top + "px", left: this.position.left + "px",
+			width: this.size.width + "px", height: this.size.height + "px"
+		});
+
+		if (!this._helper && this._proportionallyResizeElements.length)
+			this._proportionallyResize();
+
+		this._updateCache(data);
+
+		// calling the user callback at the end
+		this._trigger('resize', event, this.ui());
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		this.resizing = false;
+		var o = this.options, self = this;
+
+		if(this._helper) {
+			var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+				soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+				soffsetw = ista ? 0 : self.sizeDiff.width;
+
+			var s = { width: (self.helper.width()  - soffsetw), height: (self.helper.height() - soffseth) },
+				left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+				top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+			if (!o.animate)
+				this.element.css($.extend(s, { top: top, left: left }));
+
+			self.helper.height(self.size.height);
+			self.helper.width(self.size.width);
+
+			if (this._helper && !o.animate) this._proportionallyResize();
+		}
+
+		$('body').css('cursor', 'auto');
+
+		this.element.removeClass("ui-resizable-resizing");
+
+		this._propagate("stop", event);
+
+		if (this._helper) this.helper.remove();
+		return false;
+
+	},
+
+	_updateCache: function(data) {
+		var o = this.options;
+		this.offset = this.helper.offset();
+		if (isNumber(data.left)) this.position.left = data.left;
+		if (isNumber(data.top)) this.position.top = data.top;
+		if (isNumber(data.height)) this.size.height = data.height;
+		if (isNumber(data.width)) this.size.width = data.width;
+	},
+
+	_updateRatio: function(data, event) {
+
+		var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+		if (data.height) data.width = (csize.height * this.aspectRatio);
+		else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+		if (a == 'sw') {
+			data.left = cpos.left + (csize.width - data.width);
+			data.top = null;
+		}
+		if (a == 'nw') {
+			data.top = cpos.top + (csize.height - data.height);
+			data.left = cpos.left + (csize.width - data.width);
+		}
+
+		return data;
+	},
+
+	_respectSize: function(data, event) {
+
+		var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+					isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+		if (isminw) data.width = o.minWidth;
+		if (isminh) data.height = o.minHeight;
+		if (ismaxw) data.width = o.maxWidth;
+		if (ismaxh) data.height = o.maxHeight;
+
+		var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+		var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+		if (isminw && cw) data.left = dw - o.minWidth;
+		if (ismaxw && cw) data.left = dw - o.maxWidth;
+		if (isminh && ch)	data.top = dh - o.minHeight;
+		if (ismaxh && ch)	data.top = dh - o.maxHeight;
+
+		// fixing jump error on top/left - bug #2330
+		var isNotwh = !data.width && !data.height;
+		if (isNotwh && !data.left && data.top) data.top = null;
+		else if (isNotwh && !data.top && data.left) data.left = null;
+
+		return data;
+	},
+
+	_proportionallyResize: function() {
+
+		var o = this.options;
+		if (!this._proportionallyResizeElements.length) return;
+		var element = this.helper || this.element;
+
+		for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+			var prel = this._proportionallyResizeElements[i];
+
+			if (!this.borderDif) {
+				var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+					p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+				this.borderDif = $.map(b, function(v, i) {
+					var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+					return border + padding;
+				});
+			}
+
+			if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+				continue;
+
+			prel.css({
+				height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+				width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+			});
+
+		};
+
+	},
+
+	_renderProxy: function() {
+
+		var el = this.element, o = this.options;
+		this.elementOffset = el.offset();
+
+		if(this._helper) {
+
+			this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+			// fix ie6 offset TODO: This seems broken
+			var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+			pxyoffset = ( ie6 ? 2 : -1 );
+
+			this.helper.addClass(this._helper).css({
+				width: this.element.outerWidth() + pxyoffset,
+				height: this.element.outerHeight() + pxyoffset,
+				position: 'absolute',
+				left: this.elementOffset.left - ie6offset +'px',
+				top: this.elementOffset.top - ie6offset +'px',
+				zIndex: ++o.zIndex //TODO: Don't modify option
+			});
+
+			this.helper
+				.appendTo("body")
+				.disableSelection();
+
+		} else {
+			this.helper = this.element;
+		}
+
+	},
+
+	_change: {
+		e: function(event, dx, dy) {
+			return { width: this.originalSize.width + dx };
+		},
+		w: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { left: sp.left + dx, width: cs.width - dx };
+		},
+		n: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { top: sp.top + dy, height: cs.height - dy };
+		},
+		s: function(event, dx, dy) {
+			return { height: this.originalSize.height + dy };
+		},
+		se: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		sw: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		},
+		ne: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		nw: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		}
+	},
+
+	_propagate: function(n, event) {
+		$.ui.plugin.call(this, n, [event, this.ui()]);
+		(n != "resize" && this._trigger(n, event, this.ui()));
+	},
+
+	plugins: {},
+
+	ui: function() {
+		return {
+			originalElement: this.originalElement,
+			element: this.element,
+			helper: this.helper,
+			position: this.position,
+			size: this.size,
+			originalSize: this.originalSize,
+			originalPosition: this.originalPosition
+		};
+	}
+
+});
+
+$.extend($.ui.resizable, {
+	version: "1.8.11"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+	start: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var _store = function (exp) {
+			$(exp).each(function() {
+				var el = $(this);
+				el.data("resizable-alsoresize", {
+					width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+					left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10),
+					position: el.css('position') // to reset Opera on stop()
+				});
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+			if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+			else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
+		}else{
+			_store(o.alsoResize);
+		}
+	},
+
+	resize: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+		var delta = {
+			height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+			top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+		},
+
+		_alsoResize = function (exp, c) {
+			$(exp).each(function() {
+				var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, 
+					css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
+
+				$.each(css, function (i, prop) {
+					var sum = (start[prop]||0) + (delta[prop]||0);
+					if (sum && sum >= 0)
+						style[prop] = sum || null;
+				});
+
+				// Opera fixing relative position
+				if ($.browser.opera && /relative/.test(el.css('position'))) {
+					self._revertToRelativePosition = true;
+					el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+				}
+
+				el.css(style);
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+			$.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
+		}else{
+			_alsoResize(o.alsoResize);
+		}
+	},
+
+	stop: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var _reset = function (exp) {
+			$(exp).each(function() {
+				var el = $(this);
+				// reset position for Opera - no need to verify it was changed
+				el.css({ position: el.data("resizable-alsoresize").position });
+			});
+		};
+
+		if (self._revertToRelativePosition) {
+			self._revertToRelativePosition = false;
+			if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+				$.each(o.alsoResize, function (exp) { _reset(exp); });
+			}else{
+				_reset(o.alsoResize);
+			}
+		}
+
+		$(this).removeData("resizable-alsoresize");
+	}
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+	stop: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+					soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+						soffsetw = ista ? 0 : self.sizeDiff.width;
+
+		var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+					left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+						top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+		self.element.animate(
+			$.extend(style, top && left ? { top: top, left: left } : {}), {
+				duration: o.animateDuration,
+				easing: o.animateEasing,
+				step: function() {
+
+					var data = {
+						width: parseInt(self.element.css('width'), 10),
+						height: parseInt(self.element.css('height'), 10),
+						top: parseInt(self.element.css('top'), 10),
+						left: parseInt(self.element.css('left'), 10)
+					};
+
+					if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+					// propagating resize, and updating values for each animation step
+					self._updateCache(data);
+					self._propagate("resize", event);
+
+				}
+			}
+		);
+	}
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+	start: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, el = self.element;
+		var oc = o.containment,	ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+		if (!ce) return;
+
+		self.containerElement = $(ce);
+
+		if (/document/.test(oc) || oc == document) {
+			self.containerOffset = { left: 0, top: 0 };
+			self.containerPosition = { left: 0, top: 0 };
+
+			self.parentData = {
+				element: $(document), left: 0, top: 0,
+				width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+			};
+		}
+
+		// i'm a node, so compute top, left, right, bottom
+		else {
+			var element = $(ce), p = [];
+			$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+			self.containerOffset = element.offset();
+			self.containerPosition = element.position();
+			self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+			var co = self.containerOffset, ch = self.containerSize.height,	cw = self.containerSize.width,
+						width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+			self.parentData = {
+				element: ce, left: co.left, top: co.top, width: width, height: height
+			};
+		}
+	},
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options,
+				ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+				pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+		if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+		if (cp.left < (self._helper ? co.left : 0)) {
+			self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+			if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+			self.position.left = o.helper ? co.left : 0;
+		}
+
+		if (cp.top < (self._helper ? co.top : 0)) {
+			self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+			if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+			self.position.top = self._helper ? co.top : 0;
+		}
+
+		self.offset.left = self.parentData.left+self.position.left;
+		self.offset.top = self.parentData.top+self.position.top;
+
+		var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+					hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+		var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+		    isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+		if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+		if (woset + self.size.width >= self.parentData.width) {
+			self.size.width = self.parentData.width - woset;
+			if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+		}
+
+		if (hoset + self.size.height >= self.parentData.height) {
+			self.size.height = self.parentData.height - hoset;
+			if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+		}
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options, cp = self.position,
+				co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+		var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+		if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+		if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+	}
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+	start: function(event, ui) {
+
+		var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+		self.ghost = self.originalElement.clone();
+		self.ghost
+			.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+			.addClass('ui-resizable-ghost')
+			.addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+		self.ghost.appendTo(self.helper);
+
+	},
+
+	resize: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+	}
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+		o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+		var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+		if (/^(se|s|e)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+		}
+		else if (/^(ne)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+		}
+		else if (/^(sw)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.left = op.left - ox;
+		}
+		else {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+			self.position.left = op.left - ox;
+		}
+	}
+
+});
+
+var num = function(v) {
+	return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+	return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.selectable.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,266 @@
+/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+	options: {
+		appendTo: 'body',
+		autoRefresh: true,
+		distance: 0,
+		filter: '*',
+		tolerance: 'touch'
+	},
+	_create: function() {
+		var self = this;
+
+		this.element.addClass("ui-selectable");
+
+		this.dragged = false;
+
+		// cache selectee children based on filter
+		var selectees;
+		this.refresh = function() {
+			selectees = $(self.options.filter, self.element[0]);
+			selectees.each(function() {
+				var $this = $(this);
+				var pos = $this.offset();
+				$.data(this, "selectable-item", {
+					element: this,
+					$element: $this,
+					left: pos.left,
+					top: pos.top,
+					right: pos.left + $this.outerWidth(),
+					bottom: pos.top + $this.outerHeight(),
+					startselected: false,
+					selected: $this.hasClass('ui-selected'),
+					selecting: $this.hasClass('ui-selecting'),
+					unselecting: $this.hasClass('ui-unselecting')
+				});
+			});
+		};
+		this.refresh();
+
+		this.selectees = selectees.addClass("ui-selectee");
+
+		this._mouseInit();
+
+		this.helper = $("<div class='ui-selectable-helper'></div>");
+	},
+
+	destroy: function() {
+		this.selectees
+			.removeClass("ui-selectee")
+			.removeData("selectable-item");
+		this.element
+			.removeClass("ui-selectable ui-selectable-disabled")
+			.removeData("selectable")
+			.unbind(".selectable");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseStart: function(event) {
+		var self = this;
+
+		this.opos = [event.pageX, event.pageY];
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		this.selectees = $(options.filter, this.element[0]);
+
+		this._trigger("start", event);
+
+		$(options.appendTo).append(this.helper);
+		// position helper (lasso)
+		this.helper.css({
+			"left": event.clientX,
+			"top": event.clientY,
+			"width": 0,
+			"height": 0
+		});
+
+		if (options.autoRefresh) {
+			this.refresh();
+		}
+
+		this.selectees.filter('.ui-selected').each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.startselected = true;
+			if (!event.metaKey) {
+				selectee.$element.removeClass('ui-selected');
+				selectee.selected = false;
+				selectee.$element.addClass('ui-unselecting');
+				selectee.unselecting = true;
+				// selectable UNSELECTING callback
+				self._trigger("unselecting", event, {
+					unselecting: selectee.element
+				});
+			}
+		});
+
+		$(event.target).parents().andSelf().each(function() {
+			var selectee = $.data(this, "selectable-item");
+			if (selectee) {
+				var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected');
+				selectee.$element
+					.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+					.addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+				selectee.unselecting = !doSelect;
+				selectee.selecting = doSelect;
+				selectee.selected = doSelect;
+				// selectable (UN)SELECTING callback
+				if (doSelect) {
+					self._trigger("selecting", event, {
+						selecting: selectee.element
+					});
+				} else {
+					self._trigger("unselecting", event, {
+						unselecting: selectee.element
+					});
+				}
+				return false;
+			}
+		});
+
+	},
+
+	_mouseDrag: function(event) {
+		var self = this;
+		this.dragged = true;
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+		if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+		if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+		this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+		this.selectees.each(function() {
+			var selectee = $.data(this, "selectable-item");
+			//prevent helper from being selected if appendTo: selectable
+			if (!selectee || selectee.element == self.element[0])
+				return;
+			var hit = false;
+			if (options.tolerance == 'touch') {
+				hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+			} else if (options.tolerance == 'fit') {
+				hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+			}
+
+			if (hit) {
+				// SELECT
+				if (selectee.selected) {
+					selectee.$element.removeClass('ui-selected');
+					selectee.selected = false;
+				}
+				if (selectee.unselecting) {
+					selectee.$element.removeClass('ui-unselecting');
+					selectee.unselecting = false;
+				}
+				if (!selectee.selecting) {
+					selectee.$element.addClass('ui-selecting');
+					selectee.selecting = true;
+					// selectable SELECTING callback
+					self._trigger("selecting", event, {
+						selecting: selectee.element
+					});
+				}
+			} else {
+				// UNSELECT
+				if (selectee.selecting) {
+					if (event.metaKey && selectee.startselected) {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						selectee.$element.addClass('ui-selected');
+						selectee.selected = true;
+					} else {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						if (selectee.startselected) {
+							selectee.$element.addClass('ui-unselecting');
+							selectee.unselecting = true;
+						}
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+				if (selectee.selected) {
+					if (!event.metaKey && !selectee.startselected) {
+						selectee.$element.removeClass('ui-selected');
+						selectee.selected = false;
+
+						selectee.$element.addClass('ui-unselecting');
+						selectee.unselecting = true;
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+			}
+		});
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+		var self = this;
+
+		this.dragged = false;
+
+		var options = this.options;
+
+		$('.ui-unselecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-unselecting');
+			selectee.unselecting = false;
+			selectee.startselected = false;
+			self._trigger("unselected", event, {
+				unselected: selectee.element
+			});
+		});
+		$('.ui-selecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+			selectee.selecting = false;
+			selectee.selected = true;
+			selectee.startselected = true;
+			self._trigger("selected", event, {
+				selected: selectee.element
+			});
+		});
+		this._trigger("stop", event);
+
+		this.helper.remove();
+
+		return false;
+	}
+
+});
+
+$.extend($.ui.selectable, {
+	version: "1.8.11"
+});
+
+})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.sortable.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1073 @@
+/*
+ * jQuery UI Sortable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+	widgetEventPrefix: "sort",
+	options: {
+		appendTo: "parent",
+		axis: false,
+		connectWith: false,
+		containment: false,
+		cursor: 'auto',
+		cursorAt: false,
+		dropOnEmpty: true,
+		forcePlaceholderSize: false,
+		forceHelperSize: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		items: '> *',
+		opacity: false,
+		placeholder: false,
+		revert: false,
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		scope: "default",
+		tolerance: "intersect",
+		zIndex: 1000
+	},
+	_create: function() {
+
+		var o = this.options;
+		this.containerCache = {};
+		this.element.addClass("ui-sortable");
+
+		//Get the items
+		this.refresh();
+
+		//Let's determine if the items are being displayed horizontally
+		this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
+
+		//Let's determine the parent's offset
+		this.offset = this.element.offset();
+
+		//Initialize mouse events for interaction
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass("ui-sortable ui-sortable-disabled")
+			.removeData("sortable")
+			.unbind(".sortable");
+		this._mouseDestroy();
+
+		for ( var i = this.items.length - 1; i >= 0; i-- )
+			this.items[i].item.removeData("sortable-item");
+
+		return this;
+	},
+
+	_setOption: function(key, value){
+		if ( key === "disabled" ) {
+			this.options[ key ] = value;
+	
+			this.widget()
+				[ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+		} else {
+			// Don't call widget base _setOption for disable as it adds ui-state-disabled class
+			$.Widget.prototype._setOption.apply(this, arguments);
+		}
+	},
+
+	_mouseCapture: function(event, overrideHandle) {
+
+		if (this.reverting) {
+			return false;
+		}
+
+		if(this.options.disabled || this.options.type == 'static') return false;
+
+		//We have to refresh the items data once first
+		this._refreshItems(event);
+
+		//Find out if the clicked node (or one of its parents) is a actual item in this.items
+		var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+			if($.data(this, 'sortable-item') == self) {
+				currentItem = $(this);
+				return false;
+			}
+		});
+		if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+		if(!currentItem) return false;
+		if(this.options.handle && !overrideHandle) {
+			var validHandle = false;
+
+			$(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+			if(!validHandle) return false;
+		}
+
+		this.currentItem = currentItem;
+		this._removeCurrentsFromItems();
+		return true;
+
+	},
+
+	_mouseStart: function(event, overrideHandle, noActivation) {
+
+		var o = this.options, self = this;
+		this.currentContainer = this;
+
+		//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+		this.refreshPositions();
+
+		//Create and append the visible helper
+		this.helper = this._createHelper(event);
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Get the next scrolling parent
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.currentItem.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		// Only after we got the offset, we can change the helper's position to absolute
+		// TODO: Still need to figure out a way to make relative sorting possible
+		this.helper.css("position", "absolute");
+		this.cssPosition = this.helper.css("position");
+
+		$.extend(this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+		});
+
+		//Generate the original position
+		this.originalPosition = this._generatePosition(event);
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+		//Cache the former DOM position
+		this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+		//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+		if(this.helper[0] != this.currentItem[0]) {
+			this.currentItem.hide();
+		}
+
+		//Create the placeholder
+		this._createPlaceholder();
+
+		//Set a containment if given in the options
+		if(o.containment)
+			this._setContainment();
+
+		if(o.cursor) { // cursor option
+			if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+			$('body').css("cursor", o.cursor);
+		}
+
+		if(o.opacity) { // opacity option
+			if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+			this.helper.css("opacity", o.opacity);
+		}
+
+		if(o.zIndex) { // zIndex option
+			if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+			this.helper.css("zIndex", o.zIndex);
+		}
+
+		//Prepare scrolling
+		if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+			this.overflowOffset = this.scrollParent.offset();
+
+		//Call callbacks
+		this._trigger("start", event, this._uiHash());
+
+		//Recache the helper size
+		if(!this._preserveHelperProportions)
+			this._cacheHelperProportions();
+
+
+		//Post 'activate' events to possible containers
+		if(!noActivation) {
+			 for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+		}
+
+		//Prepare possible droppables
+		if($.ui.ddmanager)
+			$.ui.ddmanager.current = this;
+
+		if ($.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(this, event);
+
+		this.dragging = true;
+
+		this.helper.addClass("ui-sortable-helper");
+		this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+		return true;
+
+	},
+
+	_mouseDrag: function(event) {
+
+		//Compute the helpers position
+		this.position = this._generatePosition(event);
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		if (!this.lastPositionAbs) {
+			this.lastPositionAbs = this.positionAbs;
+		}
+
+		//Do scrolling
+		if(this.options.scroll) {
+			var o = this.options, scrolled = false;
+			if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+				if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+				else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+				if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+				else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+			} else {
+
+				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+			}
+
+			if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+				$.ui.ddmanager.prepareOffsets(this, event);
+		}
+
+		//Regenerate the absolute position used for position checks
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		//Set the helper position
+		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+		//Rearrange
+		for (var i = this.items.length - 1; i >= 0; i--) {
+
+			//Cache variables and intersection, continue if no intersection
+			var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+			if (!intersection) continue;
+
+			if(itemElement != this.currentItem[0] //cannot intersect with itself
+				&&	this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+				&&	!$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+				&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+				//&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+			) {
+
+				this.direction = intersection == 1 ? "down" : "up";
+
+				if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+					this._rearrange(event, item);
+				} else {
+					break;
+				}
+
+				this._trigger("change", event, this._uiHash());
+				break;
+			}
+		}
+
+		//Post events to containers
+		this._contactContainers(event);
+
+		//Interconnect with droppables
+		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+		//Call callbacks
+		this._trigger('sort', event, this._uiHash());
+
+		this.lastPositionAbs = this.positionAbs;
+		return false;
+
+	},
+
+	_mouseStop: function(event, noPropagation) {
+
+		if(!event) return;
+
+		//If we are using droppables, inform the manager about the drop
+		if ($.ui.ddmanager && !this.options.dropBehaviour)
+			$.ui.ddmanager.drop(this, event);
+
+		if(this.options.revert) {
+			var self = this;
+			var cur = self.placeholder.offset();
+
+			self.reverting = true;
+
+			$(this.helper).animate({
+				left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+				top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+			}, parseInt(this.options.revert, 10) || 500, function() {
+				self._clear(event);
+			});
+		} else {
+			this._clear(event, noPropagation);
+		}
+
+		return false;
+
+	},
+
+	cancel: function() {
+
+		var self = this;
+
+		if(this.dragging) {
+
+			this._mouseUp({ target: null });
+
+			if(this.options.helper == "original")
+				this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+			else
+				this.currentItem.show();
+
+			//Post deactivating events to containers
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+				if(this.containers[i].containerCache.over) {
+					this.containers[i]._trigger("out", null, self._uiHash(this));
+					this.containers[i].containerCache.over = 0;
+				}
+			}
+
+		}
+
+		if (this.placeholder) {
+			//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+			if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+			if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+			$.extend(this, {
+				helper: null,
+				dragging: false,
+				reverting: false,
+				_noFinalSort: null
+			});
+
+			if(this.domPosition.prev) {
+				$(this.domPosition.prev).after(this.currentItem);
+			} else {
+				$(this.domPosition.parent).prepend(this.currentItem);
+			}
+		}
+
+		return this;
+
+	},
+
+	serialize: function(o) {
+
+		var items = this._getItemsAsjQuery(o && o.connected);
+		var str = []; o = o || {};
+
+		$(items).each(function() {
+			var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+			if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+		});
+
+		if(!str.length && o.key) {
+			str.push(o.key + '=');
+		}
+
+		return str.join('&');
+
+	},
+
+	toArray: function(o) {
+
+		var items = this._getItemsAsjQuery(o && o.connected);
+		var ret = []; o = o || {};
+
+		items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+		return ret;
+
+	},
+
+	/* Be careful with the following core functions */
+	_intersectsWith: function(item) {
+
+		var x1 = this.positionAbs.left,
+			x2 = x1 + this.helperProportions.width,
+			y1 = this.positionAbs.top,
+			y2 = y1 + this.helperProportions.height;
+
+		var l = item.left,
+			r = l + item.width,
+			t = item.top,
+			b = t + item.height;
+
+		var dyClick = this.offset.click.top,
+			dxClick = this.offset.click.left;
+
+		var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+		if(	   this.options.tolerance == "pointer"
+			|| this.options.forcePointerForContainers
+			|| (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+		) {
+			return isOverElement;
+		} else {
+
+			return (l < x1 + (this.helperProportions.width / 2) // Right Half
+				&& x2 - (this.helperProportions.width / 2) < r // Left Half
+				&& t < y1 + (this.helperProportions.height / 2) // Bottom Half
+				&& y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+		}
+	},
+
+	_intersectsWithPointer: function(item) {
+
+		var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+			isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+			isOverElement = isOverElementHeight && isOverElementWidth,
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if (!isOverElement)
+			return false;
+
+		return this.floating ?
+			( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+			: ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+	},
+
+	_intersectsWithSides: function(item) {
+
+		var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+			isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if (this.floating && horizontalDirection) {
+			return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+		} else {
+			return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+		}
+
+	},
+
+	_getDragVerticalDirection: function() {
+		var delta = this.positionAbs.top - this.lastPositionAbs.top;
+		return delta != 0 && (delta > 0 ? "down" : "up");
+	},
+
+	_getDragHorizontalDirection: function() {
+		var delta = this.positionAbs.left - this.lastPositionAbs.left;
+		return delta != 0 && (delta > 0 ? "right" : "left");
+	},
+
+	refresh: function(event) {
+		this._refreshItems(event);
+		this.refreshPositions();
+		return this;
+	},
+
+	_connectWith: function() {
+		var options = this.options;
+		return options.connectWith.constructor == String
+			? [options.connectWith]
+			: options.connectWith;
+	},
+	
+	_getItemsAsjQuery: function(connected) {
+
+		var self = this;
+		var items = [];
+		var queries = [];
+		var connectWith = this._connectWith();
+
+		if(connectWith && connected) {
+			for (var i = connectWith.length - 1; i >= 0; i--){
+				var cur = $(connectWith[i]);
+				for (var j = cur.length - 1; j >= 0; j--){
+					var inst = $.data(cur[j], 'sortable');
+					if(inst && inst != this && !inst.options.disabled) {
+						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+					}
+				};
+			};
+		}
+
+		queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+		for (var i = queries.length - 1; i >= 0; i--){
+			queries[i][0].each(function() {
+				items.push(this);
+			});
+		};
+
+		return $(items);
+
+	},
+
+	_removeCurrentsFromItems: function() {
+
+		var list = this.currentItem.find(":data(sortable-item)");
+
+		for (var i=0; i < this.items.length; i++) {
+
+			for (var j=0; j < list.length; j++) {
+				if(list[j] == this.items[i].item[0])
+					this.items.splice(i,1);
+			};
+
+		};
+
+	},
+
+	_refreshItems: function(event) {
+
+		this.items = [];
+		this.containers = [this];
+		var items = this.items;
+		var self = this;
+		var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+		var connectWith = this._connectWith();
+
+		if(connectWith) {
+			for (var i = connectWith.length - 1; i >= 0; i--){
+				var cur = $(connectWith[i]);
+				for (var j = cur.length - 1; j >= 0; j--){
+					var inst = $.data(cur[j], 'sortable');
+					if(inst && inst != this && !inst.options.disabled) {
+						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+						this.containers.push(inst);
+					}
+				};
+			};
+		}
+
+		for (var i = queries.length - 1; i >= 0; i--) {
+			var targetData = queries[i][1];
+			var _queries = queries[i][0];
+
+			for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+				var item = $(_queries[j]);
+
+				item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+				items.push({
+					item: item,
+					instance: targetData,
+					width: 0, height: 0,
+					left: 0, top: 0
+				});
+			};
+		};
+
+	},
+
+	refreshPositions: function(fast) {
+
+		//This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+		if(this.offsetParent && this.helper) {
+			this.offset.parent = this._getParentOffset();
+		}
+
+		for (var i = this.items.length - 1; i >= 0; i--){
+			var item = this.items[i];
+
+			var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+			if (!fast) {
+				item.width = t.outerWidth();
+				item.height = t.outerHeight();
+			}
+
+			var p = t.offset();
+			item.left = p.left;
+			item.top = p.top;
+		};
+
+		if(this.options.custom && this.options.custom.refreshContainers) {
+			this.options.custom.refreshContainers.call(this);
+		} else {
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				var p = this.containers[i].element.offset();
+				this.containers[i].containerCache.left = p.left;
+				this.containers[i].containerCache.top = p.top;
+				this.containers[i].containerCache.width	= this.containers[i].element.outerWidth();
+				this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+			};
+		}
+
+		return this;
+	},
+
+	_createPlaceholder: function(that) {
+
+		var self = that || this, o = self.options;
+
+		if(!o.placeholder || o.placeholder.constructor == String) {
+			var className = o.placeholder;
+			o.placeholder = {
+				element: function() {
+
+					var el = $(document.createElement(self.currentItem[0].nodeName))
+						.addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+						.removeClass("ui-sortable-helper")[0];
+
+					if(!className)
+						el.style.visibility = "hidden";
+
+					return el;
+				},
+				update: function(container, p) {
+
+					// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+					if(className && !o.forcePlaceholderSize) return;
+
+					//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+					if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+					if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+				}
+			};
+		}
+
+		//Create the placeholder
+		self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+		//Append it after the actual current item
+		self.currentItem.after(self.placeholder);
+
+		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+		o.placeholder.update(self, self.placeholder);
+
+	},
+
+	_contactContainers: function(event) {
+		
+		// get innermost container that intersects with item 
+		var innermostContainer = null, innermostIndex = null;		
+		
+		
+		for (var i = this.containers.length - 1; i >= 0; i--){
+
+			// never consider a container that's located within the item itself 
+			if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+				continue;
+
+			if(this._intersectsWith(this.containers[i].containerCache)) {
+
+				// if we've already found a container and it's more "inner" than this, then continue 
+				if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+					continue;
+
+				innermostContainer = this.containers[i]; 
+				innermostIndex = i;
+					
+			} else {
+				// container doesn't intersect. trigger "out" event if necessary 
+				if(this.containers[i].containerCache.over) {
+					this.containers[i]._trigger("out", event, this._uiHash(this));
+					this.containers[i].containerCache.over = 0;
+				}
+			}
+
+		}
+		
+		// if no intersecting containers found, return 
+		if(!innermostContainer) return; 
+
+		// move the item into the container if it's not there already
+		if(this.containers.length === 1) {
+			this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+			this.containers[innermostIndex].containerCache.over = 1;
+		} else if(this.currentContainer != this.containers[innermostIndex]) { 
+
+			//When entering a new container, we will find the item with the least distance and append our item near it 
+			var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; 
+			for (var j = this.items.length - 1; j >= 0; j--) { 
+				if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; 
+				var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; 
+				if(Math.abs(cur - base) < dist) { 
+					dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; 
+				} 
+			} 
+
+			if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled 
+				return; 
+
+			this.currentContainer = this.containers[innermostIndex]; 
+			itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); 
+			this._trigger("change", event, this._uiHash()); 
+			this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); 
+
+			//Update the placeholder 
+			this.options.placeholder.update(this.currentContainer, this.placeholder); 
+		
+			this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); 
+			this.containers[innermostIndex].containerCache.over = 1;
+		} 
+	
+		
+	},
+
+	_createHelper: function(event) {
+
+		var o = this.options;
+		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+		if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+			$(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+		if(helper[0] == this.currentItem[0])
+			this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+		if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+		if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function(obj) {
+		if (typeof obj == 'string') {
+			obj = obj.split(' ');
+		}
+		if ($.isArray(obj)) {
+			obj = {left: +obj[0], top: +obj[1] || 0};
+		}
+		if ('left' in obj) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ('right' in obj) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ('top' in obj) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ('bottom' in obj) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+			po = { top: 0, left: 0 };
+
+		return {
+			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if(this.cssPosition == "relative") {
+			var p = this.currentItem.position();
+			return {
+				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+			top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var o = this.options;
+		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+		if(o.containment == 'document' || o.containment == 'window') this.containment = [
+			0 - this.offset.relative.left - this.offset.parent.left,
+			0 - this.offset.relative.top - this.offset.parent.top,
+			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+		];
+
+		if(!(/^(document|window|parent)$/).test(o.containment)) {
+			var ce = $(o.containment)[0];
+			var co = $(o.containment).offset();
+			var over = ($(ce).css("overflow") != 'hidden');
+
+			this.containment = [
+				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+			];
+		}
+
+	},
+
+	_convertPositionTo: function(d, pos) {
+
+		if(!pos) pos = this.position;
+		var mod = d == "absolute" ? 1 : -1;
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		return {
+			top: (
+				pos.top																	// The absolute mouse position
+				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+			),
+			left: (
+				pos.left																// The absolute mouse position
+				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+			)
+		};
+
+	},
+
+	_generatePosition: function(event) {
+
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		// This is another very weird special case that only happens for relative elements:
+		// 1. If the css position is relative
+		// 2. and the scroll parent is the document or similar to the offset parent
+		// we have to refresh the relative offset during the scroll so there are no jumps
+		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+			this.offset.relative = this._getRelativeOffset();
+		}
+
+		var pageX = event.pageX;
+		var pageY = event.pageY;
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+			if(this.containment) {
+				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+			}
+
+			if(o.grid) {
+				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+			}
+
+		}
+
+		return {
+			top: (
+				pageY																// The absolute mouse position
+				- this.offset.click.top													// Click offset (relative to the element)
+				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+			),
+			left: (
+				pageX																// The absolute mouse position
+				- this.offset.click.left												// Click offset (relative to the element)
+				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+			)
+		};
+
+	},
+
+	_rearrange: function(event, i, a, hardRefresh) {
+
+		a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+		//Various things done here to improve the performance:
+		// 1. we create a setTimeout, that calls refreshPositions
+		// 2. on the instance, we have a counter variable, that get's higher after every append
+		// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+		// 4. this lets only the last addition to the timeout stack through
+		this.counter = this.counter ? ++this.counter : 1;
+		var self = this, counter = this.counter;
+
+		window.setTimeout(function() {
+			if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+		},0);
+
+	},
+
+	_clear: function(event, noPropagation) {
+
+		this.reverting = false;
+		// We delay all events that have to be triggered to after the point where the placeholder has been removed and
+		// everything else normalized again
+		var delayedTriggers = [], self = this;
+
+		// We first have to update the dom position of the actual currentItem
+		// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+		if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+		this._noFinalSort = null;
+
+		if(this.helper[0] == this.currentItem[0]) {
+			for(var i in this._storedCSS) {
+				if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+			}
+			this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+		} else {
+			this.currentItem.show();
+		}
+
+		if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+		if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+		if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+			if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+					delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+					delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this));  }; }).call(this, this.containers[i]));
+				}
+			};
+		};
+
+		//Post events to containers
+		for (var i = this.containers.length - 1; i >= 0; i--){
+			if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+			if(this.containers[i].containerCache.over) {
+				delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+				this.containers[i].containerCache.over = 0;
+			}
+		}
+
+		//Do what was originally in plugins
+		if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+		if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+		if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+		this.dragging = false;
+		if(this.cancelHelperRemoval) {
+			if(!noPropagation) {
+				this._trigger("beforeStop", event, this._uiHash());
+				for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+				this._trigger("stop", event, this._uiHash());
+			}
+			return false;
+		}
+
+		if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+		this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+		if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+		if(!noPropagation) {
+			for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+			this._trigger("stop", event, this._uiHash());
+		}
+
+		this.fromOutside = false;
+		return true;
+
+	},
+
+	_trigger: function() {
+		if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+			this.cancel();
+		}
+	},
+
+	_uiHash: function(inst) {
+		var self = inst || this;
+		return {
+			helper: self.helper,
+			placeholder: self.placeholder || $([]),
+			position: self.position,
+			originalPosition: self.originalPosition,
+			offset: self.positionAbs,
+			item: self.currentItem,
+			sender: inst ? inst.element : null
+		};
+	}
+
+});
+
+$.extend($.ui.sortable, {
+	version: "1.8.11"
+});
+
+})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/jquery.ui.widget.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,262 @@
+/*!
+ * jQuery UI Widget 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+	var _cleanData = $.cleanData;
+	$.cleanData = function( elems ) {
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			$( elem ).triggerHandler( "remove" );
+		}
+		_cleanData( elems );
+	};
+} else {
+	var _remove = $.fn.remove;
+	$.fn.remove = function( selector, keepData ) {
+		return this.each(function() {
+			if ( !keepData ) {
+				if ( !selector || $.filter( selector, [ this ] ).length ) {
+					$( "*", this ).add( [ this ] ).each(function() {
+						$( this ).triggerHandler( "remove" );
+					});
+				}
+			}
+			return _remove.call( $(this), selector, keepData );
+		});
+	};
+}
+
+$.widget = function( name, base, prototype ) {
+	var namespace = name.split( "." )[ 0 ],
+		fullName;
+	name = name.split( "." )[ 1 ];
+	fullName = namespace + "-" + name;
+
+	if ( !prototype ) {
+		prototype = base;
+		base = $.Widget;
+	}
+
+	// create selector for plugin
+	$.expr[ ":" ][ fullName ] = function( elem ) {
+		return !!$.data( elem, name );
+	};
+
+	$[ namespace ] = $[ namespace ] || {};
+	$[ namespace ][ name ] = function( options, element ) {
+		// allow instantiation without initializing for simple inheritance
+		if ( arguments.length ) {
+			this._createWidget( options, element );
+		}
+	};
+
+	var basePrototype = new base();
+	// we need to make the options hash a property directly on the new instance
+	// otherwise we'll modify the options hash on the prototype that we're
+	// inheriting from
+//	$.each( basePrototype, function( key, val ) {
+//		if ( $.isPlainObject(val) ) {
+//			basePrototype[ key ] = $.extend( {}, val );
+//		}
+//	});
+	basePrototype.options = $.extend( true, {}, basePrototype.options );
+	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+		namespace: namespace,
+		widgetName: name,
+		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+		widgetBaseClass: fullName
+	}, prototype );
+
+	$.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+	$.fn[ name ] = function( options ) {
+		var isMethodCall = typeof options === "string",
+			args = Array.prototype.slice.call( arguments, 1 ),
+			returnValue = this;
+
+		// allow multiple hashes to be passed on init
+		options = !isMethodCall && args.length ?
+			$.extend.apply( null, [ true, options ].concat(args) ) :
+			options;
+
+		// prevent calls to internal methods
+		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+			return returnValue;
+		}
+
+		if ( isMethodCall ) {
+			this.each(function() {
+				var instance = $.data( this, name ),
+					methodValue = instance && $.isFunction( instance[options] ) ?
+						instance[ options ].apply( instance, args ) :
+						instance;
+				// TODO: add this back in 1.9 and use $.error() (see #5972)
+//				if ( !instance ) {
+//					throw "cannot call methods on " + name + " prior to initialization; " +
+//						"attempted to call method '" + options + "'";
+//				}
+//				if ( !$.isFunction( instance[options] ) ) {
+//					throw "no such method '" + options + "' for " + name + " widget instance";
+//				}
+//				var methodValue = instance[ options ].apply( instance, args );
+				if ( methodValue !== instance && methodValue !== undefined ) {
+					returnValue = methodValue;
+					return false;
+				}
+			});
+		} else {
+			this.each(function() {
+				var instance = $.data( this, name );
+				if ( instance ) {
+					instance.option( options || {} )._init();
+				} else {
+					$.data( this, name, new object( options, this ) );
+				}
+			});
+		}
+
+		return returnValue;
+	};
+};
+
+$.Widget = function( options, element ) {
+	// allow instantiation without initializing for simple inheritance
+	if ( arguments.length ) {
+		this._createWidget( options, element );
+	}
+};
+
+$.Widget.prototype = {
+	widgetName: "widget",
+	widgetEventPrefix: "",
+	options: {
+		disabled: false
+	},
+	_createWidget: function( options, element ) {
+		// $.widget.bridge stores the plugin instance, but we do it anyway
+		// so that it's stored even before the _create function runs
+		$.data( element, this.widgetName, this );
+		this.element = $( element );
+		this.options = $.extend( true, {},
+			this.options,
+			this._getCreateOptions(),
+			options );
+
+		var self = this;
+		this.element.bind( "remove." + this.widgetName, function() {
+			self.destroy();
+		});
+
+		this._create();
+		this._trigger( "create" );
+		this._init();
+	},
+	_getCreateOptions: function() {
+		return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+	},
+	_create: function() {},
+	_init: function() {},
+
+	destroy: function() {
+		this.element
+			.unbind( "." + this.widgetName )
+			.removeData( this.widgetName );
+		this.widget()
+			.unbind( "." + this.widgetName )
+			.removeAttr( "aria-disabled" )
+			.removeClass(
+				this.widgetBaseClass + "-disabled " +
+				"ui-state-disabled" );
+	},
+
+	widget: function() {
+		return this.element;
+	},
+
+	option: function( key, value ) {
+		var options = key;
+
+		if ( arguments.length === 0 ) {
+			// don't return a reference to the internal hash
+			return $.extend( {}, this.options );
+		}
+
+		if  (typeof key === "string" ) {
+			if ( value === undefined ) {
+				return this.options[ key ];
+			}
+			options = {};
+			options[ key ] = value;
+		}
+
+		this._setOptions( options );
+
+		return this;
+	},
+	_setOptions: function( options ) {
+		var self = this;
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+		});
+
+		return this;
+	},
+	_setOption: function( key, value ) {
+		this.options[ key ] = value;
+
+		if ( key === "disabled" ) {
+			this.widget()
+				[ value ? "addClass" : "removeClass"](
+					this.widgetBaseClass + "-disabled" + " " +
+					"ui-state-disabled" )
+				.attr( "aria-disabled", value );
+		}
+
+		return this;
+	},
+
+	enable: function() {
+		return this._setOption( "disabled", false );
+	},
+	disable: function() {
+		return this._setOption( "disabled", true );
+	},
+
+	_trigger: function( type, event, data ) {
+		var callback = this.options[ type ];
+
+		event = $.Event( event );
+		event.type = ( type === this.widgetEventPrefix ?
+			type :
+			this.widgetEventPrefix + type ).toLowerCase();
+		data = data || {};
+
+		// copy original event properties over to the new event
+		// this would happen if we could call $.event.fix instead of $.Event
+		// but we don't have a way to force an event to be fixed multiple times
+		if ( event.originalEvent ) {
+			for ( var i = $.event.props.length, prop; i; ) {
+				prop = $.event.props[ --i ];
+				event[ prop ] = event.originalEvent[ prop ];
+			}
+		}
+
+		this.element.trigger( event, data );
+
+		return !( $.isFunction(callback) &&
+			callback.call( this.element[0], event, data ) === false ||
+			event.isDefaultPrevented() );
+	}
+};
+
+})( jQuery );
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.accordion.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,30 @@
+/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
+this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
+e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
+e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
+"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.11",
+animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
+f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
+paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.autocomplete.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,32 @@
+/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
+a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
+b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
+this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
+b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
+d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},
+deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);
+e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,
+g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
+this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.button.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,25 @@
+/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,f=a([]);if(c)f=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return f};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
+i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
+function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(f)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");
+b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var e=b.element[0];h(e).not(e).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");
+g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(e){if(c.disabled)return false;if(e.keyCode==a.ui.keyCode.SPACE||e.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(e){e.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",
+c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){var b=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=b.find(c);if(!this.buttonElement.length){b=b.length?b.siblings():this.element.siblings();this.buttonElement=b.filter(c);if(!this.buttonElement.length)this.buttonElement=b.find(c)}this.element.addClass("ui-helper-hidden-accessible");
+(b=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active  ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());
+this.hasTitle||this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
+c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.push(f?"ui-button-icons-only":
+"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.core.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,17 @@
+/*!
+ * jQuery UI 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.11",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
+b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.dialog.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,40 @@
+/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *  jquery.ui.button.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&
+c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
+-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role",
+"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=
+b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&
+a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index");
+isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);
+d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}});
+c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,
+h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=
+d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,
+position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,
+h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===
+1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in
+l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");
+break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e=
+this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&&
+this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.11",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===
+0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,
+function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.draggable.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,50 @@
+/*
+ * jQuery UI Draggable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&
+this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),
+height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?
+document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),
+10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),
+10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&
+d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=
+this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?
+e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,
+offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.11"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g.refreshPositions();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},
+b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=
+d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};
+a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&
+this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",
+{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+
+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",
+a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+
+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<
+c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+
+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),
+f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=
+c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=
+c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),
+{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=
+parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.droppable.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,26 @@
+/*
+ * jQuery UI Droppable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.11"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
+i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
+d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.mouse.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,17 @@
+/*!
+ * jQuery UI Mouse 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=
+a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,e=a.which==1,f=typeof this.options.cancel=="string"?b(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
+this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(d){return c._mouseMove(d)};this._mouseUpDelegate=function(d){return c._mouseUp(d)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=
+true}},_mouseMove:function(a){if(b.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);
+if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.position.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,16 @@
+/*
+ * jQuery UI Position 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.resizable.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,47 @@
+/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
+f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");
+this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=
+null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+
+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=
+[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=
+this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,
+a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,
+c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,
+originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.11"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=
+b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width",
+"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};
+if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-
+g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,
+height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=
+e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,
+d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?
+d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=
+a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&
+/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");
+b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/
+(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.selectable.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,22 @@
+/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
+e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.11"})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.sortable.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,60 @@
+/*
+ * jQuery UI Sortable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=
+b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;
+d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-
+this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
+return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<
+b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-
+b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,
+a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
+e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
+c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
+toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||
+this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();
+var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},
+_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
+if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),
+this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&
+this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=
+e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];
+if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);
+c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===
+1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=
+this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):
+b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==
+""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
+this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
+10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
+{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||
+document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,
+b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=
+document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-
+this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<
+this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&
+this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=
+this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();
+this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],
+this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",
+g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||
+this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,
+originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.11"})})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/ui/minified/jquery.ui.widget.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,15 @@
+/*!
+ * jQuery UI Widget 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
+e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
+this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/development-bundle/version.txt	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,1 @@
+1.8.11
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,323 @@
+<!DOCTYPE html>
+<html>
+	<head>
+		<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1" />
+		<title>jQuery UI Example Page</title>
+		<link type="text/css" href="css/ui-lightness/jquery-ui-1.8.11.custom.css" rel="stylesheet" />	
+		<script type="text/javascript" src="js/jquery-1.5.1.min.js"></script>
+		<script type="text/javascript" src="js/jquery-ui-1.8.11.custom.min.js"></script>
+		<script type="text/javascript">
+			$(function(){
+
+				// Accordion
+				$("#accordion").accordion({ header: "h3" });
+	
+
+				// Dialog			
+				$('#dialog').dialog({
+					autoOpen: false,
+					width: 600,
+					buttons: {
+						"Ok": function() { 
+							$(this).dialog("close"); 
+						}, 
+						"Cancel": function() { 
+							$(this).dialog("close"); 
+						} 
+					}
+				});
+				
+				// Dialog Link
+				$('#dialog_link').click(function(){
+					$('#dialog').dialog('open');
+					return false;
+				});
+				
+				//hover states on the static widgets
+				$('#dialog_link, ul#icons li').hover(
+					function() { $(this).addClass('ui-state-hover'); }, 
+					function() { $(this).removeClass('ui-state-hover'); }
+				);
+				
+			});
+		</script>
+		<style type="text/css">
+			/*demo page css*/
+			body{ font: 62.5% "Trebuchet MS", sans-serif; margin: 50px;}
+			.demoHeaders { margin-top: 2em; }
+			#dialog_link {padding: .4em 1em .4em 20px;text-decoration: none;position: relative;}
+			#dialog_link span.ui-icon {margin: 0 5px 0 0;position: absolute;left: .2em;top: 50%;margin-top: -8px;}
+			ul#icons {margin: 0; padding: 0;}
+			ul#icons li {margin: 2px; position: relative; padding: 4px 0; cursor: pointer; float: left;  list-style: none;}
+			ul#icons span.ui-icon {float: left; margin: 0 4px;}
+		</style>	
+	</head>
+	<body>
+	<h1>Welcome to jQuery UI!</h1>
+	<p style="font-size: 1.3em; line-height: 1.5; margin: 1em 0; width: 50%;">This page demonstrates the widgets you downloaded using the theme you selected in the download builder. We've included and linked to minified versions of <a href="js/jquery-1.5.1.min.js">jQuery</a>, your personalized copy of <a href="js/jquery-ui-1.8.11.custom.min.js">jQuery UI (js/jquery-ui-1.8.11.custom.min.js)</a>, and <a href="css/ui-lightness/jquery-ui-1.8.11.custom.css">css/ui-lightness/jquery-ui-1.8.11.custom.css</a> which imports the entire jQuery UI CSS Framework. You can choose to link a subset of the CSS Framework depending on your needs. </p>
+	<p style="font-size: 1.2em; line-height: 1.5; margin: 1em 0; width: 50%;">You've downloaded components and a theme that are compatible with jQuery 1.3+. Please make sure you are using jQuery 1.3+ in your production environment.</p>	
+
+	<p style="font-weight: bold; margin: 2em 0 1em; font-size: 1.3em;">YOUR COMPONENTS:</p>
+		
+		<!-- Accordion -->
+		<h2 class="demoHeaders">Accordion</h2>
+		<div id="accordion">
+			<div>
+				<h3><a href="#">First</a></h3>
+				<div>Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet.</div>
+			</div>
+			<div>
+				<h3><a href="#">Second</a></h3>
+				<div>Phasellus mattis tincidunt nibh.</div>
+			</div>
+			<div>
+				<h3><a href="#">Third</a></h3>
+				<div>Nam dui erat, auctor a, dignissim quis.</div>
+			</div>
+		</div>
+	
+		<!-- Dialog NOTE: Dialog is not generated by UI in this demo so it can be visually styled in themeroller-->
+		<h2 class="demoHeaders">Dialog</h2>
+		<p><a href="#" id="dialog_link" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-newwin"></span>Open Dialog</a></p>
+		
+		
+		<h2 class="demoHeaders">Overlay and Shadow Classes <em>(not currently used in UI widgets)</em></h2>
+		<div style="position: relative; width: 96%; height: 200px; padding:1% 4%; overflow:hidden;" class="fakewindowcontain">
+			<p>Lorem ipsum dolor sit amet,  Nulla nec tortor. Donec id elit quis purus consectetur consequat. </p><p>Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. </p><p>Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. </p><p>Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. </p><p>Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. </p><p>Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. </p>
+			
+			<!-- ui-dialog -->
+			<div class="ui-overlay"><div class="ui-widget-overlay"></div><div class="ui-widget-shadow ui-corner-all" style="width: 302px; height: 152px; position: absolute; left: 50px; top: 30px;"></div></div>
+			<div style="position: absolute; width: 280px; height: 130px;left: 50px; top: 30px; padding: 10px;" class="ui-widget ui-widget-content ui-corner-all">
+				<div class="ui-dialog-content ui-widget-content" style="background: none; border: 0;">
+					<p>Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.</p>
+				</div>
+			</div>
+		
+		</div>
+
+		
+		<!-- ui-dialog -->
+		<div id="dialog" title="Dialog Title">
+			<p>Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.</p>
+		</div>
+			
+				
+				
+		<h2 class="demoHeaders">Framework Icons (content color preview)</h2>
+		<ul id="icons" class="ui-widget ui-helper-clearfix">
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-n"><span class="ui-icon ui-icon-carat-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-ne"><span class="ui-icon ui-icon-carat-1-ne"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-e"><span class="ui-icon ui-icon-carat-1-e"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-se"><span class="ui-icon ui-icon-carat-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-s"><span class="ui-icon ui-icon-carat-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-sw"><span class="ui-icon ui-icon-carat-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-w"><span class="ui-icon ui-icon-carat-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-nw"><span class="ui-icon ui-icon-carat-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-2-n-s"><span class="ui-icon ui-icon-carat-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-2-e-w"><span class="ui-icon ui-icon-carat-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-n"><span class="ui-icon ui-icon-triangle-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-ne"><span class="ui-icon ui-icon-triangle-1-ne"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-e"><span class="ui-icon ui-icon-triangle-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-se"><span class="ui-icon ui-icon-triangle-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-s"><span class="ui-icon ui-icon-triangle-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-sw"><span class="ui-icon ui-icon-triangle-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-w"><span class="ui-icon ui-icon-triangle-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-nw"><span class="ui-icon ui-icon-triangle-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-2-n-s"><span class="ui-icon ui-icon-triangle-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-2-e-w"><span class="ui-icon ui-icon-triangle-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-n"><span class="ui-icon ui-icon-arrow-1-n"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-ne"><span class="ui-icon ui-icon-arrow-1-ne"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-e"><span class="ui-icon ui-icon-arrow-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-se"><span class="ui-icon ui-icon-arrow-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-s"><span class="ui-icon ui-icon-arrow-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-sw"><span class="ui-icon ui-icon-arrow-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-w"><span class="ui-icon ui-icon-arrow-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-nw"><span class="ui-icon ui-icon-arrow-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-n-s"><span class="ui-icon ui-icon-arrow-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-ne-sw"><span class="ui-icon ui-icon-arrow-2-ne-sw"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-e-w"><span class="ui-icon ui-icon-arrow-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-se-nw"><span class="ui-icon ui-icon-arrow-2-se-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-n"><span class="ui-icon ui-icon-arrowstop-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-e"><span class="ui-icon ui-icon-arrowstop-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-s"><span class="ui-icon ui-icon-arrowstop-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-w"><span class="ui-icon ui-icon-arrowstop-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-n"><span class="ui-icon ui-icon-arrowthick-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-ne"><span class="ui-icon ui-icon-arrowthick-1-ne"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-e"><span class="ui-icon ui-icon-arrowthick-1-e"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-se"><span class="ui-icon ui-icon-arrowthick-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-s"><span class="ui-icon ui-icon-arrowthick-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-sw"><span class="ui-icon ui-icon-arrowthick-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-w"><span class="ui-icon ui-icon-arrowthick-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-nw"><span class="ui-icon ui-icon-arrowthick-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-n-s"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-ne-sw"><span class="ui-icon ui-icon-arrowthick-2-ne-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-e-w"><span class="ui-icon ui-icon-arrowthick-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-se-nw"><span class="ui-icon ui-icon-arrowthick-2-se-nw"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-n"><span class="ui-icon ui-icon-arrowthickstop-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-e"><span class="ui-icon ui-icon-arrowthickstop-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-s"><span class="ui-icon ui-icon-arrowthickstop-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-w"><span class="ui-icon ui-icon-arrowthickstop-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-w"><span class="ui-icon ui-icon-arrowreturnthick-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-n"><span class="ui-icon ui-icon-arrowreturnthick-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-e"><span class="ui-icon ui-icon-arrowreturnthick-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-s"><span class="ui-icon ui-icon-arrowreturnthick-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-w"><span class="ui-icon ui-icon-arrowreturn-1-w"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-n"><span class="ui-icon ui-icon-arrowreturn-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-e"><span class="ui-icon ui-icon-arrowreturn-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-s"><span class="ui-icon ui-icon-arrowreturn-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-w"><span class="ui-icon ui-icon-arrowrefresh-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-n"><span class="ui-icon ui-icon-arrowrefresh-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-e"><span class="ui-icon ui-icon-arrowrefresh-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-s"><span class="ui-icon ui-icon-arrowrefresh-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-4"><span class="ui-icon ui-icon-arrow-4"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-4-diag"><span class="ui-icon ui-icon-arrow-4-diag"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-extlink"><span class="ui-icon ui-icon-extlink"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-newwin"><span class="ui-icon ui-icon-newwin"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-refresh"><span class="ui-icon ui-icon-refresh"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-shuffle"><span class="ui-icon ui-icon-shuffle"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-transfer-e-w"><span class="ui-icon ui-icon-transfer-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-transferthick-e-w"><span class="ui-icon ui-icon-transferthick-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-folder-collapsed"><span class="ui-icon ui-icon-folder-collapsed"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-folder-open"><span class="ui-icon ui-icon-folder-open"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-document"><span class="ui-icon ui-icon-document"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-document-b"><span class="ui-icon ui-icon-document-b"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-note"><span class="ui-icon ui-icon-note"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-mail-closed"><span class="ui-icon ui-icon-mail-closed"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-mail-open"><span class="ui-icon ui-icon-mail-open"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-suitcase"><span class="ui-icon ui-icon-suitcase"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-comment"><span class="ui-icon ui-icon-comment"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-person"><span class="ui-icon ui-icon-person"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-print"><span class="ui-icon ui-icon-print"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-trash"><span class="ui-icon ui-icon-trash"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-locked"><span class="ui-icon ui-icon-locked"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-unlocked"><span class="ui-icon ui-icon-unlocked"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-bookmark"><span class="ui-icon ui-icon-bookmark"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-tag"><span class="ui-icon ui-icon-tag"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-home"><span class="ui-icon ui-icon-home"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-flag"><span class="ui-icon ui-icon-flag"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-calculator"><span class="ui-icon ui-icon-calculator"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-cart"><span class="ui-icon ui-icon-cart"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pencil"><span class="ui-icon ui-icon-pencil"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-clock"><span class="ui-icon ui-icon-clock"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-disk"><span class="ui-icon ui-icon-disk"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-calendar"><span class="ui-icon ui-icon-calendar"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-zoomin"><span class="ui-icon ui-icon-zoomin"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-zoomout"><span class="ui-icon ui-icon-zoomout"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-search"><span class="ui-icon ui-icon-search"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-wrench"><span class="ui-icon ui-icon-wrench"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-gear"><span class="ui-icon ui-icon-gear"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-heart"><span class="ui-icon ui-icon-heart"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-star"><span class="ui-icon ui-icon-star"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-link"><span class="ui-icon ui-icon-link"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-cancel"><span class="ui-icon ui-icon-cancel"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-plus"><span class="ui-icon ui-icon-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-plusthick"><span class="ui-icon ui-icon-plusthick"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-minus"><span class="ui-icon ui-icon-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-minusthick"><span class="ui-icon ui-icon-minusthick"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-close"><span class="ui-icon ui-icon-close"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-closethick"><span class="ui-icon ui-icon-closethick"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-key"><span class="ui-icon ui-icon-key"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-lightbulb"><span class="ui-icon ui-icon-lightbulb"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-scissors"><span class="ui-icon ui-icon-scissors"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-clipboard"><span class="ui-icon ui-icon-clipboard"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-copy"><span class="ui-icon ui-icon-copy"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-contact"><span class="ui-icon ui-icon-contact"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-image"><span class="ui-icon ui-icon-image"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-video"><span class="ui-icon ui-icon-video"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-script"><span class="ui-icon ui-icon-script"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-alert"><span class="ui-icon ui-icon-alert"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-info"><span class="ui-icon ui-icon-info"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-notice"><span class="ui-icon ui-icon-notice"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-help"><span class="ui-icon ui-icon-help"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-check"><span class="ui-icon ui-icon-check"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-bullet"><span class="ui-icon ui-icon-bullet"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-radio-off"><span class="ui-icon ui-icon-radio-off"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-radio-on"><span class="ui-icon ui-icon-radio-on"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pin-w"><span class="ui-icon ui-icon-pin-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pin-s"><span class="ui-icon ui-icon-pin-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-play"><span class="ui-icon ui-icon-play"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pause"><span class="ui-icon ui-icon-pause"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-next"><span class="ui-icon ui-icon-seek-next"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-prev"><span class="ui-icon ui-icon-seek-prev"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-end"><span class="ui-icon ui-icon-seek-end"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-first"><span class="ui-icon ui-icon-seek-first"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-stop"><span class="ui-icon ui-icon-stop"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-eject"><span class="ui-icon ui-icon-eject"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-volume-off"><span class="ui-icon ui-icon-volume-off"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-volume-on"><span class="ui-icon ui-icon-volume-on"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-power"><span class="ui-icon ui-icon-power"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-signal-diag"><span class="ui-icon ui-icon-signal-diag"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-signal"><span class="ui-icon ui-icon-signal"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-0"><span class="ui-icon ui-icon-battery-0"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-1"><span class="ui-icon ui-icon-battery-1"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-2"><span class="ui-icon ui-icon-battery-2"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-3"><span class="ui-icon ui-icon-battery-3"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-plus"><span class="ui-icon ui-icon-circle-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-minus"><span class="ui-icon ui-icon-circle-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-close"><span class="ui-icon ui-icon-circle-close"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-e"><span class="ui-icon ui-icon-circle-triangle-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-s"><span class="ui-icon ui-icon-circle-triangle-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-w"><span class="ui-icon ui-icon-circle-triangle-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-n"><span class="ui-icon ui-icon-circle-triangle-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-e"><span class="ui-icon ui-icon-circle-arrow-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-s"><span class="ui-icon ui-icon-circle-arrow-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-w"><span class="ui-icon ui-icon-circle-arrow-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-n"><span class="ui-icon ui-icon-circle-arrow-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-zoomin"><span class="ui-icon ui-icon-circle-zoomin"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-zoomout"><span class="ui-icon ui-icon-circle-zoomout"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-check"><span class="ui-icon ui-icon-circle-check"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-plus"><span class="ui-icon ui-icon-circlesmall-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-minus"><span class="ui-icon ui-icon-circlesmall-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-close"><span class="ui-icon ui-icon-circlesmall-close"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-plus"><span class="ui-icon ui-icon-squaresmall-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-minus"><span class="ui-icon ui-icon-squaresmall-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-close"><span class="ui-icon ui-icon-squaresmall-close"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-dotted-vertical"><span class="ui-icon ui-icon-grip-dotted-vertical"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-dotted-horizontal"><span class="ui-icon ui-icon-grip-dotted-horizontal"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-solid-vertical"><span class="ui-icon ui-icon-grip-solid-vertical"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-solid-horizontal"><span class="ui-icon ui-icon-grip-solid-horizontal"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-gripsmall-diagonal-se"><span class="ui-icon ui-icon-gripsmall-diagonal-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-diagonal-se"><span class="ui-icon ui-icon-grip-diagonal-se"></span></li>
+		</ul>
+
+			
+		<!-- Highlight / Error -->
+		<h2 class="demoHeaders">Highlight / Error</h2>
+		<div class="ui-widget">
+			<div class="ui-state-highlight ui-corner-all" style="margin-top: 20px; padding: 0 .7em;"> 
+				<p><span class="ui-icon ui-icon-info" style="float: left; margin-right: .3em;"></span>
+				<strong>Hey!</strong> Sample ui-state-highlight style.</p>
+			</div>
+		</div>
+		<br/>
+		<div class="ui-widget">
+			<div class="ui-state-error ui-corner-all" style="padding: 0 .7em;"> 
+				<p><span class="ui-icon ui-icon-alert" style="float: left; margin-right: .3em;"></span> 
+				<strong>Alert:</strong> Sample ui-state-error style.</p>
+			</div>
+		</div>
+
+	</body>
+</html>
+
+
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/js/jquery-1.5.1.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,16 @@
+/*!
+ * jQuery JavaScript Library v1.5.1
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Wed Feb 23 13:55:29 2011 -0500
+ */
+(function(a,b){function cg(a){return d.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cd(a){if(!bZ[a]){var b=d("<"+a+">").appendTo("body"),c=b.css("display");b.remove();if(c==="none"||c==="")c="block";bZ[a]=c}return bZ[a]}function cc(a,b){var c={};d.each(cb.concat.apply([],cb.slice(0,b)),function(){c[this]=a});return c}function bY(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function bX(){try{return new a.XMLHttpRequest}catch(b){}}function bW(){d(a).unload(function(){for(var a in bU)bU[a](0,1)})}function bQ(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var e=a.dataTypes,f={},g,h,i=e.length,j,k=e[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h==="string"&&(f[h.toLowerCase()]=a.converters[h]);l=k,k=e[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=f[m]||f["* "+k];if(!n){p=b;for(o in f){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=f[j[1]+" "+k];if(p){o=f[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&d.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function bP(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function bO(a,b,c,e){if(d.isArray(b)&&b.length)d.each(b,function(b,f){c||bq.test(a)?e(a,f):bO(a+"["+(typeof f==="object"||d.isArray(f)?b:"")+"]",f,c,e)});else if(c||b==null||typeof b!=="object")e(a,b);else if(d.isArray(b)||d.isEmptyObject(b))e(a,"");else for(var f in b)bO(a+"["+f+"]",b[f],c,e)}function bN(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bH,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l==="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bN(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bN(a,c,d,e,"*",g));return l}function bM(a){return function(b,c){typeof b!=="string"&&(c=b,b="*");if(d.isFunction(c)){var e=b.toLowerCase().split(bB),f=0,g=e.length,h,i,j;for(;f<g;f++)h=e[f],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bo(a,b,c){var e=b==="width"?bi:bj,f=b==="width"?a.offsetWidth:a.offsetHeight;if(c==="border")return f;d.each(e,function(){c||(f-=parseFloat(d.css(a,"padding"+this))||0),c==="margin"?f+=parseFloat(d.css(a,"margin"+this))||0:f-=parseFloat(d.css(a,"border"+this+"Width"))||0});return f}function ba(a,b){b.src?d.ajax({url:b.src,async:!1,dataType:"script"}):d.globalEval(b.text||b.textContent||b.innerHTML||""),b.parentNode&&b.parentNode.removeChild(b)}function _(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function $(a,b){if(b.nodeType===1){var c=b.nodeName.toLowerCase();b.clearAttributes(),b.mergeAttributes(a);if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(d.expando)}}function Z(a,b){if(b.nodeType===1&&d.hasData(a)){var c=d.expando,e=d.data(a),f=d.data(b,e);if(e=e[c]){var g=e.events;f=f[c]=d.extend({},e);if(g){delete f.handle,f.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)d.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function Y(a,b){return d.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function O(a,b,c){if(d.isFunction(b))return d.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return d.grep(a,function(a,d){return a===b===c});if(typeof b==="string"){var e=d.grep(a,function(a){return a.nodeType===1});if(J.test(b))return d.filter(b,e,!c);b=d.filter(b,e)}return d.grep(a,function(a,e){return d.inArray(a,b)>=0===c})}function N(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function F(a,b){return(a&&a!=="*"?a+".":"")+b.replace(r,"`").replace(s,"&")}function E(a){var b,c,e,f,g,h,i,j,k,l,m,n,o,q=[],r=[],s=d._data(this,"events");if(a.liveFired!==this&&s&&s.live&&!a.target.disabled&&(!a.button||a.type!=="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var t=s.live.slice(0);for(i=0;i<t.length;i++)g=t[i],g.origType.replace(p,"")===a.type?r.push(g.selector):t.splice(i--,1);f=d(a.target).closest(r,a.currentTarget);for(j=0,k=f.length;j<k;j++){m=f[j];for(i=0;i<t.length;i++){g=t[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,e=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,e=d(a.relatedTarget).closest(g.selector)[0];(!e||e!==h)&&q.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=q.length;j<k;j++){f=q[j];if(c&&f.level>c)break;a.currentTarget=f.elem,a.data=f.handleObj.data,a.handleObj=f.handleObj,o=f.handleObj.origHandler.apply(f.elem,arguments);if(o===!1||a.isPropagationStopped()){c=f.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function C(a,c,e){var f=d.extend({},e[0]);f.type=a,f.originalEvent={},f.liveFired=b,d.event.handle.call(c,f),f.isDefaultPrevented()&&e[0].preventDefault()}function w(){return!0}function v(){return!1}function g(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function f(a,c,f){if(f===b&&a.nodeType===1){f=a.getAttribute("data-"+c);if(typeof f==="string"){try{f=f==="true"?!0:f==="false"?!1:f==="null"?null:d.isNaN(f)?e.test(f)?d.parseJSON(f):f:parseFloat(f)}catch(g){}d.data(a,c,f)}else f=b}return f}var c=a.document,d=function(){function I(){if(!d.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(I,1);return}d.ready()}}var d=function(a,b){return new d.fn.init(a,b,g)},e=a.jQuery,f=a.$,g,h=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,i=/\S/,j=/^\s+/,k=/\s+$/,l=/\d/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=navigator.userAgent,w,x=!1,y,z="then done fail isResolved isRejected promise".split(" "),A,B=Object.prototype.toString,C=Object.prototype.hasOwnProperty,D=Array.prototype.push,E=Array.prototype.slice,F=String.prototype.trim,G=Array.prototype.indexOf,H={};d.fn=d.prototype={constructor:d,init:function(a,e,f){var g,i,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!e&&c.body){this.context=c,this[0]=c.body,this.selector="body",this.length=1;return this}if(typeof a==="string"){g=h.exec(a);if(!g||!g[1]&&e)return!e||e.jquery?(e||f).find(a):this.constructor(e).find(a);if(g[1]){e=e instanceof d?e[0]:e,k=e?e.ownerDocument||e:c,j=m.exec(a),j?d.isPlainObject(e)?(a=[c.createElement(j[1])],d.fn.attr.call(a,e,!0)):a=[k.createElement(j[1])]:(j=d.buildFragment([g[1]],[k]),a=(j.cacheable?d.clone(j.fragment):j.fragment).childNodes);return d.merge(this,a)}i=c.getElementById(g[2]);if(i&&i.parentNode){if(i.id!==g[2])return f.find(a);this.length=1,this[0]=i}this.context=c,this.selector=a;return this}if(d.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return d.makeArray(a,this)},selector:"",jquery:"1.5.1",length:0,size:function(){return this.length},toArray:function(){return E.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var e=this.constructor();d.isArray(a)?D.apply(e,a):d.merge(e,a),e.prevObject=this,e.context=this.context,b==="find"?e.selector=this.selector+(this.selector?" ":"")+c:b&&(e.selector=this.selector+"."+b+"("+c+")");return e},each:function(a,b){return d.each(this,a,b)},ready:function(a){d.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(E.apply(this,arguments),"slice",E.call(arguments).join(","))},map:function(a){return this.pushStack(d.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:D,sort:[].sort,splice:[].splice},d.fn.init.prototype=d.fn,d.extend=d.fn.extend=function(){var a,c,e,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i==="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!=="object"&&!d.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){e=i[c],f=a[c];if(i===f)continue;l&&f&&(d.isPlainObject(f)||(g=d.isArray(f)))?(g?(g=!1,h=e&&d.isArray(e)?e:[]):h=e&&d.isPlainObject(e)?e:{},i[c]=d.extend(l,h,f)):f!==b&&(i[c]=f)}return i},d.extend({noConflict:function(b){a.$=f,b&&(a.jQuery=e);return d},isReady:!1,readyWait:1,ready:function(a){a===!0&&d.readyWait--;if(!d.readyWait||a!==!0&&!d.isReady){if(!c.body)return setTimeout(d.ready,1);d.isReady=!0;if(a!==!0&&--d.readyWait>0)return;y.resolveWith(c,[d]),d.fn.trigger&&d(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!x){x=!0;if(c.readyState==="complete")return setTimeout(d.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",A,!1),a.addEventListener("load",d.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",A),a.attachEvent("onload",d.ready);var b=!1;try{b=a.frameElement==null}catch(e){}c.documentElement.doScroll&&b&&I()}}},isFunction:function(a){return d.type(a)==="function"},isArray:Array.isArray||function(a){return d.type(a)==="array"},isWindow:function(a){return a&&typeof a==="object"&&"setInterval"in a},isNaN:function(a){return a==null||!l.test(a)||isNaN(a)},type:function(a){return a==null?String(a):H[B.call(a)]||"object"},isPlainObject:function(a){if(!a||d.type(a)!=="object"||a.nodeType||d.isWindow(a))return!1;if(a.constructor&&!C.call(a,"constructor")&&!C.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a){}return c===b||C.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!=="string"||!b)return null;b=d.trim(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return a.JSON&&a.JSON.parse?a.JSON.parse(b):(new Function("return "+b))();d.error("Invalid JSON: "+b)},parseXML:function(b,c,e){a.DOMParser?(e=new DOMParser,c=e.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),e=c.documentElement,(!e||!e.nodeName||e.nodeName==="parsererror")&&d.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(a){if(a&&i.test(a)){var b=c.head||c.getElementsByTagName("head")[0]||c.documentElement,e=c.createElement("script");d.support.scriptEval()?e.appendChild(c.createTextNode(a)):e.text=a,b.insertBefore(e,b.firstChild),b.removeChild(e)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,e){var f,g=0,h=a.length,i=h===b||d.isFunction(a);if(e){if(i){for(f in a)if(c.apply(a[f],e)===!1)break}else for(;g<h;)if(c.apply(a[g++],e)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(var j=a[0];g<h&&c.call(j,g,j)!==!1;j=a[++g]){}return a},trim:F?function(a){return a==null?"":F.call(a)}:function(a){return a==null?"":(a+"").replace(j,"").replace(k,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var e=d.type(a);a.length==null||e==="string"||e==="function"||e==="regexp"||d.isWindow(a)?D.call(c,a):d.merge(c,a)}return c},inArray:function(a,b){if(b.indexOf)return b.indexOf(a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length==="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,b,c){var d=[],e;for(var f=0,g=a.length;f<g;f++)e=b(a[f],f,c),e!=null&&(d[d.length]=e);return d.concat.apply([],d)},guid:1,proxy:function(a,c,e){arguments.length===2&&(typeof c==="string"?(e=a,a=e[c],c=b):c&&!d.isFunction(c)&&(e=c,c=b)),!c&&a&&(c=function(){return a.apply(e||this,arguments)}),a&&(c.guid=a.guid=a.guid||c.guid||d.guid++);return c},access:function(a,c,e,f,g,h){var i=a.length;if(typeof c==="object"){for(var j in c)d.access(a,j,c[j],f,g,e);return a}if(e!==b){f=!h&&f&&d.isFunction(e);for(var k=0;k<i;k++)g(a[k],c,f?e.call(a[k],k,g(a[k],c)):e,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},_Deferred:function(){var a=[],b,c,e,f={done:function(){if(!e){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=d.type(i),j==="array"?f.done.apply(f,i):j==="function"&&a.push(i);k&&f.resolveWith(k[0],k[1])}return this},resolveWith:function(d,f){if(!e&&!b&&!c){c=1;try{while(a[0])a.shift().apply(d,f)}catch(g){throw g}finally{b=[d,f],c=0}}return this},resolve:function(){f.resolveWith(d.isFunction(this.promise)?this.promise():this,arguments);return this},isResolved:function(){return c||b},cancel:function(){e=1,a=[];return this}};return f},Deferred:function(a){var b=d._Deferred(),c=d._Deferred(),e;d.extend(b,{then:function(a,c){b.done(a).fail(c);return this},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,promise:function(a){if(a==null){if(e)return e;e=a={}}var c=z.length;while(c--)a[z[c]]=b[z[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){var b=arguments.length,c=b<=1&&a&&d.isFunction(a.promise)?a:d.Deferred(),e=c.promise();if(b>1){var f=E.call(arguments,0),g=b,h=function(a){return function(b){f[a]=arguments.length>1?E.call(arguments,0):b,--g||c.resolveWith(e,f)}};while(b--)a=f[b],a&&d.isFunction(a.promise)?a.promise().then(h(b),c.reject):--g;g||c.resolveWith(e,f)}else c!==a&&c.resolve(a);return e},uaMatch:function(a){a=a.toLowerCase();var b=r.exec(a)||s.exec(a)||t.exec(a)||a.indexOf("compatible")<0&&u.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}d.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.subclass=this.subclass,a.fn.init=function b(b,c){c&&c instanceof d&&!(c instanceof a)&&(c=a(c));return d.fn.init.call(this,b,c,e)},a.fn.init.prototype=a.fn;var e=a(c);return a},browser:{}}),y=d._Deferred(),d.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){H["[object "+b+"]"]=b.toLowerCase()}),w=d.uaMatch(v),w.browser&&(d.browser[w.browser]=!0,d.browser.version=w.version),d.browser.webkit&&(d.browser.safari=!0),G&&(d.inArray=function(a,b){return G.call(b,a)}),i.test(" ")&&(j=/^[\s\xA0]+/,k=/[\s\xA0]+$/),g=d(c),c.addEventListener?A=function(){c.removeEventListener("DOMContentLoaded",A,!1),d.ready()}:c.attachEvent&&(A=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",A),d.ready())});return d}();(function(){d.support={};var b=c.createElement("div");b.style.display="none",b.innerHTML="   <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";var e=b.getElementsByTagName("*"),f=b.getElementsByTagName("a")[0],g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=b.getElementsByTagName("input")[0];if(e&&e.length&&f){d.support={leadingWhitespace:b.firstChild.nodeType===3,tbody:!b.getElementsByTagName("tbody").length,htmlSerialize:!!b.getElementsByTagName("link").length,style:/red/.test(f.getAttribute("style")),hrefNormalized:f.getAttribute("href")==="/a",opacity:/^0.55$/.test(f.style.opacity),cssFloat:!!f.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,deleteExpando:!0,optDisabled:!1,checkClone:!1,noCloneEvent:!0,noCloneChecked:!0,boxModel:null,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableHiddenOffsets:!0},i.checked=!0,d.support.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,d.support.optDisabled=!h.disabled;var j=null;d.support.scriptEval=function(){if(j===null){var b=c.documentElement,e=c.createElement("script"),f="script"+d.now();try{e.appendChild(c.createTextNode("window."+f+"=1;"))}catch(g){}b.insertBefore(e,b.firstChild),a[f]?(j=!0,delete a[f]):j=!1,b.removeChild(e),b=e=f=null}return j};try{delete b.test}catch(k){d.support.deleteExpando=!1}!b.addEventListener&&b.attachEvent&&b.fireEvent&&(b.attachEvent("onclick",function l(){d.support.noCloneEvent=!1,b.detachEvent("onclick",l)}),b.cloneNode(!0).fireEvent("onclick")),b=c.createElement("div"),b.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";var m=c.createDocumentFragment();m.appendChild(b.firstChild),d.support.checkClone=m.cloneNode(!0).cloneNode(!0).lastChild.checked,d(function(){var a=c.createElement("div"),b=c.getElementsByTagName("body")[0];if(b){a.style.width=a.style.paddingLeft="1px",b.appendChild(a),d.boxModel=d.support.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,d.support.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",d.support.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";var e=a.getElementsByTagName("td");d.support.reliableHiddenOffsets=e[0].offsetHeight===0,e[0].style.display="",e[1].style.display="none",d.support.reliableHiddenOffsets=d.support.reliableHiddenOffsets&&e[0].offsetHeight===0,a.innerHTML="",b.removeChild(a).style.display="none",a=e=null}});var n=function(a){var b=c.createElement("div");a="on"+a;if(!b.attachEvent)return!0;var d=a in b;d||(b.setAttribute(a,"return;"),d=typeof b[a]==="function"),b=null;return d};d.support.submitBubbles=n("submit"),d.support.changeBubbles=n("change"),b=e=f=null}})();var e=/^(?:\{.*\}|\[.*\])$/;d.extend({cache:{},uuid:0,expando:"jQuery"+(d.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?d.cache[a[d.expando]]:a[d.expando];return!!a&&!g(a)},data:function(a,c,e,f){if(d.acceptData(a)){var g=d.expando,h=typeof c==="string",i,j=a.nodeType,k=j?d.cache:a,l=j?a[d.expando]:a[d.expando]&&d.expando;if((!l||f&&l&&!k[l][g])&&h&&e===b)return;l||(j?a[d.expando]=l=++d.uuid:l=d.expando),k[l]||(k[l]={},j||(k[l].toJSON=d.noop));if(typeof c==="object"||typeof c==="function")f?k[l][g]=d.extend(k[l][g],c):k[l]=d.extend(k[l],c);i=k[l],f&&(i[g]||(i[g]={}),i=i[g]),e!==b&&(i[c]=e);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[c]:i}},removeData:function(b,c,e){if(d.acceptData(b)){var f=d.expando,h=b.nodeType,i=h?d.cache:b,j=h?b[d.expando]:d.expando;if(!i[j])return;if(c){var k=e?i[j][f]:i[j];if(k){delete k[c];if(!g(k))return}}if(e){delete i[j][f];if(!g(i[j]))return}var l=i[j][f];d.support.deleteExpando||i!=a?delete i[j]:i[j]=null,l?(i[j]={},h||(i[j].toJSON=d.noop),i[j][f]=l):h&&(d.support.deleteExpando?delete b[d.expando]:b.removeAttribute?b.removeAttribute(d.expando):b[d.expando]=null)}},_data:function(a,b,c){return d.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=d.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),d.fn.extend({data:function(a,c){var e=null;if(typeof a==="undefined"){if(this.length){e=d.data(this[0]);if(this[0].nodeType===1){var g=this[0].attributes,h;for(var i=0,j=g.length;i<j;i++)h=g[i].name,h.indexOf("data-")===0&&(h=h.substr(5),f(this[0],h,e[h]))}}return e}if(typeof a==="object")return this.each(function(){d.data(this,a)});var k=a.split(".");k[1]=k[1]?"."+k[1]:"";if(c===b){e=this.triggerHandler("getData"+k[1]+"!",[k[0]]),e===b&&this.length&&(e=d.data(this[0],a),e=f(this[0],a,e));return e===b&&k[1]?this.data(k[0]):e}return this.each(function(){var b=d(this),e=[k[0],c];b.triggerHandler("setData"+k[1]+"!",e),d.data(this,a,c),b.triggerHandler("changeData"+k[1]+"!",e)})},removeData:function(a){return this.each(function(){d.removeData(this,a)})}}),d.extend({queue:function(a,b,c){if(a){b=(b||"fx")+"queue";var e=d._data(a,b);if(!c)return e||[];!e||d.isArray(c)?e=d._data(a,b,d.makeArray(c)):e.push(c);return e}},dequeue:function(a,b){b=b||"fx";var c=d.queue(a,b),e=c.shift();e==="inprogress"&&(e=c.shift()),e&&(b==="fx"&&c.unshift("inprogress"),e.call(a,function(){d.dequeue(a,b)})),c.length||d.removeData(a,b+"queue",!0)}}),d.fn.extend({queue:function(a,c){typeof a!=="string"&&(c=a,a="fx");if(c===b)return d.queue(this[0],a);return this.each(function(b){var e=d.queue(this,a,c);a==="fx"&&e[0]!=="inprogress"&&d.dequeue(this,a)})},dequeue:function(a){return this.each(function(){d.dequeue(this,a)})},delay:function(a,b){a=d.fx?d.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){d.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var h=/[\n\t\r]/g,i=/\s+/,j=/\r/g,k=/^(?:href|src|style)$/,l=/^(?:button|input)$/i,m=/^(?:button|input|object|select|textarea)$/i,n=/^a(?:rea)?$/i,o=/^(?:radio|checkbox)$/i;d.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"},d.fn.extend({attr:function(a,b){return d.access(this,a,b,!0,d.attr)},removeAttr:function(a,b){return this.each(function(){d.attr(this,a,""),this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(d.isFunction(a))return this.each(function(b){var c=d(this);c.addClass(a.call(this,b,c.attr("class")))});if(a&&typeof a==="string"){var b=(a||"").split(i);for(var c=0,e=this.length;c<e;c++){var f=this[c];if(f.nodeType===1)if(f.className){var g=" "+f.className+" ",h=f.className;for(var j=0,k=b.length;j<k;j++)g.indexOf(" "+b[j]+" ")<0&&(h+=" "+b[j]);f.className=d.trim(h)}else f.className=a}}return this},removeClass:function(a){if(d.isFunction(a))return this.each(function(b){var c=d(this);c.removeClass(a.call(this,b,c.attr("class")))});if(a&&typeof a==="string"||a===b){var c=(a||"").split(i);for(var e=0,f=this.length;e<f;e++){var g=this[e];if(g.nodeType===1&&g.className)if(a){var j=(" "+g.className+" ").replace(h," ");for(var k=0,l=c.length;k<l;k++)j=j.replace(" "+c[k]+" "," ");g.className=d.trim(j)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,e=typeof b==="boolean";if(d.isFunction(a))return this.each(function(c){var e=d(this);e.toggleClass(a.call(this,c,e.attr("class"),b),b)});return this.each(function(){if(c==="string"){var f,g=0,h=d(this),j=b,k=a.split(i);while(f=k[g++])j=e?j:!h.hasClass(f),h[j?"addClass":"removeClass"](f)}else if(c==="undefined"||c==="boolean")this.className&&d._data(this,"__className__",this.className),this.className=this.className||a===!1?"":d._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(h," ").indexOf(b)>-1)return!0;return!1},val:function(a){if(!arguments.length){var c=this[0];if(c){if(d.nodeName(c,"option")){var e=c.attributes.value;return!e||e.specified?c.value:c.text}if(d.nodeName(c,"select")){var f=c.selectedIndex,g=[],h=c.options,i=c.type==="select-one";if(f<0)return null;for(var k=i?f:0,l=i?f+1:h.length;k<l;k++){var m=h[k];if(m.selected&&(d.support.optDisabled?!m.disabled:m.getAttribute("disabled")===null)&&(!m.parentNode.disabled||!d.nodeName(m.parentNode,"optgroup"))){a=d(m).val();if(i)return a;g.push(a)}}if(i&&!g.length&&h.length)return d(h[f]).val();return g}if(o.test(c.type)&&!d.support.checkOn)return c.getAttribute("value")===null?"on":c.value;return(c.value||"").replace(j,"")}return b}var n=d.isFunction(a);return this.each(function(b){var c=d(this),e=a;if(this.nodeType===1){n&&(e=a.call(this,b,c.val())),e==null?e="":typeof e==="number"?e+="":d.isArray(e)&&(e=d.map(e,function(a){return a==null?"":a+""}));if(d.isArray(e)&&o.test(this.type))this.checked=d.inArray(c.val(),e)>=0;else if(d.nodeName(this,"select")){var f=d.makeArray(e);d("option",this).each(function(){this.selected=d.inArray(d(this).val(),f)>=0}),f.length||(this.selectedIndex=-1)}else this.value=e}})}}),d.extend({attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,e,f){if(!a||a.nodeType===3||a.nodeType===8||a.nodeType===2)return b;if(f&&c in d.attrFn)return d(a)[c](e);var g=a.nodeType!==1||!d.isXMLDoc(a),h=e!==b;c=g&&d.props[c]||c;if(a.nodeType===1){var i=k.test(c);if(c==="selected"&&!d.support.optSelected){var j=a.parentNode;j&&(j.selectedIndex,j.parentNode&&j.parentNode.selectedIndex)}if((c in a||a[c]!==b)&&g&&!i){h&&(c==="type"&&l.test(a.nodeName)&&a.parentNode&&d.error("type property can't be changed"),e===null?a.nodeType===1&&a.removeAttribute(c):a[c]=e);if(d.nodeName(a,"form")&&a.getAttributeNode(c))return a.getAttributeNode(c).nodeValue;if(c==="tabIndex"){var o=a.getAttributeNode("tabIndex");return o&&o.specified?o.value:m.test(a.nodeName)||n.test(a.nodeName)&&a.href?0:b}return a[c]}if(!d.support.style&&g&&c==="style"){h&&(a.style.cssText=""+e);return a.style.cssText}h&&a.setAttribute(c,""+e);if(!a.attributes[c]&&(a.hasAttribute&&!a.hasAttribute(c)))return b;var p=!d.support.hrefNormalized&&g&&i?a.getAttribute(c,2):a.getAttribute(c);return p===null?b:p}h&&(a[c]=e);return a[c]}});var p=/\.(.*)$/,q=/^(?:textarea|input|select)$/i,r=/\./g,s=/ /g,t=/[^\w\s.|`]/g,u=function(a){return a.replace(t,"\\$&")};d.event={add:function(c,e,f,g){if(c.nodeType!==3&&c.nodeType!==8){try{d.isWindow(c)&&(c!==a&&!c.frameElement)&&(c=a)}catch(h){}if(f===!1)f=v;else if(!f)return;var i,j;f.handler&&(i=f,f=i.handler),f.guid||(f.guid=d.guid++);var k=d._data(c);if(!k)return;var l=k.events,m=k.handle;l||(k.events=l={}),m||(k.handle=m=function(){return typeof d!=="undefined"&&!d.event.triggered?d.event.handle.apply(m.elem,arguments):b}),m.elem=c,e=e.split(" ");var n,o=0,p;while(n=e[o++]){j=i?d.extend({},i):{handler:f,data:g},n.indexOf(".")>-1?(p=n.split("."),n=p.shift(),j.namespace=p.slice(0).sort().join(".")):(p=[],j.namespace=""),j.type=n,j.guid||(j.guid=f.guid);var q=l[n],r=d.event.special[n]||{};if(!q){q=l[n]=[];if(!r.setup||r.setup.call(c,g,p,m)===!1)c.addEventListener?c.addEventListener(n,m,!1):c.attachEvent&&c.attachEvent("on"+n,m)}r.add&&(r.add.call(c,j),j.handler.guid||(j.handler.guid=f.guid)),q.push(j),d.event.global[n]=!0}c=null}},global:{},remove:function(a,c,e,f){if(a.nodeType!==3&&a.nodeType!==8){e===!1&&(e=v);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=d.hasData(a)&&d._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(e=c.handler,c=c.type);if(!c||typeof c==="string"&&c.charAt(0)==="."){c=c||"";for(h in t)d.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+d.map(m.slice(0).sort(),u).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!e){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))d.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=d.event.special[h]||{};for(j=f||0;j<p.length;j++){q=p[j];if(e.guid===q.guid){if(l||n.test(q.namespace))f==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(f!=null)break}}if(p.length===0||f!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&d.removeEvent(a,h,s.handle),g=null,delete t[h]}if(d.isEmptyObject(t)){var w=s.handle;w&&(w.elem=null),delete s.events,delete s.handle,d.isEmptyObject(s)&&d.removeData(a,b,!0)}}},trigger:function(a,c,e){var f=a.type||a,g=arguments[3];if(!g){a=typeof a==="object"?a[d.expando]?a:d.extend(d.Event(f),a):d.Event(f),f.indexOf("!")>=0&&(a.type=f=f.slice(0,-1),a.exclusive=!0),e||(a.stopPropagation(),d.event.global[f]&&d.each(d.cache,function(){var b=d.expando,e=this[b];e&&e.events&&e.events[f]&&d.event.trigger(a,c,e.handle.elem)}));if(!e||e.nodeType===3||e.nodeType===8)return b;a.result=b,a.target=e,c=d.makeArray(c),c.unshift(a)}a.currentTarget=e;var h=d._data(e,"handle");h&&h.apply(e,c);var i=e.parentNode||e.ownerDocument;try{e&&e.nodeName&&d.noData[e.nodeName.toLowerCase()]||e["on"+f]&&e["on"+f].apply(e,c)===!1&&(a.result=!1,a.preventDefault())}catch(j){}if(!a.isPropagationStopped()&&i)d.event.trigger(a,c,i,!0);else if(!a.isDefaultPrevented()){var k,l=a.target,m=f.replace(p,""),n=d.nodeName(l,"a")&&m==="click",o=d.event.special[m]||{};if((!o._default||o._default.call(e,a)===!1)&&!n&&!(l&&l.nodeName&&d.noData[l.nodeName.toLowerCase()])){try{l[m]&&(k=l["on"+m],k&&(l["on"+m]=null),d.event.triggered=!0,l[m]())}catch(q){}k&&(l["on"+m]=k),d.event.triggered=!1}}},handle:function(c){var e,f,g,h,i,j=[],k=d.makeArray(arguments);c=k[0]=d.event.fix(c||a.event),c.currentTarget=this,e=c.type.indexOf(".")<0&&!c.exclusive,e||(g=c.type.split("."),c.type=g.shift(),j=g.slice(0).sort(),h=new RegExp("(^|\\.)"+j.join("\\.(?:.*\\.)?")+"(\\.|$)")),c.namespace=c.namespace||j.join("."),i=d._data(this,"events"),f=(i||{})[c.type];if(i&&f){f=f.slice(0);for(var l=0,m=f.length;l<m;l++){var n=f[l];if(e||h.test(n.namespace)){c.handler=n.handler,c.data=n.data,c.handleObj=n;var o=n.handler.apply(this,k);o!==b&&(c.result=o,o===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[d.expando])return a;var e=a;a=d.Event(e);for(var f=this.props.length,g;f;)g=this.props[--f],a[g]=e[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=c.documentElement,i=c.body;a.pageX=a.clientX+(h&&h.scrollLeft||i&&i.scrollLeft||0)-(h&&h.clientLeft||i&&i.clientLeft||0),a.pageY=a.clientY+(h&&h.scrollTop||i&&i.scrollTop||0)-(h&&h.clientTop||i&&i.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:d.proxy,special:{ready:{setup:d.bindReady,teardown:d.noop},live:{add:function(a){d.event.add(this,F(a.origType,a.selector),d.extend({},a,{handler:E,guid:a.handler.guid}))},remove:function(a){d.event.remove(this,F(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){d.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},d.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},d.Event=function(a){if(!this.preventDefault)return new d.Event(a);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?w:v):this.type=a,this.timeStamp=d.now(),this[d.expando]=!0},d.Event.prototype={preventDefault:function(){this.isDefaultPrevented=w;var a=this.originalEvent;a&&(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=w;var a=this.originalEvent;a&&(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=w,this.stopPropagation()},isDefaultPrevented:v,isPropagationStopped:v,isImmediatePropagationStopped:v};var x=function(a){var b=a.relatedTarget;try{if(b!==c&&!b.parentNode)return;while(b&&b!==this)b=b.parentNode;b!==this&&(a.type=a.data,d.event.handle.apply(this,arguments))}catch(e){}},y=function(a){a.type=a.data,d.event.handle.apply(this,arguments)};d.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){d.event.special[a]={setup:function(c){d.event.add(this,b,c&&c.selector?y:x,a)},teardown:function(a){d.event.remove(this,b,a&&a.selector?y:x)}}}),d.support.submitBubbles||(d.event.special.submit={setup:function(a,b){if(this.nodeName&&this.nodeName.toLowerCase()!=="form")d.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&d(b).closest("form").length&&C("submit",this,arguments)}),d.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&d(b).closest("form").length&&a.keyCode===13&&C("submit",this,arguments)});else return!1},teardown:function(a){d.event.remove(this,".specialSubmit")}});if(!d.support.changeBubbles){var z,A=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?d.map(a.options,function(a){return a.selected}).join("-"):"":a.nodeName.toLowerCase()==="select"&&(c=a.selectedIndex);return c},B=function B(a){var c=a.target,e,f;if(q.test(c.nodeName)&&!c.readOnly){e=d._data(c,"_change_data"),f=A(c),(a.type!=="focusout"||c.type!=="radio")&&d._data(c,"_change_data",f);if(e===b||f===e)return;if(e!=null||f)a.type="change",a.liveFired=b,d.event.trigger(a,arguments[1],c)}};d.event.special.change={filters:{focusout:B,beforedeactivate:B,click:function(a){var b=a.target,c=b.type;(c==="radio"||c==="checkbox"||b.nodeName.toLowerCase()==="select")&&B.call(this,a)},keydown:function(a){var b=a.target,c=b.type;(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&B.call(this,a)},beforeactivate:function(a){var b=a.target;d._data(b,"_change_data",A(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in z)d.event.add(this,c+".specialChange",z[c]);return q.test(this.nodeName)},teardown:function(a){d.event.remove(this,".specialChange");return q.test(this.nodeName)}},z=d.event.special.change.filters,z.focus=z.beforeactivate}c.addEventListener&&d.each({focus:"focusin",blur:"focusout"},function(a,b){function c(a){a=d.event.fix(a),a.type=b;return d.event.handle.call(this,a)}d.event.special[b]={setup:function(){this.addEventListener(a,c,!0)},teardown:function(){this.removeEventListener(a,c,!0)}}}),d.each(["bind","one"],function(a,c){d.fn[c]=function(a,e,f){if(typeof a==="object"){for(var g in a)this[c](g,e,a[g],f);return this}if(d.isFunction(e)||e===!1)f=e,e=b;var h=c==="one"?d.proxy(f,function(a){d(this).unbind(a,h);return f.apply(this,arguments)}):f;if(a==="unload"&&c!=="one")this.one(a,e,f);else for(var i=0,j=this.length;i<j;i++)d.event.add(this[i],a,h,e);return this}}),d.fn.extend({unbind:function(a,b){if(typeof a!=="object"||a.preventDefault)for(var e=0,f=this.length;e<f;e++)d.event.remove(this[e],a,b);else for(var c in a)this.unbind(c,a[c]);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){d.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){var c=d.Event(a);c.preventDefault(),c.stopPropagation(),d.event.trigger(c,b,this[0]);return c.result}},toggle:function(a){var b=arguments,c=1;while(c<b.length)d.proxy(a,b[c++]);return this.click(d.proxy(a,function(e){var f=(d._data(this,"lastToggle"+a.guid)||0)%c;d._data(this,"lastToggle"+a.guid,f+1),e.preventDefault();return b[f].apply(this,arguments)||!1}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var D={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};d.each(["live","die"],function(a,c){d.fn[c]=function(a,e,f,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:d(this.context);if(typeof a==="object"&&!a.preventDefault){for(var o in a)n[c](o,e,a[o],m);return this}d.isFunction(e)&&(f=e,e=b),a=(a||"").split(" ");while((h=a[i++])!=null){j=p.exec(h),k="",j&&(k=j[0],h=h.replace(p,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,h==="focus"||h==="blur"?(a.push(D[h]+k),h=h+k):h=(D[h]||h)+k;if(c==="live")for(var q=0,r=n.length;q<r;q++)d.event.add(n[q],"live."+F(h,m),{data:e,selector:m,handler:f,origType:h,origHandler:f,preType:l});else n.unbind("live."+F(h,m),f)}return this}}),d.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){d.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},d.attrFn&&(d.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!=="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,f=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,e,g){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!=="string")return e;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(f.call(n)==="[object Array]")if(u)if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&e.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&e.push(j[t]);else e.push.apply(e,n);else p(n,e);o&&(k(o,h,e,g),k.uniqueSort(e));return e};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!=="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(f){if(f===!0)continue}else g=o=!0}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b==="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1){}a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b==="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var d,f=e++,g=u;typeof b==="string"&&!j.test(b)&&(b=b.toLowerCase(),d=b,g=t),g("parentNode",b,f,a,d,c)},"~":function(a,b,c){var d,f=e++,g=u;typeof b==="string"&&!j.test(b)&&(b=b.toLowerCase(),d=b,g=t),g("previousSibling",b,f,a,d,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!=="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!=="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!=="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){return"text"===a.getAttribute("type")},radio:function(a){return"radio"===a.type},checkbox:function(a){return"checkbox"===a.type},file:function(a){return"file"===a.type},password:function(a){return"password"===a.type},submit:function(a){return"submit"===a.type},image:function(a){return"image"===a.type},reset:function(a){return"reset"===a.type},button:function(a){return"button"===a.type||a.nodeName.toLowerCase()==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(f.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length==="number")for(var e=a.length;c<e;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(a===b){g=!0;return 0}if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!=="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!=="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!=="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!=="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector,d=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(e){d=!0}b&&(k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(d||!l.match.PSEUDO.test(c)&&!/!=/.test(c))return b.call(a,c)}catch(e){}return k(c,null,null,[a]).length>0})}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!=="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};d.find=k,d.expr=k.selectors,d.expr[":"]=d.expr.filters,d.unique=k.uniqueSort,d.text=k.getText,d.isXMLDoc=k.isXML,d.contains=k.contains}();var G=/Until$/,H=/^(?:parents|prevUntil|prevAll)/,I=/,/,J=/^.[^:#\[\.,]*$/,K=Array.prototype.slice,L=d.expr.match.POS,M={children:!0,contents:!0,next:!0,prev:!0};d.fn.extend({find:function(a){var b=this.pushStack("","find",a),c=0;for(var e=0,f=this.length;e<f;e++){c=b.length,d.find(a,this[e],b);if(e>0)for(var g=c;g<b.length;g++)for(var h=0;h<c;h++)if(b[h]===b[g]){b.splice(g--,1);break}}return b},has:function(a){var b=d(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(d.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(O(this,a,!1),"not",a)},filter:function(a){return this.pushStack(O(this,a,!0),"filter",a)},is:function(a){return!!a&&d.filter(a,this).length>0},closest:function(a,b){var c=[],e,f,g=this[0];if(d.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(e=0,f=a.length;e<f;e++)i=a[e],j[i]||(j[i]=d.expr.match.POS.test(i)?d(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:d(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=L.test(a)?d(a,b||this.context):null;for(e=0,f=this.length;e<f;e++){g=this[e];while(g){if(l?l.index(g)>-1:d.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b)break}}c=c.length>1?d.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a==="string")return d.inArray(this[0],a?d(a):this.parent().children());return d.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a==="string"?d(a,b):d.makeArray(a),e=d.merge(this.get(),c);return this.pushStack(N(c[0])||N(e[0])?e:d.unique(e))},andSelf:function(){return this.add(this.prevObject)}}),d.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return d.dir(a,"parentNode")},parentsUntil:function(a,b,c){return d.dir(a,"parentNode",c)},next:function(a){return d.nth(a,2,"nextSibling")},prev:function(a){return d.nth(a,2,"previousSibling")},nextAll:function(a){return d.dir(a,"nextSibling")},prevAll:function(a){return d.dir(a,"previousSibling")},nextUntil:function(a,b,c){return d.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return d.dir(a,"previousSibling",c)},siblings:function(a){return d.sibling(a.parentNode.firstChild,a)},children:function(a){return d.sibling(a.firstChild)},contents:function(a){return d.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:d.makeArray(a.childNodes)}},function(a,b){d.fn[a]=function(c,e){var f=d.map(this,b,c),g=K.call(arguments);G.test(a)||(e=c),e&&typeof e==="string"&&(f=d.filter(e,f)),f=this.length>1&&!M[a]?d.unique(f):f,(this.length>1||I.test(e))&&H.test(a)&&(f=f.reverse());return this.pushStack(f,a,g.join(","))}}),d.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?d.find.matchesSelector(b[0],a)?[b[0]]:[]:d.find.matches(a,b)},dir:function(a,c,e){var f=[],g=a[c];while(g&&g.nodeType!==9&&(e===b||g.nodeType!==1||!d(g).is(e)))g.nodeType===1&&f.push(g),g=g[c];return f},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var P=/ jQuery\d+="(?:\d+|null)"/g,Q=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,S=/<([\w:]+)/,T=/<tbody/i,U=/<|&#?\w+;/,V=/<(?:script|object|embed|option|style)/i,W=/checked\s*(?:[^=]|=\s*.checked.)/i,X={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};X.optgroup=X.option,X.tbody=X.tfoot=X.colgroup=X.caption=X.thead,X.th=X.td,d.support.htmlSerialize||(X._default=[1,"div<div>","</div>"]),d.fn.extend({text:function(a){if(d.isFunction(a))return this.each(function(b){var c=d(this);c.text(a.call(this,b,c.text()))});if(typeof a!=="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return d.text(this)},wrapAll:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapAll(a.call(this,b))});if(this[0]){var b=d(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(d.isFunction(a))return this.each(function(b){d(this).wrapInner(a.call(this,b))});return this.each(function(){var b=d(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){d(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){d.nodeName(this,"body")||d(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=d(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,d(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,e;(e=this[c])!=null;c++)if(!a||d.filter(a,[e]).length)!b&&e.nodeType===1&&(d.cleanData(e.getElementsByTagName("*")),d.cleanData([e])),e.parentNode&&e.parentNode.removeChild(e);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&d.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return d.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(P,""):null;if(typeof a!=="string"||V.test(a)||!d.support.leadingWhitespace&&Q.test(a)||X[(S.exec(a)||["",""])[1].toLowerCase()])d.isFunction(a)?this.each(function(b){var c=d(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);else{a=a.replace(R,"<$1></$2>");try{for(var c=0,e=this.length;c<e;c++)this[c].nodeType===1&&(d.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(f){this.empty().append(a)}}return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(d.isFunction(a))return this.each(function(b){var c=d(this),e=c.html();c.replaceWith(a.call(this,b,e))});typeof a!=="string"&&(a=d(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;d(this).remove(),b?d(b).before(a):d(c).append(a)})}return this.pushStack(d(d.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,e){var f,g,h,i,j=a[0],k=[];if(!d.support.checkClone&&arguments.length===3&&typeof j==="string"&&W.test(j))return this.each(function(){d(this).domManip(a,c,e,!0)});if(d.isFunction(j))return this.each(function(f){var g=d(this);a[0]=j.call(this,f,c?g.html():b),g.domManip(a,c,e)});if(this[0]){i=j&&j.parentNode,d.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?f={fragment:i}:f=d.buildFragment(a,this,k),h=f.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&d.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)e.call(c?Y(this[l],g):this[l],f.cacheable||m>1&&l<n?d.clone(h,!0,!0):h)}k.length&&d.each(k,ba)}return this}}),d.buildFragment=function(a,b,e){var f,g,h,i=b&&b[0]?b[0].ownerDocument||b[0]:c;a.length===1&&typeof a[0]==="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!V.test(a[0])&&(d.support.checkClone||!W.test(a[0]))&&(g=!0,h=d.fragments[a[0]],h&&(h!==1&&(f=h))),f||(f=i.createDocumentFragment(),d.clean(a,i,f,e)),g&&(d.fragments[a[0]]=h?f:1);return{fragment:f,cacheable:g}},d.fragments={},d.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){d.fn[a]=function(c){var e=[],f=d(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&f.length===1){f[b](this[0]);return this}for(var h=0,i=f.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();d(f[h])[b](j),e=e.concat(j)}return this.pushStack(e,a,f.selector)}}),d.extend({clone:function(a,b,c){var e=a.cloneNode(!0),f,g,h;if((!d.support.noCloneEvent||!d.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!d.isXMLDoc(a)){$(a,e),f=_(a),g=_(e);for(h=0;f[h];++h)$(f[h],g[h])}if(b){Z(a,e);if(c){f=_(a),g=_(e);for(h=0;f[h];++h)Z(f[h],g[h])}}return e},clean:function(a,b,e,f){b=b||c,typeof b.createElement==="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var g=[];for(var h=0,i;(i=a[h])!=null;h++){typeof i==="number"&&(i+="");if(!i)continue;if(typeof i!=="string"||U.test(i)){if(typeof i==="string"){i=i.replace(R,"<$1></$2>");var j=(S.exec(i)||["",""])[1].toLowerCase(),k=X[j]||X._default,l=k[0],m=b.createElement("div");m.innerHTML=k[1]+i+k[2];while(l--)m=m.lastChild;if(!d.support.tbody){var n=T.test(i),o=j==="table"&&!n?m.firstChild&&m.firstChild.childNodes:k[1]==="<table>"&&!n?m.childNodes:[];for(var p=o.length-1;p>=0;--p)d.nodeName(o[p],"tbody")&&!o[p].childNodes.length&&o[p].parentNode.removeChild(o[p])}!d.support.leadingWhitespace&&Q.test(i)&&m.insertBefore(b.createTextNode(Q.exec(i)[0]),m.firstChild),i=m.childNodes}}else i=b.createTextNode(i);i.nodeType?g.push(i):g=d.merge(g,i)}if(e)for(h=0;g[h];h++)!f||!d.nodeName(g[h],"script")||g[h].type&&g[h].type.toLowerCase()!=="text/javascript"?(g[h].nodeType===1&&g.splice.apply(g,[h+1,0].concat(d.makeArray(g[h].getElementsByTagName("script")))),e.appendChild(g[h])):f.push(g[h].parentNode?g[h].parentNode.removeChild(g[h]):g[h]);return g},cleanData:function(a){var b,c,e=d.cache,f=d.expando,g=d.event.special,h=d.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&d.noData[j.nodeName.toLowerCase()])continue;c=j[d.expando];if(c){b=e[c]&&e[c][f];if(b&&b.events){for(var k in b.events)g[k]?d.event.remove(j,k):d.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[d.expando]:j.removeAttribute&&j.removeAttribute(d.expando),delete e[c]}}}});var bb=/alpha\([^)]*\)/i,bc=/opacity=([^)]*)/,bd=/-([a-z])/ig,be=/([A-Z])/g,bf=/^-?\d+(?:px)?$/i,bg=/^-?\d/,bh={position:"absolute",visibility:"hidden",display:"block"},bi=["Left","Right"],bj=["Top","Bottom"],bk,bl,bm,bn=function(a,b){return b.toUpperCase()};d.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return d.access(this,a,c,!0,function(a,c,e){return e!==b?d.style(a,c,e):d.css(a,c)})},d.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bk(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0},cssProps:{"float":d.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,e,f){if(a&&a.nodeType!==3&&a.nodeType!==8&&a.style){var g,h=d.camelCase(c),i=a.style,j=d.cssHooks[h];c=d.cssProps[h]||h;if(e===b){if(j&&"get"in j&&(g=j.get(a,!1,f))!==b)return g;return i[c]}if(typeof e==="number"&&isNaN(e)||e==null)return;typeof e==="number"&&!d.cssNumber[h]&&(e+="px");if(!j||!("set"in j)||(e=j.set(a,e))!==b)try{i[c]=e}catch(k){}}},css:function(a,c,e){var f,g=d.camelCase(c),h=d.cssHooks[g];c=d.cssProps[g]||g;if(h&&"get"in h&&(f=h.get(a,!0,e))!==b)return f;if(bk)return bk(a,c,g)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bd,bn)}}),d.curCSS=d.css,d.each(["height","width"],function(a,b){d.cssHooks[b]={get:function(a,c,e){var f;if(c){a.offsetWidth!==0?f=bo(a,b,e):d.swap(a,bh,function(){f=bo(a,b,e)});if(f<=0){f=bk(a,b,b),f==="0px"&&bm&&(f=bm(a,b,b));if(f!=null)return f===""||f==="auto"?"0px":f}if(f<0||f==null){f=a.style[b];return f===""||f==="auto"?"0px":f}return typeof f==="string"?f:f+"px"}},set:function(a,b){if(!bf.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),d.support.opacity||(d.cssHooks.opacity={get:function(a,b){return bc.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style;c.zoom=1;var e=d.isNaN(b)?"":"alpha(opacity="+b*100+")",f=c.filter||"";c.filter=bb.test(f)?f.replace(bb,e):c.filter+" "+e}}),c.defaultView&&c.defaultView.getComputedStyle&&(bl=function(a,c,e){var f,g,h;e=e.replace(be,"-$1").toLowerCase();if(!(g=a.ownerDocument.defaultView))return b;if(h=g.getComputedStyle(a,null))f=h.getPropertyValue(e),f===""&&!d.contains(a.ownerDocument.documentElement,a)&&(f=d.style(a,e));return f}),c.documentElement.currentStyle&&(bm=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bf.test(d)&&bg.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bk=bl||bm,d.expr&&d.expr.filters&&(d.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!d.support.reliableHiddenOffsets&&(a.style.display||d.css(a,"display"))==="none"},d.expr.filters.visible=function(a){return!d.expr.filters.hidden(a)});var bp=/%20/g,bq=/\[\]$/,br=/\r?\n/g,bs=/#.*$/,bt=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bu=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bv=/(?:^file|^widget|\-extension):$/,bw=/^(?:GET|HEAD)$/,bx=/^\/\//,by=/\?/,bz=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bA=/^(?:select|textarea)/i,bB=/\s+/,bC=/([?&])_=[^&]*/,bD=/(^|\-)([a-z])/g,bE=function(a,b,c){return b+c.toUpperCase()},bF=/^([\w\+\.\-]+:)\/\/([^\/?#:]*)(?::(\d+))?/,bG=d.fn.load,bH={},bI={},bJ,bK;try{bJ=c.location.href}catch(bL){bJ=c.createElement("a"),bJ.href="",bJ=bJ.href}bK=bF.exec(bJ.toLowerCase()),d.fn.extend({load:function(a,c,e){if(typeof a!=="string"&&bG)return bG.apply(this,arguments);if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var g=a.slice(f,a.length);a=a.slice(0,f)}var h="GET";c&&(d.isFunction(c)?(e=c,c=b):typeof c==="object"&&(c=d.param(c,d.ajaxSettings.traditional),h="POST"));var i=this;d.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?d("<div>").append(c.replace(bz,"")).find(g):c)),e&&i.each(e,[c,b,a])}});return this},serialize:function(){return d.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?d.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bA.test(this.nodeName)||bu.test(this.type))}).map(function(a,b){var c=d(this).val();return c==null?null:d.isArray(c)?d.map(c,function(a,c){return{name:b.name,value:a.replace(br,"\r\n")}}):{name:b.name,value:c.replace(br,"\r\n")}}).get()}}),d.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){d.fn[b]=function(a){return this.bind(b,a)}}),d.each(["get","post"],function(a,c){d[c]=function(a,e,f,g){d.isFunction(e)&&(g=g||f,f=e,e=b);return d.ajax({type:c,url:a,data:e,success:f,dataType:g})}}),d.extend({getScript:function(a,c){return d.get(a,b,c,"script")},getJSON:function(a,b,c){return d.get(a,b,c,"json")},ajaxSetup:function(a,b){b?d.extend(!0,a,d.ajaxSettings,b):(b=a,a=d.extend(!0,d.ajaxSettings,b));for(var c in {context:1,url:1})c in b?a[c]=b[c]:c in d.ajaxSettings&&(a[c]=d.ajaxSettings[c]);return a},ajaxSettings:{url:bJ,isLocal:bv.test(bK[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":d.parseJSON,"text xml":d.parseXML}},ajaxPrefilter:bM(bH),ajaxTransport:bM(bI),ajax:function(a,c){function v(a,c,l,n){if(r!==2){r=2,p&&clearTimeout(p),o=b,m=n||"",u.readyState=a?4:0;var q,t,v,w=l?bP(e,u,l):b,x,y;if(a>=200&&a<300||a===304){if(e.ifModified){if(x=u.getResponseHeader("Last-Modified"))d.lastModified[k]=x;if(y=u.getResponseHeader("Etag"))d.etag[k]=y}if(a===304)c="notmodified",q=!0;else try{t=bQ(e,w),c="success",q=!0}catch(z){c="parsererror",v=z}}else{v=c;if(!c||a)c="error",a<0&&(a=0)}u.status=a,u.statusText=c,q?h.resolveWith(f,[t,c,u]):h.rejectWith(f,[u,c,v]),u.statusCode(j),j=b,s&&g.trigger("ajax"+(q?"Success":"Error"),[u,e,q?t:v]),i.resolveWith(f,[u,c]),s&&(g.trigger("ajaxComplete",[u,e]),--d.active||d.event.trigger("ajaxStop"))}}typeof a==="object"&&(c=a,a=b),c=c||{};var e=d.ajaxSetup({},c),f=e.context||e,g=f!==e&&(f.nodeType||f instanceof d)?d(f):d.event,h=d.Deferred(),i=d._Deferred(),j=e.statusCode||{},k,l={},m,n,o,p,q,r=0,s,t,u={readyState:0,setRequestHeader:function(a,b){r||(l[a.toLowerCase().replace(bD,bE)]=b);return this},getAllResponseHeaders:function(){return r===2?m:null},getResponseHeader:function(a){var c;if(r===2){if(!n){n={};while(c=bt.exec(m))n[c[1].toLowerCase()]=c[2]}c=n[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){r||(e.mimeType=a);return this},abort:function(a){a=a||"abort",o&&o.abort(a),v(0,a);return this}};h.promise(u),u.success=u.done,u.error=u.fail,u.complete=i.done,u.statusCode=function(a){if(a){var b;if(r<2)for(b in a)j[b]=[j[b],a[b]];else b=a[u.status],u.then(b,b)}return this},e.url=((a||e.url)+"").replace(bs,"").replace(bx,bK[1]+"//"),e.dataTypes=d.trim(e.dataType||"*").toLowerCase().split(bB),e.crossDomain||(q=bF.exec(e.url.toLowerCase()),e.crossDomain=q&&(q[1]!=bK[1]||q[2]!=bK[2]||(q[3]||(q[1]==="http:"?80:443))!=(bK[3]||(bK[1]==="http:"?80:443)))),e.data&&e.processData&&typeof e.data!=="string"&&(e.data=d.param(e.data,e.traditional)),bN(bH,e,c,u);if(r===2)return!1;s=e.global,e.type=e.type.toUpperCase(),e.hasContent=!bw.test(e.type),s&&d.active++===0&&d.event.trigger("ajaxStart");if(!e.hasContent){e.data&&(e.url+=(by.test(e.url)?"&":"?")+e.data),k=e.url;if(e.cache===!1){var w=d.now(),x=e.url.replace(bC,"$1_="+w);e.url=x+(x===e.url?(by.test(e.url)?"&":"?")+"_="+w:"")}}if(e.data&&e.hasContent&&e.contentType!==!1||c.contentType)l["Content-Type"]=e.contentType;e.ifModified&&(k=k||e.url,d.lastModified[k]&&(l["If-Modified-Since"]=d.lastModified[k]),d.etag[k]&&(l["If-None-Match"]=d.etag[k])),l.Accept=e.dataTypes[0]&&e.accepts[e.dataTypes[0]]?e.accepts[e.dataTypes[0]]+(e.dataTypes[0]!=="*"?", */*; q=0.01":""):e.accepts["*"];for(t in e.headers)u.setRequestHeader(t,e.headers[t]);if(e.beforeSend&&(e.beforeSend.call(f,u,e)===!1||r===2)){u.abort();return!1}for(t in {success:1,error:1,complete:1})u[t](e[t]);o=bN(bI,e,c,u);if(o){u.readyState=1,s&&g.trigger("ajaxSend",[u,e]),e.async&&e.timeout>0&&(p=setTimeout(function(){u.abort("timeout")},e.timeout));try{r=1,o.send(l,v)}catch(y){status<2?v(-1,y):d.error(y)}}else v(-1,"No Transport");return u},param:function(a,c){var e=[],f=function(a,b){b=d.isFunction(b)?b():b,e[e.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=d.ajaxSettings.traditional);if(d.isArray(a)||a.jquery&&!d.isPlainObject(a))d.each(a,function(){f(this.name,this.value)});else for(var g in a)bO(g,a[g],c,f);return e.join("&").replace(bp,"+")}}),d.extend({active:0,lastModified:{},etag:{}});var bR=d.now(),bS=/(\=)\?(&|$)|()\?\?()/i;d.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return d.expando+"_"+bR++}}),d.ajaxPrefilter("json jsonp",function(b,c,e){var f=typeof b.data==="string";if(b.dataTypes[0]==="jsonp"||c.jsonpCallback||c.jsonp!=null||b.jsonp!==!1&&(bS.test(b.url)||f&&bS.test(b.data))){var g,h=b.jsonpCallback=d.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2",m=function(){a[h]=i,g&&d.isFunction(i)&&a[h](g[0])};b.jsonp!==!1&&(j=j.replace(bS,l),b.url===j&&(f&&(k=k.replace(bS,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},e.then(m,m),b.converters["script json"]=function(){g||d.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),d.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){d.globalEval(a);return a}}}),d.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),d.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var bT=d.now(),bU,bV;d.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&bX()||bY()}:bX,bV=d.ajaxSettings.xhr(),d.support.ajax=!!bV,d.support.cors=bV&&"withCredentials"in bV,bV=b,d.support.ajax&&d.ajaxTransport(function(a){if(!a.crossDomain||d.support.cors){var c;return{send:function(e,f){var g=a.xhr(),h,i;a.username?g.open(a.type,a.url,a.async,a.username,a.password):g.open(a.type,a.url,a.async);if(a.xhrFields)for(i in a.xhrFields)g[i]=a.xhrFields[i];a.mimeType&&g.overrideMimeType&&g.overrideMimeType(a.mimeType),(!a.crossDomain||a.hasContent)&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(i in e)g.setRequestHeader(i,e[i])}catch(j){}g.send(a.hasContent&&a.data||null),c=function(e,i){var j,k,l,m,n;try{if(c&&(i||g.readyState===4)){c=b,h&&(g.onreadystatechange=d.noop,delete bU[h]);if(i)g.readyState!==4&&g.abort();else{j=g.status,l=g.getAllResponseHeaders(),m={},n=g.responseXML,n&&n.documentElement&&(m.xml=n),m.text=g.responseText;try{k=g.statusText}catch(o){k=""}j||!a.isLocal||a.crossDomain?j===1223&&(j=204):j=m.text?200:404}}}catch(p){i||f(-1,p)}m&&f(j,k,m,l)},a.async&&g.readyState!==4?(bU||(bU={},bW()),h=bT++,g.onreadystatechange=bU[h]=c):c()},abort:function(){c&&c(0,1)}}}});var bZ={},b$=/^(?:toggle|show|hide)$/,b_=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,ca,cb=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];d.fn.extend({show:function(a,b,c){var e,f;if(a||a===0)return this.animate(cc("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)e=this[g],f=e.style.display,!d._data(e,"olddisplay")&&f==="none"&&(f=e.style.display=""),f===""&&d.css(e,"display")==="none"&&d._data(e,"olddisplay",cd(e.nodeName));for(g=0;g<h;g++){e=this[g],f=e.style.display;if(f===""||f==="none")e.style.display=d._data(e,"olddisplay")||""}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cc("hide",3),a,b,c);for(var e=0,f=this.length;e<f;e++){var g=d.css(this[e],"display");g!=="none"&&!d._data(this[e],"olddisplay")&&d._data(this[e],"olddisplay",g)}for(e=0;e<f;e++)this[e].style.display="none";return this},_toggle:d.fn.toggle,toggle:function(a,b,c){var e=typeof a==="boolean";d.isFunction(a)&&d.isFunction(b)?this._toggle.apply(this,arguments):a==null||e?this.each(function(){var b=e?a:d(this).is(":hidden");d(this)[b?"show":"hide"]()}):this.animate(cc("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,e){var f=d.speed(b,c,e);if(d.isEmptyObject(a))return this.each(f.complete);return this[f.queue===!1?"each":"queue"](function(){var b=d.extend({},f),c,e=this.nodeType===1,g=e&&d(this).is(":hidden"),h=this;for(c in a){var i=d.camelCase(c);c!==i&&(a[i]=a[c],delete a[c],c=i);if(a[c]==="hide"&&g||a[c]==="show"&&!g)return b.complete.call(this);if(e&&(c==="height"||c==="width")){b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(d.css(this,"display")==="inline"&&d.css(this,"float")==="none")if(d.support.inlineBlockNeedsLayout){var j=cd(this.nodeName);j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)}else this.style.display="inline-block"}d.isArray(a[c])&&((b.specialEasing=b.specialEasing||{})[c]=a[c][1],a[c]=a[c][0])}b.overflow!=null&&(this.style.overflow="hidden"),b.curAnim=d.extend({},a),d.each(a,function(c,e){var f=new d.fx(h,b,c);if(b$.test(e))f[e==="toggle"?g?"show":"hide":e](a);else{var i=b_.exec(e),j=f.cur();if(i){var k=parseFloat(i[2]),l=i[3]||(d.cssNumber[c]?"":"px");l!=="px"&&(d.style(h,c,(k||1)+l),j=(k||1)/f.cur()*j,d.style(h,c,j+l)),i[1]&&(k=(i[1]==="-="?-1:1)*k+j),f.custom(j,k,l)}else f.custom(j,e,"")}});return!0})},stop:function(a,b){var c=d.timers;a&&this.queue([]),this.each(function(){for(var a=c.length-1;a>=0;a--)c[a].elem===this&&(b&&c[a](!0),c.splice(a,1))}),b||this.dequeue();return this}}),d.each({slideDown:cc("show",1),slideUp:cc("hide",1),slideToggle:cc("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){d.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),d.extend({speed:function(a,b,c){var e=a&&typeof a==="object"?d.extend({},a):{complete:c||!c&&b||d.isFunction(a)&&a,duration:a,easing:c&&b||b&&!d.isFunction(b)&&b};e.duration=d.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in d.fx.speeds?d.fx.speeds[e.duration]:d.fx.speeds._default,e.old=e.complete,e.complete=function(){e.queue!==!1&&d(this).dequeue(),d.isFunction(e.old)&&e.old.call(this)};return e},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig||(b.orig={})}}),d.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(d.fx.step[this.prop]||d.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=d.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function g(a){return e.step(a)}var e=this,f=d.fx;this.startTime=d.now(),this.start=a,this.end=b,this.unit=c||this.unit||(d.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,g.elem=this.elem,g()&&d.timers.push(g)&&!ca&&(ca=setInterval(f.tick,f.interval))},show:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),d(this.elem).show()},hide:function(){this.options.orig[this.prop]=d.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=d.now(),c=!0;if(a||b>=this.options.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),this.options.curAnim[this.prop]=!0;for(var e in this.options.curAnim)this.options.curAnim[e]!==!0&&(c=!1);if(c){if(this.options.overflow!=null&&!d.support.shrinkWrapBlocks){var f=this.elem,g=this.options;d.each(["","X","Y"],function(a,b){f.style["overflow"+b]=g.overflow[a]})}this.options.hide&&d(this.elem).hide();if(this.options.hide||this.options.show)for(var h in this.options.curAnim)d.style(this.elem,h,this.options.orig[h]);this.options.complete.call(this.elem)}return!1}var i=b-this.startTime;this.state=i/this.options.duration;var j=this.options.specialEasing&&this.options.specialEasing[this.prop],k=this.options.easing||(d.easing.swing?"swing":"linear");this.pos=d.easing[j||k](this.state,i,0,1,this.options.duration),this.now=this.start+(this.end-this.start)*this.pos,this.update();return!0}},d.extend(d.fx,{tick:function(){var a=d.timers;for(var b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||d.fx.stop()},interval:13,stop:function(){clearInterval(ca),ca=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){d.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),d.expr&&d.expr.filters&&(d.expr.filters.animated=function(a){return d.grep(d.timers,function(b){return a===b.elem}).length});var ce=/^t(?:able|d|h)$/i,cf=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?d.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){d.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return d.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(e){}var f=b.ownerDocument,g=f.documentElement;if(!c||!d.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=f.body,i=cg(f),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||d.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||d.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:d.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){d.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return d.offset.bodyOffset(b);d.offset.initialize();var c,e=b.offsetParent,f=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(d.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===e&&(l+=b.offsetTop,m+=b.offsetLeft,d.offset.doesNotAddBorder&&(!d.offset.doesAddBorderForTableAndCells||!ce.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),f=e,e=b.offsetParent),d.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;d.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},d.offset={initialize:function(){var a=c.body,b=c.createElement("div"),e,f,g,h,i=parseFloat(d.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";d.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),e=b.firstChild,f=e.firstChild,h=e.nextSibling.firstChild.firstChild,this.doesNotAddBorder=f.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,f.style.position="fixed",f.style.top="20px",this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15,f.style.position=f.style.top="",e.style.overflow="hidden",e.style.position="relative",this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),a=b=e=f=g=h=null,d.offset.initialize=d.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;d.offset.initialize(),d.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(d.css(a,"marginTop"))||0,c+=parseFloat(d.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var e=d.css(a,"position");e==="static"&&(a.style.position="relative");var f=d(a),g=f.offset(),h=d.css(a,"top"),i=d.css(a,"left"),j=e==="absolute"&&d.inArray("auto",[h,i])>-1,k={},l={},m,n;j&&(l=f.position()),m=j?l.top:parseInt(h,10)||0,n=j?l.left:parseInt(i,10)||0,d.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):f.css(k)}},d.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),e=cf.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(d.css(a,"marginTop"))||0,c.left-=parseFloat(d.css(a,"marginLeft"))||0,e.top+=parseFloat(d.css(b[0],"borderTopWidth"))||0,e.left+=parseFloat(d.css(b[0],"borderLeftWidth"))||0;return{top:c.top-e.top,left:c.left-e.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&(!cf.test(a.nodeName)&&d.css(a,"position")==="static"))a=a.offsetParent;return a})}}),d.each(["Left","Top"],function(a,c){var e="scroll"+c;d.fn[e]=function(c){var f=this[0],g;if(!f)return null;if(c!==b)return this.each(function(){g=cg(this),g?g.scrollTo(a?d(g).scrollLeft():c,a?c:d(g).scrollTop()):this[e]=c});g=cg(f);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:d.support.boxModel&&g.document.documentElement[e]||g.document.body[e]:f[e]}}),d.each(["Height","Width"],function(a,c){var e=c.toLowerCase();d.fn["inner"+c]=function(){return this[0]?parseFloat(d.css(this[0],e,"padding")):null},d.fn["outer"+c]=function(a){return this[0]?parseFloat(d.css(this[0],e,a?"margin":"border")):null},d.fn[e]=function(a){var f=this[0];if(!f)return a==null?null:this;if(d.isFunction(a))return this.each(function(b){var c=d(this);c[e](a.call(this,b,c[e]()))});if(d.isWindow(f)){var g=f.document.documentElement["client"+c];return f.document.compatMode==="CSS1Compat"&&g||f.document.body["client"+c]||g}if(f.nodeType===9)return Math.max(f.documentElement["client"+c],f.body["scroll"+c],f.documentElement["scroll"+c],f.body["offset"+c],f.documentElement["offset"+c]);if(a===b){var h=d.css(f,e),i=parseFloat(h);return d.isNaN(i)?h:i}return this.css(e,typeof a==="string"?a:a+"px")}}),a.jQuery=a.$=d})(window);
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/jquery-ui/js/jquery-ui-1.8.11.custom.min.js	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,398 @@
+/*!
+ * jQuery UI 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.11",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
+b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
+;/*!
+ * jQuery UI Widget 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
+e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
+this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+;/*!
+ * jQuery UI Mouse 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function(b){b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=
+a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,e=a.which==1,f=typeof this.options.cancel=="string"?b(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
+this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(d){return c._mouseMove(d)};this._mouseUpDelegate=function(d){return c._mouseUp(d)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=
+true}},_mouseMove:function(a){if(b.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);
+if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&
+this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),
+height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?
+document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),
+10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),
+10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&
+d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=
+this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?
+e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,
+offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.11"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g.refreshPositions();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},
+b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=
+d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};
+a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&
+this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",
+{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+
+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",
+a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+
+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<
+c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+
+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),
+f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=
+c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=
+c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),
+{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=
+parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
+;/*
+ * jQuery UI Droppable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.11"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
+i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
+d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
+;/*
+ * jQuery UI Resizable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
+f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");
+this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=
+null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+
+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=
+[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=
+this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,
+a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,
+c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,
+originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.11"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=
+b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width",
+"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};
+if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-
+g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,
+height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=
+e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,
+d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?
+d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=
+a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&
+/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");
+b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/
+(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
+e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.11"})})(jQuery);
+;/*
+ * jQuery UI Sortable 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=
+b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;
+d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-
+this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
+return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<
+b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-
+b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,
+a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
+e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
+c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
+toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||
+this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();
+var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},
+_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
+if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),
+this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&
+this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=
+e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];
+if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);
+c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===
+1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=
+this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):
+b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==
+""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
+this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
+10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
+{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||
+document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,
+b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=
+document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-
+this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<
+this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&
+this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=
+this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();
+this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],
+this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",
+g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||
+this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,
+originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.11"})})(jQuery);
+;/*
+ * jQuery UI Accordion 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
+this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
+e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
+e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
+"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.11",
+animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
+f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
+paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
+a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
+b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
+this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
+b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
+d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},
+deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);
+e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,
+g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
+this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
+;/*
+ * jQuery UI Button 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,f=a([]);if(c)f=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return f};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
+i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
+function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(f)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");
+b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var e=b.element[0];h(e).not(e).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");
+g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(e){if(c.disabled)return false;if(e.keyCode==a.ui.keyCode.SPACE||e.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(e){e.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",
+c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){var b=this.element.parents().filter(":last"),c="label[for="+this.element.attr("id")+"]";this.buttonElement=b.find(c);if(!this.buttonElement.length){b=b.length?b.siblings():this.element.siblings();this.buttonElement=b.filter(c);if(!this.buttonElement.length)this.buttonElement=b.find(c)}this.element.addClass("ui-helper-hidden-accessible");
+(b=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active  ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());
+this.hasTitle||this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
+c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.push(f?"ui-button-icons-only":
+"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *  jquery.ui.button.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&
+c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
+-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role",
+"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=
+b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&
+a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index");
+isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);
+d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}});
+c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,
+h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=
+d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,
+position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,
+h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===
+1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in
+l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");
+break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e=
+this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&&
+this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.11",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===
+0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,
+function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
+;
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/zpt/addMPIWGThesaurusForm.zpt	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,19 @@
+<html>
+<body>
+<h2>Add a thesaurus folder</h2>
+
+
+
+<form method="post" action="manage_addMPIWGThesaurus">
+<table>
+<tr>
+	<td><b>ID</b></td>
+	<td><input type="text" size="40" name="id"></td>
+</tr>
+
+
+<input type="submit" value="create">
+
+</form>
+</body>
+</html>
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/zpt/changeMPIWGThesaurusForm.zpt	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,44 @@
+<html>
+<body>
+<h2>Change Thesaurus</h2>
+
+
+<form method="post" action="changeMPIWGThesaurus">
+<table>
+<tr>
+	<td><b>Approaches</b></td>
+	<td><textarea rows="10" name="approachesTxt" tal:content="here/approachesTxt"></textarea></td>
+</tr>
+<tr>
+	<td><b>Disciplines</b></td>
+	<td><textarea rows="10" name="disciplinesTxt" tal:content="here/disciplinesTxt"></textarea></td>
+</tr>
+
+<tr>
+	<td><b>Periods</b></td>
+	<td><textarea rows="10" name="periodsTxt" tal:content="here/periodsTxt"></textarea></td>
+</tr>
+
+<tr>
+	<td><b>Spaces</b></td>
+	<td><textarea rows="10" name="spacesTxt" tal:content="here/spacesTxt"></textarea></td>
+</tr>
+
+<tr>
+	<td><b>Technologies</b></td>
+	<td><textarea rows="10" name="technologiesTxt" tal:content="here/technologiesTxt"></textarea></td>
+</tr>
+
+<tr>
+	<td><b>KnowledgeTransfers</b></td>
+	<td><textarea rows="10" name="knowledgeTransfersTxt" tal:content="here/knowledgeTransfersTxt"></textarea></td>
+</tr>
+
+<tr>
+<td>&nbsp;</td>
+<td>
+<input type="submit" value="change">
+</td>
+</form>
+</body>
+</html>
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/zpt/index.html	Thu Jun 30 09:07:49 2011 +0200
@@ -0,0 +1,323 @@
+<!DOCTYPE html>
+<html>
+	<head>
+		<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1" />
+		<title>jQuery UI Example Page</title>
+		<link type="text/css" href="./jquery-ui/css/ui-lightness/jquery-ui-1.8.11.custom.css" rel="stylesheet" />	
+		<script type="text/javascript" src="./jquery-ui/js/jquery-1.5.1.min.js"></script>
+		<script type="text/javascript" src="./jquery-ui/js/jquery-ui-1.8.11.custom.min.js"></script>
+		<script type="text/javascript">
+			$(function(){
+
+				// Accordion
+				$("#accordion").accordion({ header: "h3" });
+	
+
+				// Dialog			
+				$('#dialog').dialog({
+					autoOpen: false,
+					width: 600,
+					buttons: {
+						"Ok": function() { 
+							$(this).dialog("close"); 
+						}, 
+						"Cancel": function() { 
+							$(this).dialog("close"); 
+						} 
+					}
+				});
+				
+				// Dialog Link
+				$('#dialog_link').click(function(){
+					$('#dialog').dialog('open');
+					return false;
+				});
+				
+				//hover states on the static widgets
+				$('#dialog_link, ul#icons li').hover(
+					function() { $(this).addClass('ui-state-hover'); }, 
+					function() { $(this).removeClass('ui-state-hover'); }
+				);
+				
+			});
+		</script>
+		<style type="text/css">
+			/*demo page css*/
+			body{ font: 62.5% "Trebuchet MS", sans-serif; margin: 50px;}
+			.demoHeaders { margin-top: 2em; }
+			#dialog_link {padding: .4em 1em .4em 20px;text-decoration: none;position: relative;}
+			#dialog_link span.ui-icon {margin: 0 5px 0 0;position: absolute;left: .2em;top: 50%;margin-top: -8px;}
+			ul#icons {margin: 0; padding: 0;}
+			ul#icons li {margin: 2px; position: relative; padding: 4px 0; cursor: pointer; float: left;  list-style: none;}
+			ul#icons span.ui-icon {float: left; margin: 0 4px;}
+		</style>	
+	</head>
+	<body>
+	<h1>Welcome to jQuery UI!</h1>
+	<p style="font-size: 1.3em; line-height: 1.5; margin: 1em 0; width: 50%;">This page demonstrates the widgets you downloaded using the theme you selected in the download builder. We've included and linked to minified versions of <a href="js/jquery-1.5.1.min.js">jQuery</a>, your personalized copy of <a href="js/jquery-ui-1.8.11.custom.min.js">jQuery UI (js/jquery-ui-1.8.11.custom.min.js)</a>, and <a href="css/ui-lightness/jquery-ui-1.8.11.custom.css">css/ui-lightness/jquery-ui-1.8.11.custom.css</a> which imports the entire jQuery UI CSS Framework. You can choose to link a subset of the CSS Framework depending on your needs. </p>
+	<p style="font-size: 1.2em; line-height: 1.5; margin: 1em 0; width: 50%;">You've downloaded components and a theme that are compatible with jQuery 1.3+. Please make sure you are using jQuery 1.3+ in your production environment.</p>	
+
+	<p style="font-weight: bold; margin: 2em 0 1em; font-size: 1.3em;">YOUR COMPONENTS:</p>
+		
+		<!-- Accordion -->
+		<h2 class="demoHeaders">Accordion</h2>
+		<div id="accordion">
+			<div>
+				<h3><a href="#">First</a></h3>
+				<div>Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet.</div>
+			</div>
+			<div>
+				<h3><a href="#">Second</a></h3>
+				<div>Phasellus mattis tincidunt nibh.</div>
+			</div>
+			<div>
+				<h3><a href="#">Third</a></h3>
+				<div>Nam dui erat, auctor a, dignissim quis.</div>
+			</div>
+		</div>
+	
+		<!-- Dialog NOTE: Dialog is not generated by UI in this demo so it can be visually styled in themeroller-->
+		<h2 class="demoHeaders">Dialog</h2>
+		<p><a href="#" id="dialog_link" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-newwin"></span>Open Dialog</a></p>
+		
+		
+		<h2 class="demoHeaders">Overlay and Shadow Classes <em>(not currently used in UI widgets)</em></h2>
+		<div style="position: relative; width: 96%; height: 200px; padding:1% 4%; overflow:hidden;" class="fakewindowcontain">
+			<p>Lorem ipsum dolor sit amet,  Nulla nec tortor. Donec id elit quis purus consectetur consequat. </p><p>Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. </p><p>Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. </p><p>Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. </p><p>Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. Aliquam ante. </p><p>Suspendisse scelerisque dui nec velit. Duis augue augue, gravida euismod, vulputate ac, facilisis id, sem. Morbi in orci. Nulla purus lacus, pulvinar vel, malesuada ac, mattis nec, quam. Nam molestie scelerisque quam. Nullam feugiat cursus lacus.orem ipsum dolor sit amet, consectetur adipiscing elit. Donec libero risus, commodo vitae, pharetra mollis, posuere eu, pede. Nulla nec tortor. Donec id elit quis purus consectetur consequat. Nam congue semper tellus. Sed erat dolor, dapibus sit amet, venenatis ornare, ultrices ut, nisi. </p>
+			
+			<!-- ui-dialog -->
+			<div class="ui-overlay"><div class="ui-widget-overlay"></div><div class="ui-widget-shadow ui-corner-all" style="width: 302px; height: 152px; position: absolute; left: 50px; top: 30px;"></div></div>
+			<div style="position: absolute; width: 280px; height: 130px;left: 50px; top: 30px; padding: 10px;" class="ui-widget ui-widget-content ui-corner-all">
+				<div class="ui-dialog-content ui-widget-content" style="background: none; border: 0;">
+					<p>Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.</p>
+				</div>
+			</div>
+		
+		</div>
+
+		
+		<!-- ui-dialog -->
+		<div id="dialog" title="Dialog Title">
+			<p>Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat.</p>
+		</div>
+			
+				
+				
+		<h2 class="demoHeaders">Framework Icons (content color preview)</h2>
+		<ul id="icons" class="ui-widget ui-helper-clearfix">
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-n"><span class="ui-icon ui-icon-carat-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-ne"><span class="ui-icon ui-icon-carat-1-ne"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-e"><span class="ui-icon ui-icon-carat-1-e"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-se"><span class="ui-icon ui-icon-carat-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-s"><span class="ui-icon ui-icon-carat-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-sw"><span class="ui-icon ui-icon-carat-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-w"><span class="ui-icon ui-icon-carat-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-1-nw"><span class="ui-icon ui-icon-carat-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-2-n-s"><span class="ui-icon ui-icon-carat-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-carat-2-e-w"><span class="ui-icon ui-icon-carat-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-n"><span class="ui-icon ui-icon-triangle-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-ne"><span class="ui-icon ui-icon-triangle-1-ne"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-e"><span class="ui-icon ui-icon-triangle-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-se"><span class="ui-icon ui-icon-triangle-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-s"><span class="ui-icon ui-icon-triangle-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-sw"><span class="ui-icon ui-icon-triangle-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-w"><span class="ui-icon ui-icon-triangle-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-1-nw"><span class="ui-icon ui-icon-triangle-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-2-n-s"><span class="ui-icon ui-icon-triangle-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-triangle-2-e-w"><span class="ui-icon ui-icon-triangle-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-n"><span class="ui-icon ui-icon-arrow-1-n"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-ne"><span class="ui-icon ui-icon-arrow-1-ne"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-e"><span class="ui-icon ui-icon-arrow-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-se"><span class="ui-icon ui-icon-arrow-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-s"><span class="ui-icon ui-icon-arrow-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-sw"><span class="ui-icon ui-icon-arrow-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-w"><span class="ui-icon ui-icon-arrow-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-1-nw"><span class="ui-icon ui-icon-arrow-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-n-s"><span class="ui-icon ui-icon-arrow-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-ne-sw"><span class="ui-icon ui-icon-arrow-2-ne-sw"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-e-w"><span class="ui-icon ui-icon-arrow-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-2-se-nw"><span class="ui-icon ui-icon-arrow-2-se-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-n"><span class="ui-icon ui-icon-arrowstop-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-e"><span class="ui-icon ui-icon-arrowstop-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-s"><span class="ui-icon ui-icon-arrowstop-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowstop-1-w"><span class="ui-icon ui-icon-arrowstop-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-n"><span class="ui-icon ui-icon-arrowthick-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-ne"><span class="ui-icon ui-icon-arrowthick-1-ne"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-e"><span class="ui-icon ui-icon-arrowthick-1-e"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-se"><span class="ui-icon ui-icon-arrowthick-1-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-s"><span class="ui-icon ui-icon-arrowthick-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-sw"><span class="ui-icon ui-icon-arrowthick-1-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-w"><span class="ui-icon ui-icon-arrowthick-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-1-nw"><span class="ui-icon ui-icon-arrowthick-1-nw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-n-s"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-ne-sw"><span class="ui-icon ui-icon-arrowthick-2-ne-sw"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-e-w"><span class="ui-icon ui-icon-arrowthick-2-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthick-2-se-nw"><span class="ui-icon ui-icon-arrowthick-2-se-nw"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-n"><span class="ui-icon ui-icon-arrowthickstop-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-e"><span class="ui-icon ui-icon-arrowthickstop-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-s"><span class="ui-icon ui-icon-arrowthickstop-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowthickstop-1-w"><span class="ui-icon ui-icon-arrowthickstop-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-w"><span class="ui-icon ui-icon-arrowreturnthick-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-n"><span class="ui-icon ui-icon-arrowreturnthick-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-e"><span class="ui-icon ui-icon-arrowreturnthick-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturnthick-1-s"><span class="ui-icon ui-icon-arrowreturnthick-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-w"><span class="ui-icon ui-icon-arrowreturn-1-w"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-n"><span class="ui-icon ui-icon-arrowreturn-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-e"><span class="ui-icon ui-icon-arrowreturn-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowreturn-1-s"><span class="ui-icon ui-icon-arrowreturn-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-w"><span class="ui-icon ui-icon-arrowrefresh-1-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-n"><span class="ui-icon ui-icon-arrowrefresh-1-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-e"><span class="ui-icon ui-icon-arrowrefresh-1-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrowrefresh-1-s"><span class="ui-icon ui-icon-arrowrefresh-1-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-4"><span class="ui-icon ui-icon-arrow-4"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-arrow-4-diag"><span class="ui-icon ui-icon-arrow-4-diag"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-extlink"><span class="ui-icon ui-icon-extlink"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-newwin"><span class="ui-icon ui-icon-newwin"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-refresh"><span class="ui-icon ui-icon-refresh"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-shuffle"><span class="ui-icon ui-icon-shuffle"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-transfer-e-w"><span class="ui-icon ui-icon-transfer-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-transferthick-e-w"><span class="ui-icon ui-icon-transferthick-e-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-folder-collapsed"><span class="ui-icon ui-icon-folder-collapsed"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-folder-open"><span class="ui-icon ui-icon-folder-open"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-document"><span class="ui-icon ui-icon-document"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-document-b"><span class="ui-icon ui-icon-document-b"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-note"><span class="ui-icon ui-icon-note"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-mail-closed"><span class="ui-icon ui-icon-mail-closed"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-mail-open"><span class="ui-icon ui-icon-mail-open"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-suitcase"><span class="ui-icon ui-icon-suitcase"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-comment"><span class="ui-icon ui-icon-comment"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-person"><span class="ui-icon ui-icon-person"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-print"><span class="ui-icon ui-icon-print"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-trash"><span class="ui-icon ui-icon-trash"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-locked"><span class="ui-icon ui-icon-locked"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-unlocked"><span class="ui-icon ui-icon-unlocked"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-bookmark"><span class="ui-icon ui-icon-bookmark"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-tag"><span class="ui-icon ui-icon-tag"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-home"><span class="ui-icon ui-icon-home"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-flag"><span class="ui-icon ui-icon-flag"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-calculator"><span class="ui-icon ui-icon-calculator"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-cart"><span class="ui-icon ui-icon-cart"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pencil"><span class="ui-icon ui-icon-pencil"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-clock"><span class="ui-icon ui-icon-clock"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-disk"><span class="ui-icon ui-icon-disk"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-calendar"><span class="ui-icon ui-icon-calendar"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-zoomin"><span class="ui-icon ui-icon-zoomin"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-zoomout"><span class="ui-icon ui-icon-zoomout"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-search"><span class="ui-icon ui-icon-search"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-wrench"><span class="ui-icon ui-icon-wrench"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-gear"><span class="ui-icon ui-icon-gear"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-heart"><span class="ui-icon ui-icon-heart"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-star"><span class="ui-icon ui-icon-star"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-link"><span class="ui-icon ui-icon-link"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-cancel"><span class="ui-icon ui-icon-cancel"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-plus"><span class="ui-icon ui-icon-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-plusthick"><span class="ui-icon ui-icon-plusthick"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-minus"><span class="ui-icon ui-icon-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-minusthick"><span class="ui-icon ui-icon-minusthick"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-close"><span class="ui-icon ui-icon-close"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-closethick"><span class="ui-icon ui-icon-closethick"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-key"><span class="ui-icon ui-icon-key"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-lightbulb"><span class="ui-icon ui-icon-lightbulb"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-scissors"><span class="ui-icon ui-icon-scissors"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-clipboard"><span class="ui-icon ui-icon-clipboard"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-copy"><span class="ui-icon ui-icon-copy"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-contact"><span class="ui-icon ui-icon-contact"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-image"><span class="ui-icon ui-icon-image"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-video"><span class="ui-icon ui-icon-video"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-script"><span class="ui-icon ui-icon-script"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-alert"><span class="ui-icon ui-icon-alert"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-info"><span class="ui-icon ui-icon-info"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-notice"><span class="ui-icon ui-icon-notice"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-help"><span class="ui-icon ui-icon-help"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-check"><span class="ui-icon ui-icon-check"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-bullet"><span class="ui-icon ui-icon-bullet"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-radio-off"><span class="ui-icon ui-icon-radio-off"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-radio-on"><span class="ui-icon ui-icon-radio-on"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pin-w"><span class="ui-icon ui-icon-pin-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pin-s"><span class="ui-icon ui-icon-pin-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-play"><span class="ui-icon ui-icon-play"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-pause"><span class="ui-icon ui-icon-pause"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-next"><span class="ui-icon ui-icon-seek-next"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-prev"><span class="ui-icon ui-icon-seek-prev"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-end"><span class="ui-icon ui-icon-seek-end"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-seek-first"><span class="ui-icon ui-icon-seek-first"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-stop"><span class="ui-icon ui-icon-stop"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-eject"><span class="ui-icon ui-icon-eject"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-volume-off"><span class="ui-icon ui-icon-volume-off"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-volume-on"><span class="ui-icon ui-icon-volume-on"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-power"><span class="ui-icon ui-icon-power"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-signal-diag"><span class="ui-icon ui-icon-signal-diag"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-signal"><span class="ui-icon ui-icon-signal"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-0"><span class="ui-icon ui-icon-battery-0"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-1"><span class="ui-icon ui-icon-battery-1"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-2"><span class="ui-icon ui-icon-battery-2"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-battery-3"><span class="ui-icon ui-icon-battery-3"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-plus"><span class="ui-icon ui-icon-circle-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-minus"><span class="ui-icon ui-icon-circle-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-close"><span class="ui-icon ui-icon-circle-close"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-e"><span class="ui-icon ui-icon-circle-triangle-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-s"><span class="ui-icon ui-icon-circle-triangle-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-w"><span class="ui-icon ui-icon-circle-triangle-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-triangle-n"><span class="ui-icon ui-icon-circle-triangle-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-e"><span class="ui-icon ui-icon-circle-arrow-e"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-s"><span class="ui-icon ui-icon-circle-arrow-s"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-w"><span class="ui-icon ui-icon-circle-arrow-w"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-arrow-n"><span class="ui-icon ui-icon-circle-arrow-n"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-zoomin"><span class="ui-icon ui-icon-circle-zoomin"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-zoomout"><span class="ui-icon ui-icon-circle-zoomout"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circle-check"><span class="ui-icon ui-icon-circle-check"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-plus"><span class="ui-icon ui-icon-circlesmall-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-minus"><span class="ui-icon ui-icon-circlesmall-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-circlesmall-close"><span class="ui-icon ui-icon-circlesmall-close"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-plus"><span class="ui-icon ui-icon-squaresmall-plus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-minus"><span class="ui-icon ui-icon-squaresmall-minus"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-squaresmall-close"><span class="ui-icon ui-icon-squaresmall-close"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-dotted-vertical"><span class="ui-icon ui-icon-grip-dotted-vertical"></span></li>
+		
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-dotted-horizontal"><span class="ui-icon ui-icon-grip-dotted-horizontal"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-solid-vertical"><span class="ui-icon ui-icon-grip-solid-vertical"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-solid-horizontal"><span class="ui-icon ui-icon-grip-solid-horizontal"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-gripsmall-diagonal-se"><span class="ui-icon ui-icon-gripsmall-diagonal-se"></span></li>
+		<li class="ui-state-default ui-corner-all" title=".ui-icon-grip-diagonal-se"><span class="ui-icon ui-icon-grip-diagonal-se"></span></li>
+		</ul>
+
+			
+		<!-- Highlight / Error -->
+		<h2 class="demoHeaders">Highlight / Error</h2>
+		<div class="ui-widget">
+			<div class="ui-state-highlight ui-corner-all" style="margin-top: 20px; padding: 0 .7em;"> 
+				<p><span class="ui-icon ui-icon-info" style="float: left; margin-right: .3em;"></span>
+				<strong>Hey!</strong> Sample ui-state-highlight style.</p>
+			</div>
+		</div>
+		<br/>
+		<div class="ui-widget">
+			<div class="ui-state-error ui-corner-all" style="padding: 0 .7em;"> 
+				<p><span class="ui-icon ui-icon-alert" style="float: left; margin-right: .3em;"></span> 
+				<strong>Alert:</strong> Sample ui-state-error style.</p>
+			</div>
+		</div>
+
+	</body>
+</html>
+
+