Mercurial > hg > digilib-old
changeset 757:5d3f74f378dd stream
merge with jquery branch
ccf67eaf97ee44f0b65edd745f4837399aa1b6df
author | robcast |
---|---|
date | Mon, 07 Feb 2011 09:12:47 +0100 |
parents | 3292343f64d6 (current diff) ccf67eaf97ee (diff) |
children | 485b85f6e097 |
files | client/digitallibrary/dlInfo-js.jsp servlet/src/digilib/image/ImageJobDescription.java servlet/src/digilib/io/DocuDirectory.java servlet/src/digilib/servlet/Scaler.java |
diffstat | 163 files changed, 24024 insertions(+), 75 deletions(-) [+] |
line wrap: on
line diff
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/ImgInfo-json.jsp Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,47 @@ +<%@page language="java" + import="digilib.io.FileOps, digilib.io.ImageFileset, digilib.io.ImageFile, + digilib.image.ImageSize, digilib.servlet.DigilibConfiguration" + contentType="application/json"%><%! +// create DocumentBean instance for all JSP requests +digilib.servlet.DocumentBean docBean = new digilib.servlet.DocumentBean(); + +// initialize DocumentBean instance in JSP init +public void jspInit() { + try { + // set servlet init-parameter + docBean.setConfig(getServletConfig()); + } catch (javax.servlet.ServletException e) { + System.out.println(e); + } +} +%><% +// parsing the query +digilib.servlet.DigilibRequest dlRequest = new digilib.servlet.DigilibRequest(request); +docBean.setRequest(dlRequest); +// dir cache +digilib.servlet.DigilibConfiguration dlConfig = docBean.getDlConfig(); +digilib.io.DocuDirCache dirCache = (digilib.io.DocuDirCache) dlConfig.getValue("servlet.dir.cache"); +// get file +FileOps.FileClass fc = FileOps.FileClass.IMAGE; +ImageFileset imgFile = (ImageFileset) dirCache.getFile(dlRequest.getFilePath(), dlRequest.getAsInt("pn"), fc); + +%>{ <% + if (imgFile != null) { + ImageFile img = imgFile.getBiggest(); + if (!img.isChecked()) { + DigilibConfiguration.docuImageIdentify(img); + } + ImageSize imgSize = img.getSize(); + %> + "filename" : "<%= imgFile.getName() %>", + "aspect" : <%= imgFile.getAspect() %>, + "dpi_x" : <%= imgFile.getResX() %>, + "dpi_y" : <%= imgFile.getResY() %><% + + if (imgSize != null) { + %>, + "width" : <%= imgSize.getWidth() %>, + "height" : <%= imgSize.getHeight() %> +<% } + } +%>}
--- a/client/digitallibrary/WEB-INF/web.xml Tue Jan 11 21:08:12 2011 +0100 +++ b/client/digitallibrary/WEB-INF/web.xml Mon Feb 07 09:12:47 2011 +0100 @@ -66,27 +66,6 @@ digilib.servlet.PDFCache </servlet-class> </servlet> - <!-- We want to mess around with the default JSP servlet... --> - <servlet> - <servlet-name> - doc-jsp - </servlet-name> - <servlet-class> - org.apache.jasper.servlet.JspServlet - </servlet-class> - <!-- parameters to the JSP servlet --> - <init-param> - <param-name> - logVerbosityLevel - </param-name> - <param-value> - WARNING - </param-value> - </init-param> - <load-on-startup> - 3 - </load-on-startup> - </servlet> <!-- The mapping for the Scaler servlet --> <servlet-mapping> <servlet-name> @@ -138,15 +117,6 @@ /authenticated/servlet/PDFCache/* </url-pattern> </servlet-mapping> - <!-- The mapping for the JSP servlet --> - <servlet-mapping> - <servlet-name> - doc-jsp - </servlet-name> - <url-pattern> - *.jsp - </url-pattern> - </servlet-mapping> <!-- region for authenticated access --> <security-constraint> <web-resource-collection> @@ -158,11 +128,11 @@ </url-pattern> </web-resource-collection> <!-- we need a default user --> - <auth-constraint> +<!-- <auth-constraint> <role-name> user </role-name> - </auth-constraint> + </auth-constraint> --> </security-constraint> <login-config> <!--
--- a/client/digitallibrary/dlInfo-js.jsp Tue Jan 11 21:08:12 2011 +0100 +++ /dev/null Thu Jan 01 00:00:00 1970 +0000 @@ -1,34 +0,0 @@ -<%@ page language="java" %> -<%! -// create DocumentBean instance for all JSP requests -digilib.servlet.DocumentBean docBean = new digilib.servlet.DocumentBean(); - -// initialize DocumentBean instance in JSP init -public void jspInit() { - try { - // set servlet init-parameter - docBean.setConfig(getServletConfig()); - } catch (javax.servlet.ServletException e) { - System.out.println(e); - } -} -%><% -// parsing the query -digilib.servlet.DigilibRequest dlRequest = new digilib.servlet.DigilibRequest(request); -docBean.setRequest(dlRequest); -%> -// Automatically generated JavaScript snippet with parameters -<% - Object[] keys = dlRequest.getParams().keySet().toArray(); - java.util.Arrays.sort(keys); - int l = keys.length; - for (int i = 0; i < l; i++) { - String key = (String) keys[i]; - String val = dlRequest.getAsString(key); - if (val.length() == 0) { - val = ""; - } - %>var dl_<%= key %> = "<%= val %>"; -<% - } -%>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/dlInfo-json.jsp Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,36 @@ +<%@ page language="java" %> +<%! +// create DocumentBean instance for all JSP requests +digilib.servlet.DocumentBean docBean = new digilib.servlet.DocumentBean(); + +// initialize DocumentBean instance in JSP init +public void jspInit() { + try { + // set servlet init-parameter + docBean.setConfig(getServletConfig()); + } catch (javax.servlet.ServletException e) { + System.out.println(e); + } +} +%><% +// parsing the query +digilib.servlet.DigilibRequest dlRequest = new digilib.servlet.DigilibRequest(request); +docBean.setRequest(dlRequest); +%> +// JSON format metadata about request and image +{ +<% + Object[] keys = dlRequest.getParams().keySet().toArray(); + java.util.Arrays.sort(keys); + int l = keys.length; + for (int i = 0; i < l; i++) { + String key = (String) keys[i]; + String val = dlRequest.getAsString(key); + if (val.length() == 0) { + val = ""; + } + %>"<%= key %>" : "<%= val %>", +<% + } +%> +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/dlGeometry.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,486 @@ +/* digilib geometry classes + * should be integrated into jquery.digilib.js + */ + +var dlGeometry = function() { + /* + * Size class + */ + var size = function(w, h) { + var that; + if (typeof w === "object") { + // assume its size + that = { + width : w.width, + height : w.height + }; + } else { + that = { + width : parseFloat(w), + height : parseFloat(h) + }; + } + that.equals = function(other) { + return (this.width === other.width && this.height === other.height); + }; + that.toString = function() { + return (this.width + "x" + this.height); + }; + return that; + }; + + /* + * Position class + */ + var position = function(x, y) { + var that; + if (typeof x === "object") { + if (x instanceof jQuery) { + // jQuery object + var pos = x.offset(); + that = { + x : pos.left, + y : pos.top + }; + } else { + if (x.x != null) { + // position object + that = { + x : x.x, + y : x.y + }; + } + if (x.pageX != null) { + // event object + that = { + x : x.pageX, + y : x.pageY + }; + } + } + } else { + that = { + x : parseFloat(x), + y : parseFloat(y) + }; + } + that.equals = function(other) { + return (this.x === other.x && this.y === other.y); + }; + // add position other to this + that.add = function(other) { + this.x += other.x; + this.y += other.y; + return this; + }; + // returns negative position + that.neg = function() { + return position({ + x : -this.x, + y : -this.y + }); + }; + // returns new position that is the difference between this and other + that.delta = function(other) { + return position({ + x : other.x - this.x, + y : other.y - this.y + }); + }; + // adjusts position $elem to this position + that.adjustDiv = function($elem) { + $elem.offset({ + left : this.x, + top : this.y + }); + }; + // returns distance of this position to pos (length if pos == null) + that.distance = function(pos) { + if (pos == null) { + pos = { + x : 0, + y : 0 + }; + } + var dx = pos.x - this.x; + var dy = pos.y - this.y; + return Math.sqrt(dx * dx + dy * dy); + }; + that.toString = function() { + return (this.x + "," + this.y); + }; + return that; + }; + /* + * Rectangle class + */ + var rectangle = function(x, y, w, h) { + var that = {}; + if (typeof x === "object") { + if (x instanceof jQuery) { + // jQuery object + var pos = x.offset(); + that = { + x : pos.left, + y : pos.top, + width : x.width(), + height : x.height() + }; + } else if (y == null) { + // assume x is rectangle + that = { + x : x.x, + y : x.y, + width : x.width, + height : x.height + }; + } else { + // assume x and y are Position + that = { + x : Math.min(x.x, y.x), + y : Math.min(x.y, y.y), + width : Math.abs(y.x - x.x), + height : Math.abs(y.y - x.y) + }; + } + } else { + that = { + x : parseFloat(x), + y : parseFloat(y), + width : parseFloat(w), + height : parseFloat(h) + }; + } + // returns a copy of this Rectangle + that.copy = function() { + return rectangle(this); + }; + // returns the position of this Rectangle + that.getPosition = function() { + return position(this); + }; + // returns the size of this Rectangle + that.getSize = function() { + return size(this); + }; + // returns the upper left corner position + that.getPt1 = that.getPosition; + // returns the lower right corner position of this Rectangle + that.getPt2 = function() { + return position({ + x : this.x + this.width, + y : this.y + this.height + }); + }; + // sets the upper left corner position to pos + that.setPosition = function(pos) { + this.x = pos.x; + this.y = pos.y; + return this; + }; + that.setPt1 = that.setPosition; // TODO: not really the same + // adds pos to the position + that.addPosition = function(pos) { + this.x += pos.x; + this.y += pos.y; + return this; + }; + // sets the lower right corner to position pos + that.setPt2 = function(pos) { + this.width = pos.x - this.x; + this.height = pos.y - this.y; + return this; + }; + // returns the center position of this Rectangle + that.getCenter = function() { + return position({ + x : this.x + this.width / 2, + y : this.y + this.height / 2 + }); + }; + // moves this Rectangle's center to position pos + that.setCenter = function(pos) { + this.x = pos.x - this.width / 2; + this.y = pos.y - this.height / 2; + return this; + }; + that.equals = function(other) { + // equal props + var eq = (this.x === other.x && this.y === other.y && this.width === other.width); + return eq; + }; + // returns the area of this Rectangle + that.getArea = function() { + return (this.width * this.height); + }; + // eliminates negative width and height + that.normalize = function() { + var p = this.getPt2(); + this.x = Math.min(this.x, p.x); + this.y = Math.min(this.y, p.y); + this.width = Math.abs(this.width); + this.height = Math.abs(this.height); + return this; + }; + // returns if Position "pos" lies inside of this rectangle + that.containsPosition = function(pos) { + var ct = ((pos.x >= this.x) && (pos.y >= this.y) + && (pos.x <= this.x + this.width) && (pos.y <= this.y + + this.height)); + return ct; + }; + // returns if rectangle "rect" is contained in this rectangle + that.containsRect = function(rect) { + return (this.containsPosition(rect.getPt1()) && this + .containsPosition(rect.getPt2())); + }; + // changes this rectangle's x/y values so it stays inside of rectangle + // rect + // keeping the proportions + that.stayInside = function(rect) { + if (this.x < rect.x) { + this.x = rect.x; + } + if (this.y < rect.y) { + this.y = rect.y; + } + if (this.x + this.width > rect.x + rect.width) { + this.x = rect.x + rect.width - this.width; + } + if (this.y + this.height > rect.y + rect.height) { + this.y = rect.y + rect.height - this.height; + } + return this; + }; + // clips this rectangle so it stays inside of rectangle rect + that.clipTo = function(rect) { + var p1 = rect.getPt1(); + var p2 = rect.getPt2(); + var this2 = this.getPt2(); + this.setPosition(position(Math.max(this.x, p1.x), Math.max(this.y, p1.y))); + this.setPt2(position(Math.min(this2.x, p2.x), Math.min(this2.y, p2.y))); + return this; + }; + // returns the intersection of the given Rectangle and this one + that.intersect = function(rect) { + // FIX ME: not really, it should return null if there is no overlap + var sec = rect.copy(); + if (sec.x < this.x) { + sec.width = sec.width - (this.x - sec.x); + sec.x = this.x; + } + if (sec.y < this.y) { + sec.height = sec.height - (this.y - sec.y); + sec.y = this.y; + } + if (sec.x + sec.width > this.x + this.width) { + sec.width = (this.x + this.width) - sec.x; + } + if (sec.y + sec.height > this.y + this.height) { + sec.height = (this.y + this.height) - sec.y; + } + return sec; + }; + // returns a Rectangle that fits into this one (by moving first) + that.fit = function(rect) { + var sec = rect.copy(); + sec.x = Math.max(sec.x, this.x); + sec.y = Math.max(sec.y, this.x); + if (sec.x + sec.width > this.x + this.width) { + sec.x = this.x + this.width - sec.width; + } + if (sec.y + sec.height > this.y + this.height) { + sec.y = this.y + this.height - sec.height; + } + return sec.intersect(this); + }; + // adjusts position and size of $elem to this rectangle + that.adjustDiv = function($elem) { + $elem.offset({ + left : this.x, + top : this.y + }); + $elem.width(this.width).height(this.height); + }; + // returns size and position in css-compatible format + that.getAsCss = function() { + return { + left : this.x, + top : this.y, + width : this.width, + height : this.height + }; + }; + that.toString = function() { + return this.width + "x" + this.height + "@" + this.x + "," + this.y; + }; + return that; + }; + + /* + * Transform class + * + * defines a class of affine transformations + */ + var transform = function(spec) { + var that = { + m00 : 1.0, + m01 : 0.0, + m02 : 0.0, + m10 : 0.0, + m11 : 1.0, + m12 : 0.0, + m20 : 0.0, + m21 : 0.0, + m22 : 1.0 + }; + if (spec) { + jQuery.extend(that, spec); + } + ; + that.concat = function(trafA) { + // add Transform trafA to this Transform (i.e. this = trafC = trafA + // * this) + var trafC = {}; + for ( var i = 0; i < 3; i++) { + for ( var j = 0; j < 3; j++) { + var c = 0.0; + for ( var k = 0; k < 3; k++) { + c += trafA["m" + i + k] * this["m" + k + j]; + } + trafC["m" + i + j] = c; + } + } + jQuery.extend(this, trafC); + return this; + }; + that.transform = function(rect) { + // returns transformed Rectangle or Position with this Transform + // applied + var x = this.m00 * rect.x + this.m01 * rect.y + this.m02; + var y = this.m10 * rect.x + this.m11 * rect.y + this.m12; + var pt = position(x, y); + if (rect.width) { + // transform the other corner point + var pt2 = this.transform(rect.getPt2()); + return rectangle(pt, pt2); + } + return pt; + }; + that.invtransform = function(rect) { + // returns transformed Rectangle or Position with the inverse of + // this Transform applied + var det = this.m00 * this.m11 - this.m01 * this.m10; + var x = (this.m11 * rect.x - this.m01 * rect.y - this.m11 + * this.m02 + this.m01 * this.m12) + / det; + var y = (-this.m10 * rect.x + this.m00 * rect.y + this.m10 + * this.m02 - this.m00 * this.m12) + / det; + var pt = position(x, y); + if (rect.width) { + // transform the other corner point + var pt2 = this.invtransform(rect.getPt2()); + return rectangle(pt, pt2); + } + return pt; + }; + that.toString = function(pretty) { + var s = '['; + if (pretty) + s += '\n'; + for ( var i = 0; i < 3; ++i) { + s += '['; + for ( var j = 0; j < 3; ++j) { + if (j) + s += ','; + s += this['m' + i + j]; + } + s += ']'; + if (pretty) + s += '\n'; + } + s += ']'; + if (pretty) + s += '\n'; + return s; + }; + // add class methods to instance + that.getRotation = transform.getRotation; + that.getRotationAround = transform.getRotationAround; + that.getTranslation = transform.getTranslation; + that.getMirror = transform.getMirror; + that.getScale = transform.getScale; + + return that; + }; + + transform.getRotation = function(angle) { + // returns a Transform that is a rotation by angle degrees around [0,0] + if (angle !== 0) { + var t = Math.PI * parseFloat(angle) / 180.0; + var cost = Math.cos(t); + var sint = Math.sin(t); + var traf = { + m00 : cost, + m01 : -sint, + m10 : sint, + m11 : cost + }; + return transform(traf); + } + return transform(); + }; + + transform.getRotationAround = function(angle, pos) { + // returns a Transform that is a rotation by angle degrees around pos + var traf = transform.getTranslation(pos.neg()); + traf.concat(transform.getRotation(angle)); + traf.concat(transform.getTranslation(pos)); + return traf; + }; + + transform.getTranslation = function(pos) { + // returns a Transform that is a translation by [pos.x, pos,y] + var traf = { + m02 : pos.x, + m12 : pos.y + }; + return transform(traf); + }; + + transform.getMirror = function(type) { + // returns a Transform that is a mirror about the axis type + if (type === 'x') { + var traf = { + m00 : 1, + m11 : -1 + }; + } else { + var traf = { + m00 : -1, + m11 : 1 + }; + } + return transform(traf); + }; + + transform.getScale = function(size) { + // returns a Transform that is a scale by [size.width, size.height] + var traf = { + m00 : size.width, + m11 : size.height + }; + return transform(traf); + }; + + // export functions + var that = { + size : size, + position : position, + rectangle : rectangle, + transform : transform + }; + + return that; +};
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/img/embedded.svg Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,966 @@ +<?xml version="1.0" encoding="UTF-8" standalone="no"?> +<!-- Created with Inkscape (http://www.inkscape.org/) --> + +<svg + xmlns:dc="http://purl.org/dc/elements/1.1/" + xmlns:cc="http://creativecommons.org/ns#" + xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" + xmlns:svg="http://www.w3.org/2000/svg" + xmlns="http://www.w3.org/2000/svg" + xmlns:xlink="http://www.w3.org/1999/xlink" + xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" + xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" + width="32" + height="32" + id="svg2" + version="1.1" + inkscape:version="0.48+devel r10012" + sodipodi:docname="embedded.svg" + style="display:inline"> + <defs + id="defs4"> + <linearGradient + id="linearGradient788"> + <stop + style="stop-color:#aa0000;stop-opacity:1;" + offset="0" + id="stop790" /> + <stop + style="stop-color:#560000;stop-opacity:1;" + offset="1" + id="stop792" /> + </linearGradient> + <linearGradient + inkscape:collect="always" + xlink:href="#linearGradient788" + id="linearGradient794" + x1="13.169864" + y1="12.024234" + x2="26.958447" + y2="27.138639" + gradientUnits="userSpaceOnUse" /> + </defs> + <sodipodi:namedview + id="base" + pagecolor="#ffffff" + bordercolor="#666666" + borderopacity="1.0" + inkscape:pageopacity="0.0" + inkscape:pageshadow="2" + inkscape:zoom="16.533016" + inkscape:cx="15.816836" + inkscape:cy="16.69448" + inkscape:document-units="px" + inkscape:current-layer="layer1" + showgrid="true" + inkscape:window-width="1024" + inkscape:window-height="719" + inkscape:window-x="1020" + inkscape:window-y="-4" + inkscape:window-maximized="1" + inkscape:snap-nodes="false" + inkscape:snap-bbox="false" + inkscape:snap-global="true"> + <inkscape:grid + empspacing="5" + visible="true" + enabled="true" + snapvisiblegridlinesonly="true" + type="xygrid" + id="grid891" /> + </sodipodi:namedview> + <metadata + id="metadata7"> + <rdf:RDF> + <cc:Work + rdf:about=""> + <dc:format>image/svg+xml</dc:format> + <dc:type + rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> + <dc:title /> + </cc:Work> + </rdf:RDF> + </metadata> + <g + inkscape:label="bg" + inkscape:groupmode="layer" + id="layer1" + transform="translate(0,-1020.3622)" + style="display:inline" + sodipodi:insensitive="true" /> + <g + inkscape:groupmode="layer" + id="layer2" + inkscape:label="back" + style="display:none" + sodipodi:insensitive="true"> + <path + id="path913" + d="M 27.047707,2.0090135 27.007792,15.939515 26.967877,29.870017 14.913402,22.844893 2.8988431,15.859684 14.993233,8.9543067 27.047707,2.0090135 z m -2.594506,4.4705336 -8.182673,4.7100269 -8.2225882,4.67011 8.1826732,4.789858 8.182673,4.749942 0.03992,-9.459969 0,-9.4599679 z" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer3" + inkscape:label="fwd" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="M 5.144847,2.0090135 5.184936,16 5.225025,29.990987 17.331838,22.935361 29.398564,15.919823 17.251661,8.9844625 5.144847,2.0090135 z m 2.605771,4.4899442 8.218202,4.7304773 8.25829,4.690388 -8.218202,4.810654 L 7.790707,25.501043 7.750618,16 l 0,-9.5010423 z" + id="path139" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer4" + inkscape:label="birds-eye" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 8.0195218,9.4025604 c -2.868989,0.09575 -2.729553,1.2399626 -6.1052839,0.3052646 2.9345127,5.081608 10.4072341,-2.483952 13.6496701,7.631605 0.134913,0.420759 0.316439,0.553536 0.479701,0.436092 0.149752,0.07011 0.269484,-0.05233 0.392483,-0.436092 C 19.678526,7.223873 27.151248,14.789433 30.085762,9.707825 25.584788,10.954081 27.330095,8.5262259 19.837607,9.7514298 17.727437,10.0965 16.646344,11.369319 16.043609,12.760462 15.443243,11.361913 14.28161,10.097977 12.162393,9.7514298 10.289271,9.4451425 8.9758507,9.3706455 8.0195218,9.4025604 z" + id="rect914" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 4.96875,0.90625 0,6.71875 2,0 0,-4.59375 17.84375,0 0,4.59375 2.09375,0 0,-6.71875 -21.9375,0 z m 0,13.375 0,16.6875 21.9375,0 0,-16.6875 -2.09375,0 0,14.625 -17.84375,0 0,-14.625 -2,0 z" + id="rect941" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer6" + inkscape:label="brightness" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="M 16.09375,6.8125 C 11.074025,6.8125 7,10.886525 7,15.90625 7,20.925975 11.074025,25 16.09375,25 c 5.019725,0 9.09375,-4.074025 9.09375,-9.09375 0,-5.019725 -4.074025,-9.09375 -9.09375,-9.09375 z M 16,9 c 3.865993,0 7,3.134007 7,7 0,3.865993 -3.134007,7 -7,7 -3.865993,0 -7,-3.134007 -7,-7 0,-3.865993 3.134007,-7 7,-7 z" + id="path876" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 15,1.40625 0,7.6875 C 15.328121,9.0465852 15.658826,9 16,9 c 0.406896,0 0.799622,0.058366 1.1875,0.125 l 0,-7.71875 -2.1875,0 z M 17.1875,22.875 C 16.799622,22.941634 16.406896,23 16,23 15.658826,23 15.328121,22.95341 15,22.90625 l 0,7.84375 2.1875,0 0,-7.875 z" + id="rect878" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 1.40625,15 0,2.1875 7.71875,0 C 9.0583662,16.799622 9,16.406896 9,16 9,15.658826 9.0465852,15.328121 9.09375,15 l -7.6875,0 z m 21.5,0 C 22.953415,15.328121 23,15.658826 23,16 c 0,0.406896 -0.05837,0.799622 -0.125,1.1875 l 7.875,0 0,-2.1875 -7.84375,0 z" + id="rect880" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="M 6.5,4.9375 4.9375,6.5 l 5.40625,5.40625 c 0.431996,-0.593548 0.968952,-1.130504 1.5625,-1.5625 L 6.5,4.9375 z M 21.65625,20.125 c -0.429134,0.585228 -0.975687,1.104157 -1.5625,1.53125 L 25.6875,27.25 27.21875,25.6875 21.65625,20.125 z" + id="rect919" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 25.6875,4.9375 -5.46875,5.46875 C 20.801807,10.848406 21.330141,11.39966 21.75,12 L 27.25,6.5 25.6875,4.9375 z M 10.40625,20.21875 4.9375,25.6875 6.5,27.25 12,21.75 c -0.60034,-0.419859 -1.151594,-0.948193 -1.59375,-1.53125 z" + id="rect921" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer7" + inkscape:label="calibration-x" + style="display:none" + sodipodi:insensitive="true"> + <g + transform="matrix(-1.1475732,0,0,-1.1217078,34.475262,33.555864)" + style="display:inline" + id="g134-1-8"> + <rect + transform="matrix(-0.99998722,0.00505534,0.0025573,0.99999673,0,0)" + y="10.020195" + x="-28.974745" + height="11.116359" + width="1.9766066" + id="rect895-7-8-7-8" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(-0.99999354,0.00359556,0.00359556,0.99999354,0,0)" + y="13.062714" + x="-22.93886" + height="3.9713874" + width="1.9856937" + id="rect897-4-2-4-2" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(-0.99998713,0.00507297,0.0025484,0.99999675,0,0)" + y="9.9487858" + x="-16.946508" + height="11.12725" + width="1.9716681" + id="rect899-0-4-0-4" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(-0.99999354,0.00359556,0.00359556,0.99999354,0,0)" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect905-9-5-9-5" + width="1.9857715" + height="3.9715431" + x="-10.938862" + y="13.062556" /> + <rect + transform="matrix(-0.99998745,0.00501028,0.0025803,0.99999667,0,0)" + y="10.024814" + x="-4.9459147" + height="10.990158" + width="1.9717447" + id="rect907-4-5-4-5" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + </g> + <g + inkscape:groupmode="layer" + id="layer8" + inkscape:label="calibration-y" + style="display:none" + sodipodi:insensitive="true"> + <g + transform="matrix(0,1.152586,-1.1944557,0,34.956357,-2.4577577)" + style="display:inline" + id="g134-1"> + <rect + transform="matrix(-0.99998722,0.00505534,0.0025573,0.99999673,0,0)" + y="10.020195" + x="-28.974745" + height="11.116359" + width="1.9766066" + id="rect895-7-8-7" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(-0.99999354,0.00359556,0.00359556,0.99999354,0,0)" + y="13.062714" + x="-22.93886" + height="3.9713874" + width="1.9856937" + id="rect897-4-2-4" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(-0.99998713,0.00507297,0.0025484,0.99999675,0,0)" + y="9.9487858" + x="-16.946508" + height="11.12725" + width="1.9716681" + id="rect899-0-4-0" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(-0.99999354,0.00359556,0.00359556,0.99999354,0,0)" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect905-9-5-9" + width="1.9857715" + height="3.9715431" + x="-10.938862" + y="13.062556" /> + <rect + transform="matrix(-0.99998745,0.00501028,0.0025803,0.99999667,0,0)" + y="10.024814" + x="-4.9459147" + height="10.990158" + width="1.9717447" + id="rect907-4-5-4" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + </g> + <g + inkscape:groupmode="layer" + id="layer9" + inkscape:label="cat" + style="display:none" + sodipodi:insensitive="true"> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1000" + width="8" + height="11" + x="2" + y="4" /> + <rect + y="4" + x="12" + height="11" + width="8" + id="rect207" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect209" + width="8" + height="11" + x="22" + y="4" /> + <rect + y="17" + x="2" + height="11" + width="8" + id="rect213" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect215" + width="8" + height="11" + x="12" + y="17" /> + <rect + y="17" + x="22" + height="11" + width="8" + id="rect217" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + <g + inkscape:groupmode="layer" + id="layer10" + inkscape:label="contrast" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="M 13.40625,3.28125 C 7.4823693,4.4934515 3,9.7177604 3,16 3,22.28224 7.4823693,27.506548 13.40625,28.71875 l 0,-25.4375 z m 5.1875,0 0,25.4375 C 24.51763,27.506548 29,22.28224 29,16 29,9.7177604 24.51763,4.4934515 18.59375,3.28125 z m -7.125,3.125 0,19.125 c -3.7414989,-1.915747 -6.25,-5.456732 -6.25,-9.5625 0,-4.105769 2.5085011,-7.6467526 6.25,-9.5625 z" + id="path1016" + inkscape:connector-curvature="0" /> + </g> + <g + style="display:none" + inkscape:label="mark" + id="g1030" + inkscape:groupmode="layer" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 3.2,2 0,28 25.8875,0 0,-28 L 3.2,2 z m 6.8125,4.2 8.175,0 0,1.4 0,16.8 6.8125,0 0,1.4 -17.7125,0 0,-1.4 6.8125,0 0,-16.8 -4.0875,0 0,-1.4 z" + id="rect947" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="g960" + inkscape:label="delmark" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 3.1092104,2.0000001 0,28.0000009 25.8907896,0 0,-28.0000009 -25.8907896,0 z m 6.8133655,4.2000002 8.1760391,0 0,1.4 0,2.6250007 3.747352,-3.8500008 2.89568,2.9750003 -6.643032,6.8249995 0,8.225001 6.813366,0 0,1.399999 -17.714751,0 0,-1.399999 6.813366,0 0,-4.025001 -3.747352,3.850002 L 7.3675641,21.25 l 6.6430319,-6.825001 0,-6.8249987 -4.0880201,0 0,-1.4 z" + id="path962" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer12" + inkscape:label="help" + style="display:none" + sodipodi:insensitive="true"> + <text + xml:space="preserve" + style="font-size:41.39486694px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#ffffff;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans" + x="3.4375441" + y="32.943199" + id="text935" + sodipodi:linespacing="125%" + transform="scale(1.1102234,0.90071962)"><tspan + sodipodi:role="line" + id="tspan937" + x="3.4375441" + y="32.943199">?</tspan></text> + </g> + <g + inkscape:groupmode="layer" + id="layer13" + inkscape:label="options" + style="display:none" + sodipodi:insensitive="true"> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect968" + width="5" + height="5" + x="4" + y="14.000001" /> + <rect + y="14.000001" + x="13.000001" + height="5" + width="5" + id="rect970" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect972" + width="5" + height="5" + x="22.000002" + y="14.000001" /> + </g> + <g + inkscape:groupmode="layer" + id="layer14" + inkscape:label="original-size" + style="display:none" + sodipodi:insensitive="true"> + <text + xml:space="preserve" + style="font-size:17.97092056px;font-style:normal;font-weight:bold;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#ffffff;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans;-inkscape-font-specification:Bitstream Vera Sans Bold" + x="-0.9710269" + y="23.421276" + id="text975" + sodipodi:linespacing="125%" + transform="scale(1.0298376,0.97102688)"><tspan + sodipodi:role="line" + id="tspan977" + x="-0.9710269" + y="23.421276">1:1</tspan></text> + </g> + <g + inkscape:groupmode="layer" + id="layer15" + inkscape:label="page" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 5,1 0,30 22,0 0,-19.03125 -9.53125,0 -1.375,0 L 16.09375,1 5,1 z m 12.46875,0.84375 0,8.75 8.8125,0 -8.8125,-8.75 z M 7,3 l 7,0 0,11 11,0 0,15 -11,0 -1,0 -6,0 0,-26 z" + id="rect982" + inkscape:connector-curvature="0" /> + <path + inkscape:connector-curvature="0" + id="path918" + d="m 5,1 0,30 22,0 0,-19.03125 -9.53125,0 -1.375,0 L 16.09375,1 5,1 z m 12.46875,0.84375 0,8.75 8.8125,0 -8.8125,-8.75 z M 7,3 l 7,0 0,11 11,0 0,15 -11,0 -1,0 -6,0 0,-26 z" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + <g + inkscape:groupmode="layer" + id="layer16" + inkscape:label="pagewidth" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="M 5,1 5,31 27,31 27,1 5,1 z M 7,3 25,3 25,29 7,29 7,3 z" + id="rect956" + inkscape:connector-curvature="0" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect961" + width="10.217689" + height="2" + x="11.088731" + y="10" /> + <path + sodipodi:type="star" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="path967" + sodipodi:sides="3" + sodipodi:cx="11" + sodipodi:cy="11" + sodipodi:r1="3" + sodipodi:r2="1.4999999" + sodipodi:arg1="3.1415927" + sodipodi:arg2="4.1887902" + inkscape:flatsided="false" + inkscape:rounded="0" + inkscape:randomized="0" + d="M 8,11 10.25,9.700962 12.5,8.4019239 12.5,11 l 0,2.598076 -2.25,-1.299038 z" + inkscape:transform-center-x="0.75" /> + <path + inkscape:transform-center-x="-0.74999988" + d="M 8,11 10.25,9.700962 12.5,8.4019239 12.5,11 l 0,2.598076 -2.25,-1.299038 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="4.1887902" + sodipodi:arg1="3.1415927" + sodipodi:r2="1.4999999" + sodipodi:r1="3" + sodipodi:cy="11" + sodipodi:cx="11" + sodipodi:sides="3" + id="path971" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" + transform="matrix(-1,0,0,1,31.89515,0)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer17" + inkscape:label="pixel-by-pixel" + style="display:none" + sodipodi:insensitive="true"> + <text + xml:space="preserve" + style="font-size:17.12094688px;font-style:normal;font-weight:bold;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#ffffff;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans;-inkscape-font-specification:Bitstream Vera Sans Bold" + x="0.95822293" + y="22.596033" + id="text1041" + sodipodi:linespacing="125%" + transform="scale(1.0435985,0.95822291)"><tspan + sodipodi:role="line" + id="tspan1043" + x="0.95822293" + y="22.596033">x:x</tspan></text> + </g> + <g + inkscape:groupmode="layer" + id="layer18" + inkscape:label="quality" + style="display:none" + sodipodi:insensitive="true"> + <text + xml:space="preserve" + style="font-size:27.2751503px;font-style:normal;font-weight:bold;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#ffffff;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans;-inkscape-font-specification:Bitstream Vera Sans Bold" + x="3.8965476" + y="25.107218" + id="text1046" + sodipodi:linespacing="125%" + transform="scale(1.0265498,0.97413686)"><tspan + sodipodi:role="line" + id="tspan1048" + x="3.8965476" + y="25.107218">Q</tspan></text> + </g> + <g + inkscape:groupmode="layer" + id="layer19" + inkscape:label="reference" + style="display:none" + sodipodi:insensitive="true"> + <text + xml:space="preserve" + style="font-size:16.48912811px;font-style:normal;font-weight:bold;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#ffffff;fill-opacity:1;stroke:none;font-family:Bitstream Vera Sans;-inkscape-font-specification:Bitstream Vera Sans Bold" + x="2.6207335e-015" + y="23.032148" + id="text1051" + sodipodi:linespacing="125%" + transform="scale(1.0147782,0.98543702)"><tspan + sodipodi:role="line" + id="tspan1053" + x="2.6207335e-015" + y="23.032148">url:</tspan></text> + </g> + <g + inkscape:groupmode="layer" + id="layer20" + inkscape:label="reset" + style="display:none" + sodipodi:insensitive="true"> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect143" + width="27.823114" + height="4.9597726" + x="8.485281" + y="-2.8284271" + transform="matrix(0.70710678,0.70710678,-0.70710678,0.70710678,0,0)" /> + <rect + transform="matrix(-0.70710678,0.70710678,-0.70710678,-0.70710678,0,0)" + y="-24.876724" + x="-14.260098" + height="4.9597726" + width="27.823114" + id="rect145" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + <g + inkscape:groupmode="layer" + id="layer21" + inkscape:label="rgb" + style="display:none" + sodipodi:insensitive="true"> + <rect + style="color:#000000;fill:#ff0000;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1084" + width="10.999999" + height="11" + x="11" + y="2" /> + <rect + y="16" + x="4" + height="11" + width="10.999999" + id="rect1086" + style="color:#000000;fill:#00ff00;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + style="color:#000000;fill:#0000ff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1088" + width="11" + height="11" + x="18" + y="16" /> + </g> + <g + style="display:none" + inkscape:label="rotate" + id="g1090" + inkscape:groupmode="layer" + sodipodi:insensitive="true"> + <path + inkscape:connector-curvature="0" + id="path1092" + d="m 15.684921,4.3978351 c -6.3617718,0 -11.5059878,5.1442165 -11.5059878,11.5059889 0,6.36177 5.144216,11.542057 11.5059878,11.542057 0.04802,0 0.0964,5.89e-4 0.144281,0 l 0,-2.380549 c -0.07124,0.0016 -0.144789,0 -0.216413,0 -4.973749,0 -9.0172321,-4.043484 -9.0172321,-9.017234 0,-4.973748 4.0434831,-9.0172311 9.0172321,-9.0172311 2.486875,0 4.75161,1.0004431 6.3842,2.6330311 L 23.872574,7.7883149 C 21.788528,5.6857583 18.884216,4.3978351 15.684927,4.3978351 z" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <path + transform="matrix(-1.4945171,0,0,1.4945171,36.11648,-0.39278602)" + inkscape:transform-center-y="-0.41195904" + inkscape:transform-center-x="-0.41195904" + d="M 5.6120683,9.3311528 6.3256024,6.6682079 7.0391363,4.0052628 8.9885471,5.9546739 10.937958,7.9040849 8.2750133,8.6176187 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="3.403392" + sodipodi:arg1="2.3561945" + sodipodi:r2="1.5916873" + sodipodi:r1="3.1833749" + sodipodi:cy="7.0801668" + sodipodi:cx="7.8630543" + sodipodi:sides="3" + id="path1094" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" /> + </g> + <g + inkscape:groupmode="layer" + id="layer22" + inkscape:label="size" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="star" + style="color:#000000;fill:#f6f6f6;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="path1104" + sodipodi:sides="3" + sodipodi:cx="1.0887306" + sodipodi:cy="16.031952" + sodipodi:r1="5.9929037" + sodipodi:r2="2.9964516" + sodipodi:arg1="-3.1415927" + sodipodi:arg2="-2.0943951" + inkscape:flatsided="false" + inkscape:rounded="0" + inkscape:randomized="0" + d="m -4.9041731,16.031952 4.49467787,-2.595003 4.49467743,-2.595004 0,5.190007 5e-7,5.190007 -4.49467794,-2.595004 z" + inkscape:transform-center-x="1.2023113" + transform="matrix(0.80248992,0,0,0.80248992,4.7046891,3.1977231)" /> + <path + transform="matrix(-0.80248992,0,0,0.80248992,27.123251,2.9332441)" + inkscape:transform-center-x="-1.2023108" + d="m -4.9041731,16.031952 4.49467787,-2.595003 4.49467743,-2.595004 0,5.190007 5e-7,5.190007 -4.49467794,-2.595004 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="-2.0943951" + sodipodi:arg1="-3.1415927" + sodipodi:r2="2.9964516" + sodipodi:r1="5.9929037" + sodipodi:cy="16.031952" + sodipodi:cx="1.0887306" + sodipodi:sides="3" + id="path1108" + style="color:#000000;fill:#f6f6f6;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" /> + <g + id="g1114" + transform="matrix(0,1.093159,-1.093159,0,33.329046,-1.465536)"> + <path + inkscape:transform-center-x="1.0998503" + sodipodi:type="star" + style="color:#000000;fill:#f6f6f6;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="path1110" + sodipodi:sides="3" + sodipodi:cx="1.0887306" + sodipodi:cy="16.031952" + sodipodi:r1="5.9929037" + sodipodi:r2="2.9964516" + sodipodi:arg1="-3.1415927" + sodipodi:arg2="-2.0943951" + inkscape:flatsided="false" + inkscape:rounded="0" + inkscape:randomized="0" + d="m -4.9041731,16.031952 4.49467787,-2.595003 4.49467743,-2.595004 0,5.190007 5e-7,5.190007 -4.49467794,-2.595004 z" + transform="matrix(0.73410176,0,0,0.73410176,5.6599436,4.2828493)" /> + <path + inkscape:transform-center-x="-1.0998503" + transform="matrix(-0.73410176,0,0,0.73410176,26.167997,4.0409092)" + d="m -4.9041731,16.031952 4.49467787,-2.595003 4.49467743,-2.595004 0,5.190007 5e-7,5.190007 -4.49467794,-2.595004 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="-2.0943951" + sodipodi:arg1="-3.1415927" + sodipodi:r2="2.9964516" + sodipodi:r1="5.9929037" + sodipodi:cy="16.031952" + sodipodi:cx="1.0887306" + sodipodi:sides="3" + id="path1112" + style="color:#000000;fill:#f6f6f6;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" /> + </g> + </g> + <g + inkscape:groupmode="layer" + id="layer23" + inkscape:label="zoom-in" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 17.748648,1.3382448 c -7.250407,0 -13.1159091,5.8655027 -13.1159091,13.1159112 0,7.250406 5.8655021,13.115909 13.1159091,13.115909 7.250407,0 13.11591,-5.865503 13.11591,-13.115909 0,-7.2504085 -5.865503,-13.1159112 -13.11591,-13.1159112 z M 17.58521,4.3209906 c 5.590676,0 10.133163,4.5424881 10.133163,10.1331654 0,5.590675 -4.542487,10.133163 -10.133163,10.133163 -5.590675,0 -10.1331634,-4.542488 -10.1331634,-10.133163 0,-5.5906773 4.5424884,-10.1331654 10.1331634,-10.1331654 z" + id="path1151" + inkscape:connector-curvature="0" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1156" + width="8.2247858" + height="4.0333085" + x="-18.871775" + y="20.726204" + transform="matrix(0.70710678,-0.70710678,0.70710678,0.70710678,0,0)" + inkscape:transform-center-x="2.8470402" + inkscape:transform-center-y="1.7398583" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1164" + width="13.075049" + height="4.9134407" + x="11.170264" + y="12.038293" /> + <rect + y="-20.164509" + x="7.9574871" + height="4.9134407" + width="13.075049" + id="rect1174" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + transform="matrix(0,1,-1,0,0,0)" /> + </g> + <g + style="display:none" + inkscape:label="zoom-out" + id="g1166" + inkscape:groupmode="layer" + sodipodi:insensitive="true"> + <path + id="path1168" + d="m 17.821044,1.1451167 c -7.298426,0 -13.2027765,5.9043503 -13.2027765,13.2027763 0,7.298427 5.9043505,13.202777 13.2027765,13.202777 7.298426,0 13.202777,-5.90435 13.202777,-13.202777 0,-7.298426 -5.904351,-13.2027763 -13.202777,-13.2027763 z m -0.164521,3.0025006 c 5.627703,0 10.200276,4.5725733 10.200276,10.2002757 0,5.627704 -4.572573,10.200277 -10.200276,10.200277 -5.627703,0 -10.2002753,-4.572573 -10.2002753,-10.200277 0,-5.6277024 4.5725723,-10.2002757 10.2002753,-10.2002757 z" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + inkscape:connector-curvature="0" /> + <rect + inkscape:transform-center-y="1.7513804" + inkscape:transform-center-x="2.8658974" + transform="matrix(0.70710678,-0.70710678,0.70710678,0.70710678,0,0)" + y="20.688717" + x="-18.885862" + height="4.0600214" + width="8.2792606" + id="rect1170" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + y="12.105096" + x="11.19909" + height="4.5678501" + width="13.161647" + id="rect1172" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + <g + inkscape:groupmode="layer" + id="layer24" + inkscape:label="zoom-full" + style="display:none" + sodipodi:insensitive="true"> + <path + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 17.711691,1.3083981 c -7.224276,0 -13.0686399,5.8443637 -13.0686399,13.0686399 0,7.224277 5.8443639,13.068641 13.0686399,13.068641 7.224277,0 13.068641,-5.844364 13.068641,-13.068641 0,-7.2242762 -5.844364,-13.0686399 -13.068641,-13.0686399 z m -0.162849,2.9719961 c 1.56671,0 3.032191,0.3792196 4.356214,1.0178068 l 2.279887,0 0,1.5063542 c 2.115514,1.8516034 3.460543,4.5444668 3.460543,7.5724828 0,3.028016 -1.345029,5.72088 -3.460543,7.572483 l 0,1.587779 -2.442736,0 c -1.282102,0.590107 -2.691039,0.936382 -4.193365,0.936382 -1.502326,0 -2.911262,-0.346275 -4.193364,-0.936382 l -2.198463,0 0,-1.343505 C 8.8875148,20.341368 7.452198,17.530661 7.452198,14.377038 c 0,-3.153622 1.4353168,-5.9643297 3.704817,-7.8167564 l 0,-1.2620806 2.035614,0 c 1.324023,-0.6385872 2.789502,-1.0178068 4.356213,-1.0178068 z" + id="path1168-7" + inkscape:connector-curvature="0" /> + <rect + inkscape:transform-center-y="1.7335882" + inkscape:transform-center-x="2.8367804" + transform="matrix(0.70710678,-0.70710678,0.70710678,0.70710678,0,0)" + y="20.65291" + x="-18.76697" + height="4.0187726" + width="8.1951447" + id="rect1170-4" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1198" + width="1.3027928" + height="15.633513" + x="9.8542233" + y="6.6009941" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1200" + width="1.3027928" + height="15.633513" + x="24.184944" + y="6.6009941" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1202" + width="9.1195498" + height="1.3027928" + x="12.459808" + y="23.5373" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1204" + width="10.422342" + height="1.3027928" + x="12.459808" + y="3.9954081" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4129" + width="1" + height="20" + x="11" + y="5" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4135" + width="1.814551" + height="19.718121" + x="23.347221" + y="4.7817354" /> + </g> + <g + style="display:none" + inkscape:label="zoom-area" + id="g1209" + inkscape:groupmode="layer" + sodipodi:insensitive="true"> + <path + id="path1211" + d="m 17.64448,1.308398 c -7.194559,0 -13.0148807,5.8203218 -13.0148807,13.01488 0,7.194559 5.8203217,13.01488 13.0148807,13.01488 7.194558,0 13.01488,-5.820321 13.01488,-13.01488 0,-7.1945582 -5.820322,-13.01488 -13.01488,-13.01488 z M 17.4823,4.2681683 c 1.560265,0 3.019717,0.3776596 4.338293,1.0136199 l 2.27051,0 0,1.5001575 c 2.106811,1.8439865 3.446307,4.5257733 3.446307,7.5413323 0,3.01556 -1.339496,5.697346 -3.446307,7.541333 l 0,1.581246 -2.432689,0 c -1.276828,0.587679 -2.679968,0.932531 -4.176114,0.932531 -1.496146,0 -2.899286,-0.344852 -4.176114,-0.932531 l -2.189419,0 0,-1.337978 C 8.8566026,20.263073 7.4271903,17.463928 7.4271903,14.323278 c 0,-3.140649 1.4294123,-5.9397946 3.6895767,-7.7846011 l 0,-1.2568887 2.02724,0 C 14.462584,4.6458279 15.922034,4.2681683 17.4823,4.2681683 z" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + inkscape:connector-curvature="0" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect1213" + width="8.1614323" + height="4.0022411" + x="-18.689583" + y="20.575754" + transform="matrix(0.70710678,-0.70710678,0.70710678,0.70710678,0,0)" + inkscape:transform-center-x="2.825112" + inkscape:transform-center-y="1.7264579" /> + <rect + y="6.5792217" + x="9.8193331" + height="15.569202" + width="1.2974335" + id="rect1215" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + y="6.5792217" + x="24.091103" + height="15.569202" + width="1.2974335" + id="rect1217" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + y="23.445856" + x="12.414202" + height="1.2974335" + width="9.0820351" + id="rect1219" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + y="3.9843547" + x="12.414202" + height="1.2974335" + width="10.379468" + id="rect1221" + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:#15a221;stroke-width:0;stroke-linecap:square;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4109" + width="1" + height="19" + x="11" + y="5" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4117" + width="1.814551" + height="18.810844" + x="23.226252" + y="5.0841608" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4121" + width="10" + height="2" + x="11" + y="9" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4123" + width="2" + height="8" + x="19" + y="10" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4125" + width="9" + height="2" + x="11" + y="16" /> + <rect + style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect4127" + width="1" + height="6" + x="12" + y="11" /> + </g> + <g + inkscape:groupmode="layer" + id="layer11" + inkscape:label="mirror-horizontal" + style="display:none"> + <path + inkscape:connector-curvature="0" + style="fill:#ffffff;fill-opacity:1;stroke:none;display:inline" + d="M 14,3 1,29 14,29 14,3 z m -2,8 0,16 -8,0 8,-16 z" + id="path225-1" /> + <path + inkscape:connector-curvature="0" + id="path4054-7" + d="m 17.967761,3 c 0,26.096718 0,26 0,26 l 13,0 z" + style="fill:#ffffff;fill-opacity:1;stroke:none;display:inline" /> + </g> + <g + inkscape:groupmode="layer" + id="layer25" + inkscape:label="mirror-vertical" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#ffffff;fill-opacity:1;stroke:none" + d="M 3,14 29,1 29,14 3,14 z m 8,-2 16,0 0,-8 -16,8 z" + id="path225" + inkscape:connector-curvature="0" /> + <path + inkscape:connector-curvature="0" + id="path4054" + d="m 3,18 c 26.096718,0 26,0 26,0 l 0,13 z" + style="fill:#ffffff;fill-opacity:1;stroke:none" /> + </g> + <g + inkscape:groupmode="layer" + id="layer5" + inkscape:label="fonds" + style="display:none" + sodipodi:insensitive="true" /> +</svg>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/img/embedded_icons.cmd Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,14 @@ +rem @echo off +setlocal + +rem saxon embedded.svg embedded_icons.xsl + +set ink=C:\prog_mr\inkscape-0.48.1\inkscape.exe + +for %%f in (embedded\svg\*.svg) do ( + echo %%~nf + %ink% %%f --export-png=embedded\16\%%~nf.png -w16 -h16 + %ink% %%f --export-png=embedded\32\%%~nf.png -w32 -h32 + ) + +endlocal \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/img/embedded_icons.xsl Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,43 @@ +<?xml version="1.0" encoding="UTF-8"?> +<xsl:stylesheet version="2.0" + xmlns:xsl="http://www.w3.org/1999/XSL/Transform" + xmlns:dc="http://purl.org/dc/elements/1.1/" + xmlns:cc="http://creativecommons.org/ns#" + xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" + xmlns:svg="http://www.w3.org/2000/svg" + xmlns:xlink="http://www.w3.org/1999/xlink" + xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" + xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" + > + +<!-- +Create icons from a single SVG file. +In the SVG the icons reside in labelled groups --> + +<xsl:output method="xml"/> + +<xsl:template match="/"> + <!-- select all hidden layers --> + <xsl:apply-templates select="//svg:g[@style='display:none']" /> +</xsl:template> + +<xsl:template match="svg:g"> + <xsl:variable name="name" select="@inkscape:label"/> + <xsl:variable name="file" select="concat('embedded/svg/',$name,'.svg')"/> + <xsl:result-document href="{$file}"> + <svg:svg> + <xsl:copy-of select="/svg:svg/@*"/> + <xsl:copy-of select="/svg:svg/*[not(@style='display:none')]"/> + <svg:g> + <xsl:copy-of select="@*"/> + <!-- replace the "style" attribute --> + <xsl:attribute name="style">display:inline</xsl:attribute> + <xsl:copy-of select="*"/> + </svg:g> + </svg:svg> + </xsl:result-document> +</xsl:template> + + +</xsl:stylesheet> +
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/img/fullscreen.svg Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,1166 @@ +<?xml version="1.0" encoding="UTF-8" standalone="no"?> +<!-- Created with Inkscape (http://www.inkscape.org/) --> + +<svg + xmlns:dc="http://purl.org/dc/elements/1.1/" + xmlns:cc="http://creativecommons.org/ns#" + xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" + xmlns:svg="http://www.w3.org/2000/svg" + xmlns="http://www.w3.org/2000/svg" + xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" + xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" + width="48" + height="48" + id="svg2388" + sodipodi:version="0.32" + inkscape:version="0.48+devel r10012" + sodipodi:docname="fullscreen.svg" + inkscape:export-filename="C:\src\ECHO\digilib\client\digitallibrary\greyskin\back.png" + inkscape:export-xdpi="60.000000" + inkscape:export-ydpi="60.000000" + version="1.1" + style="display:inline"> + <defs + id="defs2390"> + <linearGradient + id="linearGradient3124"> + <stop + id="stop7644" + offset="0.0000000" + style="stop-color:#000000;stop-opacity:0.19587629;" /> + <stop + style="stop-color:#545454;stop-opacity:0.22680412;" + offset="0.50000000" + id="stop7646" /> + <stop + style="stop-color:#5f5f5f;stop-opacity:1.0000000;" + offset="1.0000000" + id="stop3128" /> + </linearGradient> + <linearGradient + id="linearGradient3124-4"> + <stop + style="stop-color:#000000;stop-opacity:0.19587629;" + offset="0.0000000" + id="stop7644-0" /> + <stop + id="stop7646-9" + offset="0.50000000" + style="stop-color:#545454;stop-opacity:0.22680412;" /> + <stop + id="stop3128-4" + offset="1.0000000" + style="stop-color:#5f5f5f;stop-opacity:1.0000000;" /> + </linearGradient> + <linearGradient + id="linearGradient3124-40"> + <stop + style="stop-color:#000000;stop-opacity:0.19587629;" + offset="0.0000000" + id="stop7644-9" /> + <stop + id="stop7646-4" + offset="0.50000000" + style="stop-color:#545454;stop-opacity:0.22680412;" /> + <stop + id="stop3128-8" + offset="1.0000000" + style="stop-color:#5f5f5f;stop-opacity:1.0000000;" /> + </linearGradient> + </defs> + <sodipodi:namedview + id="base" + pagecolor="#ffffff" + bordercolor="#666666" + borderopacity="1.0" + inkscape:pageopacity="0.0" + inkscape:pageshadow="2" + inkscape:zoom="13.477814" + inkscape:cx="36.471552" + inkscape:cy="25.345983" + inkscape:current-layer="layer6" + showgrid="true" + inkscape:grid-bbox="true" + inkscape:document-units="px" + inkscape:window-width="1024" + inkscape:window-height="719" + inkscape:window-x="1020" + inkscape:window-y="-4" + inkscape:window-maximized="1" + showguides="true" + inkscape:guide-bbox="true" + inkscape:snap-object-midpoints="true" + inkscape:snap-bbox="false" + inkscape:snap-grids="false" + inkscape:snap-global="false" + inkscape:snap-nodes="true"> + <sodipodi:guide + orientation="1,0" + position="24,24" + id="guide79" /> + <sodipodi:guide + orientation="0,1" + position="24,24" + id="guide96" /> + </sodipodi:namedview> + <metadata + id="metadata2393"> + <rdf:RDF> + <cc:Work + rdf:about=""> + <dc:format>image/svg+xml</dc:format> + <dc:type + rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> + <dc:title /> + </cc:Work> + </rdf:RDF> + </metadata> + <g + inkscape:groupmode="layer" + id="layer6" + inkscape:label="bg" + style="display:inline;opacity:1" + sodipodi:insensitive="true"> + <rect + style="color:#000000;fill:#924747;fill-opacity:0.59183673000000003;fill-rule:evenodd;stroke:none;stroke-width:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="rect468" + width="47.930622" + height="47.856426" + x="0.14839204" + y="0.66294771" /> + </g> + <g + id="layer1" + inkscape:label="back-bg" + inkscape:groupmode="layer" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.265625,4.6583478 C 13.095813,5.0514781 4.9531248,13.574558 4.953125,24.002098 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437502 -19.03125,-19.3437502 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m 8.0625,10.2187502 0,19.5625 -17,-10 17,-9.5625 z" + id="path2396" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer3" + inkscape:label="back" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" + d="m 31.712561,14.428571 0,19.571429 -17,-10 17,-9.571429 z" + id="path2474" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer4" + inkscape:label="birds-eye" + style="display:none" + sodipodi:insensitive="true"> + <g + style="display:inline" + id="g3261" + transform="translate(-0.421875,1.1270978)"> + <g + inkscape:label="Layer 1" + id="layer1-2"> + <path + id="path2396-4" + d="M 23.6875,3.53125 C 13.517688,3.9243803 5.3749998,12.44746 5.375,22.875 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.34375 -19.03125,-19.34375 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -11.5,5.03125 c 8.054946,0 16.101305,0 24.15625,0 -0.177792,7.640664 -0.145474,19.582098 -0.375,28.875 -7.925408,0 -15.855841,0 -23.78125,0 0,-9.629629 0,-19.245371 0,-28.875 z" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + inkscape:connector-curvature="0" /> + </g> + <g + style="display:none" + inkscape:label="l2" + id="layer2"> + <path + id="path7614" + d="M 17,13.428571 17,33 34,23 17,13.428571 z" + style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" + inkscape:connector-curvature="0" /> + </g> + <g + style="display:inline" + inkscape:label="l3" + id="layer3-5"> + <path + sodipodi:nodetypes="cccccccccccccc" + id="path2398" + d="m 24.5,21.513718 c -0.970522,-2.062516 -4.45045,-4.216194 -6.575189,-4.233117 -3.372855,-0.126345 -4.809255,2.432072 -8.1569103,2.60025 -0.5923567,0.114228 -2.4633921,-0.689608 -1.64777,0.191066 1.232791,1.767212 5.0695153,-0.03597 7.0973333,-0.318185 2.771908,-0.238773 3.830042,0.577482 6.591043,1.46039 1.834483,1.550761 1.367191,4.328133 2.425478,5.038122 M 24.5,21.513718 c 0.970522,-2.062516 4.136456,-4.091194 6.261195,-4.108117 3.372855,-0.126345 4.68363,2.576424 8.031286,2.744602 0.592446,0.113949 2.903534,-0.958549 2.086592,-0.07844 -1.22746,1.744907 -5.120704,-0.107454 -7.130879,-0.360979 -2.878245,-0.225465 -3.954942,0.28254 -6.823783,1.173122 -2.192668,0.619125 -0.865145,4.640924 -2.752927,5.273194" + style="fill:#000000;fill-opacity:1;fill-rule:evenodd;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + inkscape:connector-curvature="0" /> + </g> + </g> + </g> + <g + inkscape:groupmode="layer" + id="layer5" + inkscape:label="brightness" + style="display:none" + sodipodi:insensitive="true"> + <g + style="display:inline" + id="g60" + transform="translate(-0.51107063,1.065898)"> + <g + style="display:inline" + inkscape:label="Layer 1" + id="layer1-4"> + <path + transform="matrix(1.062015,0,0,1.062015,-7.659466,-4.965116)" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + sodipodi:ry="18.214285" + sodipodi:rx="17.928572" + sodipodi:cy="26.214285" + sodipodi:cx="30.214285" + id="path2396-5" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + sodipodi:type="arc" /> + </g> + <g + style="display:none" + inkscape:label="l2" + id="layer2-5"> + <path + id="path7614-1" + d="m 16.866525,15.295096 0,16.088379 13.974577,-8.220339 -13.974577,-7.86804 z" + style="fill:none;stroke:#000000;stroke-width:1.23305082;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" + inkscape:connector-curvature="0" /> + <path + id="path1367" + d="m 33,13.571429 0,18.857142" + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + inkscape:connector-curvature="0" /> + </g> + <g + style="display:inline" + inkscape:label="l3" + id="layer3-7"> + <g + style="fill:#919191;fill-opacity:1" + id="g3803"> + <path + sodipodi:type="arc" + style="color:#000000;fill:#919191;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + id="path2955" + sodipodi:cx="34.642857" + sodipodi:cy="12.5" + sodipodi:rx="10.214286" + sodipodi:ry="10.214286" + d="m 44.857142,12.5 a 10.214286,10.214286 0 1 1 -20.428571,0 10.214286,10.214286 0 1 1 20.428571,0 z" + transform="translate(-10.42857,10.28571)" /> + <g + style="fill:#919191;fill-opacity:1" + id="g2968"> + <rect + y="6" + x="23" + height="33" + width="2.4285715" + id="rect2959" + style="color:#000000;fill:#919191;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(0,-1,1,0,0,0)" + y="7.500001" + x="-24" + height="33" + width="2.4285715" + id="rect2966" + style="color:#000000;fill:#919191;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + <g + style="fill:#919191;fill-opacity:1;display:inline" + id="g2972" + transform="matrix(0.707107,0.707107,-0.707107,0.707107,23.26192,-10.5061)"> + <rect + y="6" + x="23" + height="33" + width="2.4285715" + id="rect2974" + style="color:#000000;fill:#919191;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" /> + <rect + transform="matrix(0,-1,1,0,0,0)" + y="7.500001" + x="-24" + height="33" + width="2.4285715" + id="rect2976" + style="color:#000000;fill:#919191;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" /> + </g> + </g> + </g> + </g> + </g> + <g + inkscape:groupmode="layer" + id="layer7" + inkscape:label="brightness-on" + style="display:none" + sodipodi:insensitive="true"> + <path + transform="translate(-10.60335,11.571789)" + d="m 44.857142,12.5 a 10.214286,10.214286 0 1 1 -20.428571,0 10.214286,10.214286 0 1 1 20.428571,0 z" + sodipodi:ry="10.214286" + sodipodi:rx="10.214286" + sodipodi:cy="12.5" + sodipodi:cx="34.642857" + id="path152" + style="color:#000000;fill:#ffffff;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="arc" /> + </g> + <g + inkscape:groupmode="layer" + id="layer8" + inkscape:label="calibration-x" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path155" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.0858183,-3.9813063)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer9" + inkscape:label="calibration-y" + style="display:inline" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path162" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.178838,-3.9263719)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer10" + inkscape:label="cat" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 22.617324,4.6441901 C 12.724712,5.3372091 4.9298238,13.762793 4.929824,23.98794 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 -0.07945,0.00307 -0.170799,-0.00406 -0.25,0 -0.07858,0.00403 -0.171671,-0.005 -0.25,0 -0.03886,0.00248 -0.0862,-0.00272 -0.125,0 z m -9.71875,6.9687499 8.8125,0 0,10.40625 -8.8125,0 0,-10.40625 z m 13.34375,0 8.8125,0 0,10.40625 -8.8125,0 0,-10.40625 z m -13.21875,14.15625 8.84375,0 0,10.40625 -8.84375,0 0,-10.40625 z m 13.28125,0 8.8125,0 0,10.40625 -8.8125,0 0,-10.40625 z" + id="path169" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer11" + inkscape:label="contrast-on" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path174" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.030446,-3.9263719)" /> + <path + style="color:#000000;fill:#000000;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 23.00402,14.069994 c -5.246609,0.466434 -9.375,4.882786 -9.375,10.25 0,5.435055 4.221162,9.91039 9.5625,10.28125 l 0,-20.53125 c -0.06538,0.0046 -0.122459,-0.0058 -0.1875,0 z" + id="path2882" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#fefefe;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 25.25402,14.040552 c 5.246609,0.466434 9.375,4.882786 9.375,10.25 0,5.435055 -4.221162,9.91039 -9.5625,10.28125 l 0,-20.53125 c 0.06538,0.0046 0.122459,-0.0058 0.1875,0 z" + id="path2891" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer12" + inkscape:label="contrast" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path183" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.178838,-3.9263719)" /> + <path + style="color:#000000;fill:#7f7f7f;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 22.855628,14.069994 c -5.246609,0.466434 -9.375,4.882786 -9.375,10.25 0,5.435055 4.221162,9.91039 9.5625,10.28125 l 0,-20.53125 c -0.06538,0.0046 -0.122459,-0.0058 -0.1875,0 z" + id="path189" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#d2d2d2;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 25.105628,14.040552 c 5.246609,0.466434 9.375,4.882786 9.375,10.25 0,5.435055 -4.221162,9.91039 -9.5625,10.28125 l 0,-20.53125 c 0.06538,0.0046 0.122459,-0.0058 0.1875,0 z" + id="path191" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer14" + inkscape:label="delmark" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52965355;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path197" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.030446,-3.8521759)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer15" + inkscape:label="down" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#ffa060;fill-opacity:1;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.31652,43.327497 C 13.146708,42.934366 5.0040198,34.411287 5.00402,23.983747 c 0,-10.677802 8.552192,-19.3437493 19.0625,-19.3437503 7.061613,0 13.212731,3.912981 16.5,9.7187503 l -16.4375,0 -16.5,0 8.25,14.28125 8.25,14.28125 8.25,-14.28125 8.21875,-14.21875 c 1.583645,2.821161 2.5,6.084514 2.5,9.5625 0,10.677802 -8.520943,19.34375 -19.03125,19.34375 -0.246335,0 -0.505925,0.0094 -0.75,0 z" + id="path204" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer16" + inkscape:label="first" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.242324,4.6441901 C 13.072512,5.0373204 4.9298238,13.5604 4.929824,23.98794 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m 9.46875,12.4687499 0,16.09375 -13.96875,-8.21875 13.96875,-7.875 z" + id="path207" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;display:inline" + d="m 16.795269,15.695439 0,18.857142" + id="path1372" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1.23305082;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" + d="m 33.012495,17.323033 0,16.088379 -13.974578,-8.220339 13.974578,-7.86804 z" + id="path2576" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer18" + inkscape:label="fwd" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="m 24.859466,4.6441901 c 10.169812,0.3931303 18.3125,8.9162099 18.3125,19.3437499 0,10.677802 -8.552192,19.343749 -19.0625,19.34375 -10.510307,0 -19.031249,-8.665948 -19.03125,-19.34375 0,-10.677802 8.520943,-19.3437499 19.03125,-19.3437499 0.246335,0 0.505925,-0.00944 0.75,0 z m -8.0625,10.2187499 0,19.5625 17,-10 -17,-9.5625 z" + id="path226" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" + d="m 16.85179,14.346335 0,19.571429 17,-10 -17,-9.571429 z" + id="path230" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer19" + inkscape:label="help" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path233" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.030446,-3.8521759)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer20" + inkscape:label="last" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="m 24.78527,4.7183861 c 10.169812,0.3931303 18.3125,8.9162099 18.3125,19.3437499 0,10.677802 -8.552192,19.343749 -19.0625,19.34375 -10.510307,0 -19.031249,-8.665948 -19.03125,-19.34375 0,-10.677802 8.520943,-19.3437499 19.03125,-19.3437499 0.246335,0 0.505925,-0.00944 0.75,0 z m -9.46875,12.4687499 0,16.09375 13.96875,-8.21875 -13.96875,-7.875 z" + id="path240" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1.23305082;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" + d="m 15.085821,16.853212 0,16.088379 13.974577,-8.220339 -13.974577,-7.86804 z" + id="path242" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + d="m 31.367688,15.648917 0,18.857142" + id="path244" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer21" + inkscape:label="left" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#ffa060;fill-opacity:1;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 4.5608495,23.325664 C 4.9539805,13.155852 13.477059,5.0131644 23.904599,5.0131646 c 10.677802,0 19.34375,8.5521914 19.343751,19.0624994 0,7.061613 -3.912981,13.212731 -9.718751,16.5 l 0,-16.4375 0,-16.4999994 -14.28125,8.2499994 -14.2812495,8.25 14.2812495,8.25 14.21875,8.21875 c -2.821161,1.583645 -6.084514,2.5 -9.5625,2.5 -10.677802,0 -19.3437495,-8.520943 -19.3437495,-19.03125 0,-0.246335 -0.00944,-0.505925 0,-0.75 z" + id="path251" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer24" + inkscape:label="mark" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path260" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.178838,-3.8521759)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer25" + inkscape:label="mirror-horizontal-on" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.31652,4.6441901 C 13.146708,5.0373204 5.0040198,13.5604 5.00402,23.98794 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -12.25,9.4687499 12,0 0,23 -12,-23 z" + id="path267" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#000000;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 25.057591,14.11294 12,0 -12,23 0,-23 z" + id="rect2628" + sodipodi:nodetypes="cccc" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer26" + inkscape:label="mirror-horizontal" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.31652,4.5699941 C 13.146708,4.9631244 5.0040198,13.486204 5.00402,23.913744 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -12.25,9.4687499 12,0 0,23 -12,-23 z" + id="path275" + inkscape:connector-curvature="0" /> + <path + style="color:#000000;fill:#818181;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 25.057591,14.038744 12,0 -12,23 0,-23 z" + id="path281" + sodipodi:nodetypes="cccc" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer27" + inkscape:label="mirror-vertical-on" + style="display:none" + sodipodi:insensitive="true"> + <path + id="path288" + d="M 23.390716,4.7183858 C 13.220904,5.1115161 5.0782153,13.634596 5.0782163,24.062136 c 0,10.677802 8.5521917,19.343749 19.0624997,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437502 -19.03125,-19.3437502 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -12.25,9.4687502 12,0 0,23 -12,-23 z" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none;display:inline" + inkscape:connector-curvature="0" /> + <path + sodipodi:nodetypes="cccc" + id="path290" + d="m 25.131787,14.187136 12,0 -12,23 0,-23 z" + style="color:#000000;fill:#000000;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer28" + inkscape:label="mirror-vertical" + style="display:none" + sodipodi:insensitive="true"> + <path + id="path297" + d="M 23.464912,4.7183861 C 13.2951,5.1115164 5.1524118,13.634596 5.152412,24.062136 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -12.25,9.4687499 12,0 0,23 -12,-23 z" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none;display:inline" + inkscape:connector-curvature="0" /> + <path + sodipodi:nodetypes="cccc" + id="path299" + d="m 25.205983,14.187136 12,0 -12,23 0,-23 z" + style="color:#000000;fill:#818181;fill-opacity:0.98214285;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer29" + inkscape:label="mirror" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path302" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-7.659466,-4.965116)" /> + <path + style="fill:none;stroke:#000000;stroke-width:1.23305082;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" + d="m 16.866525,15.295096 0,16.088379 13.974577,-8.220339 -13.974577,-7.86804 z" + id="path304" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + d="m 33,13.571429 0,18.857142" + id="path306" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1.23305082;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" + d="m 33.151332,16.009382 0,16.088379 -13.974577,-8.220339 13.974577,-7.86804 z" + id="path308" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1;display:inline" + d="m 17.017857,14.285715 0,18.857142" + id="path310" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer30" + inkscape:label="options" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 22.964912,4.6441901 C 13.017144,5.2790115 5.1524118,13.722694 5.152412,23.98794 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 -0.07945,0.00307 -0.170799,-0.00406 -0.25,0 -0.07858,0.00403 -0.171671,-0.005 -0.25,0 z m -11.1875,19.4687499 5.5625,0 0,5.5625 -5.5625,0 0,-5.5625 z m 9.5,0 5.5625,0 0,5.5625 -5.5625,0 0,-5.5625 z m 9.5,0 5.5625,0 0,5.5625 -5.5625,0 0,-5.5625 z" + id="path313" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer31" + inkscape:label="original-size" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.464912,4.4957981 C 13.2951,4.8889284 5.1524118,13.412008 5.152412,23.839548 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -11.5,5.03125 c 8.054946,0 16.101305,0 24.15625,0 -0.177792,7.6406639 -0.145474,19.5820979 -0.375,28.8749999 -7.925408,0 -15.855841,0 -23.78125,0 0,-9.629629 0,-19.245371 0,-28.8749999 z" + id="path320" + inkscape:connector-curvature="0" /> + <path + transform="translate(-1.294017,0.25026109)" + d="m 27.285715,18.785715 a 1.9285715,1.9285715 0 1 1 -3.857143,0 1.9285715,1.9285715 0 1 1 3.857143,0 z" + sodipodi:ry="1.9285715" + sodipodi:rx="1.9285715" + sodipodi:cy="18.785715" + sodipodi:cx="25.357143" + id="path3538" + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="arc" /> + <path + transform="translate(-1.294017,9.2502611)" + d="m 27.285715,18.785715 a 1.9285715,1.9285715 0 1 1 -3.857143,0 1.9285715,1.9285715 0 1 1 3.857143,0 z" + sodipodi:ry="1.9285715" + sodipodi:rx="1.9285715" + sodipodi:cy="18.785715" + sodipodi:cx="25.357143" + id="path3542" + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="arc" /> + </g> + <g + inkscape:groupmode="layer" + id="layer32" + inkscape:label="page" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.464912,4.5699941 C 13.2951,4.9631244 5.1524118,13.486204 5.152412,23.913744 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -8.6875,6.4687499 14,0 0.15625,0 5.28125,6.84375 0,19.15625 -19.4375,0 0,-26 z" + id="path327" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" + d="m 28.777412,11.038744 c 0,7 0,7 0,7 l 6,0" + id="path2414" + inkscape:connector-curvature="0" /> + <path + style="fill:none;stroke:#000000;stroke-width:1.5;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" + d="m 15.063126,10.788744 13.999999,0 0.142858,0 5.285715,6.857143 0,19.142857 -19.428572,0 0,-26 z" + id="path2438" + sodipodi:nodetypes="ccccccc" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer33" + inkscape:label="pagewidth" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.464912,4.6441901 C 13.2951,5.0373204 5.1524118,13.5604 5.152412,23.98794 c 0,3.561406 0.9701688,6.883089 2.625,9.75 l 0,-19.1875 33,0 0,18.96875 c 1.570104,-2.812214 2.46875,-6.069306 2.46875,-9.53125 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -9.6875,35.5312499 c 2.993555,1.992339 6.594037,3.15625 10.4375,3.15625 3.833988,0 7.385948,-1.172923 10.375,-3.15625 l -20.8125,0 z" + id="path334" + inkscape:connector-curvature="0" /> + <path + sodipodi:type="star" + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:#000000;stroke-width:1;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="path2222" + sodipodi:sides="3" + sodipodi:cx="15.514512" + sodipodi:cy="22.353563" + sodipodi:r1="3.2910488" + sodipodi:r2="1.6455244" + sodipodi:arg1="1.046877" + sodipodi:arg2="2.0940745" + inkscape:flatsided="false" + inkscape:rounded="0" + inkscape:randomized="0" + d="m 17.16095,25.203168 -2.468743,-1.424275 -2.468744,-1.424275 2.46783,-1.425857 2.46783,-1.425857 9.13e-4,2.850132 z" + transform="matrix(1.056109,0,0,1.093566,-3.933877,-0.3103459)" /> + <path + sodipodi:type="star" + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:#000000;stroke-width:1;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="path3103" + sodipodi:sides="3" + sodipodi:cx="15.514512" + sodipodi:cy="22.353563" + sodipodi:r1="3.2910488" + sodipodi:r2="1.6455244" + sodipodi:arg1="1.046877" + sodipodi:arg2="2.0940745" + inkscape:flatsided="false" + inkscape:rounded="0" + inkscape:randomized="0" + d="m 17.16095,25.203168 -2.468743,-1.424275 -2.468744,-1.424275 2.46783,-1.425857 2.46783,-1.425857 9.13e-4,2.850132 z" + transform="matrix(-1.056109,0,0,1.093566,52.438582,-0.2974859)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer34" + inkscape:label="pixel-by-pixel" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.6875,3.53125 C 13.517688,3.9243803 5.3749998,12.44746 5.375,22.875 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.34375 -19.03125,-19.34375 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -11.5,5.03125 c 8.054946,0 16.101305,0 24.15625,0 -0.177792,7.640664 -0.145474,19.582098 -0.375,28.875 -7.925408,0 -15.855841,0 -23.78125,0 0,-9.629629 0,-19.245371 0,-28.875 z" + id="path343" + inkscape:connector-curvature="0" /> + <path + transform="translate(-1.368213,0.47284911)" + d="m 27.285715,18.785715 a 1.9285715,1.9285715 0 1 1 -3.857143,0 1.9285715,1.9285715 0 1 1 3.857143,0 z" + sodipodi:ry="1.9285715" + sodipodi:rx="1.9285715" + sodipodi:cy="18.785715" + sodipodi:cx="25.357143" + id="path347" + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="arc" /> + <path + transform="translate(-1.368213,9.4728491)" + d="m 27.285715,18.785715 a 1.9285715,1.9285715 0 1 1 -3.857143,0 1.9285715,1.9285715 0 1 1 3.857143,0 z" + sodipodi:ry="1.9285715" + sodipodi:rx="1.9285715" + sodipodi:cy="18.785715" + sodipodi:cx="25.357143" + id="path349" + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="arc" /> + </g> + <g + inkscape:groupmode="layer" + id="layer35" + inkscape:label="quality" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path352" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-7.9562501,-3.8521759)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer36" + inkscape:label="reference" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="m 23.31652,4.6441901 c -6.248958,0.2415635 -11.702829,3.5677067 -15,8.4999999 l 31.5,0 c -3.425954,-5.1249416 -9.196849,-8.4999999 -15.75,-8.4999999 -0.246335,0 -0.505925,-0.00944 -0.75,0 z M 7.87902,34.14419 c 3.357176,5.507237 9.346957,9.187499 16.1875,9.1875 6.840543,0 12.830324,-3.680263 16.1875,-9.1875 l -32.375,0 z" + id="path359" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer37" + inkscape:label="reset" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:nodetypes="cssssc" + id="path366" + d="M 23.242324,4.5699941 C 13.072512,4.9631244 4.9298238,13.486204 4.929824,23.913744 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none;display:inline" + inkscape:connector-curvature="0" /> + <path + id="path811" + d="m 14.968932,13.288926 c -0.09111,-0.002 -0.188341,0.03681 -0.28125,0.0625 -0.01064,0.0029 -0.02063,-0.0033 -0.03125,0 l 0,0.03125 c -0.350033,0.113463 -0.579179,0.390226 -0.65625,0.6875 -0.07578,0.292276 0.01031,0.638512 0.25,0.90625 l -0.03125,0.03125 0.03125,0.03125 8.4375,8.96875 -8.75,8.25 c -0.0085,0.0071 0.0082,0.0239 0,0.03125 -0.2876,0.256825 -0.415258,0.628364 -0.3125,1 0.0029,0.01064 -0.0033,0.02063 0,0.03125 l 0.03125,0 c 0.113463,0.350033 0.390226,0.579179 0.6875,0.65625 0.292276,0.07578 0.638512,-0.01031 0.90625,-0.25 l 0.03125,0.03125 0.03125,-0.03125 8.75,-8.25 8.15625,8.65625 c 0.790154,0.861986 2.290154,-0.513014 1.5,-1.375 l -8.15625,-8.65625 8.84375,-8.34375 c 0.861986,-0.790154 -0.513014,-2.290154 -1.375,-1.5 l -8.875,8.375 -8.4375,-8.96875 c -0.0071,-0.0085 -0.0239,0.0082 -0.03125,0 -0.192619,-0.2157 -0.445432,-0.368966 -0.71875,-0.375 z" + style="font-size:medium;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;text-indent:0;text-align:start;text-decoration:none;line-height:normal;letter-spacing:normal;word-spacing:normal;text-transform:none;direction:ltr;block-progression:tb;writing-mode:lr-tb;text-anchor:start;color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:#000000;stroke-width:1;stroke-opacity:1;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate;font-family:Bitstream Vera Sans;-inkscape-font-specification:Bitstream Vera Sans" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer38" + inkscape:label="rgb-on" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.093932,4.6441901 C 12.92412,5.0373204 4.7814318,13.5604 4.781432,23.98794 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m 0.625,11.1874999 c 0.03501,-4.44e-4 0.08988,0 0.125,0 4.494857,0 8.125,3.661393 8.125,8.15625 0,4.494858 -3.630143,8.15625 -8.125,8.15625 -4.494858,-1e-6 -8.15625,-3.661393 -8.15625,-8.15625 0,-4.459741 3.584807,-8.099865 8.03125,-8.15625 z" + id="path374" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer39" + inkscape:label="rgb" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path381" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.2530341,-3.8521759)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer40" + inkscape:label="right" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#ffa060;fill-opacity:1;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="m 43.763529,23.607278 c -0.393131,10.169812 -8.91621,18.3125 -19.34375,18.3125 -10.677802,0 -19.3437497,-8.552192 -19.3437507,-19.0625 0,-7.061613 3.912981,-13.212731 9.7187507,-16.4999997 l 0,16.4374997 0,16.5 14.28125,-8.25 14.28125,-8.25 -14.28125,-8.25 -14.21875,-8.2187497 c 2.821161,-1.583645 6.084514,-2.5 9.5625,-2.5 10.677802,0 19.34375,8.5209427 19.34375,19.0312497 0,0.246335 0.0094,0.505925 0,0.75 z" + id="path388" + inkscape:export-filename="C:\src\ECHO\digilib\client\digitallibrary\greyskin\right.png" + inkscape:export-xdpi="60" + inkscape:export-ydpi="60" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer42" + inkscape:label="rotate-on" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path397" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.104642,-3.8521759)" /> + <path + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 23.173913,13.392912 c -5.256566,0.331025 -9.413313,4.723535 -9.413313,10.06323 0,0.02893 -2.44e-4,0.05499 0,0.08386 l 2.201331,0 c -2.74e-4,-0.02705 0,-0.05675 0,-0.08386 0,-4.23644 3.349847,-7.70218 7.547423,-7.861899 0.100742,-0.0038 0.212801,0 0.314476,0 4.338114,0 7.861898,3.523784 7.861898,7.861899 0,4.209327 -3.324433,7.661202 -7.484527,7.861898 l 0,2.201332 c 5.38247,-0.196267 9.685859,-4.633096 9.685859,-10.06323 0,-5.554903 -4.508327,-10.06323 -10.06323,-10.06323 -0.151892,0 -0.310975,-0.0067 -0.461232,0 -0.06263,0.0028 -0.126354,-0.0039 -0.188685,0 z" + id="path3724" + inkscape:connector-curvature="0" /> + <path + sodipodi:type="star" + style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + id="path3738" + sodipodi:sides="3" + sodipodi:cx="7.7142859" + sodipodi:cy="23.142857" + sodipodi:r1="5.1448407" + sodipodi:r2="2.5724204" + sodipodi:arg1="1.5707963" + sodipodi:arg2="2.6179939" + inkscape:flatsided="false" + inkscape:rounded="0" + inkscape:randomized="0" + d="m 7.714286,28.287697 -2.2277816,-3.85863 -2.2277814,-3.858631 4.4555629,0 4.4555631,0 -2.2277818,3.858631 z" + transform="matrix(0.991317,0,0,0.991317,7.2328959,2.7740831)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer43" + inkscape:label="rotate" + style="display:none" + sodipodi:insensitive="true"> + <path + sodipodi:type="arc" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + id="path406" + sodipodi:cx="30.214285" + sodipodi:cy="26.214285" + sodipodi:rx="17.928572" + sodipodi:ry="18.214285" + d="m 48.142857,26.214285 a 17.928572,18.214285 0 1 1 -35.857144,0 17.928572,18.214285 0 1 1 35.857144,0 z" + transform="matrix(1.062015,0,0,1.062015,-8.0880238,-3.8399638)" /> + <path + style="color:#000000;fill:#797979;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + d="m 23.090452,13.376007 c -5.256566,0.331025 -9.413313,4.723535 -9.413313,10.06323 0,0.02893 -2.44e-4,0.05499 0,0.08386 l 2.201331,0 c -2.74e-4,-0.02705 0,-0.05675 0,-0.08386 0,-4.23644 3.349847,-7.70218 7.547423,-7.861899 0.100742,-0.0038 0.212801,0 0.314476,0 4.338114,0 7.861898,3.523784 7.861898,7.861899 0,4.209327 -3.324433,7.661202 -7.484527,7.861898 l 0,2.201332 c 5.38247,-0.196267 9.685859,-4.633096 9.685859,-10.06323 0,-5.554903 -4.508327,-10.06323 -10.06323,-10.06323 -0.151892,0 -0.310975,-0.0067 -0.461232,0 -0.06263,0.0028 -0.126354,-0.0039 -0.188685,0 z" + id="path412" + inkscape:connector-curvature="0" /> + <path + sodipodi:type="star" + style="color:#000000;fill:#797979;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.5625;marker:none;visibility:visible;display:inline;overflow:visible" + id="path414" + sodipodi:sides="3" + sodipodi:cx="7.7142859" + sodipodi:cy="23.142857" + sodipodi:r1="5.1448407" + sodipodi:r2="2.5724204" + sodipodi:arg1="1.5707963" + sodipodi:arg2="2.6179939" + inkscape:flatsided="false" + inkscape:rounded="0" + inkscape:randomized="0" + d="m 7.714286,28.287697 -2.2277816,-3.85863 -2.2277814,-3.858631 4.4555629,0 4.4555631,0 -2.2277818,3.858631 z" + transform="matrix(0.991317,0,0,0.991317,7.1586999,2.7920209)" /> + </g> + <g + inkscape:groupmode="layer" + id="layer44" + inkscape:label="size" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 22.543128,4.7183861 C 12.650516,5.4114051 4.8556277,13.836989 4.8556279,24.062136 c 0,10.677802 8.5521921,19.343749 19.0625001,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 -0.07945,0.00307 -0.170799,-0.00406 -0.25,0 -0.07858,0.00403 -0.171671,-0.005 -0.25,0 -0.03886,0.00248 -0.0862,-0.00272 -0.125,0 z m 1.71875,1.09375 2.8125,4.9062499 2.78125,4.875 -5.625,-0.03125 -5.625,0 2.84375,-4.875 2.8125,-4.8749999 z m -8.5625,13.1874999 0.03125,5.625 0,5.625 -4.875,-2.8125 -4.8750001,-2.78125 4.8437501,-2.84375 4.875,-2.8125 z m 16.96875,0 4.875,2.8125 4.875,2.84375 -4.90625,2.78125 -4.875,2.8125 0.03125,-5.625 0,-5.625 z m -8.4375,13.5 5.625,0 -2.78125,4.875 -2.8125,4.875 -2.8125,-4.875 -2.84375,-4.84375 5.625,-0.03125 z" + id="path421" + inkscape:connector-curvature="0" /> + <path + transform="matrix(0.832068,0.650269,-0.650269,0.832068,8.142727,-5.7134922)" + d="m 26.285714,22.285714 -5.275457,0.760073 -5.275458,0.760073 1.979486,-4.948717 1.979487,-4.948717 3.295971,4.188644 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="1.4277039" + sodipodi:arg1="0.38050638" + sodipodi:r2="3.0772371" + sodipodi:r1="6.1544743" + sodipodi:cy="20" + sodipodi:cx="20.571428" + sodipodi:sides="3" + id="path2370" + style="color:#000000;fill:none;stroke:#000000;stroke-width:0.82857955;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" /> + <path + transform="matrix(-0.832068,0.650269,0.650269,0.832068,39.798676,-5.7134922)" + d="m 26.285714,22.285714 -5.275457,0.760073 -5.275458,0.760073 1.979486,-4.948717 1.979487,-4.948717 3.295971,4.188644 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="1.4277039" + sodipodi:arg1="0.38050638" + sodipodi:r2="3.0772371" + sodipodi:r1="6.1544743" + sodipodi:cy="20" + sodipodi:cx="20.571428" + sodipodi:sides="3" + id="path2372" + style="color:#000000;fill:none;stroke:#000000;stroke-width:0.82857955;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" /> + <path + transform="matrix(0.650269,-0.832068,0.832068,0.650269,-5.990163,39.538968)" + d="m 26.285714,22.285714 -5.275457,0.760073 -5.275458,0.760073 1.979486,-4.948717 1.979487,-4.948717 3.295971,4.188644 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="1.4277039" + sodipodi:arg1="0.38050638" + sodipodi:r2="3.0772371" + sodipodi:r1="6.1544743" + sodipodi:cy="20" + sodipodi:cx="20.571428" + sodipodi:sides="3" + id="path2374" + style="color:#000000;fill:none;stroke:#000000;stroke-width:0.82857955;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" /> + <path + transform="matrix(0.650269,0.832068,0.832068,-0.650269,-5.990163,7.8830228)" + d="m 26.285714,22.285714 -5.275457,0.760073 -5.275458,0.760073 1.979486,-4.948717 1.979487,-4.948717 3.295971,4.188644 z" + inkscape:randomized="0" + inkscape:rounded="0" + inkscape:flatsided="false" + sodipodi:arg2="1.4277039" + sodipodi:arg1="0.38050638" + sodipodi:r2="3.0772371" + sodipodi:r1="6.1544743" + sodipodi:cy="20" + sodipodi:cx="20.571428" + sodipodi:sides="3" + id="path2376" + style="color:#000000;fill:none;stroke:#000000;stroke-width:0.82857955;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="star" /> + </g> + <g + inkscape:groupmode="layer" + id="layer45" + inkscape:label="up" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#ffa060;fill-opacity:1;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.6875,3.53125 C 13.517688,3.9243803 5.3749998,12.44746 5.375,22.875 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 7.061613,0 13.212731,-3.912981 16.5,-9.71875 L 24.5,32.5 8,32.5 16.25,18.21875 24.5,3.9375 32.75,18.21875 40.96875,32.4375 c 1.583645,-2.821161 2.5,-6.084514 2.5,-9.5625 0,-10.677802 -8.520943,-19.34375 -19.03125,-19.34375 -0.246335,0 -0.505925,-0.00944 -0.75,0 z" + id="path428" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer46" + inkscape:label="zoom-area" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52899998;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.242324,4.7183861 C 13.072512,5.1115164 4.9298238,13.634596 4.929824,24.062136 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -11.5,5.03125 c 8.054946,0 16.101305,0 24.15625,0 -0.177792,7.6406639 -0.145474,19.5820979 -0.375,28.8749999 -7.925408,0 -15.855841,0 -23.78125,0 0,-9.629629 0,-19.245371 0,-28.8749999 z" + id="path431" + inkscape:connector-curvature="0" /> + <path + sodipodi:type="arc" + style="fill:none;stroke:#000000;stroke-opacity:1;display:inline" + id="path3286" + sodipodi:cx="18.857143" + sodipodi:cy="16.857143" + sodipodi:rx="6" + sodipodi:ry="5.5714288" + d="m 24.857143,16.857143 a 6,5.5714288 0 1 1 -12,0 6,5.5714288 0 1 1 12,0 z" + transform="matrix(1.088683,0,0,1.172638,-8.8022,17.946136)" /> + <path + style="fill:none;stroke:#000000;stroke-width:3.0204308;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" + d="m 7.0446086,42.697351 c -5.781968,5.436776 -5.781968,5.436776 -5.781968,5.436776" + id="path3290" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer47" + inkscape:label="zoom-full" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.31652,4.6441901 C 13.146708,5.0373204 5.0040198,13.5604 5.00402,23.98794 c 0,10.677802 8.552192,19.343749 19.0625,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437499 -19.03125,-19.3437499 -0.246335,0 -0.505925,-0.00944 -0.75,0 z m -11.5,5.03125 c 8.054946,0 16.101305,0 24.15625,0 -0.177792,7.6406639 -0.145474,19.5820979 -0.375,28.8749999 -7.925408,0 -15.855841,0 -23.78125,0 0,-9.629629 0,-19.245371 0,-28.8749999 z" + id="path438" + inkscape:connector-curvature="0" /> + <path + sodipodi:type="arc" + style="fill:none;stroke:#000000;stroke-opacity:1;display:inline" + id="path442" + sodipodi:cx="18.857143" + sodipodi:cy="16.857143" + sodipodi:rx="6" + sodipodi:ry="5.5714288" + d="m 24.857143,16.857143 a 6,5.5714288 0 1 1 -12,0 6,5.5714288 0 1 1 12,0 z" + transform="matrix(1.088683,0,0,1.172638,-8.728004,17.87194)" /> + <path + style="fill:none;stroke:#000000;stroke-width:3.0204308;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" + d="m 7.1188046,42.623155 c -5.781968,5.436776 -5.781968,5.436776 -5.781968,5.436776" + id="path444" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer48" + inkscape:label="zoom-in" + style="display:none" + sodipodi:insensitive="true"> + <path + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none" + d="M 23.015625,4.6583475 C 12.957061,5.1740675 4.9531249,13.656023 4.9531251,24.002098 c 0,10.677802 8.5521919,19.343749 19.0624999,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437505 -19.03125,-19.3437505 -0.246335,0 -0.505925,-0.00944 -0.75,0 -0.07945,0.00307 -0.170799,-0.00406 -0.25,0 z m -0.125,7.9062505 c 0.04349,-0.0038 0.08137,0.0033 0.125,0 0.0055,-4.14e-4 0.02595,1.56e-4 0.03125,0 0.02067,1.24e-4 0.0418,-2.57e-4 0.0625,0 0.0053,-1.06e-4 0.02574,3.48e-4 0.03125,0 0.0028,-1.76e-4 0.0248,-6.1e-5 0.03125,0 0.02064,9.1e-5 0.04183,-2.26e-4 0.0625,0 0.0053,-8.4e-5 0.02567,2.83e-4 0.03125,0 0.184218,-0.0093 0.375973,0 0.5625,0 5.96888,0 10.8125,4.842552 10.8125,10.8125 2e-6,5.969949 -4.84362,10.8125 -10.8125,10.8125 -5.968879,-2e-6 -10.8125,-4.842552 -10.8125,-10.8125 0,-5.648895 4.351686,-10.328698 9.875,-10.8125 z" + id="path447" + inkscape:connector-curvature="0" /> + <path + sodipodi:type="arc" + style="color:#000000;fill:none;stroke:#000000;stroke-width:1.3868767;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + id="path3217" + sodipodi:cx="27.142857" + sodipodi:cy="19.714285" + sodipodi:rx="10.428572" + sodipodi:ry="10.142858" + d="m 37.571428,19.714285 a 10.428572,10.142858 0 1 1 -20.857143,0 10.428572,10.142858 0 1 1 20.857143,0 z" + transform="matrix(1.0569175,0,0,1.1067914,-4.9474456,1.618147)" /> + <path + style="fill:none;stroke:#000000;stroke-width:5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" + d="m 16.351608,30.961781 c -9.571429,9 -9.571429,9 -9.571429,9" + id="path454" + inkscape:connector-curvature="0" /> + </g> + <g + inkscape:groupmode="layer" + id="layer49" + inkscape:label="zoom-out" + style="display:none" + sodipodi:insensitive="true"> + <path + inkscape:connector-curvature="0" + id="path1269" + d="M 23.036721,4.6188415 C 12.978157,5.1345615 4.9742204,13.616517 4.9742206,23.962592 c 0,10.677802 8.5521924,19.343749 19.0625004,19.34375 10.510307,0 19.031249,-8.665948 19.03125,-19.34375 0,-10.677802 -8.520943,-19.3437505 -19.03125,-19.3437505 -0.246335,0 -0.505925,-0.00944 -0.75,0 -0.07945,0.00307 -0.170799,-0.00406 -0.25,0 z m -0.125,7.9062505 c 0.04349,-0.0038 0.08137,0.0033 0.125,0 0.0055,-4.14e-4 0.02595,1.56e-4 0.03125,0 0.02067,1.24e-4 0.0418,-2.57e-4 0.0625,0 0.0053,-1.06e-4 0.02574,3.48e-4 0.03125,0 0.0028,-1.76e-4 0.0248,-6.1e-5 0.03125,0 0.02064,9.1e-5 0.04183,-2.26e-4 0.0625,0 0.0053,-8.4e-5 0.02567,2.83e-4 0.03125,0 0.184218,-0.0093 0.375973,0 0.5625,0 5.96888,0 10.8125,4.842552 10.8125,10.8125 2e-6,5.969949 -4.84362,10.8125 -10.8125,10.8125 -5.968879,-2e-6 -10.8125,-4.842552 -10.8125,-10.8125 0,-5.648895 4.351686,-10.328698 9.875,-10.8125 z" + style="fill:#707070;fill-opacity:0.35526315;fill-rule:evenodd;stroke:#000000;stroke-width:0.52918273;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:0.50331128;stroke-dasharray:none;display:inline" /> + <path + transform="matrix(1.0569175,0,0,1.1067914,-4.92635,1.578641)" + d="m 37.571428,19.714285 a 10.428572,10.142858 0 1 1 -20.857143,0 10.428572,10.142858 0 1 1 20.857143,0 z" + sodipodi:ry="10.142858" + sodipodi:rx="10.428572" + sodipodi:cy="19.714285" + sodipodi:cx="27.142857" + id="path1271" + style="color:#000000;fill:none;stroke:#000000;stroke-width:1.3868767;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible" + sodipodi:type="arc" /> + <path + inkscape:connector-curvature="0" + id="path1273" + d="m 16.372704,30.996471 c -9.5714294,9 -9.5714294,9 -9.5714294,9" + style="fill:none;stroke:#000000;stroke-width:5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;display:inline" /> + </g> +</svg>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/img/make_icon.cmd Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,11 @@ +@echo off +setlocal + +rem saxon embedded.svg embedded_icons.xsl + +set ink=C:\prog_mr\inkscape-0.48.1\inkscape.exe + +%ink% embedded\svg\%1.svg --export-png=embedded\16\%1.png -w16 -h16 +%ink% embedded\svg\%1.svg --export-png=embedded\32\%1.png -w32 -h32 + +endlocal \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery-1.4.4.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,7181 @@ +/*! + * jQuery JavaScript Library v1.4.4 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Nov 11 19:04:53 2010 -0500 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/, + + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + rwhite = /\s/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for non-word characters + rnonword = /\W/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // Has the ready events already been bound? + readyBound = false, + + // The functions to execute on DOM ready + readyList = [], + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = "body"; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $("TAG") + } else if ( !context && !rnonword.test( selector ) ) { + this.selector = selector; + this.context = document; + selector = document.getElementsByTagName( selector ); + return jQuery.merge( this, selector ); + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return jQuery( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.4.4", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this.slice(num)[ 0 ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = jQuery(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // If the DOM is already ready + if ( jQuery.isReady ) { + // Execute the function immediately + fn.call( document, jQuery ); + + // Otherwise, remember the function for later + } else if ( readyList ) { + // Add the function to the wait list + readyList.push( fn ); + } + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || jQuery(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + // A third-party is pushing the ready event forwards + if ( wait === true ) { + jQuery.readyWait--; + } + + // Make sure that the DOM is not already loaded + if ( !jQuery.readyWait || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + if ( readyList ) { + // Execute all of them + var fn, + i = 0, + ready = readyList; + + // Reset the list of functions + readyList = null; + + while ( (fn = ready[ i++ ]) ) { + fn.call( document, jQuery ); + } + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + } + }, + + bindReady: function() { + if ( readyBound ) { + return; + } + + readyBound = true; + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", DOMContentLoaded); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test(data.replace(rvalidescape, "@") + .replace(rvalidtokens, "]") + .replace(rvalidbraces, "")) ) { + + // Try to use the native JSON parser first + return window.JSON && window.JSON.parse ? + window.JSON.parse( data ) : + (new Function("return " + data))(); + + } else { + jQuery.error( "Invalid JSON: " + data ); + } + }, + + noop: function() {}, + + // Evalulates a script in a global context + globalEval: function( data ) { + if ( data && rnotwhite.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + + if ( jQuery.support.scriptEval ) { + script.appendChild( document.createTextNode( data ) ); + } else { + script.text = data; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction(object); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {} + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type(array); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + if ( array.indexOf ) { + return array.indexOf( elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var ret = [], value; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + proxy: function( fn, proxy, thisObject ) { + if ( arguments.length === 2 ) { + if ( typeof proxy === "string" ) { + thisObject = fn; + fn = thisObject[ proxy ]; + proxy = undefined; + + } else if ( proxy && !jQuery.isFunction( proxy ) ) { + thisObject = proxy; + proxy = undefined; + } + } + + if ( !proxy && fn ) { + proxy = function() { + return fn.apply( thisObject || this, arguments ); + }; + } + + // Set the guid of unique handler to the same of original handler, so it can be removed + if ( fn ) { + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + } + + // So proxy can be declared as an argument + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can be optionally by executed if its a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +if ( indexOf ) { + jQuery.inArray = function( elem, array ) { + return indexOf.call( array, elem ); + }; +} + +// Verify that \s matches non-breaking spaces +// (IE fails on this test) +if ( !rwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +// Expose jQuery to the global object +return (window.jQuery = window.$ = jQuery); + +})(); + + +(function() { + + jQuery.support = {}; + + var root = document.documentElement, + script = document.createElement("script"), + div = document.createElement("div"), + id = "script" + jQuery.now(); + + div.style.display = "none"; + div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + var all = div.getElementsByTagName("*"), + a = div.getElementsByTagName("a")[0], + select = document.createElement("select"), + opt = select.appendChild( document.createElement("option") ); + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return; + } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType === 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: /red/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: div.getElementsByTagName("input")[0].value === "on", + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Will be defined later + deleteExpando: true, + optDisabled: false, + checkClone: false, + scriptEval: false, + noCloneEvent: true, + boxModel: null, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableHiddenOffsets: true + }; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as diabled) + select.disabled = true; + jQuery.support.optDisabled = !opt.disabled; + + script.type = "text/javascript"; + try { + script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + } catch(e) {} + + root.insertBefore( script, root.firstChild ); + + // Make sure that the execution of code works by injecting a script + // tag with appendChild/createTextNode + // (IE doesn't support this, fails, and uses .text instead) + if ( window[ id ] ) { + jQuery.support.scriptEval = true; + delete window[ id ]; + } + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete script.test; + + } catch(e) { + jQuery.support.deleteExpando = false; + } + + root.removeChild( script ); + + if ( div.attachEvent && div.fireEvent ) { + div.attachEvent("onclick", function click() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + jQuery.support.noCloneEvent = false; + div.detachEvent("onclick", click); + }); + div.cloneNode(true).fireEvent("onclick"); + } + + div = document.createElement("div"); + div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>"; + + var fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked; + + // Figure out if the W3C box model works as expected + // document.body must exist before we can do this + jQuery(function() { + var div = document.createElement("div"); + div.style.width = div.style.paddingLeft = "1px"; + + document.body.appendChild( div ); + jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + jQuery.support.inlineBlockNeedsLayout = div.offsetWidth === 2; + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + jQuery.support.shrinkWrapBlocks = div.offsetWidth !== 2; + } + + div.innerHTML = "<table><tr><td style='padding:0;display:none'></td><td>t</td></tr></table>"; + var tds = div.getElementsByTagName("td"); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + jQuery.support.reliableHiddenOffsets = tds[0].offsetHeight === 0; + + tds[0].style.display = ""; + tds[1].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + jQuery.support.reliableHiddenOffsets = jQuery.support.reliableHiddenOffsets && tds[0].offsetHeight === 0; + div.innerHTML = ""; + + document.body.removeChild( div ).style.display = "none"; + div = tds = null; + }); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + var eventSupported = function( eventName ) { + var el = document.createElement("div"); + eventName = "on" + eventName; + + var isSupported = (eventName in el); + if ( !isSupported ) { + el.setAttribute(eventName, "return;"); + isSupported = typeof el[eventName] === "function"; + } + el = null; + + return isSupported; + }; + + jQuery.support.submitBubbles = eventSupported("submit"); + jQuery.support.changeBubbles = eventSupported("change"); + + // release memory in IE + root = script = div = all = a = null; +})(); + + + +var windowData = {}, + rbrace = /^(?:\{.*\}|\[.*\])$/; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + expando: "jQuery" + jQuery.now(), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + data: function( elem, name, data ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var isNode = elem.nodeType, + id = isNode ? elem[ jQuery.expando ] : null, + cache = jQuery.cache, thisCache; + + if ( isNode && !id && typeof name === "string" && data === undefined ) { + return; + } + + // Get the data from the object directly + if ( !isNode ) { + cache = elem; + + // Compute a unique ID for the element + } else if ( !id ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } + + // Avoid generating a new cache unless none exists and we + // want to manipulate it. + if ( typeof name === "object" ) { + if ( isNode ) { + cache[ id ] = jQuery.extend(cache[ id ], name); + + } else { + jQuery.extend( cache, name ); + } + + } else if ( isNode && !cache[ id ] ) { + cache[ id ] = {}; + } + + thisCache = isNode ? cache[ id ] : cache; + + // Prevent overriding the named cache with undefined values + if ( data !== undefined ) { + thisCache[ name ] = data; + } + + return typeof name === "string" ? thisCache[ name ] : thisCache; + }, + + removeData: function( elem, name ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + elem = elem == window ? + windowData : + elem; + + var isNode = elem.nodeType, + id = isNode ? elem[ jQuery.expando ] : elem, + cache = jQuery.cache, + thisCache = isNode ? cache[ id ] : id; + + // If we want to remove a specific section of the element's data + if ( name ) { + if ( thisCache ) { + // Remove the section of cache data + delete thisCache[ name ]; + + // If we've removed all the data, remove the element's cache + if ( isNode && jQuery.isEmptyObject(thisCache) ) { + jQuery.removeData( elem ); + } + } + + // Otherwise, we want to remove all of the element's data + } else { + if ( isNode && jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + + // Completely remove the data cache + } else if ( isNode ) { + delete cache[ id ]; + + // Remove all fields from the object + } else { + for ( var n in elem ) { + delete elem[ n ]; + } + } + } + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + var attr = this[0].attributes, name; + data = jQuery.data( this[0] ); + + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = name.substr( 5 ); + dataAttr( this[0], name, data[ name ] ); + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + data = elem.getAttribute( "data-" + key ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + + + + +jQuery.extend({ + queue: function( elem, type, data ) { + if ( !elem ) { + return; + } + + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( !data ) { + return q || []; + } + + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data) ); + + } else { + q.push( data ); + } + + return q; + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(); + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function( i ) { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + } +}); + + + + +var rclass = /[\n\t]/g, + rspaces = /\s+/, + rreturn = /\r/g, + rspecialurl = /^(?:href|src|style)$/, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rradiocheck = /^(?:radio|checkbox)$/i; + +jQuery.props = { + "for": "htmlFor", + "class": "className", + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + colspan: "colSpan", + tabindex: "tabIndex", + usemap: "useMap", + frameborder: "frameBorder" +}; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name, fn ) { + return this.each(function(){ + jQuery.attr( this, name, "" ); + if ( this.nodeType === 1 ) { + this.removeAttribute( name ); + } + }); + }, + + addClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.addClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( value && typeof value === "string" ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className ) { + elem.className = value; + + } else { + var className = " " + elem.className + " ", + setClass = elem.className; + + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) { + setClass += " " + classNames[c]; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + self.removeClass( value.call(this, i, self.attr("class")) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + var classNames = (value || "").split( rspaces ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + var elem = this[i]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + var className = (" " + elem.className + " ").replace(rclass, " "); + for ( var c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[c] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this); + self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspaces ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery.data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + if ( !arguments.length ) { + var elem = this[0]; + + if ( elem ) { + if ( jQuery.nodeName( elem, "option" ) ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) { + return elem.getAttribute("value") === null ? "on" : elem.value; + } + + + // Everything else, we just grab the value + return (elem.value || "").replace(rreturn, ""); + + } + + return undefined; + } + + var isFunction = jQuery.isFunction(value); + + return this.each(function(i) { + var self = jQuery(this), val = value; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call(this, i, self.val()); + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray(val) ) { + val = jQuery.map(val, function (value) { + return value == null ? "" : value + ""; + }); + } + + if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) { + this.checked = jQuery.inArray( self.val(), val ) >= 0; + + } else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(val); + + jQuery( "option", this ).each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + this.selectedIndex = -1; + } + + } else { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + // don't set attributes on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery(elem)[name](value); + } + + var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // These attributes require special treatment + var special = rspecialurl.test( name ); + + // Safari mis-reports the default selected property of an option + // Accessing the parent's selectedIndex property fixes it + if ( name === "selected" && !jQuery.support.optSelected ) { + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + + // If applicable, access the attribute via the DOM 0 way + // 'in' checks fail in Blackberry 4.7 #6931 + if ( (name in elem || elem[ name ] !== undefined) && notxml && !special ) { + if ( set ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } + + if ( value === null ) { + if ( elem.nodeType === 1 ) { + elem.removeAttribute( name ); + } + + } else { + elem[ name ] = value; + } + } + + // browsers index elements by id/name on forms, give priority to attributes. + if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) { + return elem.getAttributeNode( name ).nodeValue; + } + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name === "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + + return attributeNode && attributeNode.specified ? + attributeNode.value : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name === "style" ) { + if ( set ) { + elem.style.cssText = "" + value; + } + + return elem.style.cssText; + } + + if ( set ) { + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + } + + // Ensure that missing attributes return undefined + // Blackberry 4.7 returns "" from getAttribute #6938 + if ( !elem.attributes[ name ] && (elem.hasAttribute && !elem.hasAttribute( name )) ) { + return undefined; + } + + var attr = !jQuery.support.hrefNormalized && notxml && special ? + // Some attributes require a special call on IE + elem.getAttribute( name, 2 ) : + elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspace = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }, + focusCounts = { focusin: 0, focusout: 0 }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( jQuery.isWindow( elem ) && ( elem !== window && !elem.frameElement ) ) { + elem = window; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery.data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + // Use a key less likely to result in collisions for plain JS objects. + // Fixes bug #7150. + var eventKey = elem.nodeType ? "events" : "__events__", + events = elemData[ eventKey ], + eventHandle = elemData.handle; + + if ( typeof events === "function" ) { + // On plain objects events is a fn that holds the the data + // which prevents this data from being JSON serialized + // the function does not need to be called, it just contains the data + eventHandle = events.handle; + events = events.events; + + } else if ( !events ) { + if ( !elem.nodeType ) { + // On plain objects, create a fn that acts as the holder + // of the values to avoid JSON serialization of event data + elemData[ eventKey ] = elemData = function(){}; + } + + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function() { + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for global triggering + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + eventKey = elem.nodeType ? "events" : "__events__", + elemData = jQuery.data( elem ), + events = elemData && elemData[ eventKey ]; + + if ( !elemData || !events ) { + return; + } + + if ( typeof events === "function" ) { + elemData = events; + events = events.events; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( typeof elemData === "function" ) { + jQuery.removeData( elem, eventKey ); + + } else if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem /*, bubbling */ ) { + // Event object or event type + var type = event.type || event, + bubbling = arguments[3]; + + if ( !bubbling ) { + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + + // Only trigger if we've ever bound an event for it + if ( jQuery.event.global[ type ] ) { + jQuery.each( jQuery.cache, function() { + if ( this.events && this.events[type] ) { + jQuery.event.trigger( event, data, this.handle.elem ); + } + }); + } + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) { + return undefined; + } + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray( data ); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = elem.nodeType ? + jQuery.data( elem, "handle" ) : + (jQuery.data( elem, "__events__" ) || {}).handle; + + if ( handle ) { + handle.apply( elem, data ); + } + + var parent = elem.parentNode || elem.ownerDocument; + + // Trigger an inline bound script + try { + if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) { + if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) { + event.result = false; + event.preventDefault(); + } + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (inlineError) {} + + if ( !event.isPropagationStopped() && parent ) { + jQuery.event.trigger( event, data, parent, true ); + + } else if ( !event.isDefaultPrevented() ) { + var old, + target = event.target, + targetType = type.replace( rnamespaces, "" ), + isClick = jQuery.nodeName( target, "a" ) && targetType === "click", + special = jQuery.event.special[ targetType ] || {}; + + if ( (!special._default || special._default.call( elem, event ) === false) && + !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) { + + try { + if ( target[ targetType ] ) { + // Make sure that we don't accidentally re-trigger the onFOO events + old = target[ "on" + targetType ]; + + if ( old ) { + target[ "on" + targetType ] = null; + } + + jQuery.event.triggered = true; + target[ targetType ](); + } + + // prevent IE from throwing an error for some elements with some event types, see #3533 + } catch (triggerError) {} + + if ( old ) { + target[ "on" + targetType ] = old; + } + + jQuery.event.triggered = false; + } + } + }, + + handle: function( event ) { + var all, handlers, namespaces, namespace_re, events, + namespace_sort = [], + args = jQuery.makeArray( arguments ); + + event = args[0] = jQuery.event.fix( event || window.event ); + event.currentTarget = this; + + // Namespaced event handlers + all = event.type.indexOf(".") < 0 && !event.exclusive; + + if ( !all ) { + namespaces = event.type.split("."); + event.type = namespaces.shift(); + namespace_sort = namespaces.slice(0).sort(); + namespace_re = new RegExp("(^|\\.)" + namespace_sort.join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.namespace = event.namespace || namespace_sort.join("."); + + events = jQuery.data(this, this.nodeType ? "events" : "__events__"); + + if ( typeof events === "function" ) { + events = events.events; + } + + handlers = (events || {})[ event.type ]; + + if ( events && handlers ) { + // Clone the handlers to prevent manipulation + handlers = handlers.slice(0); + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Filter the functions by class + if ( all || namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + } + + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, + body = document.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + // Event type + } else { + this.type = src; + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + + // Firefox sometimes assigns relatedTarget a XUL element + // which we cannot access the parentNode property of + try { + // Traverse up the tree + while ( parent && parent !== this ) { + parent = parent.parentNode; + } + + if ( parent !== this ) { + // set the correct event type + event.type = event.data; + + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } + + // assuming we've left the element since we most likely mousedover a xul element + } catch(e) { } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( this.nodeName.toLowerCase() !== "form" ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + e.liveFired = undefined; + return trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + e.liveFired = undefined; + return trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( elem.nodeName.toLowerCase() === "select" ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery.data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery.data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + return jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = elem.type; + + if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) { + return testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = elem.type; + + if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + return testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery.data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + args[0].type = type; + return jQuery.event.handle.apply( elem, args ); +} + +// Create "bubbling" focus and blur events +if ( document.addEventListener ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + jQuery.event.special[ fix ] = { + setup: function() { + if ( focusCounts[fix]++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --focusCounts[fix] === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( e ) { + e = jQuery.event.fix( e ); + e.type = fix; + return jQuery.event.trigger( e, null, e.target ); + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( jQuery.isFunction( data ) || data === false ) { + fn = data; + data = undefined; + } + + var handler = name === "one" ? jQuery.proxy( fn, function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }) : fn; + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + var event = jQuery.Event( type ); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + i = 1; + + // link all the functions, so any of them can unbind this click handler + while ( i < args.length ) { + jQuery.proxy( fn, args[ i++ ] ); + } + + return this.click( jQuery.proxy( fn, function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + })); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( jQuery.isFunction( data ) ) { + fn = data; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( type === "focus" || type === "blur" ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery.data( this, this.nodeType ? "events" : "__events__" ); + + if ( typeof events === "function" ) { + events = events.events; + } + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) + if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspace, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + +// Prevent memory leaks in IE +// Window isn't included so as not to unbind existing unload events +// More info: +// - http://isaacschlueter.com/2006/10/msie-memory-leaks/ +if ( window.attachEvent && !window.addEventListener ) { + jQuery(window).bind("unload", function() { + for ( var id in jQuery.cache ) { + if ( jQuery.cache[ id ].handle ) { + // Try/Catch is to handle iframes being unloaded, see #4280 + try { + jQuery.event.remove( jQuery.cache[ id ].handle.elem ); + } catch(e) {} + } + } + }); +} + + +/*! + * Sizzle CSS Selector Engine - v1.0 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName( "*" ); + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+\-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !/\W/.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !/\W/.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test(part) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !/\W/.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + return context.getElementsByTagName( match[1] ); + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace(/\\/g, "") + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace(/\\/g, ""); + }, + + TAG: function( match, curLoop ) { + return match[1].toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1].replace(/\\/g, ""); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + elem.parentNode.selectedIndex; + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + return "text" === elem.type; + }, + radio: function( elem ) { + return "radio" === elem.type; + }, + + checkbox: function( elem ) { + return "checkbox" === elem.type; + }, + + file: function( elem ) { + return "file" === elem.type; + }, + password: function( elem ) { + return "password" === elem.type; + }, + + submit: function( elem ) { + return "submit" === elem.type; + }, + + image: function( elem ) { + return "image" === elem.type; + }, + + reset: function( elem ) { + return "reset" === elem.type; + }, + + button: function( elem ) { + return "button" === elem.type || elem.nodeName.toLowerCase() === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( "Syntax error, unrecognized expression: " + name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // If the nodes are siblings (or identical) we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Make sure that attribute selectors are quoted + query = query.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + if ( context.nodeType === 9 ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var old = context.getAttribute( "id" ), + nid = old || id; + + if ( !old ) { + context.setAttribute( "id", nid ); + } + + try { + return makeArray( context.querySelectorAll( "#" + nid + " " + query ), extra ); + + } catch(pseudoError) { + } finally { + if ( !old ) { + context.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector, + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + if ( matches ) { + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + return matches.call( node, expr ); + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS; + +jQuery.fn.extend({ + find: function( selector ) { + var ret = this.pushStack( "", "find", selector ), + length = 0; + + for ( var i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( var n = length; n < ret.length; n++ ) { + for ( var r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && jQuery.filter( selector, this ).length > 0; + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[selector] ) { + matches[selector] = jQuery.expr.match.POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[selector]; + + if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + var pos = POS.test( selectors ) ? + jQuery( selectors, context || this.context ) : null; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique(ret) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context || this.context ) : + jQuery.makeArray( selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, slice.call(arguments).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnocache = /<(?:script|object|embed|option|style)/i, + // checked="checked" or checked (html5) + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + raction = /\=([^="'>\s]+\/)>/g, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( events ) { + // Do the clone + var ret = this.map(function() { + if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { + // IE copies events bound via attachEvent when + // using cloneNode. Calling detachEvent on the + // clone will also remove the events from the orignal + // In order to get around this, we use innerHTML. + // Unfortunately, this means some modifications to + // attributes in IE that are actually only stored + // as properties will not be copied (such as the + // the name attribute on an input). + var html = this.outerHTML, + ownerDocument = this.ownerDocument; + + if ( !html ) { + var div = ownerDocument.createElement("div"); + div.appendChild( this.cloneNode(true) ); + html = div.innerHTML; + } + + return jQuery.clean([html.replace(rinlinejQuery, "") + // Handle the case in IE 8 where action=/test/> self-closes a tag + .replace(raction, '="$1">') + .replace(rleadingWhitespace, "")], ownerDocument)[0]; + } else { + return this.cloneNode(true); + } + }); + + // Copy the events from the original to the clone + if ( events === true ) { + cloneCopyEvent( this, ret ); + cloneCopyEvent( this.find("*"), ret.find("*") ); + } + + // Return the cloned set + return ret; + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnocache.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ); + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + i > 0 || results.cacheable || this.length > 1 ? + fragment.cloneNode(true) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent(orig, ret) { + var i = 0; + + ret.each(function() { + if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) { + return; + } + + var oldData = jQuery.data( orig[i++] ), + curData = jQuery.data( this, oldData ), + events = oldData && oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( var type in events ) { + for ( var handler in events[ type ] ) { + jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data ); + } + } + } + }); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, + doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document); + + // Only cache "small" (1/2 KB) strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document && + !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) { + + cacheable = true; + cacheresults = jQuery.fragments[ args[0] ]; + if ( cacheresults ) { + if ( cacheresults !== 1 ) { + fragment = cacheresults; + } + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +jQuery.extend({ + clean: function( elems, context, fragment, scripts ) { + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = []; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" && !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + + } else if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( var j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, cache = jQuery.cache, + special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rdashAlpha = /-([a-z])/ig, + rupper = /([A-Z])/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle, + + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "zIndex": true, + "fontWeight": true, + "opacity": true, + "zoom": true, + "lineHeight": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + // Make sure that NaN and null values aren't set. See: #7116 + if ( typeof value === "number" && isNaN( value ) || value == null ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( typeof value === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + // Make sure that we're working with the right name + var ret, origName = jQuery.camelCase( name ), + hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name, origName ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + }, + + camelCase: function( string ) { + return string.replace( rdashAlpha, fcamelCase ); + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + val = getWH( elem, name, extra ); + + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + if ( val <= 0 ) { + val = curCSS( elem, name, name ); + + if ( val === "0px" && currentStyle ) { + val = currentStyle( elem, name, name ); + } + + if ( val != null ) { + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + } + + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + + // Should return "auto" instead of 0, use 0 for + // temporary backwards-compat + return val === "" || val === "auto" ? "0px" : val; + } + + return typeof val === "string" ? val : val + "px"; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat(value); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test((computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "") ? + (parseFloat(RegExp.$1) / 100) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // Set the alpha filter to set the opacity + var opacity = jQuery.isNaN(value) ? + "" : + "alpha(opacity=" + value * 100 + ")", + filter = style.filter || ""; + + style.filter = ralpha.test(filter) ? + filter.replace(ralpha, opacity) : + style.filter + ' ' + opacity; + } + }; +} + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, newName, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + elem.runtimeStyle.left = elem.currentStyle.left; + style.left = name === "fontSize" ? "1em" : (ret || 0); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + elem.runtimeStyle.left = rsLeft; + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + var which = name === "width" ? cssWidth : cssHeight, + val = name === "width" ? elem.offsetWidth : elem.offsetHeight; + + if ( extra === "border" ) { + return val; + } + + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat(jQuery.css( elem, "padding" + this )) || 0; + } + + if ( extra === "margin" ) { + val += parseFloat(jQuery.css( elem, "margin" + this )) || 0; + + } else { + val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) || 0; + } + }); + + return val; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var jsc = jQuery.now(), + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rnoContent = /^(?:GET|HEAD)$/, + rbracket = /\[\]$/, + jsre = /\=\?(&|$)/, + rquery = /\?/, + rts = /([?&])_=[^&]*/, + rurl = /^(\w+:)?\/\/([^\/?#]+)/, + r20 = /%20/g, + rhash = /#.*$/, + + // Keep a copy of the old load method + _load = jQuery.fn.load; + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf(" "); + if ( off >= 0 ) { + var selector = url.slice(off, url.length); + url = url.slice(0, off); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = null; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + complete: function( res, status ) { + // If successful, inject the HTML into all the matched elements + if ( status === "success" || status === "notmodified" ) { + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(res.responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + res.responseText ); + } + + if ( callback ) { + self.each( callback, [res.responseText, status, res] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param(this.serializeArray()); + }, + + serializeArray: function() { + return this.map(function() { + return this.elements ? jQuery.makeArray(this.elements) : this; + }) + .filter(function() { + return this.name && !this.disabled && + (this.checked || rselectTextarea.test(this.nodeName) || + rinput.test(this.type)); + }) + .map(function( i, elem ) { + var val = jQuery(this).val(); + + return val == null ? + null : + jQuery.isArray(val) ? + jQuery.map( val, function( val, i ) { + return { name: elem.name, value: val }; + }) : + { name: elem.name, value: val }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) { + jQuery.fn[o] = function( f ) { + return this.bind(o, f); + }; +}); + +jQuery.extend({ + get: function( url, data, callback, type ) { + // shift arguments if data argument was omited + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = null; + } + + return jQuery.ajax({ + type: "GET", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + getScript: function( url, callback ) { + return jQuery.get(url, null, callback, "script"); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get(url, data, callback, "json"); + }, + + post: function( url, data, callback, type ) { + // shift arguments if data argument was omited + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = {}; + } + + return jQuery.ajax({ + type: "POST", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + ajaxSetup: function( settings ) { + jQuery.extend( jQuery.ajaxSettings, settings ); + }, + + ajaxSettings: { + url: location.href, + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + username: null, + password: null, + traditional: false, + */ + // This function can be overriden by calling jQuery.ajaxSetup + xhr: function() { + return new window.XMLHttpRequest(); + }, + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + script: "text/javascript, application/javascript", + json: "application/json, text/javascript", + text: "text/plain", + _default: "*/*" + } + }, + + ajax: function( origSettings ) { + var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings), + jsonp, status, data, type = s.type.toUpperCase(), noContent = rnoContent.test(type); + + s.url = s.url.replace( rhash, "" ); + + // Use original (not extended) context object if it was provided + s.context = origSettings && origSettings.context != null ? origSettings.context : s; + + // convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Handle JSONP Parameter Callbacks + if ( s.dataType === "jsonp" ) { + if ( type === "GET" ) { + if ( !jsre.test( s.url ) ) { + s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?"; + } + } else if ( !s.data || !jsre.test(s.data) ) { + s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?"; + } + s.dataType = "json"; + } + + // Build temporary JSONP function + if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) { + jsonp = s.jsonpCallback || ("jsonp" + jsc++); + + // Replace the =? sequence both in the query string and the data + if ( s.data ) { + s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1"); + } + + s.url = s.url.replace(jsre, "=" + jsonp + "$1"); + + // We need to make sure + // that a JSONP style response is executed properly + s.dataType = "script"; + + // Handle JSONP-style loading + var customJsonp = window[ jsonp ]; + + window[ jsonp ] = function( tmp ) { + if ( jQuery.isFunction( customJsonp ) ) { + customJsonp( tmp ); + + } else { + // Garbage collect + window[ jsonp ] = undefined; + + try { + delete window[ jsonp ]; + } catch( jsonpError ) {} + } + + data = tmp; + jQuery.handleSuccess( s, xhr, status, data ); + jQuery.handleComplete( s, xhr, status, data ); + + if ( head ) { + head.removeChild( script ); + } + }; + } + + if ( s.dataType === "script" && s.cache === null ) { + s.cache = false; + } + + if ( s.cache === false && noContent ) { + var ts = jQuery.now(); + + // try replacing _= if it is there + var ret = s.url.replace(rts, "$1_=" + ts); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : ""); + } + + // If data is available, append data to url for GET/HEAD requests + if ( s.data && noContent ) { + s.url += (rquery.test(s.url) ? "&" : "?") + s.data; + } + + // Watch for a new set of requests + if ( s.global && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Matches an absolute URL, and saves the domain + var parts = rurl.exec( s.url ), + remote = parts && (parts[1] && parts[1].toLowerCase() !== location.protocol || parts[2].toLowerCase() !== location.host); + + // If we're requesting a remote document + // and trying to load JSON or Script with a GET + if ( s.dataType === "script" && type === "GET" && remote ) { + var head = document.getElementsByTagName("head")[0] || document.documentElement; + var script = document.createElement("script"); + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + script.src = s.url; + + // Handle Script loading + if ( !jsonp ) { + var done = false; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function() { + if ( !done && (!this.readyState || + this.readyState === "loaded" || this.readyState === "complete") ) { + done = true; + jQuery.handleSuccess( s, xhr, status, data ); + jQuery.handleComplete( s, xhr, status, data ); + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + if ( head && script.parentNode ) { + head.removeChild( script ); + } + } + }; + } + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + + // We handle everything using the script element injection + return undefined; + } + + var requestDone = false; + + // Create the request object + var xhr = s.xhr(); + + if ( !xhr ) { + return; + } + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open(type, s.url, s.async, s.username, s.password); + } else { + xhr.open(type, s.url, s.async); + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + // Set content-type if data specified and content-body is valid for this type + if ( (s.data != null && !noContent) || (origSettings && origSettings.contentType) ) { + xhr.setRequestHeader("Content-Type", s.contentType); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[s.url] ) { + xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]); + } + + if ( jQuery.etag[s.url] ) { + xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]); + } + } + + // Set header so the called script knows that it's an XMLHttpRequest + // Only send the header if it's not a remote XHR + if ( !remote ) { + xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + } + + // Set the Accepts header for the server, depending on the dataType + xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ? + s.accepts[ s.dataType ] + ", */*; q=0.01" : + s.accepts._default ); + } catch( headerError ) {} + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && s.beforeSend.call(s.context, xhr, s) === false ) { + // Handle the global AJAX counter + if ( s.global && jQuery.active-- === 1 ) { + jQuery.event.trigger( "ajaxStop" ); + } + + // close opended socket + xhr.abort(); + return false; + } + + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxSend", [xhr, s] ); + } + + // Wait for a response to come back + var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) { + // The request was aborted + if ( !xhr || xhr.readyState === 0 || isTimeout === "abort" ) { + // Opera doesn't call onreadystatechange before this point + // so we simulate the call + if ( !requestDone ) { + jQuery.handleComplete( s, xhr, status, data ); + } + + requestDone = true; + if ( xhr ) { + xhr.onreadystatechange = jQuery.noop; + } + + // The transfer is complete and the data is available, or the request timed out + } else if ( !requestDone && xhr && (xhr.readyState === 4 || isTimeout === "timeout") ) { + requestDone = true; + xhr.onreadystatechange = jQuery.noop; + + status = isTimeout === "timeout" ? + "timeout" : + !jQuery.httpSuccess( xhr ) ? + "error" : + s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? + "notmodified" : + "success"; + + var errMsg; + + if ( status === "success" ) { + // Watch for, and catch, XML document parse errors + try { + // process the data (runs the xml through httpData regardless of callback) + data = jQuery.httpData( xhr, s.dataType, s ); + } catch( parserError ) { + status = "parsererror"; + errMsg = parserError; + } + } + + // Make sure that the request was successful or notmodified + if ( status === "success" || status === "notmodified" ) { + // JSONP handles its own success callback + if ( !jsonp ) { + jQuery.handleSuccess( s, xhr, status, data ); + } + } else { + jQuery.handleError( s, xhr, status, errMsg ); + } + + // Fire the complete handlers + if ( !jsonp ) { + jQuery.handleComplete( s, xhr, status, data ); + } + + if ( isTimeout === "timeout" ) { + xhr.abort(); + } + + // Stop memory leaks + if ( s.async ) { + xhr = null; + } + } + }; + + // Override the abort handler, if we can (IE 6 doesn't allow it, but that's OK) + // Opera doesn't fire onreadystatechange at all on abort + try { + var oldAbort = xhr.abort; + xhr.abort = function() { + if ( xhr ) { + // oldAbort has no call property in IE7 so + // just do it this way, which works in all + // browsers + Function.prototype.call.call( oldAbort, xhr ); + } + + onreadystatechange( "abort" ); + }; + } catch( abortError ) {} + + // Timeout checker + if ( s.async && s.timeout > 0 ) { + setTimeout(function() { + // Check to see if the request is still happening + if ( xhr && !requestDone ) { + onreadystatechange( "timeout" ); + } + }, s.timeout); + } + + // Send the data + try { + xhr.send( noContent || s.data == null ? null : s.data ); + + } catch( sendError ) { + jQuery.handleError( s, xhr, null, sendError ); + + // Fire the complete handlers + jQuery.handleComplete( s, xhr, status, data ); + } + + // firefox 1.5 doesn't fire statechange for sync requests + if ( !s.async ) { + onreadystatechange(); + } + + // return XMLHttpRequest to allow aborting the request etc. + return xhr; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction(value) ? value() : value; + s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray(a) || a.jquery ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[prefix], traditional, add ); + } + } + + // Return the resulting serialization + return s.join("&").replace(r20, "+"); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray(obj) && obj.length ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + if ( jQuery.isEmptyObject( obj ) ) { + add( prefix, "" ); + + // Serialize object item. + } else { + jQuery.each( obj, function( k, v ) { + buildParams( prefix + "[" + k + "]", v, traditional, add ); + }); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + handleError: function( s, xhr, status, e ) { + // If a local callback was specified, fire it + if ( s.error ) { + s.error.call( s.context, xhr, status, e ); + } + + // Fire the global callback + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxError", [xhr, s, e] ); + } + }, + + handleSuccess: function( s, xhr, status, data ) { + // If a local callback was specified, fire it and pass it the data + if ( s.success ) { + s.success.call( s.context, data, status, xhr ); + } + + // Fire the global callback + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxSuccess", [xhr, s] ); + } + }, + + handleComplete: function( s, xhr, status ) { + // Process result + if ( s.complete ) { + s.complete.call( s.context, xhr, status ); + } + + // The request was completed + if ( s.global ) { + jQuery.triggerGlobal( s, "ajaxComplete", [xhr, s] ); + } + + // Handle the global AJAX counter + if ( s.global && jQuery.active-- === 1 ) { + jQuery.event.trigger( "ajaxStop" ); + } + }, + + triggerGlobal: function( s, type, args ) { + (s.context && s.context.url == null ? jQuery(s.context) : jQuery.event).trigger(type, args); + }, + + // Determines if an XMLHttpRequest was successful or not + httpSuccess: function( xhr ) { + try { + // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450 + return !xhr.status && location.protocol === "file:" || + xhr.status >= 200 && xhr.status < 300 || + xhr.status === 304 || xhr.status === 1223; + } catch(e) {} + + return false; + }, + + // Determines if an XMLHttpRequest returns NotModified + httpNotModified: function( xhr, url ) { + var lastModified = xhr.getResponseHeader("Last-Modified"), + etag = xhr.getResponseHeader("Etag"); + + if ( lastModified ) { + jQuery.lastModified[url] = lastModified; + } + + if ( etag ) { + jQuery.etag[url] = etag; + } + + return xhr.status === 304; + }, + + httpData: function( xhr, type, s ) { + var ct = xhr.getResponseHeader("content-type") || "", + xml = type === "xml" || !type && ct.indexOf("xml") >= 0, + data = xml ? xhr.responseXML : xhr.responseText; + + if ( xml && data.documentElement.nodeName === "parsererror" ) { + jQuery.error( "parsererror" ); + } + + // Allow a pre-filtering function to sanitize the response + // s is checked to keep backwards compatibility + if ( s && s.dataFilter ) { + data = s.dataFilter( data, type ); + } + + // The filter can actually parse the response + if ( typeof data === "string" ) { + // Get the JavaScript object, if JSON is used. + if ( type === "json" || !type && ct.indexOf("json") >= 0 ) { + data = jQuery.parseJSON( data ); + + // If the type is "script", eval it in global context + } else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) { + jQuery.globalEval( data ); + } + } + + return data; + } + +}); + +/* + * Create the request object; Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ +if ( window.ActiveXObject ) { + jQuery.ajaxSettings.xhr = function() { + if ( window.location.protocol !== "file:" ) { + try { + return new window.XMLHttpRequest(); + } catch(xhrError) {} + } + + try { + return new window.ActiveXObject("Microsoft.XMLHTTP"); + } catch(activeError) {} + }; +} + +// Does this browser support XHR requests? +jQuery.support.ajax = !!jQuery.ajaxSettings.xhr(); + + + + +var elemdisplay = {}, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)(.*)$/, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ]; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery.data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css( elem, "display" ) === "none" ) { + jQuery.data(elem, "olddisplay", defaultDisplay(elem.nodeName)); + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[i]; + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery.data(elem, "olddisplay") || ""; + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + var display = jQuery.css( this[i], "display" ); + + if ( display !== "none" ) { + jQuery.data( this[i], "olddisplay", display ); + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + this[i].style.display = "none"; + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete ); + } + + return this[ optall.queue === false ? "each" : "queue" ](function() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + var opt = jQuery.extend({}, optall), p, + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + self = this; + + for ( p in prop ) { + var name = jQuery.camelCase( p ); + + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + p = name; + } + + if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) { + return opt.complete.call(this); + } + + if ( isElement && ( p === "height" || p === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height + // animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + if ( !jQuery.support.inlineBlockNeedsLayout ) { + this.style.display = "inline-block"; + + } else { + var display = defaultDisplay(this.nodeName); + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( display === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.display = "inline"; + this.style.zoom = 1; + } + } + } + } + + if ( jQuery.isArray( prop[p] ) ) { + // Create (if needed) and add to specialEasing + (opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1]; + prop[p] = prop[p][0]; + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + opt.curAnim = jQuery.extend({}, prop); + + jQuery.each( prop, function( name, val ) { + var e = new jQuery.fx( self, opt, name ); + + if ( rfxtypes.test(val) ) { + e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop ); + + } else { + var parts = rfxnum.exec(val), + start = e.cur() || 0; + + if ( parts ) { + var end = parseFloat( parts[2] ), + unit = parts[3] || "px"; + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( self, name, (end || 1) + unit); + start = ((end || 1) / e.cur()) * start; + jQuery.style( self, name, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ((parts[1] === "-=" ? -1 : 1) * end) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + }); + + // For JS strict compliance + return true; + }); + }, + + stop: function( clearQueue, gotoEnd ) { + var timers = jQuery.timers; + + if ( clearQueue ) { + this.queue([]); + } + + this.each(function() { + // go in reverse order so anything added to the queue during the loop is ignored + for ( var i = timers.length - 1; i >= 0; i-- ) { + if ( timers[i].elem === this ) { + if (gotoEnd) { + // force the next step to be the last + timers[i](true); + } + + timers.splice(i, 1); + } + } + }); + + // start the next in the queue if the last step wasn't forced + if ( !gotoEnd ) { + this.dequeue(); + } + + return this; + } + +}); + +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function() { + if ( opt.queue !== false ) { + jQuery(this).dequeue(); + } + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + if ( !options.orig ) { + options.orig = {}; + } + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) { + return this.elem[ this.prop ]; + } + + var r = parseFloat( jQuery.css( this.elem, this.prop ) ); + return r && r > -10000 ? r : 0; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = jQuery.now(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || "px"; + this.now = this.start; + this.pos = this.state = 0; + + function t( gotoEnd ) { + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval(fx.tick, fx.interval); + } + }, + + // Simple 'show' function + show: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var t = jQuery.now(), done = true; + + if ( gotoEnd || t >= this.options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + this.options.curAnim[ this.prop ] = true; + + for ( var i in this.options.curAnim ) { + if ( this.options.curAnim[i] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( this.options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + var elem = this.elem, + options = this.options; + + jQuery.each( [ "", "X", "Y" ], function (index, value) { + elem.style[ "overflow" + value ] = options.overflow[index]; + } ); + } + + // Hide the element if the "hide" operation was done + if ( this.options.hide ) { + jQuery(this.elem).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( this.options.hide || this.options.show ) { + for ( var p in this.options.curAnim ) { + jQuery.style( this.elem, p, this.options.orig[p] ); + } + } + + // Execute the complete function + this.options.complete.call( this.elem ); + } + + return false; + + } else { + var n = t - this.startTime; + this.state = n / this.options.duration; + + // Perform the easing function, defaults to swing + var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop]; + var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear"); + this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration); + this.now = this.start + ((this.end - this.start) * this.pos); + + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + var timers = jQuery.timers; + + for ( var i = 0; i < timers.length; i++ ) { + if ( !timers[i]() ) { + timers.splice(i--, 1); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +function defaultDisplay( nodeName ) { + if ( !elemdisplay[ nodeName ] ) { + var elem = jQuery("<" + nodeName + ">").appendTo("body"), + display = elem.css("display"); + + elem.remove(); + + if ( display === "none" || display === "" ) { + display = "block"; + } + + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box || { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = (win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop ), + scrollLeft = (win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft), + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + jQuery.offset.initialize(); + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + initialize: function() { + var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0, + html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>"; + + jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } ); + + container.innerHTML = html; + body.insertBefore( container, body.firstChild ); + innerDiv = container.firstChild; + checkDiv = innerDiv.firstChild; + td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + checkDiv.style.position = "fixed"; + checkDiv.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15); + checkDiv.style.position = checkDiv.style.top = ""; + + innerDiv.style.overflow = "hidden"; + innerDiv.style.position = "relative"; + + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop); + + body.removeChild( container ); + body = container = innerDiv = checkDiv = table = td = null; + jQuery.offset.initialize = jQuery.noop; + }, + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + jQuery.offset.initialize(); + + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = (position === "absolute" && jQuery.inArray('auto', [curCSSTop, curCSSLeft]) > -1), + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is absolute + if ( calculatePosition ) { + curPosition = curElem.position(); + } + + // curTop = calculatePosition ? curPosition.top : parseInt( curCSSTop, 10 ) || 0; + // curLeft = calculatePosition ? curPosition.left : parseInt( curCSSLeft, 10 ) || 0; + curTop = calculatePosition ? curPosition.top : parseFloat( curCSSTop ) || 0; + curLeft = calculatePosition ? curPosition.left : parseFloat( curCSSLeft ) || 0; + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if (options.top != null) { + props.top = (options.top - curOffset.top) + curTop; + } + if (options.left != null) { + props.left = (options.left - curOffset.left) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function(val) { + var elem = this[0], win; + + if ( !elem ) { + return null; + } + + if ( val !== undefined ) { + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery(win).scrollLeft(), + i ? val : jQuery(win).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + } else { + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function() { + return this[0] ? + parseFloat( jQuery.css( this[0], type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function( margin ) { + return this[0] ? + parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + return elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] || + elem.document.body[ "client" + name ]; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +})(window);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery-test-embedded-rc.html Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,108 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <title>Digilib jQuery Test: embedded</title> + + <style type="text/css"> + body { + background: silver; + } + + div.digilib { + /* padding for buttons and bird-div */ + padding-right: 18px; + padding-bottom: 100px; + /* width: 220px; */ + } + + td { + vertical-align: top; + } + + #debug { + background-color: beige; + position: absolute; + top: 400px; + padding: 0px 10px; + font-family: Arial; + font-size: 9pt; + } + + div._log { + color: grey; + } + + div._debug { + color: darkgreen; + } + + div._error { + color: red; + } + + div#test:hover { + background-color: cornsilk; + } + + </style> + + <script type="text/javascript" src="jquery-1.4.4.js"></script> + <script type="text/javascript" src="dlGeometry.js"></script> + <script type="text/javascript" src="jquery.cookie.js"></script> + <script type="text/javascript" src="jquery.digilib.js"></script> + <link rel="stylesheet" type="text/css" href="jquery.digilib.css" /> + + + <script type="text/javascript"> + $(document).ready(function(){ + $('div.digilib').digilib({ + interactionMode : 'embedded', + birdDivWidth : 100, + birdDivHeight : 100 + }); + + $('div.digilib').each(function(){ + console.log($(this).data('digilib').settings); + }); + + }); + + </script> + </head> + + <body> + <table> + <tr> + <td> + <div id="digilib-1" class="digilib single"> + <img src="http://localhost:18080/digitallibrary/servlet/Scaler?dw=200&dh=200&fn=163127KK/pageimg&pn=11" /> + </div> + </td> + + <td> + <div id="digilib-2" class="digilib"> + <img src="http://localhost:18080/digitallibrary/servlet/Scaler?dw=200&dh=200&fn=163127KK/pageimg&pn=12" /> + </div> + </td> + + <td> + <div id="digilib-3" class="digilib"> + <img src="http://localhost:18080/digitallibrary/servlet/Scaler?dw=200&dh=200&fn=163127KK/pageimg&pn=13" /> + </div> + </td> + + <td> + <div id="digilib-4" class="digilib"> + <img src="http://localhost:18080/digitallibrary/servlet/Scaler?dw=200&dh=200&fn=163127KK/pageimg&pn=14" /> + </div> + </td> + </tr> + </table> + <div id="debug">DEBUG</div> + <div id="test"> + <img id="test" src="img/black-glass-16.png"></img> + <img id="test2" src="img/black-glass-32.png"></img> + </div> + </body> +</html> +
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery-test-embedded.html Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,108 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <title>Digilib jQuery Test: embedded</title> + + <style type="text/css"> + body { + background: silver; + } + + div.digilib { + /* padding for buttons and bird-div */ + padding-right: 18px; + padding-bottom: 100px; + /* width: 220px; */ + } + + td { + vertical-align: top; + } + + #debug { + background-color: beige; + position: absolute; + top: 400px; + padding: 0px 10px; + font-family: Arial; + font-size: 9pt; + } + + div._log { + color: grey; + } + + div._debug { + color: darkgreen; + } + + div._error { + color: red; + } + + div#test:hover { + background-color: cornsilk; + } + + </style> + + <script type="text/javascript" src="jquery-1.4.4.js"></script> + <script type="text/javascript" src="dlGeometry.js"></script> + <script type="text/javascript" src="jquery.cookie.js"></script> + <script type="text/javascript" src="jquery.digilib.js"></script> + <link rel="stylesheet" type="text/css" href="jquery.digilib.css" /> + + + <script type="text/javascript"> + $(document).ready(function(){ + $('div.digilib').digilib({ + interactionMode : 'embedded', + birdDivWidth : 100, + birdDivHeight : 100 + }); + + $('div.digilib').each(function(){ + console.log($(this).data('digilib').settings); + }); + + }); + + </script> + </head> + + <body> + <table> + <tr> + <td> + <div id="digilib-1" class="digilib single"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/&pn=1" /> + </div> + </td> + + <td> + <div id="digilib-2" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/ferrara" /> + </div> + </td> + + <td> + <div id="digilib-3" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/weide" /> + </div> + </td> + + <td> + <div id="digilib-4" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/HansHolbein-NikolausKratzer" /> + </div> + </td> + </tr> + </table> + <div id="debug">DEBUG</div> + <div id="test"> + <img id="test" src="img/black-glass-16.png"></img> + <img id="test2" src="img/black-glass-32.png"></img> + </div> + </body> +</html> +
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery-test-full-rc.html Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,40 @@ +<?xml version="1.0" ?> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <title>Digilib jQuery Test: fullscreen</title> + + <style type="text/css"> + body { + background: silver; + } + + </style> + + <script type="text/javascript" src="jquery-1.4.4.js"></script> + <script type="text/javascript" src="dlGeometry.js"></script> + <script type="text/javascript" src="jquery.cookie.js"></script> + <script type="text/javascript" src="jquery.digilib.js"></script> + <link rel="stylesheet" type="text/css" href="jquery.digilib.css" /> + + + <script type="text/javascript"> + $(document).ready(function(){ + var opts = { + interactionMode : 'fullscreen', + scalerBaseUrl : 'http://localhost:18080/digitallibrary/servlet/Scaler' + }; + $('div.digilib').digilib(opts); + }); + + </script> + </head> + + <body> + + <div id="digilib-1" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/FransHals-WillemVanHeythuysen" /> + </div> + </body> +</html> +
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery-test-full.html Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,53 @@ +<?xml version="1.0" ?> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <title>Digilib jQuery Test: fullscreen</title> + + <style type="text/css"> + body { + background: silver; + } + + #debug { + background-color: beige; + position: absolute; + opacity: 50%; + top: 4px; + left: 300px; + width: 500px; + padding: 0px 5px; + font-family: Arial; + font-size: 9px; + } + + </style> + + <script type="text/javascript" src="jquery-1.4.4.js"></script> + <script type="text/javascript" src="dlGeometry.js"></script> + <script type="text/javascript" src="jquery.cookie.js"></script> + <script type="text/javascript" src="jquery.digilib.js"></script> + <link rel="stylesheet" type="text/css" href="jquery.digilib.css" /> + + + <script type="text/javascript"> + $(document).ready(function(){ + var opts = { + interactionMode : 'fullscreen', + scalerBaseUrl : 'http://digilib.biblhertz.it/digilib04/servlet/Scaler' + }; + $('div.digilib').digilib(opts); + }); + + </script> + </head> + + <body> + + <div id="digilib-1" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/FransHals-WillemVanHeythuysen" /> + </div> + <div id="debug">DEBUG</div> + </body> +</html> +
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery.cookie.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,96 @@ +/** + * Cookie plugin + * + * Copyright (c) 2006 Klaus Hartl (stilbuero.de) + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + * + */ + +/** + * Create a cookie with the given name and value and other optional parameters. + * + * @example $.cookie('the_cookie', 'the_value'); + * @desc Set the value of a cookie. + * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true }); + * @desc Create a cookie with all available options. + * @example $.cookie('the_cookie', 'the_value'); + * @desc Create a session cookie. + * @example $.cookie('the_cookie', null); + * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain + * used when the cookie was set. + * + * @param String name The name of the cookie. + * @param String value The value of the cookie. + * @param Object options An object literal containing key/value pairs to provide optional cookie attributes. + * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object. + * If a negative value is specified (e.g. a date in the past), the cookie will be deleted. + * If set to null or omitted, the cookie will be a session cookie and will not be retained + * when the the browser exits. + * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie). + * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie). + * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will + * require a secure protocol (like HTTPS). + * @type undefined + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ + +/** + * Get the value of a cookie with the given name. + * + * @example $.cookie('the_cookie'); + * @desc Get the value of a cookie. + * + * @param String name The name of the cookie. + * @return The value of the cookie. + * @type String + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ +jQuery.cookie = function(name, value, options) { + if (typeof value != 'undefined') { // name and value given, set cookie + options = options || {}; + if (value === null) { + value = ''; + options.expires = -1; + } + var expires = ''; + if (options.expires && (typeof options.expires == 'number' || options.expires.toUTCString)) { + var date; + if (typeof options.expires == 'number') { + date = new Date(); + date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000)); + } else { + date = options.expires; + } + expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE + } + // CAUTION: Needed to parenthesize options.path and options.domain + // in the following expressions, otherwise they evaluate to undefined + // in the packed version for some reason... + var path = options.path ? '; path=' + (options.path) : ''; + var domain = options.domain ? '; domain=' + (options.domain) : ''; + var secure = options.secure ? '; secure' : ''; + document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join(''); + } else { // only name given, get cookie + var cookieValue = null; + if (document.cookie && document.cookie != '') { + var cookies = document.cookie.split(';'); + for (var i = 0; i < cookies.length; i++) { + var cookie = jQuery.trim(cookies[i]); + // Does this cookie string begin with the name we want? + if (cookie.substring(0, name.length + 1) == (name + '=')) { + cookieValue = decodeURIComponent(cookie.substring(name.length + 1)); + break; + } + } + } + return cookieValue; + } +};
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery.digilib.css Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,102 @@ +/* + * CSS style file for jQuery digilib + * + * Martin Raspe, Robert Casties, 11.1.2011 + */ +div.digilib div.scaler { + background-color: grey; + z-index: 0; + width: 0px; + height: 0px; +} + +div.digilib div.birdview { + border: 1px solid white; + z-index: 10; +} + +div.digilib div.zoomrect { + position: absolute; + border: 2px solid #ff0000; + z-index: 100; +} + +div.digilib div.birdzoom { + position: absolute; + border: 2px solid #ff0000; + z-index: 100; +} + +div.digilib div.mark { + position: absolute; + color: white; + background: url('../greyskin/mark-bg-16.png'); + font-family: Verdana, Arial, Helvetica, sans-serif; + font-weight: bold; + font-size: 11px; + height: 15px; + width: 16px; + padding-top: 1px; + text-align: center; + z-index: 10; +} + +div.digilib div.about { + position: absolute; + width: 200px; + top: 100px; + left: 350px; + height: 200px; + padding: 0px 2px; + font-family: Verdana, Arial, Helvetica, sans-serif; + border: 2px solid lightcyan; + background-color: lightgrey; + text-align: center; + display: none; + z-index: 1000; +} + +/* special definitions for fullscreen */ +div.digilib.dl_fullscreen div.buttons { + position: fixed; + right: 0px; + top: 0px; + padding: 2px; + background-color: transparent; + z-index: 100; +} + +div.digilib.dl_fullscreen div.button:hover { + background-image: url('../greyskin/corona.png'); +} + +div.digilib.dl_fullscreen div.birdview { + position: fixed; + bottom: 8px; + right: 48px; +} + +/* special definitions for embedded */ +div.digilib.dl_embedded { + position: relative; +} + +div.digilib.dl_embedded div.buttons { + position: absolute; + right: 0px; + top: 0px; + padding: 1px; + background-color: grey; + opacity: 0.4; + z-index: 100; +} + +div.digilib.dl_embedded div.button:hover { + background-color: darkred; +} + +div.digilib.dl_embedded div.birdview { + position: absolute; + bottom: 0px; + right: 0px; +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/jquery.digilib.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,1599 @@ +/* Copyright (c) 2011 Martin Raspe, Robert Casties + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU Lesser General Public License as published by +the Free Software Foundation, either version 2 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU Lesser General Public License for more details. + +You should have received a copy of the GNU Lesser General Public License +along with this program. If not, see <http://www.gnu.org/licenses/>. + +Authors: + Martin Raspe, Robert Casties, 11.1.2011 +*/ + +/** + * digilib jQuery plugin +**/ + + +/* jslint browser: true, debug: true, forin: true +*/ + +// fallback for console.log calls +if (typeof(console) === 'undefined') { + var console = { + log : function(){}, + debug : function(){}, + error : function(){} + }; + var customConsole = true; +} + +(function($) { + var buttons = { + reference : { + onclick : "reference", + tooltip : "get a reference URL", + img : "reference.png" + }, + zoomin : { + onclick : ["zoomBy", 1.4], + tooltip : "zoom in", + img : "zoom-in.png" + }, + zoomout : { + onclick : ["zoomBy", 0.7], + tooltip : "zoom out", + img : "zoom-out.png" + }, + zoomarea : { + onclick : "zoomArea", + tooltip : "zoom area", + img : "zoom-area.png" + }, + zoomfull : { + onclick : "zoomFull", + tooltip : "view the whole image", + img : "zoom-full.png" + }, + pagewidth : { + onclick : ["zoomFull", "width"], + tooltip : "page width", + img : "pagewidth.png" + }, + back : { + onclick : ["gotoPage", "-1"], + tooltip : "goto previous image", + img : "back.png" + }, + fwd : { + onclick : ["gotoPage", "+1"], + tooltip : "goto next image", + img : "fwd.png" + }, + page : { + onclick : "gotoPage", + tooltip : "goto image number", + img : "page.png" + }, + bird : { + onclick : "showBirdDiv", + tooltip : "show bird's eye view", + img : "birds-eye.png" + }, + help : { + onclick : "showAboutDiv", + tooltip : "about Digilib", + img : "help.png" + }, + reset : { + onclick : "reset", + tooltip : "reset image", + img : "reset.png" + }, + mark : { + onclick : "setMark", + tooltip : "set a mark", + img : "mark.png" + }, + delmark : { + onclick : "removeMark", + tooltip : "delete the last mark", + img : "delmark.png" + }, + hmir : { + onclick : ["mirror", "h"], + tooltip : "mirror horizontally", + img : "mirror-horizontal.png" + }, + vmir : { + onclick : ["mirror", "v"], + tooltip : "mirror vertically", + img : "mirror-vertical.png" + }, + rot : { + onclick : "rotate", + tooltip : "rotate image", + img : "rotate.png" + }, + brgt : { + onclick : "brightness", + tooltip : "set brightness", + img : "brightness.png" + }, + cont : { + onclick : "contrast", + tooltip : "set contrast", + img : "contrast.png" + }, + rgb : { + onclick : "javascript:setParamWin('rgb', '...')", + tooltip : "set rgb values", + img : "rgb.png" + }, + quality : { + onclick : "setQuality", + tooltip : "set image quality", + img : "quality.png" + }, + size : { + onclick : "javascript:toggleSizeMenu()", + tooltip : "set page size", + img : "size.png" + }, + calibrationx : { + onclick : "calibrate", + tooltip : "calibrate screen resolution", + img : "calibration-x.png" + }, + scale : { + onclick : "javascript:toggleScaleMenu()", + tooltip : "change image scale", + img : "original-size.png" + }, + toggleoptions : { + onclick : "moreButtons", + tooltip : "more options", + img : "options.png" + }, + moreoptions : { + onclick : ["moreButtons", "+1"], + tooltip : "more options", + img : "options.png" + }, + lessoptions : { + onclick : ["moreButtons", "-1"], + tooltip : "less options", + img : "options.png" + }, + SEP : { + img : "sep.png" + } + }; + + var defaults = { + // version of this script + 'version' : 'jquery.digilib.js 0.9', + // logo url + 'logoUrl' : '../img/digilib-logo-text1.png', + // homepage url (behind logo) + 'homeUrl' : 'http://digilib.berlios.de', + // base URL to digilib viewer (for reference URLs) + 'digilibBaseUrl' : null, + // base URL to Scaler servlet + 'scalerBaseUrl' : null, + // list of Scaler parameters + 'scalerParamNames' : ['fn','pn','dw','dh','ww','wh','wx','wy','ws','mo', + 'rot','cont','brgt','rgbm','rgba','ddpi','ddpix','ddpiy'], + // Scaler parameter defaults + 'pn' : 1, + 'ww' : 1.0, + 'wh' : 1.0, + 'wx' : 0.0, + 'wy' : 0.0, + 'ws' : 1.0, + 'mo' : '', + 'rot' : 0, + 'cont' : 0, + 'brgt' : 0, + 'rgbm' : '0/0/0', + 'rgba' : '0/0/0', + 'ddpi' : null, + 'ddpix' : null, + 'ddpiy' : null, + // list of digilib parameters + 'digilibParamNames' : ['fn','pn','ww','wh','wx','wy','ws','mo','rot','cont','brgt','rgbm','rgba','mk','clop'], + // digilib parameter defaults + 'mk' : '', + 'clop' : '', + // mode of operation: + // fullscreen = take parameters from page URL, keep state in page URL + // embedded = take parameters from Javascript options, keep state inside object + 'interactionMode' : 'fullscreen', + // buttons + 'buttons' : buttons, + // defaults for digilib buttons + 'buttonSettings' : { + 'fullscreen' : { + // path to button images (must end with a slash) + 'imagePath' : 'img/fullscreen/', + 'standardSet' : ["reference","zoomin","zoomout","zoomarea","zoomfull","pagewidth","back","fwd","page","bird","help","reset","toggleoptions"], + 'specialSet' : ["mark","delmark","hmir","vmir","rot","brgt","cont","rgb","quality","size","calibrationx","scale","toggleoptions"], + 'buttonSets' : ['standardSet', 'specialSet'] + }, + 'embedded' : { + 'imagePath' : 'img/embedded/16/', + 'standardSet' : ["reference","zoomin","zoomout","zoomarea","zoomfull","bird","help","reset","toggleoptions"], + 'specialSet' : ["mark","delmark","hmir","vmir","rot","brgt","cont","rgb","quality","toggleoptions"], + 'buttonSets' : ['standardSet', 'specialSet'] + } + }, + // number of visible button groups + 'visibleButtonSets' : 1, + // is birdView shown? + 'isBirdDivVisible' : false, + // dimensions of bird's eye div + 'birdDivWidth' : 200, + 'birdDivHeight' : 200, + // parameters used by bird's eye div + 'birdDivParams' : ['fn','pn','dw','dh'], + // style of the zoom area indicator in the bird's eye div + 'birdIndicatorStyle' : {'border' : '2px solid #ff0000' }, + // style of zoom area "rubber band" + 'zoomrectStyle' : {'border' : '2px solid #ff0000' }, + // is the "about" window shown? + 'isAboutDivVisible' : false, + // maximum width of background image for drag-scroll + 'maxBgSize' : 10000 + + }; + + // affine geometry classes + var geom = dlGeometry(); + + var FULL_AREA = geom.rectangle(0, 0, 1, 1); + + var actions = { + // init: digilib initialization + init : function(options) { + // settings for this digilib instance are merged from defaults and options + var settings = $.extend({}, defaults, options); + var isFullscreen = settings.interactionMode === 'fullscreen'; + var queryParams = {}; + if (isFullscreen) { + queryParams = parseQueryParams(); + // check scalerBaseUrl + if (settings.scalerBaseUrl == null) { + // try the host this came from + var h = window.location.host; + if (window.location.host) { + var url = window.location.href; + // assume the page lives in [webapp]/jquery/ + var pos = url.indexOf('jquery/'); + if (pos > 0) { + settings.scalerBaseUrl = url.substring(0, pos) + 'servlet/Scaler'; + } + } + } + } + return this.each(function() { + var $elem = $(this); + var data = $elem.data('digilib'); + var params, elemSettings; + // if the plugin hasn't been initialized yet + if (!data) { + // merge query parameters + if (isFullscreen) { + params = queryParams; + } else { + params = parseImgParams($elem); + if (jQuery.cookie) { + // retrieve params from cookie + var ck = "digilib-embed:fn:" + escape(params.fn) + ":pn:" + (params.pn || '1'); + var cs = jQuery.cookie(ck); + console.debug("get cookie=", ck, " value=", cs); + if (cs) { + var cp = parseQueryString(cs); + // ignore fn and pn from cookie TODO: should we keep pn? + delete cp.fn; + delete cp.pn; + jQuery.extend(params, cp); + } + } + } + // store $(this) element in the settings + elemSettings = jQuery.extend({}, settings, params); + data = { + $elem : $elem, + settings : elemSettings, + queryParams : params + }; + // store in data element + $elem.data('digilib', data); + } + unpackParams(data); + // check if browser knows *background-size + for (var bs in {'':1, '-moz-':1, '-webkit-':1, '-o-':1}) { + if ($elem.css(bs+'background-size')) { + data.hasBgSize = true; + data.bgSizeName = bs+'background-size'; + break; + } + } + // check digilib base URL + if (elemSettings.digilibBaseUrl == null) { + if (isFullscreen) { + // take current host + var url = window.location.toString(); + var pos = url.indexOf('?'); + elemSettings.digilibBaseUrl = url.substring(0, pos); + } else { + var url = elemSettings.scalerBaseUrl; + if (url) { + // build it from scaler URL + var bp = url.indexOf('/servlet/Scaler'); + elemSettings.digilibBaseUrl = url.substring(0, bp) + '/digilib.jsp'; + } + } + } + // create HTML structure for scaler + setupScalerDiv(data); + // add buttons + for (var i = 0; i < elemSettings.visibleButtonSets; ++i) { + showButtons(data, true, i); + } + // bird's eye view creation + if (elemSettings.isBirdDivVisible) { + setupBirdDiv(data); + data.$birdDiv.show(); + } + // about window creation - TODO: could be deferred? restrict to only one item? + setupAboutDiv(data); + // drag zoom area around in scaler div + // setupZoomDrag(data); // is done in scalerImgLoadedHandler() + }); + }, + + // destroy: clean up digilib + destroy : function(data) { + return this.each(function(){ + var $elem = $(this); + $(window).unbind('.digilib'); // unbind all digilibs(?) + data.digilib.remove(); + $elem.removeData('digilib'); + }); + }, + + // show or hide the 'about' window + showAboutDiv : function(data, show) { + data.settings.isAboutDivVisible = showDiv(data.settings.isAboutDivVisible, data.$aboutDiv, show); + }, + + // event handler: toggles the visibility of the bird's eye window + showBirdDiv : function (data, show) { + var settings = data.settings; + if (data.$birdDiv == null) { + // no bird div -> create + setupBirdDiv(data); + } + settings.isBirdDivVisible = showDiv(settings.isBirdDivVisible, data.$birdDiv, show); + updateBirdDiv(data); + storeOptions(data); + // data.$birdImg.triggerHandler('load'); // TODO: we shouldn't do that + }, + + // goto given page nr (+/-: relative) + gotoPage : function (data, pageNr) { + var settings = data.settings; + var oldpn = settings.pn; + if (pageNr == null) { + pageNr = window.prompt("Goto page number", oldpn); + } + var pn = setNumValue(settings, "pn", pageNr); + if (pn == null) return false; // nothing happened + if (pn < 1) { + alert("no such page (page number too low)"); + settings.pn = oldpn; + return false; + } + if (settings.pt) { + if (pn > settings.pt) { + alert("no such page (page number too high)"); + settings.pn = oldpn; + return false; + } + } + // reset mk and others(?) + data.marks = []; + data.zoomArea = FULL_AREA; + // then reload + redisplay(data); + }, + + // zoom by a given factor + zoomBy : function (data, factor) { + zoomBy(data, factor); + }, + + // zoom interactively + zoomArea : function (data) { + zoomArea(data); + }, + + // zoom out to full page + zoomFull : function (data, mode) { + data.zoomArea = FULL_AREA; + if (mode === 'width') { + data.dlOpts.fitwidth = 1; + delete data.dlOpts.fitheight; + } else if (mode === 'height') { + data.dlOpts.fitheight = 1; + delete data.dlOpts.fitwidth; + } else { + delete data.dlOpts.fitwidth; + delete data.dlOpts.fitheight; + } + redisplay(data); + }, + + // set a mark by clicking (or giving a position) + setMark : function (data, mpos) { + if (mpos == null) { + // interactive + setMark(data); + } else { + // use position + data.marks.push(pos); + redisplay(data); + } + }, + + // remove the last mark + removeMark : function (data) { + data.marks.pop(); + redisplay(data); + }, + + // mirror the image + mirror : function (data, mode) { + var flags = data.scalerFlags; + if (mode === 'h') { + if (flags.hmir) { + delete flags.hmir; + } else { + flags.hmir = 1; + } + } else { + if (flags.vmir) { + delete flags.vmir; + } else { + flags.vmir = 1; + } + } + redisplay(data); + }, + + // rotate the image + rotate : function (data, angle) { + var rot = data.settings.rot; + if (angle == null) { + angle = window.prompt("Rotation angle:", rot); + } + data.settings.rot = angle; + redisplay(data); + }, + + // change brightness + brightness : function (data, factor) { + var brgt = data.settings.brgt; + if (factor == null) { + factor = window.prompt("Brightness (-255..255)", brgt); + } + data.settings.brgt = factor; + redisplay(data); + }, + + // change contrast + contrast : function (data, factor) { + var cont = data.settings.cont; + if (factor == null) { + factor = window.prompt("Contrast (-8, 8)", cont); + } + data.settings.cont = factor; + redisplay(data); + }, + + // display more (or less) button sets + moreButtons : function (data, more) { + var settings = data.settings; + if (more == null) { + // toggle more or less (only works for 2 sets) + var maxbtns = settings.buttonSettings[settings.interactionMode].buttonSets.length; + if (settings.visibleButtonSets >= maxbtns) { + more = '-1'; + } else { + more = '+1'; + } + } + if (more === '-1') { + // remove set + var setIdx = settings.visibleButtonSets - 1; + if (showButtons(data, false, setIdx, true)) { + settings.visibleButtonSets--; + } + } else { + // add set + var setIdx = settings.visibleButtonSets; + if (showButtons(data, true, setIdx, true)) { + settings.visibleButtonSets++; + } + } + // persist setting + storeOptions(data); + }, + + // reset image parameters to defaults + reset : function (data) { + var settings = data.settings; + var paramNames = settings.digilibParamNames; + var params = data.queryParams; + // delete all digilib parameters + for (var i = 0; i < paramNames.length; i++) { + var paramName = paramNames[i]; + delete settings[paramName]; + } + settings.fn = params.fn || ''; // no default defined + settings.pn = params.pn || defaults.pn; + settings.dw = params.dw; + settings.dh = params.dh; + settings.isBirdDivVisible = false; + settings.visibleButtonSets = 1; + // resets zoomArea, marks, scalerflags + data.zoomArea = FULL_AREA; + data.marks = []; + data.scalerFlags = {}; + delete data.dlOpts.fitwidth; + delete data.dlOpts.fitheight; + redisplay(data); + }, + + // presents a reference url (returns value if noprompt) + reference : function (data, noprompt) { + var settings = data.settings; + var url = getDigilibUrl(data); + if (noprompt == null) { + window.prompt("URL reference to the current view", url); + } + return url; + }, + + // set image quality + setQuality : function (data, qual) { + var oldq = getQuality(data); + if (qual == null) { + qual = window.prompt("Image quality (0..2)", oldq); + } + qual = parseInt(qual, 10); + if (qual >= 0 && qual <= 2) { + setQuality(data, qual); + redisplay(data); + } + }, + + // calibrate (only faking) + calibrate : function (data) { + getImageInfo(data); + } + }; + + // returns parameters from page url + var parseQueryParams = function() { + return parseQueryString(window.location.search.slice(1)); + }; + + // returns parameters from embedded img-element + var parseImgParams = function($elem) { + var src = $elem.find('img').first().attr('src'); + if (!src) return null; + var pos = src.indexOf('?'); + var query = (pos < 0) ? '' : src.substring(pos + 1); + var scalerUrl = src.substring(0, pos); + var params = parseQueryString(query); + params.scalerBaseUrl = scalerUrl; + return params; + }; + + // parses query parameter string into parameter object + var parseQueryString = function(query) { + var params = {}; + if (query == null) return params; + var pairs = query.split("&"); + //var keys = []; + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i].split("="); + if (pair.length === 2) { + params[pair[0]] = pair[1]; + //keys.push(pair[0]); + } + } + return params; + }; + + // returns a query string from key names from a parameter hash (ignoring if the same value is in defaults) + var getParamString = function (settings, keys, defaults) { + var paramString = ''; + var nx = false; + for (i = 0; i < keys.length; ++i) { + var key = keys[i]; + if ((settings[key] != null) && ((defaults == null) || (settings[key] != defaults[key]))) { + // first param gets no '&' + if (nx) { + paramString += '&'; + } else { + nx = true; + } + // add parm=val + paramString += key + '=' + settings[key]; + } + } + return paramString; + }; + + // returns URL and query string for Scaler + var getScalerUrl = function (data) { + packParams(data); + var settings = data.settings; + if (settings.scalerBaseUrl == null) { + alert("ERROR: URL of digilib Scaler servlet missing!"); + } + var keys = settings.scalerParamNames; + var queryString = getParamString(settings, keys, defaults); + var url = settings.scalerBaseUrl + '?' + queryString; + return url; + }; + + // returns URL for bird's eye view image + var getBirdImgUrl = function (data, moreParams) { + var settings = data.settings; + var birdDivOptions = { + dw : settings.birdDivWidth, + dh : settings.birdDivHeight + }; + var birdSettings = jQuery.extend({}, settings, birdDivOptions); + // use only the relevant parameters + if (moreParams == null) { + var params = getParamString(birdSettings, settings.birdDivParams, defaults); + } else { + var params = getParamString(birdSettings, + settings.birdDivParams.concat(moreParams), defaults); + } + var url = settings.scalerBaseUrl + '?' + params; + return url; + }; + + // returns URL and query string for current digilib + var getDigilibUrl = function (data) { + packParams(data); + var settings = data.settings; + var queryString = getParamString(settings, settings.digilibParamNames, defaults); + return settings.digilibBaseUrl + '?' + queryString; + }; + + // gets image information from digilib server via HTTP and calls complete + var getImageInfo = function (data, complete) { + var settings = data.settings; + var p = settings.scalerBaseUrl.indexOf('/servlet/Scaler'); + var url = settings.scalerBaseUrl.substring(0, p) + '/ImgInfo-json.jsp'; + url += '?' + getParamString(settings, ['fn', 'pn'], defaults); + jQuery.getJSON(url, function (json) { + console.debug("got json data=", json); + data.imgInfo = json; + if (complete != null) { + complete.call(this, data, json); + } + }); + }; + + // processes some parameters into objects and stuff + var unpackParams = function (data) { + var settings = data.settings; + // zoom area + var zoomArea = geom.rectangle(settings.wx, settings.wy, settings.ww, settings.wh); + data.zoomArea = zoomArea; + // marks + var marks = []; + if (settings.mk) { + var mk = settings.mk; + if (mk.indexOf(";") >= 0) { + var pa = mk.split(";"); // old format with ";" + } else { + var pa = mk.split(","); // new format + } + for (var i = 0; i < pa.length ; i++) { + var pos = pa[i].split("/"); + if (pos.length > 1) { + marks.push(geom.position(pos[0], pos[1])); + } + } + } + data.marks = marks; + // mo (Scaler flags) + var flags = {}; + if (settings.mo) { + var pa = settings.mo.split(","); + for (var i = 0; i < pa.length ; i++) { + flags[pa[i]] = pa[i]; + } + } + data.scalerFlags = flags; + retrieveOptions(data); + }; + + // put objects back into parameters + var packParams = function (data) { + var settings = data.settings; + // zoom area + if (data.zoomArea) { + settings.wx = cropFloat(data.zoomArea.x); + settings.wy = cropFloat(data.zoomArea.y); + settings.ww = cropFloat(data.zoomArea.width); + settings.wh = cropFloat(data.zoomArea.height); + } + // marks + if (data.marks) { + settings.mk = ''; + for (var i = 0; i < data.marks.length; i++) { + if (i) { + settings.mk += ','; + } + settings.mk += cropFloat(data.marks[i].x).toString() + + '/' + cropFloat(data.marks[i].y).toString(); + } + } + // Scaler flags + if (data.scalerFlags) { + var mo = ''; + for (var f in data.scalerFlags) { + if (mo) { + mo += ','; + } + mo += f; + } + settings.mo = mo; + } + // user interface options + storeOptions(data); + }; + + var storeOptions = function (data) { + // save digilib options in cookie + var settings = data.settings; + if (data.dlOpts) { + // save digilib settings in options + data.dlOpts.birdview = settings.isBirdDivVisible ? 1 : 0; + data.dlOpts.buttons = settings.visibleButtonSets; + var clop = ''; + for (var o in data.dlOpts) { + if (clop) { + clop += '&'; + } + clop += o + '=' + data.dlOpts[o]; + } + if (jQuery.cookie) { + var ck = "digilib:fn:" + escape(settings.fn) + ":pn:" + settings.pn; + console.debug("set cookie=", ck, " value=", clop); + jQuery.cookie(ck, clop); + } + } + if (settings.interactionMode !== 'fullscreen' && jQuery.cookie) { + // store normal parameters in cookie for embedded mode + var qs = getParamString(settings, settings.digilibParamNames, defaults); + var ck = "digilib-embed:fn:" + escape(settings.fn) + ":pn:" + settings.pn; + console.debug("set cookie=", ck, " value=", qs); + jQuery.cookie(ck, qs); + } + }; + + var retrieveOptions = function (data) { + // clop (digilib options) + var opts = {}; + var settings = data.settings; + if (jQuery.cookie) { + // read from cookie + var ck = "digilib:fn:" + escape(settings.fn) + ":pn:" + settings.pn; + var cp = jQuery.cookie(ck); + console.debug("get cookie=", ck, " value=", cp); + // in query string format + opts = parseQueryString(cp); + } + data.dlOpts = opts; + // birdview option + if (opts.birdview != null) { + settings.isBirdDivVisible = opts.birdview === '1'; + } + // visible button sets + if (opts.buttons != null) { + settings.visibleButtonSets = opts.buttons; + } + }; + + // (re)load the img from a new scaler URL + var redisplay = function (data) { + var settings = data.settings; + if (settings.interactionMode === 'fullscreen') { + // update location.href (browser URL) in fullscreen mode + var url = getDigilibUrl(data); + var history = window.history; + if (typeof(history.pushState) === 'function') { + console.debug("we could modify history, but we don't..."); + } + window.location = url; + } else { + // embedded mode -- just change img src + var url = getScalerUrl(data); + data.$img.attr('src', url); + // redisplay bird img + updateBirdDiv(data); + } + }; + + // returns maximum size for scaler img in fullscreen mode + var getFullscreenImgSize = function($elem) { + var $win = $(window); + var winH = $win.height(); + var winW = $win.width(); + // TODO: account for borders? + return geom.size(winW, winH); + }; + + // creates HTML structure for digilib in elem + var setupScalerDiv = function (data) { + var settings = data.settings; + var $elem = data.$elem; + $elem.addClass('digilib'); + var $img; + var scalerUrl; + if (settings.interactionMode === 'fullscreen') { + // fullscreen + $elem.addClass('dl_fullscreen'); + var imgSize = getFullscreenImgSize($elem); + // fitwidth/height omits destination height/width + if (data.dlOpts.fitheight == null) { + settings.dw = imgSize.width; + } + if (data.dlOpts.fitwidth == null) { + settings.dh = imgSize.height; + } + scalerUrl = getScalerUrl(data); + $img = $('<img/>'); + } else { + // embedded mode -- try to keep img tag + $elem.addClass('dl_embedded'); + scalerUrl = getScalerUrl(data); + $img = $elem.find('img'); + if ($img.length > 0) { + oldUrl = $img.attr('src'); + if (oldUrl === scalerUrl) { + console.debug("img detach:", $img); + $img.detach(); + } else { + $img = $('<img/>'); + } + } else { + $img = $('<img/>'); + } + } + // create new html + $elem.empty(); // TODO: should we keep stuff for customization? + var $scaler = $('<div class="scaler"/>'); + $elem.append($scaler); + $scaler.append($img); + $img.addClass('pic'); + data.$scaler = $scaler; + data.$img = $img; + // setup image load handler before setting the src attribute (IE bug) + $img.load(scalerImgLoadedHandler(data)); + $img.attr('src', scalerUrl); + }; + + // creates HTML structure for buttons in elem + var createButtons = function (data, buttonSetIdx) { + var $elem = data.$elem; + var settings = data.settings; + var mode = settings.interactionMode; + var buttonSettings = settings.buttonSettings[mode]; + var buttonGroup = buttonSettings.buttonSets[buttonSetIdx]; + if (buttonGroup == null) { + // no buttons here + return; + } + var $buttonsDiv = $('<div class="buttons"/>'); + var buttonNames = buttonSettings[buttonGroup]; + for (var i = 0; i < buttonNames.length; i++) { + var buttonName = buttonNames[i]; + var buttonConfig = settings.buttons[buttonName]; + // construct the button html + var $button = $('<div class="button"></div>'); + var $a = $('<a/>'); + var $img = $('<img class="button"/>'); + $buttonsDiv.append($button); + $button.append($a); + $a.append($img); + // add attributes and bindings + $button.attr('title', buttonConfig.tooltip); + $button.addClass('button-' + buttonName); + // create handler for the buttons + $a.bind('click.digilib', (function () { + // we create a new closure to capture the value of action + var action = buttonConfig.onclick; + if ($.isArray(action)) { + // the handler function calls digilib with action and parameters + return function (evt) { + console.debug('click action=', action, ' evt=', evt); + $elem.digilib.apply($elem, action); + return false; + }; + } else { + // the handler function calls digilib with action + return function (evt) { + console.debug('click action=', action, ' evt=', evt); + $elem.digilib(action); + return false; + }; + } + })()); + $img.attr('src', buttonSettings.imagePath + buttonConfig.img); + } + // make buttons div scroll if too large for window + if ($buttonsDiv.height() > $(window).height() - 10) { + $buttonsDiv.css('position', 'absolute'); + } + // buttons hidden at first + $buttonsDiv.hide(); + $elem.append($buttonsDiv); + if (data.$buttonSets == null) { + // first button set + data.$buttonSets = [$buttonsDiv]; + } else { + $elem.append($buttonsDiv); + data.$buttonSets[buttonSetIdx] = $buttonsDiv; + } + return $buttonsDiv; + }; + + // creates HTML structure for the bird's eye view in elem + var setupBirdDiv = function (data) { + var $elem = data.$elem; + // the bird's eye div + var $birdDiv = $('<div class="birdview" style="display:none"/>'); + // the detail indicator frame + var $birdZoom = $('<div class="birdzoom" style="display:none; background-color:transparent;"/>'); + // the small image + var $birdImg = $('<img class="birdimg"/>'); + data.$birdDiv = $birdDiv; + data.$birdZoom = $birdZoom; + data.$birdImg = $birdImg; + $elem.append($birdDiv); + $birdDiv.append($birdZoom); + $birdDiv.append($birdImg); + $birdZoom.css(data.settings.birdIndicatorStyle); + var birdUrl = getBirdImgUrl(data); + $birdImg.load(birdImgLoadedHandler(data)); + $birdImg.attr('src', birdUrl); + }; + + // update bird's eye view + var updateBirdDiv = function (data) { + if (!data.settings.isBirdDivVisible) return; + var $birdImg = data.$birdImg; + var oldsrc = $birdImg.attr('src'); + var newsrc = getBirdImgUrl(data); + if (oldsrc !== newsrc) { + $birdImg.attr('src', newsrc); + // onload handler re-renders + } else { + // re-render + renderBirdArea(data); + // enable click and drag + setupBirdDrag(data); + } + }; + + // creates HTML structure for the about view in elem + var setupAboutDiv = function (data) { + var $elem = data.$elem; + var settings = data.settings; + var $aboutDiv = $('<div class="about" style="display:none"/>'); + var $header = $('<p>Digilib Graphic Viewer</p>'); + var $link = $('<a/>'); + var $logo = $('<img class="logo" title="digilib"/>'); + var $content = $('<p/>'); + $elem.append($aboutDiv); + $aboutDiv.append($header); + $aboutDiv.append($link); + $aboutDiv.append($content); + $link.append($logo); + $logo.attr('src', settings.logoUrl); + $link.attr('href', settings.homeUrl); + $content.text('Version: ' + settings.version); + // click hides + $aboutDiv.bind('click.digilib', function () { + settings.isAboutDivVisible = showDiv(settings.isAboutDivVisible, $aboutDiv, 0); + return false; + }); + data.$aboutDiv = $aboutDiv; + }; + + // shows some window e.g. 'about' (toggle visibility if show is null) + var showDiv = function (isVisible, $div, show) { + if (show == null) { + // toggle visibility + isVisible = !isVisible; + } else { + // set visibility + isVisible = show; + } + if (isVisible) { + $div.fadeIn(); + } else { + $div.fadeOut(); + } + return isVisible; + }; + + // display more (or less) button sets + var showButtons = function (data, more, setIdx, animated) { + var atime = animated ? 'fast': 0; + if (more) { + // add set + var $otherSets = data.$elem.find('div.buttons:visible'); + var $set; + if (data.$buttonSets && data.$buttonSets[setIdx]) { + // set exists + $set = data.$buttonSets[setIdx]; + } else { + $set = createButtons(data, setIdx); + } + if ($set == null) return false; + var btnWidth = $set.width(); + // move remaining sets left and show new set + if ($otherSets.length > 0) { + $otherSets.animate({right : '+='+btnWidth+'px'}, atime, + function () {$set.show();}); + } else { + $set.show(); + } + } else { + // remove set + var $set = data.$buttonSets[setIdx]; + if ($set == null) return false; + var btnWidth = $set.width(); + // hide last set + $set.hide(); + // take remaining sets and move right + var $otherSets = data.$elem.find('div.buttons:visible'); + $otherSets.animate({right : '-='+btnWidth+'px'}, atime); + } + return true; + }; + + // create Transform from area and $img + var getImgTrafo = function ($img, area, rot, hmir, vmir) { + var picrect = geom.rectangle($img); + var trafo = geom.transform(); + // move zoom area offset to center + trafo.concat(trafo.getTranslation(geom.position(-area.x, -area.y))); + // scale zoom area size to [1,1] + trafo.concat(trafo.getScale(geom.size(1/area.width, 1/area.height))); + // rotate and mirror (around transformed image center i.e. [0.5,0.5]) + if (rot || hmir || vmir) { + // move [0.5,0.5] to center + trafo.concat(trafo.getTranslation(geom.position(-0.5, -0.5))); + if (hmir) { + // mirror about center + trafo.concat(trafo.getMirror('y')); + } + if (vmir) { + // mirror about center + trafo.concat(trafo.getMirror('x')); + } + if (rot) { + // rotate around center + trafo.concat(trafo.getRotation(parseFloat(rot))); + } + // move back + trafo.concat(trafo.getTranslation(geom.position(0.5, 0.5))); + } + // scale to screen position and size + trafo.concat(trafo.getScale(picrect)); + trafo.concat(trafo.getTranslation(picrect)); + return trafo; + }; + + // returns function for load event of scaler img + var scalerImgLoadedHandler = function (data) { + return function () { + var $img = $(this); + var $scaler = data.$scaler; + // create Transform from current area and picsize + data.imgTrafo = getImgTrafo($img, data.zoomArea, + data.settings.rot, data.scalerFlags.hmir, data.scalerFlags.vmir); + console.debug("imgTrafo=", data.imgTrafo); + // adjust scaler div size + var imgRect = geom.rectangle($img); + console.debug("imgrect=", imgRect); + imgRect.adjustDiv($scaler); + // show image in case it was hidden (for example in zoomDrag) + $img.css('visibility', 'visible'); + $scaler.css({'opacity' : '1', 'background-image' : 'none'}); + // display marks + renderMarks(data); + // enable drag-to-scroll + setupZoomDrag(data); + // TODO: digilib.showArrows(); // show arrow overlays for zoom navigation + }; + }; + + // returns function for load event of bird's eye view img + var birdImgLoadedHandler = function (data) { + return function () { + var $birdImg = $(this); + var birdRect = geom.rectangle($birdImg); + console.debug("birdImg loaded!", $birdImg, "rect=", birdRect, "data=", data); + if (birdRect.width === 0) { + // malheureusement IE7 calls load handler when there is no size info yet + setTimeout(function () { $birdImg.triggerHandler('load') }, 200); + } + // display red indicator around zoomarea + renderBirdArea(data); + // enable click and drag + setupBirdDrag(data); + }; + }; + + // place marks on the image + var renderMarks = function (data) { + var $elem = data.$elem; + var marks = data.marks; + // clear marks + $elem.find('div.mark').remove(); + for (var i = 0; i < marks.length; i++) { + var mark = marks[i]; + if (data.zoomArea.containsPosition(mark)) { + var mpos = data.imgTrafo.transform(mark); + console.debug("renderMarks: mpos=",mpos); + // create mark + var html = '<div class="mark">'+(i+1)+'</div>'; + var $mark = $(html); + $elem.append($mark); + mpos.adjustDiv($mark); + } + } + }; + + // show zoom area indicator on bird's eye view + var renderBirdArea = function (data) { + var $birdZoom = data.$birdZoom; + var zoomArea = data.zoomArea; + var normalSize = isFullArea(zoomArea); + if (normalSize) { + $birdZoom.hide(); + return; + } else { + $birdZoom.show(); + } + // create Transform from current area and picsize + data.birdTrafo = getImgTrafo(data.$birdImg, FULL_AREA); + var zoomRect = data.birdTrafo.transform(zoomArea); + console.debug("renderBirdArea:", zoomRect, "zoomArea:", zoomArea, "$birdTrafo:", data.birdTrafo); + // acount for border width + zoomRect.addPosition({x : -2, y : -2}); + if (data.settings.interactionMode === 'fullscreen') { + // no animation for fullscreen + zoomRect.adjustDiv($birdZoom); + } else { + // nice animation for embedded mode :-) + // correct offsetParent because animate doesn't use offset + var ppos = $birdZoom.offsetParent().offset(); + var dest = { + left : (zoomRect.x - ppos.left) + 'px', + top : (zoomRect.y - ppos.top) + 'px', + width : zoomRect.width, + height : zoomRect.height + }; + $birdZoom.animate(dest); + } + }; + + // zooms by the given factor + var zoomBy = function(data, factor) { + var area = data.zoomArea; + var newarea = area.copy(); + // scale + newarea.width /= factor; + newarea.height /= factor; + // and recenter + newarea.x -= 0.5 * (newarea.width - area.width); + newarea.y -= 0.5 * (newarea.height - area.height); + newarea = FULL_AREA.fit(newarea); + data.zoomArea = newarea; + redisplay(data); + }; + + // add a mark where clicked + var setMark = function (data) { + var $scaler = data.$scaler; + // unbind other handler + $scaler.unbind(".dlZoomDrag"); + // start event capturing + $scaler.one('mousedown.dlSetMark', function (evt) { + // event handler adding a new mark + console.log("setmark at=", evt); + var mpos = geom.position(evt); + var pos = data.imgTrafo.invtransform(mpos); + data.marks.push(pos); + redisplay(data); + return false; + }); + }; + + // zoom to the area around two clicked points + var zoomArea = function(data) { + $elem = data.$elem; + $scaler = data.$scaler; + var pt1, pt2; + var $zoomDiv = $('<div class="zoomrect" style="display:none"/>'); + $elem.append($zoomDiv); + $zoomDiv.css(data.settings.zoomrectStyle); + var picRect = geom.rectangle($scaler); + // FIX ME: is there a way to query the border width from CSS info? + // rect.x -= 2; // account for overlay borders + // rect.y -= 2; + + var zoomStart = function (evt) { + pt1 = geom.position(evt); + // setup and show zoom div + pt1.adjustDiv($zoomDiv); + $zoomDiv.width(0).height(0); + $zoomDiv.show(); + // register events + $elem.bind("mousemove.dlZoomArea", zoomMove); + $elem.bind("mouseup.dlZoomArea", zoomEnd); + return false; + }; + + // mouse move handler + var zoomMove = function (evt) { + pt2 = geom.position(evt); + var rect = geom.rectangle(pt1, pt2); + rect.clipTo(picRect); + // update zoom div + rect.adjustDiv($zoomDiv); + return false; + }; + + // mouseup handler: end moving + var zoomEnd = function (evt) { + pt2 = geom.position(evt); + // assume a click and continue if the area is too small + var clickRect = geom.rectangle(pt1, pt2); + if (clickRect.getArea() <= 5) return false; + // hide zoom div + $zoomDiv.remove(); + // unregister events + $elem.unbind("mousemove.dlZoomArea", zoomMove); + $elem.unbind("mouseup.dlZoomArea", zoomEnd); + // clip and transform + clickRect.clipTo(picRect); + var area = data.imgTrafo.invtransform(clickRect); + data.zoomArea = area; + // zoomed is always fit + data.settings.ws = 1; + delete data.dlOpts.fitwidth; + delete data.dlOpts.fitheight; + redisplay(data); + return false; + }; + + // clear old handler (also ZoomDrag) + $scaler.unbind('.dlZoomArea'); + $scaler.unbind(".dlZoomDrag"); + $elem.unbind('.dlZoomArea'); + // bind start zoom handler + $scaler.one('mousedown.dlZoomArea', zoomStart); + }; + + // bird's eye view zoom area click and drag handler + var setupBirdDrag = function(data) { + var $birdImg = data.$birdImg; + var $birdZoom = data.$birdZoom; + var $document = $(document); + var $scaler = data.$scaler; + var startPos, newRect, birdImgRect, birdZoomRect, fullRect, scalerPos; + + // mousedown handler: start dragging bird zoom to a new position + var birdZoomStartDrag = function(evt) { + startPos = geom.position(evt); + // position may have changed + data.birdTrafo = getImgTrafo($birdImg, FULL_AREA); + birdImgRect = geom.rectangle($birdImg); + birdZoomRect = geom.rectangle($birdZoom); + scalerPos = geom.position($scaler); + newRect = null; + fullRect = setZoomBG(data); // setup zoom background image + $document.bind("mousemove.dlBirdMove", birdZoomMove); + $document.bind("mouseup.dlBirdMove", birdZoomEndDrag); + return false; + }; + + // mousemove handler: drag + var birdZoomMove = function(evt) { + var pos = geom.position(evt); + var delta = startPos.delta(pos); + // move birdZoom div, keeping size + newRect = birdZoomRect.copy(); + newRect.addPosition(delta); + newRect.stayInside(birdImgRect); + // reflect birdview zoom position in scaler image + var area = data.birdTrafo.invtransform(newRect); + var imgArea = data.imgTrafo.transform(area); + var offset = imgArea.getPosition().neg(); + offset.add(scalerPos); + if (fullRect) { + var bgPos = fullRect.getPosition().add(offset); + } else { + var bgPos = offset; + } + // move the background image to the new position + data.$scaler.css({ + 'background-position' : bgPos.x + "px " + bgPos.y + "px" + }); + // acount for border width + newRect.addPosition({x : -2, y : -2}); + newRect.adjustDiv($birdZoom); + return false; + }; + + // mouseup handler: reload page + var birdZoomEndDrag = function(evt) { + var settings = data.settings; + $document.unbind("mousemove.dlBirdMove", birdZoomMove); + $document.unbind("mouseup.dlBirdMove", birdZoomEndDrag); + if (newRect == null) { + // no movement happened - set center to click position + startPos = birdZoomRect.getCenter(); + birdZoomMove(evt); + } + // ugly, but needed to prevent double border width compensation + newRect.addPosition({x : +2, y : +2}); + var newArea = data.birdTrafo.invtransform(newRect); + data.zoomArea = newArea; + redisplay(data); + return false; + }; + + // clear old handler + $document.unbind(".dlBirdMove"); + $birdImg.unbind(".dlBirdMove"); + $birdZoom.unbind(".dlBirdMove"); + if (! isFullArea(data.zoomArea)) { + // set new handler + $birdImg.bind("mousedown.dlBirdMove", birdZoomStartDrag); + $birdZoom.bind("mousedown.dlBirdMove", birdZoomStartDrag); + } + }; + + // move bird zoom indicator to reflect zoomed detail area + var setBirdZoom = function(data, rect) { + var part = data.imgTrafo.invtransform(rect); + // area = FULL_AREA.fit(part); // no, we want to see where we transcend the borders + birdTrafo = getImgTrafo(data.$birdImg, FULL_AREA); + var birdRect = birdTrafo.transform(part); + // acount for border width + birdRect.addPosition({x : -2, y : -2}); + birdRect.adjustDiv(data.$birdZoom); + }; + + // set zoom background + var setZoomBG = function(data) { + var $scaler = data.$scaler; + var $img = data.$img; + var fullRect = null; + // hide the scaler img, show background of div instead + $img.css('visibility', 'hidden'); + var scalerCss = { + 'background-image' : 'url(' + $img.attr('src') + ')', + 'background-repeat' : 'no-repeat', + 'background-position' : 'left top', + 'opacity' : '0.5', + 'cursor' : 'move' + }; + if (data.hasBgSize) { + // full-size background using CSS3-background-size + fullRect = data.imgTrafo.transform(FULL_AREA); + if (fullRect.height < data.settings.maxBgSize && fullRect.width < data.settings.maxBgSize) { + // correct offset because background is relative + var scalerPos = geom.position($scaler); + fullRect.addPosition(scalerPos.neg()); + var url = getBirdImgUrl(data, ['rot', 'mo']); + scalerCss['background-image'] = 'url(' + url + ')'; + scalerCss[data.bgSizeName] = fullRect.width + 'px ' + fullRect.height + 'px'; + scalerCss['background-position'] = fullRect.x + 'px '+ fullRect.y + 'px'; + } else { + // too big + fullRect = null; + } + } + $scaler.css(scalerCss); + // isBgReady = true; + return fullRect; + }; + + // setup handlers for dragging the zoomed image + var setupZoomDrag = function(data) { + var startPos, delta, fullRect; + var $document = $(document); + var $elem = data.$elem; + var $scaler = data.$scaler; + var $img = data.$img; + + // drag the image and load a new detail on mouse up + var dragStart = function (evt) { + console.debug("dragstart at=",evt); + // don't start dragging if not zoomed + if (isFullArea(data.zoomArea)) return false; + startPos = geom.position(evt); + delta = null; + // set low res background immediately on mousedown + fullRect = setZoomBG(data); + $document.bind("mousemove.dlZoomDrag", dragMove); + $document.bind("mouseup.dlZoomDrag", dragEnd); + return false; + }; + + // mousemove handler: drag zoomed image + var dragMove = function (evt) { + var pos = geom.position(evt); + delta = startPos.delta(pos); + if (fullRect) { + var bgPos = fullRect.getPosition().add(delta); + } else { + var bgPos = delta; + } + // move the background image to the new position + $scaler.css({ + 'background-position' : bgPos.x + "px " + bgPos.y + "px" + }); + // set birdview indicator to reflect new zoom position + var za = geom.rectangle($img); + za.addPosition(delta.neg()); + setBirdZoom(data, za); + return false; + }; + + // mouseup handler: reload zoomed image in new position + var dragEnd = function (evt) { + $scaler.css('cursor', 'auto'); + $document.unbind("mousemove.dlZoomDrag", dragMove); + $document.unbind("mouseup.dlZoomDrag", dragEnd); + if (delta == null || delta.distance() < 2) { + // no movement + $img.css('visibility', 'visible'); + $scaler.css({'opacity' : '1', 'background-image' : 'none'}); + return false; + } + // get old zoom area (screen coordinates) + var za = geom.rectangle($img); + // move + za.addPosition(delta.neg()); + // transform back + var newArea = data.imgTrafo.invtransform(za); + data.zoomArea = FULL_AREA.fit(newArea); + redisplay(data); + return false; + }; + + // clear old handler + $document.unbind(".dlZoomDrag"); + $scaler.unbind(".dlZoomDrag"); + if (! isFullArea(data.zoomArea)) { + // set handler + $scaler.bind("mousedown.dlZoomDrag", dragStart); + } + }; + + // get image quality as a number (0..2) + var getQuality = function (data) { + var flags = data.scalerFlags; + var q = flags.q2 || flags.q1 || 'q0'; // assume q0 as default + return parseInt(q[1], 10); + }; + + // set image quality as a number (0..2) + var setQuality = function (data, qual) { + var flags = data.scalerFlags; + // clear flags + for (var i = 0; i < 3; ++i) { + delete flags['q'+i]; + } + flags['q'+qual] = 'q'+qual; + }; + + // sets a key to a value (relative values with +/- if relative=true) + var setNumValue = function(settings, key, value) { + if (value == null) return null; + if (isNumber(value)) { + settings[key] = value; + return value; + } + var sign = value[0]; + if (sign === '+' || sign === '-') { + if (settings[key] == null) { + // this isn't perfect but still... + settings[key] = 0; + } + settings[key] = parseFloat(settings[key]) + parseFloat(value); + } else { + settings[key] = value; + } + return settings[key]; + }; + + // auxiliary function (from old dllib.js) + var isFullArea = function(area) { + return (area.width === 1.0) && (area.height === 1.0); + }; + + // auxiliary function (from Douglas Crockford, A.10) + var isNumber = function isNumber(value) { + return typeof value === 'number' && isFinite(value); + }; + + // auxiliary function to crop senseless precision + var cropFloat = function (x) { + return parseInt(10000 * x, 10) / 10000; + }; + + // fallback for console.log calls + if (customConsole) { + var logFunction = function(type) { + return function(){ + var $debug = $('#debug'); // debug div + if (!$debug) return; + var args = Array.prototype.slice.call(arguments); + var argtext = args.join(' '); + var $logDiv = $('<div/>'); + $logDiv.addClass(type); + $logDiv.text(argtext); + $debug.append($logDiv); + }; + }; + console.log = logFunction('_log'); + console.debug = logFunction('_debug'); + console.error = logFunction('_error'); + } + + // hook plugin into jquery + $.fn.digilib = function(action) { + if (actions[action]) { + // call action on this with the remaining arguments (inserting data as first argument) + var $elem = $(this); + var data = $elem.data('digilib'); + var args = Array.prototype.slice.call(arguments, 1); + args.unshift(data); + return actions[action].apply(this, args); + } else if (typeof(action) === 'object' || !action) { + // call init on this + return actions.init.apply(this, arguments); + } else { + $.error('action ' + action + ' does not exist on jQuery.digilib'); + } + }; + +})(jQuery); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/blank.svg Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,3 @@ +<?xml version="1.0" encoding="UTF-8"?> +<svg onload="(window.parent || window).jQuery.svg._registerSVG();" version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink"> +</svg> \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svg.compat-1.0.1.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,69 @@ +/* http://keith-wood.name/svg.html + SVG for jQuery compatibility from v1.0.1 to v1.4.0. + Written by Keith Wood (kbwood{at}iinet.com.au) May 2008. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +var svgManager = null; +var svgGraphing = null; + +(function($) { // Hide scope, no $ conflict + +svgManager = $.svg; +svgGraphing = $.svg.graphing; +$.svg._rootClass = $.svg._wrapperClass; + +$.extend($.svg, { + /* Retrieve the SVG wrapper for a given division. + @param input element - division to look for or + jQuery - jQuery collection containing the division or + string - jQuery selector for the division + @return SVGRoot - the associated SVG wrapper */ + getSVGFor: function(input) { + input = (input.jquery ? input : $(input)); + return $.svg._getSVG(input); + } +}); + +$.extend($.svg._rootClass.prototype, { + /* Draw a rounded rectangle. + @param parent element - the parent node for the new shape + @param x number - the x-coordinate for the left edge of the rectangle + @param y number - the y-coordinate for the top edge of the rectangle + @param width number - the width of the rectangle + @param height number - the height of the rectangle + @param rx number - the x-radius of the ellipse for the rounded corners + @param ry number - the y-radius of the ellipse for the rounded corners + @param settings object - additional settings for the shape (optional) + @return the new shape node */ + roundrect: function(parent, x, y, width, height, rx, ry, settings) { + return this.rect(parent, x, y, width, height, rx, ry, settings); + }, +}); + +/* Attach the SVG functionality to a jQuery selection. + @param loadURL string - the URL of the initial document to load (optional) + @param onLoad function - a callback functional invoked following loading (optional) + @param settings object - the new settings to use for this SVG instance (optional) + @return jQuery object - for chaining further calls */ +$.fn.svg = function(loadURL, onLoad, settings) { + if (typeof loadURL == 'function') { + settings = onLoad; + onLoad = loadURL; + loadURL = null; + } + if (loadURL && typeof loadURL == 'object') { + settings = loadURL; + loadURL = onLoad = null; + } + if (onLoad && typeof onLoad == 'object') { + settings = onLoad; + onLoad = null; + } + return this.each(function() { + $.svg._attachSVG(this, {loadURL: loadURL, onLoad: onLoad, settings: settings}); + }); +}; + +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svg.css Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,15 @@ +/* http://keith-wood.name/svg.html + SVG for jQuery v1.4.2. + Written by Keith Wood (kbwood{at}iinet.com.au) August 2007. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +svg\:svg { + display: none; +} + +.svg_error { + color: red; + font-weight: bold; +}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svg.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,1339 @@ +/* http://keith-wood.name/svg.html + SVG for jQuery v1.4.3. + Written by Keith Wood (kbwood{at}iinet.com.au) August 2007. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +(function($) { // Hide scope, no $ conflict + +/* SVG manager. + Use the singleton instance of this class, $.svg, + to interact with the SVG functionality. */ +function SVGManager() { + this._settings = []; // Settings to be remembered per SVG object + this._extensions = []; // List of SVG extensions added to SVGWrapper + // for each entry [0] is extension name, [1] is extension class (function) + // the function takes one parameter - the SVGWrapper instance + this.regional = []; // Localisations, indexed by language, '' for default (English) + this.regional[''] = {errorLoadingText: 'Error loading', + notSupportedText: 'This browser does not support SVG'}; + this.local = this.regional['']; // Current localisation + this._uuid = new Date().getTime(); + this._renesis = detectActiveX('RenesisX.RenesisCtrl'); +} + +/* Determine whether a given ActiveX control is available. + @param classId (string) the ID for the ActiveX control + @return (boolean) true if found, false if not */ +function detectActiveX(classId) { + try { + return !!(window.ActiveXObject && new ActiveXObject(classId)); + } + catch (e) { + return false; + } +} + +var PROP_NAME = 'svgwrapper'; + +$.extend(SVGManager.prototype, { + /* Class name added to elements to indicate already configured with SVG. */ + markerClassName: 'hasSVG', + + /* SVG namespace. */ + svgNS: 'http://www.w3.org/2000/svg', + /* XLink namespace. */ + xlinkNS: 'http://www.w3.org/1999/xlink', + + /* SVG wrapper class. */ + _wrapperClass: SVGWrapper, + + /* Camel-case versions of attribute names containing dashes or are reserved words. */ + _attrNames: {class_: 'class', in_: 'in', + alignmentBaseline: 'alignment-baseline', baselineShift: 'baseline-shift', + clipPath: 'clip-path', clipRule: 'clip-rule', + colorInterpolation: 'color-interpolation', + colorInterpolationFilters: 'color-interpolation-filters', + colorRendering: 'color-rendering', dominantBaseline: 'dominant-baseline', + enableBackground: 'enable-background', fillOpacity: 'fill-opacity', + fillRule: 'fill-rule', floodColor: 'flood-color', + floodOpacity: 'flood-opacity', fontFamily: 'font-family', + fontSize: 'font-size', fontSizeAdjust: 'font-size-adjust', + fontStretch: 'font-stretch', fontStyle: 'font-style', + fontVariant: 'font-variant', fontWeight: 'font-weight', + glyphOrientationHorizontal: 'glyph-orientation-horizontal', + glyphOrientationVertical: 'glyph-orientation-vertical', + horizAdvX: 'horiz-adv-x', horizOriginX: 'horiz-origin-x', + imageRendering: 'image-rendering', letterSpacing: 'letter-spacing', + lightingColor: 'lighting-color', markerEnd: 'marker-end', + markerMid: 'marker-mid', markerStart: 'marker-start', + stopColor: 'stop-color', stopOpacity: 'stop-opacity', + strikethroughPosition: 'strikethrough-position', + strikethroughThickness: 'strikethrough-thickness', + strokeDashArray: 'stroke-dasharray', strokeDashOffset: 'stroke-dashoffset', + strokeLineCap: 'stroke-linecap', strokeLineJoin: 'stroke-linejoin', + strokeMiterLimit: 'stroke-miterlimit', strokeOpacity: 'stroke-opacity', + strokeWidth: 'stroke-width', textAnchor: 'text-anchor', + textDecoration: 'text-decoration', textRendering: 'text-rendering', + underlinePosition: 'underline-position', underlineThickness: 'underline-thickness', + vertAdvY: 'vert-adv-y', vertOriginY: 'vert-origin-y', + wordSpacing: 'word-spacing', writingMode: 'writing-mode'}, + + /* Add the SVG object to its container. */ + _attachSVG: function(container, settings) { + var svg = (container.namespaceURI == this.svgNS ? container : null); + var container = (svg ? null : container); + if ($(container || svg).hasClass(this.markerClassName)) { + return; + } + if (typeof settings == 'string') { + settings = {loadURL: settings}; + } + else if (typeof settings == 'function') { + settings = {onLoad: settings}; + } + $(container || svg).addClass(this.markerClassName); + try { + if (!svg) { + svg = document.createElementNS(this.svgNS, 'svg'); + svg.setAttribute('version', '1.1'); + svg.setAttribute('width', container.clientWidth); + svg.setAttribute('height', container.clientHeight); + container.appendChild(svg); + } + this._afterLoad(container, svg, settings || {}); + } + catch (e) { + if ($.browser.msie) { + if (!container.id) { + container.id = 'svg' + (this._uuid++); + } + this._settings[container.id] = settings; + container.innerHTML = '<embed type="image/svg+xml" width="100%" ' + + 'height="100%" src="' + (settings.initPath || '') + 'blank.svg"/>'; + } + else { + container.innerHTML = '<p class="svg_error">' + + this.local.notSupportedText + '</p>'; + } + } + }, + + /* SVG callback after loading - register SVG root. */ + _registerSVG: function() { + for (var i = 0; i < document.embeds.length; i++) { // Check all + var container = document.embeds[i].parentNode; + if (!$(container).hasClass($.svg.markerClassName) || // Not SVG + $.data(container, PROP_NAME)) { // Already done + continue; + } + var svg = null; + try { + svg = document.embeds[i].getSVGDocument(); + } + catch(e) { + setTimeout($.svg._registerSVG, 250); // Renesis takes longer to load + return; + } + svg = (svg ? svg.documentElement : null); + if (svg) { + $.svg._afterLoad(container, svg); + } + } + }, + + /* Post-processing once loaded. */ + _afterLoad: function(container, svg, settings) { + var settings = settings || this._settings[container.id]; + this._settings[container ? container.id : ''] = null; + var wrapper = new this._wrapperClass(svg, container); + $.data(container || svg, PROP_NAME, wrapper); + try { + if (settings.loadURL) { // Load URL + wrapper.load(settings.loadURL, settings); + } + if (settings.settings) { // Additional settings + wrapper.configure(settings.settings); + } + if (settings.onLoad && !settings.loadURL) { // Onload callback + settings.onLoad.apply(container || svg, [wrapper]); + } + } + catch (e) { + alert(e); + } + }, + + /* Return the SVG wrapper created for a given container. + @param container (string) selector for the container or + (element) the container for the SVG object or + jQuery collection - first entry is the container + @return (SVGWrapper) the corresponding SVG wrapper element, or null if not attached */ + _getSVG: function(container) { + container = (typeof container == 'string' ? $(container)[0] : + (container.jquery ? container[0] : container)); + return $.data(container, PROP_NAME); + }, + + /* Remove the SVG functionality from a div. + @param container (element) the container for the SVG object */ + _destroySVG: function(container) { + var $container = $(container); + if (!$container.hasClass(this.markerClassName)) { + return; + } + $container.removeClass(this.markerClassName); + if (container.namespaceURI != this.svgNS) { + $container.empty(); + } + $.removeData(container, PROP_NAME); + }, + + /* Extend the SVGWrapper object with an embedded class. + The constructor function must take a single parameter that is + a reference to the owning SVG root object. This allows the + extension to access the basic SVG functionality. + @param name (string) the name of the SVGWrapper attribute to access the new class + @param extClass (function) the extension class constructor */ + addExtension: function(name, extClass) { + this._extensions.push([name, extClass]); + } +}); + +/* The main SVG interface, which encapsulates the SVG element. + Obtain a reference from $().svg('get') */ +function SVGWrapper(svg, container) { + this._svg = svg; // The SVG root node + this._container = container; // The containing div + for (var i = 0; i < $.svg._extensions.length; i++) { + var extension = $.svg._extensions[i]; + this[extension[0]] = new extension[1](this); + } +} + +$.extend(SVGWrapper.prototype, { + + /* Retrieve the width of the SVG object. */ + _width: function() { + return (this._container ? this._container.clientWidth : this._svg.width); + }, + + /* Retrieve the height of the SVG object. */ + _height: function() { + return (this._container ? this._container.clientHeight : this._svg.height); + }, + + /* Retrieve the root SVG element. + @return the top-level SVG element */ + root: function() { + return this._svg; + }, + + /* Configure the SVG root. + @param settings (object) additional settings for the root + @param clear (boolean) true to remove existing attributes first, + false to add to what is already there (optional) + @return (SVGWrapper) this root */ + configure: function(settings, clear) { + if (clear) { + for (var i = this._svg.attributes.length - 1; i >= 0; i--) { + var attr = this._svg.attributes.item(i); + if (!(attr.nodeName == 'onload' || attr.nodeName == 'version' || + attr.nodeName.substring(0, 5) == 'xmlns')) { + this._svg.attributes.removeNamedItem(attr.nodeName); + } + } + } + for (var attrName in settings) { + this._svg.setAttribute(attrName, settings[attrName]); + } + return this; + }, + + /* Locate a specific element in the SVG document. + @param id (string) the element's identifier + @return (element) the element reference, or null if not found */ + getElementById: function(id) { + return this._svg.ownerDocument.getElementById(id); + }, + + /* Change the attributes for a SVG node. + @param element (SVG element) the node to change + @param settings (object) the new settings + @return (SVGWrapper) this root */ + change: function(element, settings) { + if (element) { + for (var name in settings) { + if (settings[name] == null) { + element.removeAttribute(name); + } + else { + element.setAttribute(name, settings[name]); + } + } + } + return this; + }, + + /* Check for parent being absent and adjust arguments accordingly. */ + _args: function(values, names, optSettings) { + names.splice(0, 0, 'parent'); + names.splice(names.length, 0, 'settings'); + var args = {}; + var offset = 0; + if (values[0] != null && values[0].jquery) { + values[0] = values[0][0]; + } + if (values[0] != null && !(typeof values[0] == 'object' && values[0].nodeName)) { + args['parent'] = null; + offset = 1; + } + for (var i = 0; i < values.length; i++) { + args[names[i + offset]] = values[i]; + } + if (optSettings) { + $.each(optSettings, function(i, value) { + if (typeof args[value] == 'object') { + args.settings = args[value]; + args[value] = null; + } + }); + } + return args; + }, + + /* Add a title. + @param parent (element or jQuery) the parent node for the new title (optional) + @param text (string) the text of the title + @param settings (object) additional settings for the title (optional) + @return (element) the new title node */ + title: function(parent, text, settings) { + var args = this._args(arguments, ['text']); + var node = this._makeNode(args.parent, 'title', args.settings || {}); + node.appendChild(this._svg.ownerDocument.createTextNode(args.text)); + return node; + }, + + /* Add a description. + @param parent (element or jQuery) the parent node for the new description (optional) + @param text (string) the text of the description + @param settings (object) additional settings for the description (optional) + @return (element) the new description node */ + describe: function(parent, text, settings) { + var args = this._args(arguments, ['text']); + var node = this._makeNode(args.parent, 'desc', args.settings || {}); + node.appendChild(this._svg.ownerDocument.createTextNode(args.text)); + return node; + }, + + /* Add a definitions node. + @param parent (element or jQuery) the parent node for the new definitions (optional) + @param id (string) the ID of this definitions (optional) + @param settings (object) additional settings for the definitions (optional) + @return (element) the new definitions node */ + defs: function(parent, id, settings) { + var args = this._args(arguments, ['id'], ['id']); + return this._makeNode(args.parent, 'defs', $.extend( + (args.id ? {id: args.id} : {}), args.settings || {})); + }, + + /* Add a symbol definition. + @param parent (element or jQuery) the parent node for the new symbol (optional) + @param id (string) the ID of this symbol + @param x1 (number) the left coordinate for this symbol + @param y1 (number) the top coordinate for this symbol + @param width (number) the width of this symbol + @param height (number) the height of this symbol + @param settings (object) additional settings for the symbol (optional) + @return (element) the new symbol node */ + symbol: function(parent, id, x1, y1, width, height, settings) { + var args = this._args(arguments, ['id', 'x1', 'y1', 'width', 'height']); + return this._makeNode(args.parent, 'symbol', $.extend({id: args.id, + viewBox: args.x1 + ' ' + args.y1 + ' ' + args.width + ' ' + args.height}, + args.settings || {})); + }, + + /* Add a marker definition. + @param parent (element or jQuery) the parent node for the new marker (optional) + @param id (string) the ID of this marker + @param refX (number) the x-coordinate for the reference point + @param refY (number) the y-coordinate for the reference point + @param mWidth (number) the marker viewport width + @param mHeight (number) the marker viewport height + @param orient (string or int) 'auto' or angle (degrees) (optional) + @param settings (object) additional settings for the marker (optional) + @return (element) the new marker node */ + marker: function(parent, id, refX, refY, mWidth, mHeight, orient, settings) { + var args = this._args(arguments, ['id', 'refX', 'refY', + 'mWidth', 'mHeight', 'orient'], ['orient']); + return this._makeNode(args.parent, 'marker', $.extend( + {id: args.id, refX: args.refX, refY: args.refY, markerWidth: args.mWidth, + markerHeight: args.mHeight, orient: args.orient || 'auto'}, args.settings || {})); + }, + + /* Add a style node. + @param parent (element or jQuery) the parent node for the new node (optional) + @param styles (string) the CSS styles + @param settings (object) additional settings for the node (optional) + @return (element) the new style node */ + style: function(parent, styles, settings) { + var args = this._args(arguments, ['styles']); + var node = this._makeNode(args.parent, 'style', $.extend( + {type: 'text/css'}, args.settings || {})); + node.appendChild(this._svg.ownerDocument.createTextNode(args.styles)); + if ($.browser.opera) { + $('head').append('<style type="text/css">' + args.styles + '</style>'); + } + return node; + }, + + /* Add a script node. + @param parent (element or jQuery) the parent node for the new node (optional) + @param script (string) the JavaScript code + @param type (string) the MIME type for the code (optional, default 'text/javascript') + @param settings (object) additional settings for the node (optional) + @return (element) the new script node */ + script: function(parent, script, type, settings) { + var args = this._args(arguments, ['script', 'type'], ['type']); + var node = this._makeNode(args.parent, 'script', $.extend( + {type: args.type || 'text/javascript'}, args.settings || {})); + node.appendChild(this._svg.ownerDocument.createTextNode(this._escapeXML(args.script))); + if (!$.browser.mozilla) { + $.globalEval(args.script); + } + return node; + }, + + /* Add a linear gradient definition. + Specify all of x1, y1, x2, y2 or none of them. + @param parent (element or jQuery) the parent node for the new gradient (optional) + @param id (string) the ID for this gradient + @param stops (string[][]) the gradient stops, each entry is + [0] is offset (0.0-1.0 or 0%-100%), [1] is colour, + [2] is opacity (optional) + @param x1 (number) the x-coordinate of the gradient start (optional) + @param y1 (number) the y-coordinate of the gradient start (optional) + @param x2 (number) the x-coordinate of the gradient end (optional) + @param y2 (number) the y-coordinate of the gradient end (optional) + @param settings (object) additional settings for the gradient (optional) + @return (element) the new gradient node */ + linearGradient: function(parent, id, stops, x1, y1, x2, y2, settings) { + var args = this._args(arguments, + ['id', 'stops', 'x1', 'y1', 'x2', 'y2'], ['x1']); + var sets = $.extend({id: args.id}, + (args.x1 != null ? {x1: args.x1, y1: args.y1, x2: args.x2, y2: args.y2} : {})); + return this._gradient(args.parent, 'linearGradient', + $.extend(sets, args.settings || {}), args.stops); + }, + + /* Add a radial gradient definition. + Specify all of cx, cy, r, fx, fy or none of them. + @param parent (element or jQuery) the parent node for the new gradient (optional) + @param id (string) the ID for this gradient + @param stops (string[][]) the gradient stops, each entry + [0] is offset, [1] is colour, [2] is opacity (optional) + @param cx (number) the x-coordinate of the largest circle centre (optional) + @param cy (number) the y-coordinate of the largest circle centre (optional) + @param r (number) the radius of the largest circle (optional) + @param fx (number) the x-coordinate of the gradient focus (optional) + @param fy (number) the y-coordinate of the gradient focus (optional) + @param settings (object) additional settings for the gradient (optional) + @return (element) the new gradient node */ + radialGradient: function(parent, id, stops, cx, cy, r, fx, fy, settings) { + var args = this._args(arguments, + ['id', 'stops', 'cx', 'cy', 'r', 'fx', 'fy'], ['cx']); + var sets = $.extend({id: args.id}, (args.cx != null ? + {cx: args.cx, cy: args.cy, r: args.r, fx: args.fx, fy: args.fy} : {})); + return this._gradient(args.parent, 'radialGradient', + $.extend(sets, args.settings || {}), args.stops); + }, + + /* Add a gradient node. */ + _gradient: function(parent, name, settings, stops) { + var node = this._makeNode(parent, name, settings); + for (var i = 0; i < stops.length; i++) { + var stop = stops[i]; + this._makeNode(node, 'stop', $.extend( + {offset: stop[0], stopColor: stop[1]}, + (stop[2] != null ? {stopOpacity: stop[2]} : {}))); + } + return node; + }, + + /* Add a pattern definition. + Specify all of vx, vy, xwidth, vheight or none of them. + @param parent (element or jQuery) the parent node for the new pattern (optional) + @param id (string) the ID for this pattern + @param x (number) the x-coordinate for the left edge of the pattern + @param y (number) the y-coordinate for the top edge of the pattern + @param width (number) the width of the pattern + @param height (number) the height of the pattern + @param vx (number) the minimum x-coordinate for view box (optional) + @param vy (number) the minimum y-coordinate for the view box (optional) + @param vwidth (number) the width of the view box (optional) + @param vheight (number) the height of the view box (optional) + @param settings (object) additional settings for the pattern (optional) + @return (element) the new pattern node */ + pattern: function(parent, id, x, y, width, height, vx, vy, vwidth, vheight, settings) { + var args = this._args(arguments, ['id', 'x', 'y', 'width', 'height', + 'vx', 'vy', 'vwidth', 'vheight'], ['vx']); + var sets = $.extend({id: args.id, x: args.x, y: args.y, + width: args.width, height: args.height}, (args.vx != null ? + {viewBox: args.vx + ' ' + args.vy + ' ' + args.vwidth + ' ' + args.vheight} : {})); + return this._makeNode(args.parent, 'pattern', $.extend(sets, args.settings || {})); + }, + + /* Add a mask definition. + @param parent (element or jQuery) the parent node for the new mask (optional) + @param id (string) the ID for this mask + @param x (number) the x-coordinate for the left edge of the mask + @param y (number) the y-coordinate for the top edge of the mask + @param width (number) the width of the mask + @param height (number) the height of the mask + @param settings (object) additional settings for the mask (optional) + @return (element) the new mask node */ + mask: function(parent, id, x, y, width, height, settings) { + var args = this._args(arguments, ['id', 'x', 'y', 'width', 'height']); + return this._makeNode(args.parent, 'mask', $.extend( + {id: args.id, x: args.x, y: args.y, width: args.width, height: args.height}, + args.settings || {})); + }, + + /* Create a new path object. + @return (SVGPath) a new path object */ + createPath: function() { + return new SVGPath(); + }, + + /* Create a new text object. + @return (SVGText) a new text object */ + createText: function() { + return new SVGText(); + }, + + /* Add an embedded SVG element. + Specify all of vx, vy, vwidth, vheight or none of them. + @param parent (element or jQuery) the parent node for the new node (optional) + @param x (number) the x-coordinate for the left edge of the node + @param y (number) the y-coordinate for the top edge of the node + @param width (number) the width of the node + @param height (number) the height of the node + @param vx (number) the minimum x-coordinate for view box (optional) + @param vy (number) the minimum y-coordinate for the view box (optional) + @param vwidth (number) the width of the view box (optional) + @param vheight (number) the height of the view box (optional) + @param settings (object) additional settings for the node (optional) + @return (element) the new node */ + svg: function(parent, x, y, width, height, vx, vy, vwidth, vheight, settings) { + var args = this._args(arguments, ['x', 'y', 'width', 'height', + 'vx', 'vy', 'vwidth', 'vheight'], ['vx']); + var sets = $.extend({x: args.x, y: args.y, width: args.width, height: args.height}, + (args.vx != null ? {viewBox: args.vx + ' ' + args.vy + ' ' + + args.vwidth + ' ' + args.vheight} : {})); + return this._makeNode(args.parent, 'svg', $.extend(sets, args.settings || {})); + }, + + /* Create a group. + @param parent (element or jQuery) the parent node for the new group (optional) + @param id (string) the ID of this group (optional) + @param settings (object) additional settings for the group (optional) + @return (element) the new group node */ + group: function(parent, id, settings) { + var args = this._args(arguments, ['id'], ['id']); + return this._makeNode(args.parent, 'g', $.extend({id: args.id}, args.settings || {})); + }, + + /* Add a usage reference. + Specify all of x, y, width, height or none of them. + @param parent (element or jQuery) the parent node for the new node (optional) + @param x (number) the x-coordinate for the left edge of the node (optional) + @param y (number) the y-coordinate for the top edge of the node (optional) + @param width (number) the width of the node (optional) + @param height (number) the height of the node (optional) + @param ref (string) the ID of the definition node + @param settings (object) additional settings for the node (optional) + @return (element) the new node */ + use: function(parent, x, y, width, height, ref, settings) { + var args = this._args(arguments, ['x', 'y', 'width', 'height', 'ref']); + if (typeof args.x == 'string') { + args.ref = args.x; + args.settings = args.y; + args.x = args.y = args.width = args.height = null; + } + var node = this._makeNode(args.parent, 'use', $.extend( + {x: args.x, y: args.y, width: args.width, height: args.height}, + args.settings || {})); + node.setAttributeNS($.svg.xlinkNS, 'href', args.ref); + return node; + }, + + /* Add a link, which applies to all child elements. + @param parent (element or jQuery) the parent node for the new link (optional) + @param ref (string) the target URL + @param settings (object) additional settings for the link (optional) + @return (element) the new link node */ + link: function(parent, ref, settings) { + var args = this._args(arguments, ['ref']); + var node = this._makeNode(args.parent, 'a', args.settings); + node.setAttributeNS($.svg.xlinkNS, 'href', args.ref); + return node; + }, + + /* Add an image. + @param parent (element or jQuery) the parent node for the new image (optional) + @param x (number) the x-coordinate for the left edge of the image + @param y (number) the y-coordinate for the top edge of the image + @param width (number) the width of the image + @param height (number) the height of the image + @param ref (string) the path to the image + @param settings (object) additional settings for the image (optional) + @return (element) the new image node */ + image: function(parent, x, y, width, height, ref, settings) { + var args = this._args(arguments, ['x', 'y', 'width', 'height', 'ref']); + var node = this._makeNode(args.parent, 'image', $.extend( + {x: args.x, y: args.y, width: args.width, height: args.height}, + args.settings || {})); + node.setAttributeNS($.svg.xlinkNS, 'href', args.ref); + return node; + }, + + /* Draw a path. + @param parent (element or jQuery) the parent node for the new shape (optional) + @param path (string or SVGPath) the path to draw + @param settings (object) additional settings for the shape (optional) + @return (element) the new shape node */ + path: function(parent, path, settings) { + var args = this._args(arguments, ['path']); + return this._makeNode(args.parent, 'path', $.extend( + {d: (args.path.path ? args.path.path() : args.path)}, args.settings || {})); + }, + + /* Draw a rectangle. + Specify both of rx and ry or neither. + @param parent (element or jQuery) the parent node for the new shape (optional) + @param x (number) the x-coordinate for the left edge of the rectangle + @param y (number) the y-coordinate for the top edge of the rectangle + @param width (number) the width of the rectangle + @param height (number) the height of the rectangle + @param rx (number) the x-radius of the ellipse for the rounded corners (optional) + @param ry (number) the y-radius of the ellipse for the rounded corners (optional) + @param settings (object) additional settings for the shape (optional) + @return (element) the new shape node */ + rect: function(parent, x, y, width, height, rx, ry, settings) { + var args = this._args(arguments, ['x', 'y', 'width', 'height', 'rx', 'ry'], ['rx']); + return this._makeNode(args.parent, 'rect', $.extend( + {x: args.x, y: args.y, width: args.width, height: args.height}, + (args.rx ? {rx: args.rx, ry: args.ry} : {}), args.settings || {})); + }, + + /* Draw a circle. + @param parent (element or jQuery) the parent node for the new shape (optional) + @param cx (number) the x-coordinate for the centre of the circle + @param cy (number) the y-coordinate for the centre of the circle + @param r (number) the radius of the circle + @param settings (object) additional settings for the shape (optional) + @return (element) the new shape node */ + circle: function(parent, cx, cy, r, settings) { + var args = this._args(arguments, ['cx', 'cy', 'r']); + return this._makeNode(args.parent, 'circle', $.extend( + {cx: args.cx, cy: args.cy, r: args.r}, args.settings || {})); + }, + + /* Draw an ellipse. + @param parent (element or jQuery) the parent node for the new shape (optional) + @param cx (number) the x-coordinate for the centre of the ellipse + @param cy (number) the y-coordinate for the centre of the ellipse + @param rx (number) the x-radius of the ellipse + @param ry (number) the y-radius of the ellipse + @param settings (object) additional settings for the shape (optional) + @return (element) the new shape node */ + ellipse: function(parent, cx, cy, rx, ry, settings) { + var args = this._args(arguments, ['cx', 'cy', 'rx', 'ry']); + return this._makeNode(args.parent, 'ellipse', $.extend( + {cx: args.cx, cy: args.cy, rx: args.rx, ry: args.ry}, args.settings || {})); + }, + + /* Draw a line. + @param parent (element or jQuery) the parent node for the new shape (optional) + @param x1 (number) the x-coordinate for the start of the line + @param y1 (number) the y-coordinate for the start of the line + @param x2 (number) the x-coordinate for the end of the line + @param y2 (number) the y-coordinate for the end of the line + @param settings (object) additional settings for the shape (optional) + @return (element) the new shape node */ + line: function(parent, x1, y1, x2, y2, settings) { + var args = this._args(arguments, ['x1', 'y1', 'x2', 'y2']); + return this._makeNode(args.parent, 'line', $.extend( + {x1: args.x1, y1: args.y1, x2: args.x2, y2: args.y2}, args.settings || {})); + }, + + /* Draw a polygonal line. + @param parent (element or jQuery) the parent node for the new shape (optional) + @param points (number[][]) the x-/y-coordinates for the points on the line + @param settings (object) additional settings for the shape (optional) + @return (element) the new shape node */ + polyline: function(parent, points, settings) { + var args = this._args(arguments, ['points']); + return this._poly(args.parent, 'polyline', args.points, args.settings); + }, + + /* Draw a polygonal shape. + @param parent (element or jQuery) the parent node for the new shape (optional) + @param points (number[][]) the x-/y-coordinates for the points on the shape + @param settings (object) additional settings for the shape (optional) + @return (element) the new shape node */ + polygon: function(parent, points, settings) { + var args = this._args(arguments, ['points']); + return this._poly(args.parent, 'polygon', args.points, args.settings); + }, + + /* Draw a polygonal line or shape. */ + _poly: function(parent, name, points, settings) { + var ps = ''; + for (var i = 0; i < points.length; i++) { + ps += points[i].join() + ' '; + } + return this._makeNode(parent, name, $.extend( + {points: $.trim(ps)}, settings || {})); + }, + + /* Draw text. + Specify both of x and y or neither of them. + @param parent (element or jQuery) the parent node for the text (optional) + @param x (number or number[]) the x-coordinate(s) for the text (optional) + @param y (number or number[]) the y-coordinate(s) for the text (optional) + @param value (string) the text content or + (SVGText) text with spans and references + @param settings (object) additional settings for the text (optional) + @return (element) the new text node */ + text: function(parent, x, y, value, settings) { + var args = this._args(arguments, ['x', 'y', 'value']); + if (typeof args.x == 'string' && arguments.length < 4) { + args.value = args.x; + args.settings = args.y; + args.x = args.y = null; + } + return this._text(args.parent, 'text', args.value, $.extend( + {x: (args.x && isArray(args.x) ? args.x.join(' ') : args.x), + y: (args.y && isArray(args.y) ? args.y.join(' ') : args.y)}, + args.settings || {})); + }, + + /* Draw text along a path. + @param parent (element or jQuery) the parent node for the text (optional) + @param path (string) the ID of the path + @param value (string) the text content or + (SVGText) text with spans and references + @param settings (object) additional settings for the text (optional) + @return (element) the new text node */ + textpath: function(parent, path, value, settings) { + var args = this._args(arguments, ['path', 'value']); + var node = this._text(args.parent, 'textPath', args.value, args.settings || {}); + node.setAttributeNS($.svg.xlinkNS, 'href', args.path); + return node; + }, + + /* Draw text. */ + _text: function(parent, name, value, settings) { + var node = this._makeNode(parent, name, settings); + if (typeof value == 'string') { + node.appendChild(node.ownerDocument.createTextNode(value)); + } + else { + for (var i = 0; i < value._parts.length; i++) { + var part = value._parts[i]; + if (part[0] == 'tspan') { + var child = this._makeNode(node, part[0], part[2]); + child.appendChild(node.ownerDocument.createTextNode(part[1])); + node.appendChild(child); + } + else if (part[0] == 'tref') { + var child = this._makeNode(node, part[0], part[2]); + child.setAttributeNS($.svg.xlinkNS, 'href', part[1]); + node.appendChild(child); + } + else if (part[0] == 'textpath') { + var set = $.extend({}, part[2]); + set.href = null; + var child = this._makeNode(node, part[0], set); + child.setAttributeNS($.svg.xlinkNS, 'href', part[2].href); + child.appendChild(node.ownerDocument.createTextNode(part[1])); + node.appendChild(child); + } + else { // straight text + node.appendChild(node.ownerDocument.createTextNode(part[1])); + } + } + } + return node; + }, + + /* Add a custom SVG element. + @param parent (element or jQuery) the parent node for the new element (optional) + @param name (string) the name of the element + @param settings (object) additional settings for the element (optional) + @return (element) the new custom node */ + other: function(parent, name, settings) { + var args = this._args(arguments, ['name']); + return this._makeNode(args.parent, args.name, args.settings || {}); + }, + + /* Create a shape node with the given settings. */ + _makeNode: function(parent, name, settings) { + parent = parent || this._svg; + var node = this._svg.ownerDocument.createElementNS($.svg.svgNS, name); + for (var name in settings) { + var value = settings[name]; + if (value != null && value != null && + (typeof value != 'string' || value != '')) { + node.setAttribute($.svg._attrNames[name] || name, value); + } + } + parent.appendChild(node); + return node; + }, + + /* Add an existing SVG node to the diagram. + @param parent (element or jQuery) the parent node for the new node (optional) + @param node (element) the new node to add or + (string) the jQuery selector for the node or + (jQuery collection) set of nodes to add + @return (SVGWrapper) this wrapper */ + add: function(parent, node) { + var args = this._args((arguments.length == 1 ? [null, parent] : arguments), ['node']); + var svg = this; + args.parent = args.parent || this._svg; + try { + if ($.svg._renesis) { + throw 'Force traversal'; + } + args.parent.appendChild(args.node.cloneNode(true)); + } + catch (e) { + args.node = (args.node.jquery ? args.node : $(args.node)); + args.node.each(function() { + var child = svg._cloneAsSVG(this); + if (child) { + args.parent.appendChild(child); + } + }); + } + return this; + }, + + /* SVG nodes must belong to the SVG namespace, so clone and ensure this is so. */ + _cloneAsSVG: function(node) { + var newNode = null; + if (node.nodeType == 1) { // element + newNode = this._svg.ownerDocument.createElementNS( + $.svg.svgNS, this._checkName(node.nodeName)); + for (var i = 0; i < node.attributes.length; i++) { + var attr = node.attributes.item(i); + if (attr.nodeName != 'xmlns' && attr.nodeValue) { + if (attr.prefix == 'xlink') { + newNode.setAttributeNS($.svg.xlinkNS, attr.localName, attr.nodeValue); + } + else { + newNode.setAttribute(this._checkName(attr.nodeName), attr.nodeValue); + } + } + } + for (var i = 0; i < node.childNodes.length; i++) { + var child = this._cloneAsSVG(node.childNodes[i]); + if (child) { + newNode.appendChild(child); + } + } + } + else if (node.nodeType == 3) { // text + if ($.trim(node.nodeValue)) { + newNode = this._svg.ownerDocument.createTextNode(node.nodeValue); + } + } + else if (node.nodeType == 4) { // CDATA + if ($.trim(node.nodeValue)) { + try { + newNode = this._svg.ownerDocument.createCDATASection(node.nodeValue); + } + catch (e) { + newNode = this._svg.ownerDocument.createTextNode( + node.nodeValue.replace(/&/g, '&'). + replace(/</g, '<').replace(/>/g, '>')); + } + } + } + return newNode; + }, + + /* Node names must be lower case and without SVG namespace prefix. */ + _checkName: function(name) { + name = (name.substring(0, 1) >= 'A' && name.substring(0, 1) <= 'Z' ? + name.toLowerCase() : name); + return (name.substring(0, 4) == 'svg:' ? name.substring(4) : name); + }, + + /* Load an external SVG document. + @param url (string) the location of the SVG document or + the actual SVG content + @param settings (boolean) see addTo below or + (function) see onLoad below or + (object) additional settings for the load with attributes below: + addTo (boolean) true to add to what's already there, + or false to clear the canvas first + changeSize (boolean) true to allow the canvas size to change, + or false to retain the original + onLoad (function) callback after the document has loaded, + 'this' is the container, receives SVG object and + optional error message as a parameter + @return (SVGWrapper) this root */ + load: function(url, settings) { + settings = (typeof settings == 'boolean'? {addTo: settings} : + (typeof settings == 'function'? {onLoad: settings} : settings || {})); + if (!settings.addTo) { + this.clear(false); + } + var size = [this._svg.getAttribute('width'), this._svg.getAttribute('height')]; + var wrapper = this; + // Report a problem with the load + var reportError = function(message) { + message = $.svg.local.errorLoadingText + ': ' + message; + if (settings.onLoad) { + settings.onLoad.apply(wrapper._container || wrapper._svg, [wrapper, message]); + } + else { + wrapper.text(null, 10, 20, message); + } + }; + // Create a DOM from SVG content + var loadXML4IE = function(data) { + var xml = new ActiveXObject('Microsoft.XMLDOM'); + xml.validateOnParse = false; + xml.resolveExternals = false; + xml.async = false; + xml.loadXML(data); + if (xml.parseError.errorCode != 0) { + reportError(xml.parseError.reason); + return null; + } + return xml; + }; + // Load the SVG DOM + var loadSVG = function(data) { + if (!data) { + return; + } + if (data.documentElement.nodeName != 'svg') { + var errors = data.getElementsByTagName('parsererror'); + var messages = (errors.length ? errors[0].getElementsByTagName('div') : []); // Safari + reportError(!errors.length ? '???' : + (messages.length ? messages[0] : errors[0]).firstChild.nodeValue); + return; + } + var attrs = {}; + for (var i = 0; i < data.documentElement.attributes.length; i++) { + var attr = data.documentElement.attributes.item(i); + if (!(attr.nodeName == 'version' || attr.nodeName.substring(0, 5) == 'xmlns')) { + attrs[attr.nodeName] = attr.nodeValue; + } + } + wrapper.configure(attrs, true); + var nodes = data.documentElement.childNodes; + for (var i = 0; i < nodes.length; i++) { + try { + if ($.svg._renesis) { + throw 'Force traversal'; + } + wrapper._svg.appendChild(nodes[i].cloneNode(true)); + if (nodes[i].nodeName == 'script') { + $.globalEval(nodes[i].textContent); + } + } + catch (e) { + wrapper.add(null, nodes[i]); + } + } + if (!settings.changeSize) { + wrapper.configure({width: size[0], height: size[1]}); + } + if (settings.onLoad) { + settings.onLoad.apply(wrapper._container || wrapper._svg, [wrapper]); + } + }; + if (url.match('<svg')) { // Inline SVG + loadSVG($.browser.msie ? loadXML4IE(url) : + new DOMParser().parseFromString(url, 'text/xml')); + } + else { // Remote SVG + $.ajax({url: url, dataType: ($.browser.msie ? 'text' : 'xml'), + success: function(xml) { + loadSVG($.browser.msie ? loadXML4IE(xml) : xml); + }, error: function(http, message, exc) { + reportError(message + (exc ? ' ' + exc.message : '')); + }}); + } + return this; + }, + + /* Delete a specified node. + @param node (element or jQuery) the drawing node to remove + @return (SVGWrapper) this root */ + remove: function(node) { + node = (node.jquery ? node[0] : node); + node.parentNode.removeChild(node); + return this; + }, + + /* Delete everything in the current document. + @param attrsToo (boolean) true to clear any root attributes as well, + false to leave them (optional) + @return (SVGWrapper) this root */ + clear: function(attrsToo) { + if (attrsToo) { + this.configure({}, true); + } + while (this._svg.firstChild) { + this._svg.removeChild(this._svg.firstChild); + } + return this; + }, + + /* Serialise the current diagram into an SVG text document. + @param node (SVG element) the starting node (optional) + @return (string) the SVG as text */ + toSVG: function(node) { + node = node || this._svg; + return (typeof XMLSerializer == 'undefined' ? this._toSVG(node) : + new XMLSerializer().serializeToString(node)); + }, + + /* Serialise one node in the SVG hierarchy. */ + _toSVG: function(node) { + var svgDoc = ''; + if (!node) { + return svgDoc; + } + if (node.nodeType == 3) { // Text + svgDoc = node.nodeValue; + } + else if (node.nodeType == 4) { // CDATA + svgDoc = '<![CDATA[' + node.nodeValue + ']]>'; + } + else { // Element + svgDoc = '<' + node.nodeName; + if (node.attributes) { + for (var i = 0; i < node.attributes.length; i++) { + var attr = node.attributes.item(i); + if (!($.trim(attr.nodeValue) == '' || attr.nodeValue.match(/^\[object/) || + attr.nodeValue.match(/^function/))) { + svgDoc += ' ' + (attr.namespaceURI == $.svg.xlinkNS ? 'xlink:' : '') + + attr.nodeName + '="' + attr.nodeValue + '"'; + } + } + } + if (node.firstChild) { + svgDoc += '>'; + var child = node.firstChild; + while (child) { + svgDoc += this._toSVG(child); + child = child.nextSibling; + } + svgDoc += '</' + node.nodeName + '>'; + } + else { + svgDoc += '/>'; + } + } + return svgDoc; + }, + + /* Escape reserved characters in XML. */ + _escapeXML: function(text) { + text = text.replace(/&/g, '&'); + text = text.replace(/</g, '<'); + text = text.replace(/>/g, '>'); + return text; + } +}); + +/* Helper to generate an SVG path. + Obtain an instance from the SVGWrapper object. + String calls together to generate the path and use its value: + var path = root.createPath(); + root.path(null, path.move(100, 100).line(300, 100).line(200, 300).close(), {fill: 'red'}); + or + root.path(null, path.move(100, 100).line([[300, 100], [200, 300]]).close(), {fill: 'red'}); */ +function SVGPath() { + this._path = ''; +} + +$.extend(SVGPath.prototype, { + /* Prepare to create a new path. + @return (SVGPath) this path */ + reset: function() { + this._path = ''; + return this; + }, + + /* Move the pointer to a position. + @param x (number) x-coordinate to move to or + (number[][]) x-/y-coordinates to move to + @param y (number) y-coordinate to move to (omitted if x is array) + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + move: function(x, y, relative) { + relative = (isArray(x) ? y : relative); + return this._coords((relative ? 'm' : 'M'), x, y); + }, + + /* Draw a line to a position. + @param x (number) x-coordinate to move to or + (number[][]) x-/y-coordinates to move to + @param y (number) y-coordinate to move to (omitted if x is array) + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + line: function(x, y, relative) { + relative = (isArray(x) ? y : relative); + return this._coords((relative ? 'l' : 'L'), x, y); + }, + + /* Draw a horizontal line to a position. + @param x (number) x-coordinate to draw to or + (number[]) x-coordinates to draw to + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + horiz: function(x, relative) { + this._path += (relative ? 'h' : 'H') + (isArray(x) ? x.join(' ') : x); + return this; + }, + + /* Draw a vertical line to a position. + @param y (number) y-coordinate to draw to or + (number[]) y-coordinates to draw to + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + vert: function(y, relative) { + this._path += (relative ? 'v' : 'V') + (isArray(y) ? y.join(' ') : y); + return this; + }, + + /* Draw a cubic Bézier curve. + @param x1 (number) x-coordinate of beginning control point or + (number[][]) x-/y-coordinates of control and end points to draw to + @param y1 (number) y-coordinate of beginning control point (omitted if x1 is array) + @param x2 (number) x-coordinate of ending control point (omitted if x1 is array) + @param y2 (number) y-coordinate of ending control point (omitted if x1 is array) + @param x (number) x-coordinate of curve end (omitted if x1 is array) + @param y (number) y-coordinate of curve end (omitted if x1 is array) + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + curveC: function(x1, y1, x2, y2, x, y, relative) { + relative = (isArray(x1) ? y1 : relative); + return this._coords((relative ? 'c' : 'C'), x1, y1, x2, y2, x, y); + }, + + /* Continue a cubic Bézier curve. + Starting control point is the reflection of the previous end control point. + @param x2 (number) x-coordinate of ending control point or + (number[][]) x-/y-coordinates of control and end points to draw to + @param y2 (number) y-coordinate of ending control point (omitted if x2 is array) + @param x (number) x-coordinate of curve end (omitted if x2 is array) + @param y (number) y-coordinate of curve end (omitted if x2 is array) + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + smoothC: function(x2, y2, x, y, relative) { + relative = (isArray(x2) ? y2 : relative); + return this._coords((relative ? 's' : 'S'), x2, y2, x, y); + }, + + /* Draw a quadratic Bézier curve. + @param x1 (number) x-coordinate of control point or + (number[][]) x-/y-coordinates of control and end points to draw to + @param y1 (number) y-coordinate of control point (omitted if x1 is array) + @param x (number) x-coordinate of curve end (omitted if x1 is array) + @param y (number) y-coordinate of curve end (omitted if x1 is array) + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + curveQ: function(x1, y1, x, y, relative) { + relative = (isArray(x1) ? y1 : relative); + return this._coords((relative ? 'q' : 'Q'), x1, y1, x, y); + }, + + /* Continue a quadratic Bézier curve. + Control point is the reflection of the previous control point. + @param x (number) x-coordinate of curve end or + (number[][]) x-/y-coordinates of points to draw to + @param y (number) y-coordinate of curve end (omitted if x is array) + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + smoothQ: function(x, y, relative) { + relative = (isArray(x) ? y : relative); + return this._coords((relative ? 't' : 'T'), x, y); + }, + + /* Generate a path command with (a list of) coordinates. */ + _coords: function(cmd, x1, y1, x2, y2, x3, y3) { + if (isArray(x1)) { + for (var i = 0; i < x1.length; i++) { + var cs = x1[i]; + this._path += (i == 0 ? cmd : ' ') + cs[0] + ',' + cs[1] + + (cs.length < 4 ? '' : ' ' + cs[2] + ',' + cs[3] + + (cs.length < 6 ? '': ' ' + cs[4] + ',' + cs[5])); + } + } + else { + this._path += cmd + x1 + ',' + y1 + + (x2 == null ? '' : ' ' + x2 + ',' + y2 + + (x3 == null ? '' : ' ' + x3 + ',' + y3)); + } + return this; + }, + + /* Draw an arc to a position. + @param rx (number) x-radius of arc or + (number/boolean[][]) x-/y-coordinates and flags for points to draw to + @param ry (number) y-radius of arc (omitted if rx is array) + @param xRotate (number) x-axis rotation (degrees, clockwise) (omitted if rx is array) + @param large (boolean) true to draw the large part of the arc, + false to draw the small part (omitted if rx is array) + @param clockwise (boolean) true to draw the clockwise arc, + false to draw the anti-clockwise arc (omitted if rx is array) + @param x (number) x-coordinate of arc end (omitted if rx is array) + @param y (number) y-coordinate of arc end (omitted if rx is array) + @param relative (boolean) true for coordinates relative to the current point, + false for coordinates being absolute + @return (SVGPath) this path */ + arc: function(rx, ry, xRotate, large, clockwise, x, y, relative) { + relative = (isArray(rx) ? ry : relative); + this._path += (relative ? 'a' : 'A'); + if (isArray(rx)) { + for (var i = 0; i < rx.length; i++) { + var cs = rx[i]; + this._path += (i == 0 ? '' : ' ') + cs[0] + ',' + cs[1] + ' ' + + cs[2] + ' ' + (cs[3] ? '1' : '0') + ',' + + (cs[4] ? '1' : '0') + ' ' + cs[5] + ',' + cs[6]; + } + } + else { + this._path += rx + ',' + ry + ' ' + xRotate + ' ' + + (large ? '1' : '0') + ',' + (clockwise ? '1' : '0') + ' ' + x + ',' + y; + } + return this; + }, + + /* Close the current path. + @return (SVGPath) this path */ + close: function() { + this._path += 'z'; + return this; + }, + + /* Return the string rendering of the specified path. + @return (string) stringified path */ + path: function() { + return this._path; + } +}); + +SVGPath.prototype.moveTo = SVGPath.prototype.move; +SVGPath.prototype.lineTo = SVGPath.prototype.line; +SVGPath.prototype.horizTo = SVGPath.prototype.horiz; +SVGPath.prototype.vertTo = SVGPath.prototype.vert; +SVGPath.prototype.curveCTo = SVGPath.prototype.curveC; +SVGPath.prototype.smoothCTo = SVGPath.prototype.smoothC; +SVGPath.prototype.curveQTo = SVGPath.prototype.curveQ; +SVGPath.prototype.smoothQTo = SVGPath.prototype.smoothQ; +SVGPath.prototype.arcTo = SVGPath.prototype.arc; + +/* Helper to generate an SVG text object. + Obtain an instance from the SVGWrapper object. + String calls together to generate the text and use its value: + var text = root.createText(); + root.text(null, x, y, text.string('This is '). + span('red', {fill: 'red'}).string('!'), {fill: 'blue'}); */ +function SVGText() { + this._parts = []; // The components of the text object +} + +$.extend(SVGText.prototype, { + /* Prepare to create a new text object. + @return (SVGText) this text */ + reset: function() { + this._parts = []; + return this; + }, + + /* Add a straight string value. + @param value (string) the actual text + @return (SVGText) this text object */ + string: function(value) { + this._parts[this._parts.length] = ['text', value]; + return this; + }, + + /* Add a separate text span that has its own settings. + @param value (string) the actual text + @param settings (object) the settings for this text + @return (SVGText) this text object */ + span: function(value, settings) { + this._parts[this._parts.length] = ['tspan', value, settings]; + return this; + }, + + /* Add a reference to a previously defined text string. + @param id (string) the ID of the actual text + @param settings (object) the settings for this text + @return (SVGText) this text object */ + ref: function(id, settings) { + this._parts[this._parts.length] = ['tref', id, settings]; + return this; + }, + + /* Add text drawn along a path. + @param id (string) the ID of the path + @param value (string) the actual text + @param settings (object) the settings for this text + @return (SVGText) this text object */ + path: function(id, value, settings) { + this._parts[this._parts.length] = ['textpath', value, + $.extend({href: id}, settings || {})]; + return this; + } +}); + +/* Attach the SVG functionality to a jQuery selection. + @param command (string) the command to run (optional, default 'attach') + @param options (object) the new settings to use for these SVG instances + @return jQuery (object) for chaining further calls */ +$.fn.svg = function(options) { + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && options == 'get') { + return $.svg['_' + options + 'SVG'].apply($.svg, [this[0]].concat(otherArgs)); + } + return this.each(function() { + if (typeof options == 'string') { + $.svg['_' + options + 'SVG'].apply($.svg, [this].concat(otherArgs)); + } + else { + $.svg._attachSVG(this, options || {}); + } + }); +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && a.constructor == Array); +} + +// Singleton primary SVG interface +$.svg = new SVGManager(); + +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svganim.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,405 @@ +/* http://keith-wood.name/svg.html + SVG attribute animations for jQuery v1.4.3. + Written by Keith Wood (kbwood{at}iinet.com.au) June 2008. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +(function($) { // Hide scope, no $ conflict + +// Enable animation for all of these SVG numeric attributes - +// named as svg-* or svg* (with first character upper case) +$.each(['x', 'y', 'width', 'height', 'rx', 'ry', 'cx', 'cy', 'r', 'x1', 'y1', 'x2', 'y2', + 'stroke-width', 'strokeWidth', 'opacity', 'fill-opacity', 'fillOpacity', + 'stroke-opacity', 'strokeOpacity', 'font-size', 'fontSize'], + function(i, attrName) { + var ccName = attrName.charAt(0).toUpperCase() + attrName.substr(1); + $.fx.step['svg' + ccName] = $.fx.step['svg-' + attrName] = function(fx) { + var realAttrName = $.svg._attrNames[attrName] || attrName; + var attr = fx.elem.attributes.getNamedItem(realAttrName); + if (!fx.set) { + fx.start = (attr ? parseFloat(attr.nodeValue) : 0); + var offset = fx.options.curAnim['svg-' + attrName] || + fx.options.curAnim['svg' + ccName]; + if (/^[+-]=/.exec(offset)) { + fx.end = fx.start + parseFloat(offset.replace(/=/, '')); + } + $(fx.elem).css(realAttrName, ''); + fx.set = true; + } + var value = (fx.pos * (fx.end - fx.start) + fx.start) + (fx.unit == '%' ? '%' : ''); + (attr ? attr.nodeValue = value : fx.elem.setAttribute(realAttrName, value)); + }; + } +); + +// Enable animation for the SVG viewBox attribute +$.fx.step['svgViewBox'] = $.fx.step['svg-viewBox'] = function(fx) { + var attr = fx.elem.attributes.getNamedItem('viewBox'); + if (!fx.set) { + fx.start = parseViewBox(attr ? attr.nodeValue : ''); + var offset = fx.options.curAnim['svg-viewBox'] || fx.options.curAnim['svgViewBox']; + fx.end = parseViewBox(offset); + if (/^[+-]=/.exec(offset)) { + offset = offset.split(' '); + while (offset.length < 4) { + offset.push('0'); + } + for (var i = 0; i < 4; i++) { + if (/^[+-]=/.exec(offset[i])) { + fx.end[i] = fx.start[i] + parseFloat(offset[i].replace(/=/, '')); + } + } + } + fx.set = true; + } + var value = $.map(fx.start, function(n, i) { + return (fx.pos * (fx.end[i] - n) + n); + }).join(' '); + (attr ? attr.nodeValue = value : fx.elem.setAttribute('viewBox', value)); +}; + +/* Parse a viewBox definition: x, y, width, height. + @param value (string) the definition + @return (number[4]) the extracted values */ +function parseViewBox(value) { + var viewBox = value.split(' '); + for (var i = 0; i < viewBox.length; i++) { + viewBox[i] = parseFloat(viewBox[i]); + if (isNaN(viewBox[i])) { + viewBox[i] = 0; + } + } + while (viewBox.length < 4) { + viewBox.push(0); + } + return viewBox; +} + +// Enable animation for the SVG transform attribute +$.fx.step['svgTransform'] = $.fx.step['svg-transform'] = function(fx) { + var attr = fx.elem.attributes.getNamedItem('transform'); + if (!fx.set) { + fx.start = parseTransform(attr ? attr.nodeValue : ''); + fx.end = parseTransform(fx.end, fx.start); + fx.set = true; + } + var transform = ''; + for (var i = 0; i < fx.end.order.length; i++) { + switch (fx.end.order.charAt(i)) { + case 't': + transform += (fx.start.translateX != fx.end.translateX || fx.start.translateY != fx.end.translateY ? + ' translate(' + (fx.pos * (fx.end.translateX - fx.start.translateX) + fx.start.translateX) + ',' + + (fx.pos * (fx.end.translateY - fx.start.translateY) + fx.start.translateY) + ')' : ''); + break; + case 's': + transform += (fx.start.scaleX != fx.end.scaleX || fx.start.scaleY != fx.end.scaleY ? + ' scale(' + (fx.pos * (fx.end.scaleX - fx.start.scaleX) + fx.start.scaleX) + ',' + + (fx.pos * (fx.end.scaleY - fx.start.scaleY) + fx.start.scaleY) + ')' : ''); + break; + case 'r': + transform += (fx.start.rotateA != fx.end.rotateA || + fx.start.rotateX != fx.end.rotateX || fx.start.rotateY != fx.end.rotateY ? + ' rotate(' + (fx.pos * (fx.end.rotateA - fx.start.rotateA) + fx.start.rotateA) + ',' + + (fx.pos * (fx.end.rotateX - fx.start.rotateX) + fx.start.rotateX) + ',' + + (fx.pos * (fx.end.rotateY - fx.start.rotateY) + fx.start.rotateY) + ')' : ''); + break; + case 'x': + transform += (fx.start.skewX != fx.end.skewX ? + ' skewX(' + (fx.pos * (fx.end.skewX - fx.start.skewX) + fx.start.skewX) + ')' : ''); + case 'y': + transform += (fx.start.skewY != fx.end.skewY ? + ' skewY(' + (fx.pos * (fx.end.skewY - fx.start.skewY) + fx.start.skewY) + ')' : ''); + break; + case 'm': + var matrix = ''; + for (var j = 0; j < 6; j++) { + matrix += ',' + (fx.pos * (fx.end.matrix[j] - fx.start.matrix[j]) + fx.start.matrix[j]); + } + transform += ' matrix(' + matrix.substr(1) + ')'; + break; + } + } + (attr ? attr.nodeValue = transform : fx.elem.setAttribute('transform', transform)); +}; + +/* Decode a transform string and extract component values. + @param value (string) the transform string to parse + @param original (object) the settings from the original node + @return (object) the combined transformation attributes */ +function parseTransform(value, original) { + value = value || ''; + if (typeof value == 'object') { + value = value.nodeValue; + } + var transform = $.extend({translateX: 0, translateY: 0, scaleX: 0, scaleY: 0, + rotateA: 0, rotateX: 0, rotateY: 0, skewX: 0, skewY: 0, + matrix: [0, 0, 0, 0, 0, 0]}, original || {}); + transform.order = ''; + var pattern = /([a-zA-Z]+)\(\s*([+-]?[\d\.]+)\s*(?:[\s,]\s*([+-]?[\d\.]+)\s*(?:[\s,]\s*([+-]?[\d\.]+)\s*(?:[\s,]\s*([+-]?[\d\.]+)\s*[\s,]\s*([+-]?[\d\.]+)\s*[\s,]\s*([+-]?[\d\.]+)\s*)?)?)?\)/g; + var result = pattern.exec(value); + while (result) { + switch (result[1]) { + case 'translate': + transform.order += 't'; + transform.translateX = parseFloat(result[2]); + transform.translateY = (result[3] ? parseFloat(result[3]) : 0); + break; + case 'scale': + transform.order += 's'; + transform.scaleX = parseFloat(result[2]); + transform.scaleY = (result[3] ? parseFloat(result[3]) : transform.scaleX); + break; + case 'rotate': + transform.order += 'r'; + transform.rotateA = parseFloat(result[2]); + transform.rotateX = (result[3] ? parseFloat(result[3]) : 0); + transform.rotateY = (result[4] ? parseFloat(result[4]) : 0); + break; + case 'skewX': + transform.order += 'x'; + transform.skewX = parseFloat(result[2]); + break; + case 'skewY': + transform.order += 'y'; + transform.skewY = parseFloat(result[2]); + break; + case 'matrix': + transform.order += 'm'; + transform.matrix = [parseFloat(result[2]), parseFloat(result[3]), + parseFloat(result[4]), parseFloat(result[5]), + parseFloat(result[6]), parseFloat(result[7])]; + break; + } + result = pattern.exec(value); + } + return transform; +} + +// Enable animation for all of these SVG colour properties - based on jquery.color.js +$.each(['fill', 'stroke'], + function(i, attrName) { + var ccName = attrName.charAt(0).toUpperCase() + attrName.substr(1); + $.fx.step['svg' + ccName] = $.fx.step['svg-' + attrName] = function(fx) { + if (!fx.set) { + fx.start = getColour(fx.elem, attrName); + var toNone = (fx.end == 'none'); + fx.end = (toNone ? getColour(fx.elem.parentNode, attrName) : getRGB(fx.end)); + fx.end[3] = toNone; + $(fx.elem).css(attrName, ''); + fx.set = true; + } + var attr = fx.elem.attributes.getNamedItem(attrName); + var colour = 'rgb(' + [ + Math.min(Math.max(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 0), 255), + Math.min(Math.max(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 0), 255), + Math.min(Math.max(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 0), 255) + ].join(',') + ')'; + colour = (fx.end[3] && fx.state == 1 ? 'none' : colour); + (attr ? attr.nodeValue = colour : fx.elem.setAttribute(attrName, colour)); + } + } +); + +/* Find this attribute value somewhere up the node hierarchy. + @param elem (element) the starting element to find the attribute + @param attr (string) the attribute name + @return (number[3]) RGB components for the attribute colour */ +function getColour(elem, attr) { + var colour; + do { + colour = (elem.attributes && elem.attributes.getNamedItem(attr) ? + elem.attributes.getNamedItem(attr).nodeValue : ''); + // Keep going until we find an element that has colour, or exit SVG + if ((colour != '' && colour != 'none') || $(elem).hasClass('hasSVG')) { + break; + } + } while (elem = elem.parentNode); + return getRGB(colour); +} + +/* Parse strings looking for common colour formats. + @param colour (string) colour description to parse + @return (number[3]) RGB components of this colour */ +function getRGB(colour) { + var result; + // Check if we're already dealing with an array of colors + if (colour && colour.constructor == Array && (colour.length == 3 || colour.length == 4)) { + return colour; + } + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(colour)) { + return [parseInt(result[1], 10), parseInt(result[2], 10), parseInt(result[3], 10)]; + } + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(colour)) { + return [parseFloat(result[1]) * 2.55, parseFloat(result[2]) * 2.55, + parseFloat(result[3]) * 2.55]; + } + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(colour)) { + return [parseInt(result[1], 16), parseInt(result[2], 16), parseInt(result[3], 16)]; + } + // Look for #abc + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(colour)) { + return [parseInt(result[1] + result[1], 16), parseInt(result[2] + result[2], 16), + parseInt(result[3] + result[3], 16)]; + } + // Otherwise, we're most likely dealing with a named color + return colours[$.trim(colour).toLowerCase()] || colours['none']; +} + +// The SVG named colours +var colours = { + '': [255, 255, 255, 1], + none: [255, 255, 255, 1], + aliceblue: [240, 248, 255], + antiquewhite: [250, 235, 215], + aqua: [ 0, 255, 255], + aquamarine: [127, 255, 212], + azure: [240, 255, 255], + beige: [245, 245, 220], + bisque: [255, 228, 196], + black: [ 0, 0, 0], + blanchedalmond: [255, 235, 205], + blue: [ 0, 0, 255], + blueviolet: [138, 43, 226], + brown: [165, 42, 42], + burlywood: [222, 184, 135], + cadetblue: [ 95, 158, 160], + chartreuse: [127, 255, 0], + chocolate: [210, 105, 30], + coral: [255, 127, 80], + cornflowerblue: [100, 149, 237], + cornsilk: [255, 248, 220], + crimson: [220, 20, 60], + cyan: [ 0, 255, 255], + darkblue: [ 0, 0, 139], + darkcyan: [ 0, 139, 139], + darkgoldenrod: [184, 134, 11], + darkgray: [169, 169, 169], + darkgreen: [ 0, 100, 0], + darkgrey: [169, 169, 169], + darkkhaki: [189, 183, 107], + darkmagenta: [139, 0, 139], + darkolivegreen: [ 85, 107, 47], + darkorange: [255, 140, 0], + darkorchid: [153, 50, 204], + darkred: [139, 0, 0], + darksalmon: [233, 150, 122], + darkseagreen: [143, 188, 143], + darkslateblue: [ 72, 61, 139], + darkslategray: [ 47, 79, 79], + darkslategrey: [ 47, 79, 79], + darkturquoise: [ 0, 206, 209], + darkviolet: [148, 0, 211], + deeppink: [255, 20, 147], + deepskyblue: [ 0, 191, 255], + dimgray: [105, 105, 105], + dimgrey: [105, 105, 105], + dodgerblue: [ 30, 144, 255], + firebrick: [178, 34, 34], + floralwhite: [255, 250, 240], + forestgreen: [ 34, 139, 34], + fuchsia: [255, 0, 255], + gainsboro: [220, 220, 220], + ghostwhite: [248, 248, 255], + gold: [255, 215, 0], + goldenrod: [218, 165, 32], + gray: [128, 128, 128], + grey: [128, 128, 128], + green: [ 0, 128, 0], + greenyellow: [173, 255, 47], + honeydew: [240, 255, 240], + hotpink: [255, 105, 180], + indianred: [205, 92, 92], + indigo: [ 75, 0, 130], + ivory: [255, 255, 240], + khaki: [240, 230, 140], + lavender: [230, 230, 250], + lavenderblush: [255, 240, 245], + lawngreen: [124, 252, 0], + lemonchiffon: [255, 250, 205], + lightblue: [173, 216, 230], + lightcoral: [240, 128, 128], + lightcyan: [224, 255, 255], + lightgoldenrodyellow: [250, 250, 210], + lightgray: [211, 211, 211], + lightgreen: [144, 238, 144], + lightgrey: [211, 211, 211], + lightpink: [255, 182, 193], + lightsalmon: [255, 160, 122], + lightseagreen: [ 32, 178, 170], + lightskyblue: [135, 206, 250], + lightslategray: [119, 136, 153], + lightslategrey: [119, 136, 153], + lightsteelblue: [176, 196, 222], + lightyellow: [255, 255, 224], + lime: [ 0, 255, 0], + limegreen: [ 50, 205, 50], + linen: [250, 240, 230], + magenta: [255, 0, 255], + maroon: [128, 0, 0], + mediumaquamarine: [102, 205, 170], + mediumblue: [ 0, 0, 205], + mediumorchid: [186, 85, 211], + mediumpurple: [147, 112, 219], + mediumseagreen: [ 60, 179, 113], + mediumslateblue: [123, 104, 238], + mediumspringgreen: [ 0, 250, 154], + mediumturquoise: [ 72, 209, 204], + mediumvioletred: [199, 21, 133], + midnightblue: [ 25, 25, 112], + mintcream: [245, 255, 250], + mistyrose: [255, 228, 225], + moccasin: [255, 228, 181], + navajowhite: [255, 222, 173], + navy: [ 0, 0, 128], + oldlace: [253, 245, 230], + olive: [128, 128, 0], + olivedrab: [107, 142, 35], + orange: [255, 165, 0], + orangered: [255, 69, 0], + orchid: [218, 112, 214], + palegoldenrod: [238, 232, 170], + palegreen: [152, 251, 152], + paleturquoise: [175, 238, 238], + palevioletred: [219, 112, 147], + papayawhip: [255, 239, 213], + peachpuff: [255, 218, 185], + peru: [205, 133, 63], + pink: [255, 192, 203], + plum: [221, 160, 221], + powderblue: [176, 224, 230], + purple: [128, 0, 128], + red: [255, 0, 0], + rosybrown: [188, 143, 143], + royalblue: [ 65, 105, 225], + saddlebrown: [139, 69, 19], + salmon: [250, 128, 114], + sandybrown: [244, 164, 96], + seagreen: [ 46, 139, 87], + seashell: [255, 245, 238], + sienna: [160, 82, 45], + silver: [192, 192, 192], + skyblue: [135, 206, 235], + slateblue: [106, 90, 205], + slategray: [112, 128, 144], + slategrey: [112, 128, 144], + snow: [255, 250, 250], + springgreen: [ 0, 255, 127], + steelblue: [ 70, 130, 180], + tan: [210, 180, 140], + teal: [ 0, 128, 128], + thistle: [216, 191, 216], + tomato: [255, 99, 71], + turquoise: [ 64, 224, 208], + violet: [238, 130, 238], + wheat: [245, 222, 179], + white: [255, 255, 255], + whitesmoke: [245, 245, 245], + yellow: [255, 255, 0], + yellowgreen: [154, 205, 50] +}; + +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svgdom.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,332 @@ +/* http://keith-wood.name/svg.html + SVG/jQuery DOM compatibility for jQuery v1.4.3. + Written by Keith Wood (kbwood{at}iinet.com.au) April 2009. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +(function($) { // Hide scope, no $ conflict + +/* Support adding class names to SVG nodes. */ +$.fn.addClass = function(origAddClass) { + return function(classNames) { + classNames = classNames || ''; + return this.each(function() { + if (isSVGElem(this)) { + var node = this; + $.each(classNames.split(/\s+/), function(i, className) { + var classes = (node.className ? node.className.baseVal : node.getAttribute('class')); + if ($.inArray(className, classes.split(/\s+/)) == -1) { + classes += (classes ? ' ' : '') + className; + (node.className ? node.className.baseVal = classes : + node.setAttribute('class', classes)); + } + }); + } + else { + origAddClass.apply($(this), [classNames]); + } + }); + }; +}($.fn.addClass); + +/* Support removing class names from SVG nodes. */ +$.fn.removeClass = function(origRemoveClass) { + return function(classNames) { + classNames = classNames || ''; + return this.each(function() { + if (isSVGElem(this)) { + var node = this; + $.each(classNames.split(/\s+/), function(i, className) { + var classes = (node.className ? node.className.baseVal : node.getAttribute('class')); + classes = $.grep(classes.split(/\s+/), function(n, i) { return n != className; }). + join(' '); + (node.className ? node.className.baseVal = classes : + node.setAttribute('class', classes)); + }); + } + else { + origRemoveClass.apply($(this), [classNames]); + } + }); + }; +}($.fn.removeClass); + +/* Support toggling class names on SVG nodes. */ +$.fn.toggleClass = function(origToggleClass) { + return function(className, state) { + return this.each(function() { + if (isSVGElem(this)) { + if (typeof state !== 'boolean') { + state = !$(this).hasClass(className); + } + $(this)[(state ? 'add' : 'remove') + 'Class'](className); + } + else { + origToggleClass.apply($(this), [className, state]); + } + }); + }; +}($.fn.toggleClass); + +/* Support checking class names on SVG nodes. */ +$.fn.hasClass = function(origHasClass) { + return function(className) { + className = className || ''; + var found = false; + this.each(function() { + if (isSVGElem(this)) { + var classes = (this.className ? this.className.baseVal : + this.getAttribute('class')).split(/\s+/); + found = ($.inArray(className, classes) > -1); + } + else { + found = (origHasClass.apply($(this), [className])); + } + return !found; + }); + return found; + }; +}($.fn.hasClass); + +/* Support attributes on SVG nodes. */ +$.fn.attr = function(origAttr) { + return function(name, value, type) { + if (typeof name === 'string' && value === undefined) { + var val = origAttr.apply(this, [name, value, type]); + if (val && val.baseVal && val.baseVal.numberOfItems != null) { // Transform + value = ''; + val = val.baseVal; + for (var i = 0; i < val.numberOfItems; i++) { + var item = val.getItem(i); + switch (item.type) { + case 1: value += ' matrix(' + item.matrix.a + ',' + item.matrix.b + ',' + + item.matrix.c + ',' + item.matrix.d + ',' + + item.matrix.e + ',' + item.matrix.f + ')'; + break; + case 2: value += ' translate(' + item.matrix.e + ',' + item.matrix.f + ')'; break; + case 3: value += ' scale(' + item.matrix.a + ',' + item.matrix.d + ')'; break; + case 4: value += ' rotate(' + item.angle + ')'; break; // Doesn't handle new origin + case 5: value += ' skewX(' + item.angle + ')'; break; + case 6: value += ' skewY(' + item.angle + ')'; break; + } + } + val = value.substring(1); + } + return (val && val.baseVal ? val.baseVal.valueAsString : val); + } + var options = name; + if (typeof name === 'string') { + options = {}; + options[name] = value; + } + return this.each(function() { + if (isSVGElem(this)) { + for (var n in options) { + var val = ($.isFunction(options[n]) ? options[n]() : options[n]); + (type ? this.style[n] = val : this.setAttribute(n, val)); + } + } + else { + origAttr.apply($(this), [name, value, type]); + } + }); + }; +}($.fn.attr); + +/* Support removing attributes on SVG nodes. */ +$.fn.removeAttr = function(origRemoveAttr) { + return function(name) { + return this.each(function() { + if (isSVGElem(this)) { + (this[name] && this[name].baseVal ? this[name].baseVal.value = '' : + this.setAttribute(name, '')); + } + else { + origRemoveAttr.apply($(this), [name]); + } + }); + }; +}($.fn.removeAttr); + +/* Determine if any nodes are SVG nodes. */ +function anySVG(checkSet) { + for (var i = 0; i < checkSet.length; i++) { + if (checkSet[i].nodeType == 1 && checkSet[i].namespaceURI == $.svg.svgNS) { + return true; + } + } + return false; +} + +/* Update Sizzle selectors. */ + +$.expr.relative['+'] = function(origRelativeNext) { + return function(checkSet, part, isXML) { + origRelativeNext(checkSet, part, isXML || anySVG(checkSet)); + }; +}($.expr.relative['+']); + +$.expr.relative['>'] = function(origRelativeChild) { + return function(checkSet, part, isXML) { + origRelativeChild(checkSet, part, isXML || anySVG(checkSet)); + }; +}($.expr.relative['>']); + +$.expr.relative[''] = function(origRelativeDescendant) { + return function(checkSet, part, isXML) { + origRelativeDescendant(checkSet, part, isXML || anySVG(checkSet)); + }; +}($.expr.relative['']); + +$.expr.relative['~'] = function(origRelativeSiblings) { + return function(checkSet, part, isXML) { + origRelativeSiblings(checkSet, part, isXML || anySVG(checkSet)); + }; +}($.expr.relative['~']); + +$.expr.find.ID = function(origFindId) { + return function(match, context, isXML) { + return (isSVGElem(context) ? + [context.ownerDocument.getElementById(match[1])] : + origFindId(match, context, isXML)); + }; +}($.expr.find.ID); + +var div = document.createElement('div'); +div.appendChild(document.createComment('')); +if (div.getElementsByTagName('*').length > 0) { // Make sure no comments are found + $.expr.find.TAG = function(match, context) { + var results = context.getElementsByTagName(match[1]); + if (match[1] === '*') { // Filter out possible comments + var tmp = []; + for (var i = 0; results[i] || results.item(i); i++) { + if ((results[i] || results.item(i)).nodeType === 1) { + tmp.push(results[i] || results.item(i)); + } + } + results = tmp; + } + return results; + }; +} + +$.expr.preFilter.CLASS = function(match, curLoop, inplace, result, not, isXML) { + match = ' ' + match[1].replace(/\\/g, '') + ' '; + if (isXML) { + return match; + } + for (var i = 0, elem = {}; elem != null; i++) { + elem = curLoop[i]; + if (!elem) { + try { + elem = curLoop.item(i); + } + catch (e) { + // Ignore + } + } + if (elem) { + var className = (!isSVGElem(elem) ? elem.className : + (elem.className ? elem.className.baseVal : '') || elem.getAttribute('class')); + if (not ^ (className && (' ' + className + ' ').indexOf(match) > -1)) { + if (!inplace) + result.push(elem); + } + else if (inplace) { + curLoop[i] = false; + } + } + } + return false; +}; + +$.expr.filter.CLASS = function(elem, match) { + var className = (!isSVGElem(elem) ? elem.className : + (elem.className ? elem.className.baseVal : elem.getAttribute('class'))); + return (' ' + className + ' ').indexOf(match) > -1; +}; + +$.expr.filter.ATTR = function(origFilterAttr) { + return function(elem, match) { + var handler = null; + if (isSVGElem(elem)) { + handler = match[1]; + $.expr.attrHandle[handler] = function(elem){ + var attr = elem.getAttribute(handler); + return attr && attr.baseVal || attr; + }; + } + var filter = origFilterAttr(elem, match); + if (handler) { + $.expr.attrHandle[handler] = null; + } + return filter; + }; +}($.expr.filter.ATTR); + +/* + Change Sizzle initialisation (line 1425) in jQuery v1.3.2 base code... + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + } else if ( context.nodeType === 1 ) { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) { + results.push( set[i] || set.item(i) ); // Here + } + } + } else { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] || set.item(i) ); // Here + } + } + } + } + + Change fallback makeArray (line 2076) implementation in jQuery Sizzle... + + if ( typeof array.length === "number" ) { + for ( var i = 0, l = array.length; i < l; i++ ) { + ret.push( array[i] || array.item(i) ); // Here + } + } +*/ + +/* + Events management requires changes to jQuery v1.3.2 base code... + + In $.event.add (line 2437)... + + if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) { + // Bind the global event handler to the element + try { // Here + elem.addEventListener(type, handle, false); + } + catch(e) { + if (elem.attachEvent) + elem.attachEvent("on" + type, handle); + } + } + + In $.event.remove (line 2521)... + + if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) { + try { // Here + elem.removeEventListener(type, jQuery.data(elem, "handle"), false); + } + catch (e) { + if (elem.detachEvent) + elem.detachEvent("on" + type, jQuery.data(elem, "handle")); + } + } +*/ + +/* Does this node belong to SVG? */ +function isSVGElem(node) { + return (node.nodeType == 1 && node.namespaceURI == $.svg.svgNS); +} + +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svgfilter.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,402 @@ +/* http://keith-wood.name/svg.html + SVG filters for jQuery v1.4.3. + Written by Keith Wood (kbwood{at}iinet.com.au) August 2007. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +(function($) { // Hide scope, no $ conflict + +$.svg.addExtension('filters', SVGFilter); + +$.extend($.svg._wrapperClass.prototype, { + + /* Add a filter definition. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param id (string) the ID for this filter + @param x (number) the x-coordinate for the left edge of the filter + @param y (number) the y-coordinate for the top edge of the filter + @param width (number) the width of the filter + @param height (number) the height of the filter + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + filter: function(parent, id, x, y, width, height, settings) { + var args = this._args(arguments, ['id', 'x', 'y', 'width', 'height']); + return this._makeNode(args.parent, 'filter', $.extend( + {id: args.id, x: args.x, y: args.y, width: args.width, height: args.height}, + args.settings || {})); + } +}); + +/* Extension point for SVG filters. + Access through svg.filters. */ +function SVGFilter(wrapper) { + this._wrapper = wrapper; // The attached SVG wrapper object +} + +$.extend(SVGFilter.prototype, { + + /* Add a distant light filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param azimuth (number) the angle (degrees) in the XY plane for the light source + @param elevation (number) the angle (degrees) in the YZ plane for the light source + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + distantLight: function(parent, result, azimuth, elevation, settings) { + var args = this._wrapper._args(arguments, ['result', 'azimuth', 'elevation']); + return this._wrapper._makeNode(args.parent, 'feDistantLight', $.extend( + {result: args.result, azimuth: args.azimuth, elevation: args.elevation}, + args.settings || {})); + }, + + /* Add a point light filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param x (number) the x-coordinate for the light source + @param y (number) the y-coordinate for the light source + @param z (number) the z-coordinate for the light source + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + pointLight: function(parent, result, x, y, z, settings) { + var args = this._wrapper._args(arguments, ['result', 'x', 'y', 'z']); + return this._wrapper._makeNode(args.parent, 'fePointLight', $.extend( + {result: args.result, x: args.x, y: args.y, z: args.z}, args.settings || {})); + }, + + /* Add a spot light filter. + Specify all of toX, toY, toZ or none of them. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param x (number) the x-coordinate for the light source + @param y (number) the y-coordinate for the light source + @param z (number) the z-coordinate for the light source + @param toX (number) the x-coordinate for where the light is pointing (optional) + @param toY (number) the y-coordinate for where the light is pointing (optional) + @param toZ (number) the z-coordinate for where the light is pointing (optional) + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + spotLight: function(parent, result, x, y, z, toX, toY, toZ, settings) { + var args = this._wrapper._args(arguments, + ['result', 'x', 'y', 'z', 'toX', 'toY', 'toZ'], ['toX']); + var sets = $.extend({result: args.result, x: args.x, y: args.y, z: args.z}, + (args.toX != null ? {pointsAtX: args.toX, pointsAtY: args.toY, + pointsAtZ: args.toZ} : {})); + return this._wrapper._makeNode(args.parent, 'feSpotLight', + $.extend(sets, args.settings || {})); + }, + + /* Add a blend filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param mode (string) normal | multiply | screen | darken | lighten + @param in1 (string) the first image to blend + @param in2 (string) the second image to blend + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + blend: function(parent, result, mode, in1, in2, settings) { + var args = this._wrapper._args(arguments, ['result', 'mode', 'in1', 'in2']); + return this._wrapper._makeNode(args.parent, 'feBlend', $.extend( + {result: args.result, mode: args.mode, in_: args.in1, in2: args.in2}, + args.settings || {})); + }, + + /* Add a colour matrix filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param in1 (string) the source to colour + @param type (string) matrix | saturate | hueRotate | luminanceToAlpha + @param values (number[][]) for 'matrix' the matrix (5x4) values to apply + (number) for 'saturate' 0.0 to 1.0 + (number) for 'hueRotate' degrees + (void) for 'luminanceToAlpha' + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + colorMatrix: function(parent, result, in1, type, values, settings) { + var args = this._wrapper._args(arguments, ['result', 'in1', 'type', 'values']); + if (isArray(args.values)) { + var vs = ''; + for (var i = 0; i < args.values.length; i++) { + vs += (i == 0 ? '' : ' ') + args.values[i].join(' '); + } + args.values = vs; + } + else if (typeof args.values == 'object') { + args.settings = args.values; + args.values = null; + } + var sets = $.extend({result: args.result, in_: args.in1, type: args.type}, + (args.values != null ? {values: args.values} : {})); + return this._wrapper._makeNode(args.parent, 'feColorMatrix', + $.extend(sets, args.settings || {})); + }, + + /* Add a component transfer filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param functions (object[]) one for each of RGB and A (alpha, optional) + for each entry: + [0] is (string) identity | table | discrete | linear | gamma + [1] is (number[]) for 'table' or 'discrete' the list of + interpolation or step values OR + (number) for 'linear' the slope, for 'gamma' the amplitude, + [2] is (number) for 'linear' the intercept, for 'gamma' the exponent, + [3] is (number) for 'gamma' the offset + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + componentTransfer: function(parent, result, functions, settings) { + var args = this._wrapper._args(arguments, ['result', 'functions']); + var node = this._wrapper._makeNode(args.parent, 'feComponentTransfer', + $.extend({result: args.result}, args.settings || {})); + var rgba = ['R', 'G', 'B', 'A']; + for (var i = 0; i < Math.min(4, args.functions.length); i++) { + var props = args.functions[i]; + var sets = $.extend({type: props[0]}, + (props[0] == 'table' || props[0] == 'discrete' ? {tableValues: props[1].join(' ')} : + (props[0] == 'linear' ? {slope: props[1], intercept: props[2]} : + (props[0] == 'gamma' ? {amplitude: props[1], + exponent: props[2], offset: props[3]} : {})))); + this._wrapper._makeNode(node, 'feFunc' + rgba[i], sets); + } + return node; + }, + + /* Add a composite filter. + Specify all of k1, k2, k3, k4 or none of them. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param operator (string) over | in | out | atop | xor | arithmetic + @param in1 (string) the first filter to compose + @param in2 (string) the second filter to compose + @param k1 (number) for 'arithmetic' (optional) + @param k2 (number) for 'arithmetic' (optional) + @param k3 (number) for 'arithmetic' (optional) + @param k4 (number) for 'arithmetic' (optional) + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + composite: function(parent, result, operator, in1, in2, k1, k2, k3, k4, settings) { + var args = this._wrapper._args(arguments, ['result', 'operator', + 'in1', 'in2', 'k1', 'k2', 'k3', 'k4'], ['k1']); + var sets = $.extend({result: args.result, operator: args.operator, + 'in': args.in1, in2: args.in2}, + (args.k1 != null ? {k1: args.k1, k2: args.k2, k3: args.k3, k4: args.k4} : {})); + return this._wrapper._makeNode(args.parent, 'feComposite', + $.extend(sets, args.settings || {})); + }, + + /* Add a convolve matrix filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param order (int or 'int int') the size(s) of the matrix + @param matrix (number[][]) the kernel matrix for the convolution + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + convolveMatrix: function(parent, result, order, matrix, settings) { + var args = this._wrapper._args(arguments, ['result', 'order', 'matrix']); + var mx = ''; + for (var i = 0; i < args.matrix.length; i++) { + mx += (i == 0 ? '' : ' ') + args.matrix[i].join(' '); + } + args.matrix = mx; + return this._wrapper._makeNode(args.parent, 'feConvolveMatrix', $.extend( + {result: args.result, order: args.order, kernelMatrix: args.matrix}, + args.settings || {})); + }, + + /* Add a diffuse lighting filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param colour (string) the lighting colour (optional) + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + diffuseLighting: function(parent, result, colour, settings) { + var args = this._wrapper._args(arguments, ['result', 'colour'], ['colour']); + return this._wrapper._makeNode(args.parent, 'feDiffuseLighting', + $.extend($.extend({result: args.result}, + (args.colour ? {lightingColor: args.colour} : {})), args.settings || {})); + }, + + /* Add a displacement map filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param in1 (string) the source image + @param in2 (string) the displacement image + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + displacementMap: function(parent, result, in1, in2, settings) { + var args = this._wrapper._args(arguments, ['result', 'in1', 'in2']); + return this._wrapper._makeNode(args.parent, 'feDisplacementMap', + $.extend({result: args.result, in_: args.in1, in2: args.in2}, + args.settings || {})); + }, + + /* Add a flood filter. + Specify all of x, y, width, height or none of them. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param x (number) the left coordinate of the rectangle (optional) + @param y (number) the top coordinate of the rectangle (optional) + @param width (number) the width of the rectangle (optional) + @param height (number) the height of the rectangle (optional) + @param colour (string) the colour to fill with + @param opacity (number) the opacity 0.0-1.0 + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + flood: function(parent, result, x, y, width, height, colour, opacity, settings) { + var args = this._wrapper._args(arguments, + ['result', 'x', 'y', 'width', 'height', 'colour', 'opacity']); + if (arguments.length < 6) { + args.colour = args.x; + args.opacity = args.y; + args.settings = args.width; + args.x = null; + } + var sets = $.extend({result: args.result, floodColor: args.colour, + floodOpacity: args.opacity}, (args.x != null ? + {x: args.x, y: args.y, width: args.width, height: args.height} : {})); + return this._wrapper._makeNode(args.parent, 'feFlood', + $.extend(sets, args.settings || {})); + }, + + /* Add a Gaussian blur filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param in1 (string) the source filter + @param stdDevX (number) the standard deviation along the x-axis + @param stdDevY (number) the standard deviation along the y-axis (optional) + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + gaussianBlur: function(parent, result, in1, stdDevX, stdDevY, settings) { + var args = this._wrapper._args(arguments, + ['result', 'in1', 'stdDevX', 'stdDevY'], ['stdDevY']); + return this._wrapper._makeNode(args.parent, 'feGaussianBlur', $.extend( + {result: args.result, in_: args.in1, stdDeviation: args.stdDevX + + (args.stdDevY ? ' ' + args.stdDevY : '')}, args.settings || {})); + }, + + /* Add an image filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param href (string) the URL of the image + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + image: function(parent, result, href, settings) { + var args = this._wrapper._args(arguments, ['result', 'href']); + var node = this._wrapper._makeNode(args.parent, 'feImage', $.extend( + {result: args.result}, args.settings || {})); + node.setAttributeNS($.svg.xlinkNS, 'href', args.href); + return node; + }, + + /* Add a merge filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param refs (string[]) the IDs of the filters to merge + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + merge: function(parent, result, refs, settings) { + var args = this._wrapper._args(arguments, ['result', 'refs']); + var node = this._wrapper._makeNode(args.parent, 'feMerge', $.extend( + {result: args.result}, args.settings || {})); + for (var i = 0; i < args.refs.length; i++) { + this._wrapper._makeNode(node, 'feMergeNode', {in_: args.refs[i]}); + } + return node; + }, + + /* Add a morphology filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param in1 (string) the source filter + @param operator (string) erode | dilate + @param radiusX (number) the size of the operation in the x-axis + @param radiusY (number) the size of the operation in the y-axis (optional) + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + morphology: function(parent, result, in1, operator, radiusX, radiusY, settings) { + var args = this._wrapper._args(arguments, ['result', 'in1', + 'operator', 'radiusX', 'radiusY'], ['radiusY']); + return this._wrapper._makeNode(args.parent, 'feMorphology', $.extend( + {result: args.result, in_: args.in1, operator: args.operator, + radius: args.radiusX + (args.radiusY ? ' ' + args.radiusY : '')}, + args.settings || {})); + }, + + /* Add an offset filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param in1 (string) the source filter + @param dX (number) the offset in the x-axis + @param dY (number) the offset in the y-axis + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + offset: function(parent, result, in1, dx, dy, settings) { + var args = this._wrapper._args(arguments, ['result', 'in1', 'dx', 'dy']); + return this._wrapper._makeNode(args.parent, 'feOffset', $.extend( + {result: args.result, in_: args.in1, dx: args.dx, dy: args.dy}, + args.settings || {})); + }, + + /* Add a specular lighting filter. + Numeric params are only optional if following numeric params are also omitted. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param in1 (string) the source filter + @param surfaceScale (number) the surface height when Ain = 1 (optional) + @param specularConstant (number) the ks in Phong lighting model (optional) + @param specularExponent (number) the shininess 1.0-128.0 (optional) + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + specularLighting: function(parent, result, in1, surfaceScale, + specularConstant, specularExponent, settings) { + var args = this._wrapper._args(arguments, ['result', 'in1', + 'surfaceScale', 'specularConstant', 'specularExponent'], + ['surfaceScale', 'specularConstant', 'specularExponent']); + return this._wrapper._makeNode(args.parent, 'feSpecularLighting', $.extend( + {result: args.result, in_: args.in1, surfaceScale: args.surfaceScale, + specularConstant: args.specularConstant, specularExponent: args.specularExponent}, + args.settings || {})); + }, + + /* Add a tile filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param in1 (string) the source filter + @param x (number) the left coordinate of the rectangle + @param y (number) the top coordinate of the rectangle + @param width (number) the width of the rectangle + @param height (number) the height of the rectangle + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + tile: function(parent, result, in1, x, y, width, height, settings) { + var args = this._wrapper._args(arguments, + ['result', 'in1', 'x', 'y', 'width', 'height']); + return this._wrapper._makeNode(args.parent, 'feTile', $.extend( + {result: args.result, in_: args.in1, x: args.x, y: args.y, + width: args.width, height: args.height}, args.settings || {})); + }, + + /* Add a turbulence filter. + @param parent (element or jQuery) the parent node for the new filter (optional) + @param result (string) the ID of this filter + @param type (string) fractalNoise | turbulence + @param baseFreq (number or 'number number') the base frequency, + optionally separated into x- and y-components + @param octaves (number) the amount of turbulence (optional) + @param settings (object) additional settings for the filter (optional) + @return (element) the new filter node */ + turbulence: function(parent, result, type, baseFreq, octaves, settings) { + var args = this._wrapper._args(arguments, ['result', 'type', + 'baseFreq', 'octaves'], ['octaves']); + return this._wrapper._makeNode(args.parent, 'feTurbulence', $.extend( + {result: args.result, type: args.type, baseFrequency: args.baseFreq, + numOctaves: args.octaves}, args.settings || {})); + } +}); + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && a.constructor == Array); +} + +})(jQuery)
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svggraph.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,1482 @@ +/* http://keith-wood.name/svg.html + SVG graphing extension for jQuery v1.4.3. + Written by Keith Wood (kbwood{at}iinet.com.au) August 2007. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +(function($) { // Hide scope, no $ conflict + +$.svg.addExtension('graph', SVGGraph); + +// Singleton primary SVG graphing interface +$.svg.graphing = new SVGGraphing(); + +function SVGGraphing() { + this.regional = []; + this.regional[''] = {percentageText: 'Percentage'}; + this.region = this.regional['']; +} + +$.extend(SVGGraphing.prototype, { + _chartTypes: [], + + /* Add a new chart rendering type to the package. + The rendering object must implement the following functions: + getTitle(), getDescription(), getOptions(), drawChart(graph). + @param id (string) the ID of this graph renderer + @param chartType (object) the object implementing this chart type */ + addChartType: function(id, chartType) { + this._chartTypes[id] = chartType; + }, + + /* Retrieve the list of chart types. + @return (object[string]) the array of chart types indexed by ID */ + chartTypes: function() { + return this._chartTypes; + } +}); + +/* Extension point for SVG graphing. + Access through svg.graph. */ +function SVGGraph(wrapper) { + this._wrapper = wrapper; // The attached SVG wrapper object + this._drawNow = false; // True for immediate update, false to wait for redraw call + for (var id in $.svg.graphing._chartTypes) { + this._chartType = $.svg.graphing._chartTypes[id]; // Use first graph renderer + break; + } + this._chartOptions = {}; // Extra options for the graph type + // The graph title and settings + this._title = {value: '', offset: 25, settings: {textAnchor: 'middle'}}; + this._area = [0.1, 0.1, 0.8, 0.9]; // The chart area: left, top, right, bottom, + // > 1 in pixels, <= 1 as proportion + this._chartFormat = {fill: 'none', stroke: 'black'}; // The formatting for the chart area + this._gridlines = []; // The formatting of the x- and y-gridlines + this._series = []; // The series to be plotted, each is an object + this._onstatus = null; // The callback function for status updates + this._chartCont = this._wrapper.svg(0, 0, 0, 0, {class_: 'svg-graph'}); // The main container for the graph + + this.xAxis = new SVGGraphAxis(this); // The main x-axis + this.xAxis.title('', 40); + this.yAxis = new SVGGraphAxis(this); // The main y-axis + this.yAxis.title('', 40); + this.x2Axis = null; // The secondary x-axis + this.y2Axis = null; // The secondary y-axis + this.legend = new SVGGraphLegend(this); // The chart legend + this._drawNow = true; +} + +$.extend(SVGGraph.prototype, { + + /* Useful indexes. */ + X: 0, + Y: 1, + W: 2, + H: 3, + L: 0, + T: 1, + R: 2, + B: 3, + + /* Standard percentage axis. */ + _percentageAxis: new SVGGraphAxis(this, $.svg.graphing.region.percentageText, 0, 100, 10, 0), + + /* Set or retrieve the container for the graph. + @param cont (SVG element) the container for the graph + @return (SVGGraph) this graph object or + (SVG element) the current container (if no parameters) */ + container: function(cont) { + if (arguments.length == 0) { + return this._chartCont; + } + this._chartCont = cont; + return this; + }, + + /* Set or retrieve the type of chart to be rendered. + See $.svg.graphing.getChartTypes() for the list of available types. + @param id (string) the ID of the chart type + @param options (object) additional settings for this chart type (optional) + @return (SVGGraph) this graph object or + (string) the chart type (if no parameters) + @deprecated use type() */ + chartType: function(id, options) { + return (arguments.length == 0 ? this.type() : this.type(id, options)); + }, + + /* Set or retrieve the type of chart to be rendered. + See $.svg.graphing.getChartTypes() for the list of available types. + @param id (string) the ID of the chart type + @param options (object) additional settings for this chart type (optional) + @return (SVGGraph) this graph object or + (string) the chart type (if no parameters) */ + type: function(id, options) { + if (arguments.length == 0) { + return this._chartType; + } + var chartType = $.svg.graphing._chartTypes[id]; + if (chartType) { + this._chartType = chartType; + this._chartOptions = $.extend({}, options || {}); + } + this._drawGraph(); + return this; + }, + + /* Set or retrieve additional options for the particular chart type. + @param options (object) the extra options + @return (SVGGraph) this graph object or + (object) the chart options (if no parameters) + @deprecated use options() */ + chartOptions: function(options) { + return(arguments.length == 0 ? this.options() : this.options(options)); + }, + + /* Set or retrieve additional options for the particular chart type. + @param options (object) the extra options + @return (SVGGraph) this graph object or + (object) the chart options (if no parameters) */ + options: function(options) { + if (arguments.length == 0) { + return this._chartOptions; + } + this._chartOptions = $.extend({}, options); + this._drawGraph(); + return this; + }, + + /* Set or retrieve the background of the graph chart. + @param fill (string) how to fill the chart background + @param stroke (string) the colour of the outline (optional) + @param settings (object) additional formatting for the chart background (optional) + @return (SVGGraph) this graph object or + (object) the chart format (if no parameters) + @deprecated use format() */ + chartFormat: function(fill, stroke, settings) { + return (arguments.length == 0 ? this.format() : this.format(fill, stroke, settings)); + }, + + /* Set or retrieve the background of the graph chart. + @param fill (string) how to fill the chart background + @param stroke (string) the colour of the outline (optional) + @param settings (object) additional formatting for the chart background (optional) + @return (SVGGraph) this graph object or + (object) the chart format (if no parameters) */ + format: function(fill, stroke, settings) { + if (arguments.length == 0) { + return this._chartFormat; + } + if (typeof stroke == 'object') { + settings = stroke; + stroke = null; + } + this._chartFormat = $.extend({fill: fill}, + (stroke ? {stroke: stroke} : {}), settings || {}); + this._drawGraph(); + return this; + }, + + /* Set or retrieve the main chart area. + @param left (number) > 1 is pixels, <= 1 is proportion of width or + (number[4]) for left, top, right, bottom + @param top (number) > 1 is pixels, <= 1 is proportion of height + @param right (number) > 1 is pixels, <= 1 is proportion of width + @param bottom (number) > 1 is pixels, <= 1 is proportion of height + @return (SVGGraph) this graph object or + (number[4]) the chart area: left, top, right, bottom (if no parameters) + @deprecated use area() */ + chartArea: function(left, top, right, bottom) { + return (arguments.length == 0 ? this.area() : this.area(left, top, right, bottom)); + }, + + /* Set or retrieve the main chart area. + @param left (number) > 1 is pixels, <= 1 is proportion of width or + (number[4]) for left, top, right, bottom + @param top (number) > 1 is pixels, <= 1 is proportion of height + @param right (number) > 1 is pixels, <= 1 is proportion of width + @param bottom (number) > 1 is pixels, <= 1 is proportion of height + @return (SVGGraph) this graph object or + (number[4]) the chart area: left, top, right, bottom (if no parameters) */ + area: function(left, top, right, bottom) { + if (arguments.length == 0) { + return this._area; + } + this._area = (isArray(left) ? left : [left, top, right, bottom]); + this._drawGraph(); + return this; + }, + + /* Set or retrieve the gridlines formatting for the graph chart. + @param xSettings (string) the colour of the gridlines along the x-axis, or + (object) formatting for the gridlines along the x-axis, or + null for none + @param ySettings (string) the colour of the gridlines along the y-axis, or + (object) formatting for the gridlines along the y-axis, or + null for none + @return (SVGGraph) this graph object or + (object[2]) the gridlines formatting (if no parameters) */ + gridlines: function(xSettings, ySettings) { + if (arguments.length == 0) { + return this._gridlines; + } + this._gridlines = [(typeof xSettings == 'string' ? {stroke: xSettings} : xSettings), + (typeof ySettings == 'string' ? {stroke: ySettings} : ySettings)]; + if (this._gridlines[0] == null && this._gridlines[1] == null) { + this._gridlines = []; + } + this._drawGraph(); + return this; + }, + + /* Set or retrieve the title of the graph and its formatting. + @param value (string) the title + @param offset (number) the vertical positioning of the title + > 1 is pixels, <= 1 is proportion of width (optional) + @param colour (string) the colour of the title (optional) + @param settings (object) formatting for the title (optional) + @return (SVGGraph) this graph object or + (object) value, offset, and settings for the title (if no parameters) */ + title: function(value, offset, colour, settings) { + if (arguments.length == 0) { + return this._title; + } + if (typeof offset != 'number') { + settings = colour; + colour = offset; + offset = null; + } + if (typeof colour != 'string') { + settings = colour; + colour = null; + } + this._title = {value: value, offset: offset || this._title.offset, + settings: $.extend({textAnchor: 'middle'}, + (colour ? {fill: colour} : {}), settings || {})}; + this._drawGraph(); + return this; + }, + + /* Add a series of values to be plotted on the graph. + @param name (string) the name of this series (optional) + @param values (number[]) the values to be plotted + @param fill (string) how the plotted values are filled + @param stroke (string) the colour of the plotted lines (optional) + @param strokeWidth (number) the width of the plotted lines (optional) + @param settings (object) additional settings for the plotted values (optional) + @return (SVGGraph) this graph object */ + addSeries: function(name, values, fill, stroke, strokeWidth, settings) { + this._series.push(new SVGGraphSeries( + this, name, values, fill, stroke, strokeWidth, settings)); + this._drawGraph(); + return this; + }, + + /* Retrieve the series wrappers. + @param i (number) the series index (optional) + @return (SVGGraphSeries) the specified series or + (SVGGraphSeries[]) the list of series */ + series: function(i) { + return (arguments.length > 0 ? this._series[i] : null) || this._series; + }, + + /* Suppress drawing of the graph until redraw() is called. + @return (SVGGraph) this graph object */ + noDraw: function() { + this._drawNow = false; + return this; + }, + + /* Redraw the entire graph with the current settings and values. + @return (SVGGraph) this graph object */ + redraw: function() { + this._drawNow = true; + this._drawGraph(); + return this; + }, + + /* Set the callback function for status updates. + @param onstatus (function) the callback function + @return (SVGGraph) this graph object */ + status: function(onstatus) { + this._onstatus = onstatus; + return this; + }, + + /* Actually draw the graph (if allowed) based on the graph type set. */ + _drawGraph: function() { + if (!this._drawNow) { + return; + } + while (this._chartCont.firstChild) { + this._chartCont.removeChild(this._chartCont.firstChild); + } + if (!this._chartCont.parent) { + this._wrapper._svg.appendChild(this._chartCont); + } + // Set sizes if not already there + if (!this._chartCont.width) { + this._chartCont.setAttribute('width', + parseInt(this._chartCont.getAttribute('width'), 10) || this._wrapper._width()); + } + else if (this._chartCont.width.baseVal) { + this._chartCont.width.baseVal.value = + this._chartCont.width.baseVal.value || this._wrapper._width(); + } + else { + this._chartCont.width = this._chartCont.width || this._wrapper._width(); + } + if (!this._chartCont.height) { + this._chartCont.setAttribute('height', + parseInt(this._chartCont.getAttribute('height'), 10) || this._wrapper._height()); + } + else if (this._chartCont.height.baseVal) { + this._chartCont.height.baseVal.value = + this._chartCont.height.baseVal.value || this._wrapper._height(); + } + else { + this._chartCont.height = this._chartCont.height || this._wrapper._height(); + } + this._chartType.drawGraph(this); + }, + + /* Decode an attribute value. + @param node the node to examine + @param name the attribute name + @return the actual value */ + _getValue: function(node, name) { + return (!node[name] ? parseInt(node.getAttribute(name), 10) : + (node[name].baseVal ? node[name].baseVal.value : node[name])); + }, + + /* Draw the graph title - centred. */ + _drawTitle: function() { + this._wrapper.text(this._chartCont, this._getValue(this._chartCont, 'width') / 2, + this._title.offset, this._title.value, this._title.settings); + }, + + /* Calculate the actual dimensions of the chart area. + @param area (number[4]) the area values to evaluate (optional) + @return (number[4]) an array of dimension values: left, top, width, height */ + _getDims: function(area) { + area = area || this._area; + var availWidth = this._getValue(this._chartCont, 'width'); + var availHeight = this._getValue(this._chartCont, 'height'); + var left = (area[this.L] > 1 ? area[this.L] : availWidth * area[this.L]); + var top = (area[this.T] > 1 ? area[this.T] : availHeight * area[this.T]); + var width = (area[this.R] > 1 ? area[this.R] : availWidth * area[this.R]) - left; + var height = (area[this.B] > 1 ? area[this.B] : availHeight * area[this.B]) - top; + return [left, top, width, height]; + }, + + /* Draw the chart background, including gridlines. + @param noXGrid (boolean) true to suppress the x-gridlines, false to draw them (optional) + @param noYGrid (boolean) true to suppress the y-gridlines, false to draw them (optional) + @return (element) the background group element */ + _drawChartBackground: function(noXGrid, noYGrid) { + var bg = this._wrapper.group(this._chartCont, {class_: 'background'}); + var dims = this._getDims(); + this._wrapper.rect(bg, dims[this.X], dims[this.Y], dims[this.W], dims[this.H], this._chartFormat); + if (this._gridlines[0] && this.yAxis._ticks.major && !noYGrid) { + this._drawGridlines(bg, this.yAxis, true, dims, this._gridlines[0]); + } + if (this._gridlines[1] && this.xAxis._ticks.major && !noXGrid) { + this._drawGridlines(bg, this.xAxis, false, dims, this._gridlines[1]); + } + return bg; + }, + + /* Draw one set of gridlines. + @param bg (element) the background group element + @param axis (SVGGraphAxis) the axis definition + @param horiz (boolean) true if horizontal, false if vertical + @param dims (number[]) the left, top, width, height of the chart area + @param format (object) additional settings for the gridlines */ + _drawGridlines: function(bg, axis, horiz, dims, format) { + var g = this._wrapper.group(bg, format); + var scale = (horiz ? dims[this.H] : dims[this.W]) / (axis._scale.max - axis._scale.min); + var major = Math.floor(axis._scale.min / axis._ticks.major) * axis._ticks.major; + major = (major < axis._scale.min ? major + axis._ticks.major : major); + while (major <= axis._scale.max) { + var v = (horiz ? axis._scale.max - major : major - axis._scale.min) * scale + + (horiz ? dims[this.Y] : dims[this.X]); + this._wrapper.line(g, (horiz ? dims[this.X] : v), (horiz ? v : dims[this.Y]), + (horiz ? dims[this.X] + dims[this.W] : v), (horiz ? v : dims[this.Y] + dims[this.H])); + major += axis._ticks.major; + } + }, + + /* Draw the axes in their standard configuration. + @param noX (boolean) true to suppress the x-axes, false to draw it (optional) */ + _drawAxes: function(noX) { + var dims = this._getDims(); + if (this.xAxis && !noX) { + if (this.xAxis._title) { + this._wrapper.text(this._chartCont, dims[this.X] + dims[this.W] / 2, + dims[this.Y] + dims[this.H] + this.xAxis._titleOffset, + this.xAxis._title, this.xAxis._titleFormat); + } + this._drawAxis(this.xAxis, 'xAxis', dims[this.X], dims[this.Y] + dims[this.H], + dims[this.X] + dims[this.W], dims[this.Y] + dims[this.H]); + } + if (this.yAxis) { + if (this.yAxis._title) { + this._wrapper.text(this._chartCont, 0, 0, this.yAxis._title, $.extend({textAnchor: 'middle', + transform: 'translate(' + (dims[this.X] - this.yAxis._titleOffset) + ',' + + (dims[this.Y] + dims[this.H] / 2) + ') rotate(-90)'}, this.yAxis._titleFormat || {})); + } + this._drawAxis(this.yAxis, 'yAxis', dims[this.X], dims[this.Y], + dims[this.X], dims[this.Y] + dims[this.H]); + } + if (this.x2Axis && !noX) { + if (this.x2Axis._title) { + this._wrapper.text(this._chartCont, dims[this.X] + dims[this.W] / 2, + dims[this.X] - this.x2Axis._titleOffset, this.x2Axis._title, this.x2Axis._titleFormat); + } + this._drawAxis(this.x2Axis, 'x2Axis', dims[this.X], dims[this.Y], + dims[this.X] + dims[this.W], dims[this.Y]); + } + if (this.y2Axis) { + if (this.y2Axis._title) { + this._wrapper.text(this._chartCont, 0, 0, this.y2Axis._title, $.extend({textAnchor: 'middle', + transform: 'translate(' + (dims[this.X] + dims[this.W] + this.y2Axis._titleOffset) + + ',' + (dims[this.Y] + dims[this.H] / 2) + ') rotate(-90)'}, this.y2Axis._titleFormat || {})); + } + this._drawAxis(this.y2Axis, 'y2Axis', dims[this.X] + dims[this.W], dims[this.Y], + dims[this.X] + dims[this.W], dims[this.Y] + dims[this.H]); + } + }, + + /* Draw an axis and its tick marks. + @param axis (SVGGraphAxis) the axis definition + @param id (string) the identifier for the axis group element + @param x1 (number) starting x-coodinate for the axis + @param y1 (number) starting y-coodinate for the axis + @param x2 (number) ending x-coodinate for the axis + @param y2 (number) ending y-coodinate for the axis */ + _drawAxis: function(axis, id, x1, y1, x2, y2) { + var horiz = (y1 == y2); + var gl = this._wrapper.group(this._chartCont, $.extend({class_: id}, axis._lineFormat)); + var gt = this._wrapper.group(this._chartCont, $.extend({class_: id + 'Labels', + textAnchor: (horiz ? 'middle' : 'end')}, axis._labelFormat)); + this._wrapper.line(gl, x1, y1, x2, y2); + if (axis._ticks.major) { + var bottomRight = (x2 > (this._getValue(this._chartCont, 'width') / 2) && + y2 > (this._getValue(this._chartCont, 'height') / 2)); + var scale = (horiz ? x2 - x1 : y2 - y1) / (axis._scale.max - axis._scale.min); + var size = axis._ticks.size; + var major = Math.floor(axis._scale.min / axis._ticks.major) * axis._ticks.major; + major = (major < axis._scale.min ? major + axis._ticks.major : major); + var minor = (!axis._ticks.minor ? axis._scale.max + 1 : + Math.floor(axis._scale.min / axis._ticks.minor) * axis._ticks.minor); + minor = (minor < axis._scale.min ? minor + axis._ticks.minor : minor); + var offsets = this._getTickOffsets(axis, bottomRight); + var count = 0; + while (major <= axis._scale.max || minor <= axis._scale.max) { + var cur = Math.min(major, minor); + var len = (cur == major ? size : size / 2); + var v = (horiz ? x1 : y1) + + (horiz ? cur - axis._scale.min : axis._scale.max - cur) * scale; + this._wrapper.line(gl, (horiz ? v : x1 + len * offsets[0]), + (horiz ? y1 + len * offsets[0] : v), + (horiz ? v : x1 + len * offsets[1]), + (horiz ? y1 + len * offsets[1] : v)); + if (cur == major) { + this._wrapper.text(gt, (horiz ? v : x1 - size), (horiz ? y1 + 2 * size : v), + (axis._labels ? axis._labels[count++] : '' + cur)); + } + major += (cur == major ? axis._ticks.major : 0); + minor += (cur == minor ? axis._ticks.minor : 0); + } + } + }, + + /* Calculate offsets based on axis and tick positions. + @param axis (SVGGraphAxis) the axis definition + @param bottomRight (boolean) true if this axis is appearing on the bottom or + right of the chart area, false if to the top or left + @return (number[2]) the array of offset multipliers (-1..+1) */ + _getTickOffsets: function(axis, bottomRight) { + return [(axis._ticks.position == (bottomRight ? 'in' : 'out') || + axis._ticks.position == 'both' ? -1 : 0), + (axis._ticks.position == (bottomRight ? 'out' : 'in') || + axis._ticks.position == 'both' ? +1 : 0), ]; + }, + + /* Retrieve the standard percentage axis. + @return (SVGGraphAxis) percentage axis */ + _getPercentageAxis: function() { + this._percentageAxis._title = $.svg.graphing.region.percentageText; + return this._percentageAxis; + }, + + /* Calculate the column totals across all the series. */ + _getTotals: function() { + var totals = []; + var numVal = (this._series.length ? this._series[0]._values.length : 0); + for (var i = 0; i < numVal; i++) { + totals[i] = 0; + for (var j = 0; j < this._series.length; j++) { + totals[i] += this._series[j]._values[i]; + } + } + return totals; + }, + + /* Draw the chart legend. */ + _drawLegend: function() { + if (!this.legend._show) { + return; + } + var g = this._wrapper.group(this._chartCont, {class_: 'legend'}); + var dims = this._getDims(this.legend._area); + this._wrapper.rect(g, dims[this.X], dims[this.Y], dims[this.W], dims[this.H], + this.legend._bgSettings); + var horiz = dims[this.W] > dims[this.H]; + var numSer = this._series.length; + var offset = (horiz ? dims[this.W] : dims[this.H]) / numSer; + var xBase = dims[this.X] + 5; + var yBase = dims[this.Y] + ((horiz ? dims[this.H] : offset) + this.legend._sampleSize) / 2; + for (var i = 0; i < numSer; i++) { + var series = this._series[i]; + this._wrapper.rect(g, xBase + (horiz ? i * offset : 0), + yBase + (horiz ? 0 : i * offset) - this.legend._sampleSize, + this.legend._sampleSize, this.legend._sampleSize, + {fill: series._fill, stroke: series._stroke, strokeWidth: 1}); + this._wrapper.text(g, xBase + (horiz ? i * offset : 0) + this.legend._sampleSize + 5, + yBase + (horiz ? 0 : i * offset), series._name, this.legend._textSettings); + } + }, + + /* Show the current value status on hover. */ + _showStatus: function(elem, label, value) { + var status = this._onstatus; + if (this._onstatus) { + $(elem).hover(function() { status.apply(this, [label, value]); }, + function() { status.apply(this, ['', 0]); }); + } + } +}); + +/* Details about each graph series. + @param graph (SVGGraph) the owning graph + @param name (string) the name of this series (optional) + @param values (number[]) the list of values to be plotted + @param fill (string) how the series should be displayed + @param stroke (string) the colour of the (out)line for the series (optional) + @param strokeWidth (number) the width of the (out)line for the series (optional) + @param settings (object) additional formatting settings (optional) + @return (SVGGraphSeries) the new series object */ +function SVGGraphSeries(graph, name, values, fill, stroke, strokeWidth, settings) { + if (typeof name != 'string') { + settings = strokeWidth; + strokeWidth = stroke; + stroke = fill; + fill = values; + values = name; + name = null; + } + if (typeof stroke != 'string') { + settings = strokeWidth; + strokeWidth = stroke; + stroke = null; + } + if (typeof strokeWidth != 'number') { + settings = strokeWidth; + strokeWidth = null; + } + this._graph = graph; // The owning graph + this._name = name || ''; // The name of this series + this._values = values || []; // The list of values for this series + this._axis = 1; // Which axis this series applies to: 1 = primary, 2 = secondary + this._fill = fill || 'green'; // How the series is plotted + this._stroke = stroke || 'black'; // The colour for the (out)line + this._strokeWidth = strokeWidth || 1; // The (out)line width + this._settings = settings || {}; // Additional formatting settings for the series +} + +$.extend(SVGGraphSeries.prototype, { + + /* Set or retrieve the name for this series. + @param name (string) the series' name + @return (SVGGraphSeries) this series object or + (string) the series name (if no parameters) */ + name: function(name) { + if (arguments.length == 0) { + return this._name; + } + this._name = name; + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve the values for this series. + @param name (string) the series' name (optional) + @param values (number[]) the values to be graphed + @return (SVGGraphSeries) this series object or + (number[]) the series values (if no parameters) */ + values: function(name, values) { + if (arguments.length == 0) { + return this._values; + } + if (isArray(name)) { + values = name; + name = null; + } + this._name = name || this._name; + this._values = values; + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve the formatting for this series. + @param fill (string) how the values are filled when plotted + @param stroke (string) the (out)line colour (optional) + @param strokeWidth (number) the line's width (optional) + @param settings (object) additional formatting settings for the series (optional) + @return (SVGGraphSeries) this series object or + (object) formatting settings (if no parameters) */ + format: function(fill, stroke, strokeWidth, settings) { + if (arguments.length == 0) { + return $.extend({fill: this._fill, stroke: this._stroke, + strokeWidth: this._strokeWidth}, this._settings); + } + if (typeof stroke != 'string') { + settings = strokeWidth; + strokeWidth = stroke; + stroke = null; + } + if (typeof strokeWidth != 'number') { + settings = strokeWidth; + strokeWidth = null; + } + this._fill = fill || this._fill; + this._stroke = stroke || this._stroke; + this._strokeWidth = strokeWidth || this._strokeWidth; + $.extend(this._settings, settings || {}); + this._graph._drawGraph(); + return this; + }, + + /* Return to the parent graph. */ + end: function() { + return this._graph; + } +}); + +/* Details about each graph axis. + @param graph (SVGGraph) the owning graph + @param title (string) the title of the axis + @param min (number) the minimum value displayed on this axis + @param max (number) the maximum value displayed on this axis + @param major (number) the distance between major ticks + @param minor (number) the distance between minor ticks (optional) + @return (SVGGraphAxis) the new axis object */ +function SVGGraphAxis(graph, title, min, max, major, minor) { + this._graph = graph; // The owning graph + this._title = title || ''; // Title of this axis + this._titleFormat = {}; // Formatting settings for the title + this._titleOffset = 0; // The offset for positioning the title + this._labels = null; // List of labels for this axis - one per possible value across all series + this._labelFormat = {}; // Formatting settings for the labels + this._lineFormat = {stroke: 'black', strokeWidth: 1}; // Formatting settings for the axis lines + this._ticks = {major: major || 10, minor: minor || 0, size: 10, position: 'out'}; // Tick mark options + this._scale = {min: min || 0, max: max || 100}; // Axis scale settings + this._crossAt = 0; // Where this axis crosses the other one +} + +$.extend(SVGGraphAxis.prototype, { + + /* Set or retrieve the scale for this axis. + @param min (number) the minimum value shown + @param max (number) the maximum value shown + @return (SVGGraphAxis) this axis object or + (object) min and max values (if no parameters) */ + scale: function(min, max) { + if (arguments.length == 0) { + return this._scale; + } + this._scale.min = min; + this._scale.max = max; + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve the ticks for this axis. + @param major (number) the distance between major ticks + @param minor (number) the distance between minor ticks + @param size (number) the length of the major ticks (minor are half) (optional) + @param position (string) the location of the ticks: + 'in', 'out', 'both' (optional) + @return (SVGGraphAxis) this axis object or + (object) major, minor, size, and position values (if no parameters) */ + ticks: function(major, minor, size, position) { + if (arguments.length == 0) { + return this._ticks; + } + if (typeof size == 'string') { + position = size; + size = null; + } + this._ticks.major = major; + this._ticks.minor = minor; + this._ticks.size = size || this._ticks.size; + this._ticks.position = position || this._ticks.position; + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve the title for this axis. + @param title (string) the title text + @param offset (number) the distance to offset the title position (optional) + @param colour (string) how to colour the title (optional) + @param format (object) formatting settings for the title (optional) + @return (SVGGraphAxis) this axis object or + (object) title, offset, and format values (if no parameters) */ + title: function(title, offset, colour, format) { + if (arguments.length == 0) { + return {title: this._title, offset: this._titleOffset, format: this._titleFormat}; + } + if (typeof offset != 'number') { + format = colour; + colour = offset; + offset = null; + } + if (typeof colour != 'string') { + format = colour; + colour = null; + } + this._title = title; + this._titleOffset = (offset != null ? offset : this._titleOffset); + if (colour || format) { + this._titleFormat = $.extend(format || {}, (colour ? {fill: colour} : {})); + } + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve the labels for this axis. + @param labels (string[]) the text for each entry + @param colour (string) how to colour the labels (optional) + @param format (object) formatting settings for the labels (optional) + @return (SVGGraphAxis) this axis object or + (object) labels and format values (if no parameters) */ + labels: function(labels, colour, format) { + if (arguments.length == 0) { + return {labels: this._labels, format: this._labelFormat}; + } + if (typeof colour != 'string') { + format = colour; + colour = null; + } + this._labels = labels; + if (colour || format) { + this._labelFormat = $.extend(format || {}, (colour ? {fill: colour} : {})); + } + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve the line formatting for this axis. + @param colour (string) the line's colour + @param width (number) the line's width (optional) + @param settings (object) additional formatting settings for the line (optional) + @return (SVGGraphAxis) this axis object or + (object) line formatting values (if no parameters) */ + line: function(colour, width, settings) { + if (arguments.length == 0) { + return this._lineFormat; + } + if (typeof width == 'object') { + settings = width; + width = null; + } + $.extend(this._lineFormat, {stroke: colour}, + (width ? {strokeWidth: width} : {}), settings || {}); + this._graph._drawGraph(); + return this; + }, + + /* Return to the parent graph. */ + end: function() { + return this._graph; + } +}); + +/* Details about the graph legend. + @param graph (SVGGraph) the owning graph + @param bgSettings (object) additional formatting settings for the legend background (optional) + @param textSettings (object) additional formatting settings for the legend text (optional) + @return (SVGGraphLegend) the new legend object */ +function SVGGraphLegend(graph, bgSettings, textSettings) { + this._graph = graph; // The owning graph + this._show = true; // Show the legend? + this._area = [0.9, 0.1, 1.0, 0.9]; // The legend area: left, top, right, bottom, + // > 1 in pixels, <= 1 as proportion + this._sampleSize = 15; // Size of sample box + this._bgSettings = bgSettings || {stroke: 'gray'}; // Additional formatting settings for the legend background + this._textSettings = textSettings || {}; // Additional formatting settings for the text +} + +$.extend(SVGGraphLegend.prototype, { + + /* Set or retrieve whether the legend should be shown. + @param show (boolean) true to display it, false to hide it + @return (SVGGraphLegend) this legend object or + (boolean) show the legend? (if no parameters) */ + show: function(show) { + if (arguments.length == 0) { + return this._show; + } + this._show = show; + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve the legend area. + @param left (number) > 1 is pixels, <= 1 is proportion of width or + (number[4]) for left, top, right, bottom + @param top (number) > 1 is pixels, <= 1 is proportion of height + @param right (number) > 1 is pixels, <= 1 is proportion of width + @param bottom (number) > 1 is pixels, <= 1 is proportion of height + @return (SVGGraphLegend) this legend object or + (number[4]) the legend area: left, top, right, bottom (if no parameters) */ + area: function(left, top, right, bottom) { + if (arguments.length == 0) { + return this._area; + } + this._area = (isArray(left) ? left : [left, top, right, bottom]); + this._graph._drawGraph(); + return this; + }, + + /* Set or retrieve additional settings for the legend area. + @param sampleSize (number) the size of the sample box to display (optional) + @param bgSettings (object) additional formatting settings for the legend background + @param textSettings (object) additional formatting settings for the legend text (optional) + @return (SVGGraphLegend) this legend object or + (object) bgSettings and textSettings for the legend (if no parameters) */ + settings: function(sampleSize, bgSettings, textSettings) { + if (arguments.length == 0) { + return {sampleSize: this._sampleSize, bgSettings: this._bgSettings, + textSettings: this._textSettings}; + } + if (typeof sampleSize != 'number') { + textSettings = bgSettings; + bgSettings = sampleSize; + sampleSize = null; + } + this._sampleSize = sampleSize || this._sampleSize; + this._bgSettings = bgSettings; + this._textSettings = textSettings || this._textSettings; + this._graph._drawGraph(); + return this; + }, + + /* Return to the parent graph. */ + end: function() { + return this._graph; + } +}); + +//============================================================================== + +/* Round a number to a given number of decimal points. */ +function roundNumber(num, dec) { + return Math.round(num * Math.pow(10, dec)) / Math.pow(10, dec); +} + +var barOptions = ['barWidth (number) - the width of each bar', + 'barGap (number) - the gap between sets of bars']; + +//------------------------------------------------------------------------------ + +/* Draw a standard grouped column bar chart. */ +function SVGColumnChart() { +} + +$.extend(SVGColumnChart.prototype, { + + /* Retrieve the display title for this chart type. + @return the title */ + title: function() { + return 'Basic column chart'; + }, + + /* Retrieve a description of this chart type. + @return its description */ + description: function() { + return 'Compare sets of values as vertical bars with grouped categories.'; + }, + + /* Retrieve a list of the options that may be set for this chart type. + @return options list */ + options: function() { + return barOptions; + }, + + /* Actually draw the graph in this type's style. + @param graph (object) the SVGGraph object */ + drawGraph: function(graph) { + graph._drawChartBackground(true); + var barWidth = graph._chartOptions.barWidth || 10; + var barGap = graph._chartOptions.barGap || 10; + var numSer = graph._series.length; + var numVal = (numSer ? (graph._series[0])._values.length : 0); + var dims = graph._getDims(); + var xScale = dims[graph.W] / ((numSer * barWidth + barGap) * numVal + barGap); + var yScale = dims[graph.H] / (graph.yAxis._scale.max - graph.yAxis._scale.min); + this._chart = graph._wrapper.group(graph._chartCont, {class_: 'chart'}); + for (var i = 0; i < numSer; i++) { + this._drawSeries(graph, i, numSer, barWidth, barGap, dims, xScale, yScale); + } + graph._drawTitle(); + graph._drawAxes(true); + this._drawXAxis(graph, numSer, numVal, barWidth, barGap, dims, xScale); + graph._drawLegend(); + }, + + /* Plot an individual series. */ + _drawSeries: function(graph, cur, numSer, barWidth, barGap, dims, xScale, yScale) { + var series = graph._series[cur]; + var g = graph._wrapper.group(this._chart, + $.extend({class_: 'series' + cur, fill: series._fill, stroke: series._stroke, + strokeWidth: series._strokeWidth}, series._settings || {})); + for (var i = 0; i < series._values.length; i++) { + var r = graph._wrapper.rect(g, + dims[graph.X] + xScale * (barGap + i * (numSer * barWidth + barGap) + (cur * barWidth)), + dims[graph.Y] + yScale * (graph.yAxis._scale.max - series._values[i]), + xScale * barWidth, yScale * series._values[i]); + graph._showStatus(r, series._name, series._values[i]); + } + }, + + /* Draw the x-axis and its ticks. */ + _drawXAxis: function(graph, numSer, numVal, barWidth, barGap, dims, xScale) { + var axis = graph.xAxis; + if (axis._title) { + graph._wrapper.text(graph._chartCont, dims[graph.X] + dims[graph.W] / 2, + dims[graph.Y] + dims[graph.H] + axis._titleOffset, + axis._title, $.extend({textAnchor: 'middle'}, axis._titleFormat || {})); + } + var gl = graph._wrapper.group(graph._chartCont, $.extend({class_: 'xAxis'}, axis._lineFormat)); + var gt = graph._wrapper.group(graph._chartCont, $.extend({class_: 'xAxisLabels', + textAnchor: 'middle'}, axis._labelFormat)); + graph._wrapper.line(gl, dims[graph.X], dims[graph.Y] + dims[graph.H], + dims[graph.X] + dims[graph.W], dims[graph.Y] + dims[graph.H]); + if (axis._ticks.major) { + var offsets = graph._getTickOffsets(axis, true); + for (var i = 1; i < numVal; i++) { + var x = dims[graph.X] + xScale * (barGap / 2 + i * (numSer * barWidth + barGap)); + graph._wrapper.line(gl, x, dims[graph.Y] + dims[graph.H] + offsets[0] * axis._ticks.size, + x, dims[graph.Y] + dims[graph.H] + offsets[1] * axis._ticks.size); + } + for (var i = 0; i < numVal; i++) { + var x = dims[graph.X] + xScale * (barGap / 2 + (i + 0.5) * (numSer * barWidth + barGap)); + graph._wrapper.text(gt, x, dims[graph.Y] + dims[graph.H] + 2 * axis._ticks.size, + (axis._labels ? axis._labels[i] : '' + i)); + } + } + } +}); + +//------------------------------------------------------------------------------ + +/* Draw a stacked column bar chart. */ +function SVGStackedColumnChart() { +} + +$.extend(SVGStackedColumnChart.prototype, { + + /* Retrieve the display title for this chart type. + @return the title */ + title: function() { + return 'Stacked column chart'; + }, + + /* Retrieve a description of this chart type. + @return its description */ + description: function() { + return 'Compare sets of values as vertical bars showing ' + + 'relative contributions to the whole for each category.'; + }, + + /* Retrieve a list of the options that may be set for this chart type. + @return options list */ + options: function() { + return barOptions; + }, + + /* Actually draw the graph in this type's style. + @param graph (object) the SVGGraph object */ + drawGraph: function(graph) { + var bg = graph._drawChartBackground(true, true); + var dims = graph._getDims(); + if (graph._gridlines[0] && graph.xAxis._ticks.major) { + graph._drawGridlines(bg, graph._getPercentageAxis(), true, dims, graph._gridlines[0]); + } + var barWidth = graph._chartOptions.barWidth || 10; + var barGap = graph._chartOptions.barGap || 10; + var numSer = graph._series.length; + var numVal = (numSer ? (graph._series[0])._values.length : 0); + var xScale = dims[graph.W] / ((barWidth + barGap) * numVal + barGap); + var yScale = dims[graph.H]; + this._chart = graph._wrapper.group(graph._chartCont, {class_: 'chart'}); + this._drawColumns(graph, numSer, numVal, barWidth, barGap, dims, xScale, yScale); + graph._drawTitle(); + graph._wrapper.text(graph._chartCont, 0, 0, $.svg.graphing.region.percentageText, + $.extend({textAnchor: 'middle', transform: 'translate(' + + (dims[graph.X] - graph.yAxis._titleOffset) + ',' + + (dims[graph.Y] + dims[graph.H] / 2) + ') rotate(-90)'}, graph.yAxis._titleFormat || {})); + var pAxis = $.extend({}, graph._getPercentageAxis()); + $.extend(pAxis._labelFormat, graph.yAxis._labelFormat || {}); + graph._drawAxis(pAxis, 'yAxis', dims[graph.X], dims[graph.Y], + dims[graph.X], dims[graph.Y] + dims[graph.H]); + this._drawXAxis(graph, numVal, barWidth, barGap, dims, xScale); + graph._drawLegend(); + }, + + /* Plot all of the columns. */ + _drawColumns: function(graph, numSer, numVal, barWidth, barGap, dims, xScale, yScale) { + var totals = graph._getTotals(); + var accum = []; + for (var i = 0; i < numVal; i++) { + accum[i] = 0; + } + for (var s = 0; s < numSer; s++) { + var series = graph._series[s]; + var g = graph._wrapper.group(this._chart, + $.extend({class_: 'series' + s, fill: series._fill, + stroke: series._stroke, strokeWidth: series._strokeWidth}, + series._settings || {})); + for (var i = 0; i < series._values.length; i++) { + accum[i] += series._values[i]; + var r = graph._wrapper.rect(g, + dims[graph.X] + xScale * (barGap + i * (barWidth + barGap)), + dims[graph.Y] + yScale * (totals[i] - accum[i]) / totals[i], + xScale * barWidth, yScale * series._values[i] / totals[i]); + graph._showStatus(r, series._name, + roundNumber(series._values[i] / totals[i] * 100, 2)); + } + } + }, + + /* Draw the x-axis and its ticks. */ + _drawXAxis: function(graph, numVal, barWidth, barGap, dims, xScale) { + var axis = graph.xAxis; + if (axis._title) { + graph._wrapper.text(graph._chartCont, dims[graph.X] + dims[graph.W] / 2, + dims[graph.Y] + dims[graph.H] + axis._titleOffset, + axis._title, $.extend({textAnchor: 'middle'}, axis._titleFormat || {})); + } + var gl = graph._wrapper.group(graph._chartCont, $.extend({class_: 'xAxis'}, axis._lineFormat)); + var gt = graph._wrapper.group(graph._chartCont, $.extend({class_: 'xAxisLabels', + textAnchor: 'middle'}, axis._labelFormat)); + graph._wrapper.line(gl, dims[graph.X], dims[graph.Y] + dims[graph.H], + dims[graph.X] + dims[graph.W], dims[graph.Y] + dims[graph.H]); + if (axis._ticks.major) { + var offsets = graph._getTickOffsets(axis, true); + for (var i = 1; i < numVal; i++) { + var x = dims[graph.X] + xScale * (barGap / 2 + i * (barWidth + barGap)); + graph._wrapper.line(gl, x, dims[graph.Y] + dims[graph.H] + offsets[0] * axis._ticks.size, + x, dims[graph.Y] + dims[graph.H] + offsets[1] * axis._ticks.size); + } + for (var i = 0; i < numVal; i++) { + var x = dims[graph.X] + xScale * (barGap / 2 + (i + 0.5) * (barWidth + barGap)); + graph._wrapper.text(gt, x, dims[graph.Y] + dims[graph.H] + 2 * axis._ticks.size, + (axis._labels ? axis._labels[i] : '' + i)); + } + } + } +}); + +//------------------------------------------------------------------------------ + +/* Draw a standard grouped row bar chart. */ +function SVGRowChart() { +} + +$.extend(SVGRowChart.prototype, { + + /* Retrieve the display title for this chart type. + @return the title */ + title: function() { + return 'Basic row chart'; + }, + + /* Retrieve a description of this chart type. + @return its description */ + description: function() { + return 'Compare sets of values as horizontal rows with grouped categories.'; + }, + + /* Retrieve a list of the options that may be set for this chart type. + @return options list */ + options: function() { + return barOptions; + }, + + /* Actually draw the graph in this type's style. + @param graph (object) the SVGGraph object */ + drawGraph: function(graph) { + var bg = graph._drawChartBackground(true, true); + var dims = graph._getDims(); + graph._drawGridlines(bg, graph.yAxis, false, dims, graph._gridlines[0]); + var barWidth = graph._chartOptions.barWidth || 10; + var barGap = graph._chartOptions.barGap || 10; + var numSer = graph._series.length; + var numVal = (numSer ? (graph._series[0])._values.length : 0); + var xScale = dims[graph.W] / (graph.yAxis._scale.max - graph.yAxis._scale.min); + var yScale = dims[graph.H] / ((numSer * barWidth + barGap) * numVal + barGap); + this._chart = graph._wrapper.group(graph._chartCont, {class_: 'chart'}); + for (var i = 0; i < numSer; i++) { + this._drawSeries(graph, i, numSer, barWidth, barGap, dims, xScale, yScale); + } + graph._drawTitle(); + this._drawAxes(graph, numSer, numVal, barWidth, barGap, dims, yScale); + graph._drawLegend(); + }, + + /* Plot an individual series. */ + _drawSeries: function(graph, cur, numSer, barWidth, barGap, dims, xScale, yScale) { + var series = graph._series[cur]; + var g = graph._wrapper.group(this._chart, + $.extend({class_: 'series' + cur, fill: series._fill, + stroke: series._stroke, strokeWidth: series._strokeWidth}, + series._settings || {})); + for (var i = 0; i < series._values.length; i++) { + var r = graph._wrapper.rect(g, + dims[graph.X] + xScale * (0 - graph.yAxis._scale.min), + dims[graph.Y] + yScale * (barGap + i * (numSer * barWidth + barGap) + (cur * barWidth)), + xScale * series._values[i], yScale * barWidth); + graph._showStatus(r, series._name, series._values[i]); + } + }, + + /* Draw the axes for this graph. */ + _drawAxes: function(graph, numSer, numVal, barWidth, barGap, dims, yScale) { + // X-axis + var axis = graph.yAxis; + if (axis) { + if (axis._title) { + graph._wrapper.text(graph._chartCont, dims[graph.X] + dims[graph.W] / 2, + dims[graph.Y] + dims[graph.H] + axis._titleOffset, axis._title, axis._titleFormat); + } + graph._drawAxis(axis, 'xAxis', dims[graph.X], dims[graph.Y] + dims[graph.H], + dims[graph.X] + dims[graph.W], dims[graph.Y] + dims[graph.H]); + } + // Y-axis + var axis = graph.xAxis; + if (axis._title) { + graph._wrapper.text(graph._chartCont, 0, 0, axis._title, $.extend({textAnchor: 'middle', + transform: 'translate(' + (dims[graph.X] - axis._titleOffset) + ',' + + (dims[graph.Y] + dims[graph.H] / 2) + ') rotate(-90)'}, axis._titleFormat || {})); + } + var gl = graph._wrapper.group(graph._chartCont, $.extend({class_: 'yAxis'}, axis._lineFormat)); + var gt = graph._wrapper.group(graph._chartCont, $.extend( + {class_: 'yAxisLabels', textAnchor: 'end'}, axis._labelFormat)); + graph._wrapper.line(gl, dims[graph.X], dims[graph.Y], dims[graph.X], dims[graph.Y] + dims[graph.H]); + if (axis._ticks.major) { + var offsets = graph._getTickOffsets(axis, false); + for (var i = 1; i < numVal; i++) { + var y = dims[graph.Y] + yScale * (barGap / 2 + i * (numSer * barWidth + barGap)); + graph._wrapper.line(gl, dims[graph.X] + offsets[0] * axis._ticks.size, y, + dims[graph.X] + offsets[1] * axis._ticks.size, y); + } + for (var i = 0; i < numVal; i++) { + var y = dims[graph.Y] + yScale * (barGap / 2 + (i + 0.5) * (numSer * barWidth + barGap)); + graph._wrapper.text(gt, dims[graph.X] - axis._ticks.size, y, + (axis._labels ? axis._labels[i] : '' + i)); + } + } + } +}); + +//------------------------------------------------------------------------------ + +/* Draw a stacked row bar chart. */ +function SVGStackedRowChart() { +} + +$.extend(SVGStackedRowChart.prototype, { + + /* Retrieve the display title for this chart type. + @return the title */ + title: function() { + return 'Stacked row chart'; + }, + + /* Retrieve a description of this chart type. + @return its description */ + description: function() { + return 'Compare sets of values as horizontal bars showing ' + + 'relative contributions to the whole for each category.'; + }, + + /* Retrieve a list of the options that may be set for this chart type. + @return options list */ + options: function() { + return barOptions; + }, + + /* Actually draw the graph in this type's style. + @param graph (object) the SVGGraph object */ + drawGraph: function(graph) { + var bg = graph._drawChartBackground(true, true); + var dims = graph._getDims(); + if (graph._gridlines[0] && graph.xAxis._ticks.major) { + graph._drawGridlines(bg, graph._getPercentageAxis(), false, dims, graph._gridlines[0]); + } + var barWidth = graph._chartOptions.barWidth || 10; + var barGap = graph._chartOptions.barGap || 10; + var numSer = graph._series.length; + var numVal = (numSer ? (graph._series[0])._values.length : 0); + var xScale = dims[graph.W]; + var yScale = dims[graph.H] / ((barWidth + barGap) * numVal + barGap); + this._chart = graph._wrapper.group(graph._chartCont, {class_: 'chart'}); + this._drawRows(graph, numSer, numVal, barWidth, barGap, dims, xScale, yScale); + graph._drawTitle(); + graph._wrapper.text(graph._chartCont, dims[graph.X] + dims[graph.W] / 2, + dims[graph.Y] + dims[graph.H] + graph.xAxis._titleOffset, + $.svg.graphing.region.percentageText, + $.extend({textAnchor: 'middle'}, graph.yAxis._titleFormat || {})); + var pAxis = $.extend({}, graph._getPercentageAxis()); + $.extend(pAxis._labelFormat, graph.yAxis._labelFormat || {}); + graph._drawAxis(pAxis, 'xAxis', dims[graph.X], dims[graph.Y] + dims[graph.H], + dims[graph.X] + dims[graph.W], dims[graph.Y] + dims[graph.H]); + this._drawYAxis(graph, numVal, barWidth, barGap, dims, yScale); + graph._drawLegend(); + }, + + /* Plot all of the rows. */ + _drawRows: function(graph, numSer, numVal, barWidth, barGap, dims, xScale, yScale) { + var totals = graph._getTotals(); + var accum = []; + for (var i = 0; i < numVal; i++) { + accum[i] = 0; + } + for (var s = 0; s < numSer; s++) { + var series = graph._series[s]; + var g = graph._wrapper.group(this._chart, + $.extend({class_: 'series' + s, fill: series._fill, + stroke: series._stroke, strokeWidth: series._strokeWidth}, + series._settings || {})); + for (var i = 0; i < series._values.length; i++) { + var r = graph._wrapper.rect(g, + dims[graph.X] + xScale * accum[i] / totals[i], + dims[graph.Y] + yScale * (barGap + i * (barWidth + barGap)), + xScale * series._values[i] / totals[i], yScale * barWidth); + graph._showStatus(r, series._name, + roundNumber(series._values[i] / totals[i] * 100, 2)); + accum[i] += series._values[i]; + } + } + }, + + /* Draw the y-axis and its ticks. */ + _drawYAxis: function(graph, numVal, barWidth, barGap, dims, yScale) { + var axis = graph.xAxis; + if (axis._title) { + graph._wrapper.text(graph._chartCont, 0, 0, axis._title, $.extend({textAnchor: 'middle', + transform: 'translate(' + (dims[graph.X] - axis._titleOffset) + ',' + + (dims[graph.Y] + dims[graph.H] / 2) + ') rotate(-90)'}, axis._titleFormat || {})); + } + var gl = graph._wrapper.group(graph._chartCont, + $.extend({class_: 'yAxis'}, axis._lineFormat)); + var gt = graph._wrapper.group(graph._chartCont, + $.extend({class_: 'yAxisLabels', textAnchor: 'end'}, axis._labelFormat)); + graph._wrapper.line(gl, dims[graph.X], dims[graph.Y], + dims[graph.X], dims[graph.Y] + dims[graph.H]); + if (axis._ticks.major) { + var offsets = graph._getTickOffsets(axis, false); + for (var i = 1; i < numVal; i++) { + var y = dims[graph.Y] + yScale * (barGap / 2 + i * (barWidth + barGap)); + graph._wrapper.line(gl, dims[graph.X] + offsets[0] * axis._ticks.size, y, + dims[graph.X] + offsets[1] * axis._ticks.size, y); + } + for (var i = 0; i < numVal; i++) { + var y = dims[graph.Y] + yScale * (barGap / 2 + (i + 0.5) * (barWidth + barGap)); + graph._wrapper.text(gt, dims[graph.X] - axis._ticks.size, y, + (axis._labels ? axis._labels[i] : '' + i)); + } + } + } +}); + +//------------------------------------------------------------------------------ + +/* Draw a standard line chart. */ +function SVGLineChart() { +} + +$.extend(SVGLineChart.prototype, { + + /* Retrieve the display title for this chart type. + @return the title */ + title: function() { + return 'Basic line chart'; + }, + + /* Retrieve a description of this chart type. + @return its description */ + description: function() { + return 'Compare sets of values as continuous lines.'; + }, + + /* Retrieve a list of the options that may be set for this chart type. + @return options list */ + options: function() { + return []; + }, + + /* Actually draw the graph in this type's style. + @param graph (object) the SVGGraph object */ + drawGraph: function(graph) { + graph._drawChartBackground(); + var dims = graph._getDims(); + var xScale = dims[graph.W] / (graph.xAxis._scale.max - graph.xAxis._scale.min); + var yScale = dims[graph.H] / (graph.yAxis._scale.max - graph.yAxis._scale.min); + this._chart = graph._wrapper.group(graph._chartCont, {class_: 'chart'}); + for (var i = 0; i < graph._series.length; i++) { + this._drawSeries(graph, i, dims, xScale, yScale); + } + graph._drawTitle(); + graph._drawAxes(); + graph._drawLegend(); + }, + + /* Plot an individual series. */ + _drawSeries: function(graph, cur, dims, xScale, yScale) { + var series = graph._series[cur]; + var path = graph._wrapper.createPath(); + for (var i = 0; i < series._values.length; i++) { + var x = dims[graph.X] + i * xScale; + var y = dims[graph.Y] + (graph.yAxis._scale.max - series._values[i]) * yScale; + if (i == 0) { + path.move(x, y); + } + else { + path.line(x, y); + } + } + var p = graph._wrapper.path(this._chart, path, + $.extend({id: 'series' + cur, fill: 'none', stroke: series._stroke, + strokeWidth: series._strokeWidth}, series._settings || {})); + graph._showStatus(p, series._name, 0); + } +}); + +//------------------------------------------------------------------------------ + +/* Draw a standard pie chart. */ +function SVGPieChart() { +} + +$.extend(SVGPieChart.prototype, { + + _options: ['explode (number or number[]) - indexes of sections to explode out of the pie', + 'explodeDist (number) - the distance to move an exploded section', + 'pieGap (number) - the distance between pies for multiple values'], + + /* Retrieve the display title for this chart type. + @return the title */ + title: function() { + return 'Pie chart'; + }, + + /* Retrieve a description of this chart type. + @return its description */ + description: function() { + return 'Compare relative sizes of values as contributions to the whole.'; + }, + + /* Retrieve a list of the options that may be set for this chart type. + @return options list */ + options: function() { + return this._options; + }, + + /* Actually draw the graph in this type's style. + @param graph (object) the SVGGraph object */ + drawGraph: function(graph) { + graph._drawChartBackground(true, true); + this._chart = graph._wrapper.group(graph._chartCont, {class_: 'chart'}); + var dims = graph._getDims(); + this._drawSeries(graph, dims); + graph._drawTitle(); + graph._drawLegend(); + }, + + /* Plot all the series. */ + _drawSeries: function(graph, dims) { + var totals = graph._getTotals(); + var numSer = graph._series.length; + var numVal = (numSer ? (graph._series[0])._values.length : 0); + var path = graph._wrapper.createPath(); + var explode = graph._chartOptions.explode || []; + explode = (isArray(explode) ? explode : [explode]); + var explodeDist = graph._chartOptions.explodeDist || 10; + var pieGap = (numVal <= 1 ? 0 : graph._chartOptions.pieGap || 10); + var xBase = (dims[graph.W] - (numVal * pieGap) - pieGap) / numVal / 2; + var yBase = dims[graph.H] / 2; + var radius = Math.min(xBase, yBase) - (explode.length > 0 ? explodeDist : 0); + var gt = graph._wrapper.group(graph._chartCont, $.extend( + {class_: 'xAxisLabels', textAnchor: 'middle'}, graph.xAxis._labelFormat)); + var gl = []; + for (var i = 0; i < numVal; i++) { + var cx = dims[graph.X] + xBase + (i * (2 * Math.min(xBase, yBase) + pieGap)) + pieGap; + var cy = dims[graph.Y] + yBase; + var curTotal = 0; + for (var j = 0; j < numSer; j++) { + var series = graph._series[j]; + if (i == 0) { + gl[j] = graph._wrapper.group(this._chart, $.extend({class_: 'series' + j, + fill: series._fill, stroke: series._stroke, + strokeWidth: series._strokeWidth}, series._settings || {})); + } + if (series._values[i] == 0) { + continue; + } + var start = (curTotal / totals[i]) * 2 * Math.PI; + curTotal += series._values[i]; + var end = (curTotal / totals[i]) * 2 * Math.PI; + var exploding = false; + for (var k = 0; k < explode.length; k++) { + if (explode[k] == j) { + exploding = true; + break; + } + } + var x = cx + (exploding ? explodeDist * Math.cos((start + end) / 2) : 0); + var y = cy + (exploding ? explodeDist * Math.sin((start + end) / 2) : 0); + var p = graph._wrapper.path(gl[j], path.reset().move(x, y). + line(x + radius * Math.cos(start), y + radius * Math.sin(start)). + arc(radius, radius, 0, (end - start < Math.PI ? 0 : 1), 1, + x + radius * Math.cos(end), y + radius * Math.sin(end)).close()); + graph._showStatus(p, series._name, + roundNumber((end - start) / 2 / Math.PI * 100, 2)); + } + if (graph.xAxis) { + graph._wrapper.text(gt, cx, dims[graph.Y] + dims[graph.H] + graph.xAxis._titleOffset, + graph.xAxis._labels[i]) + } + } + } +}); + +//------------------------------------------------------------------------------ + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && a.constructor == Array); +} + +// Basic chart types +$.svg.graphing.addChartType('column', new SVGColumnChart()); +$.svg.graphing.addChartType('stackedColumn', new SVGStackedColumnChart()); +$.svg.graphing.addChartType('row', new SVGRowChart()); +$.svg.graphing.addChartType('stackedRow', new SVGStackedRowChart()); +$.svg.graphing.addChartType('line', new SVGLineChart()); +$.svg.graphing.addChartType('pie', new SVGPieChart()); + +})(jQuery)
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/jquery.svgplot.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,817 @@ +/* http://keith-wood.name/svg.html + SVG plotting extension for jQuery v1.4.3. + Written by Keith Wood (kbwood{at}iinet.com.au) December 2008. + Dual licensed under the GPL (http://dev.jquery.com/browser/trunk/jquery/GPL-LICENSE.txt) and + MIT (http://dev.jquery.com/browser/trunk/jquery/MIT-LICENSE.txt) licenses. + Please attribute the author if you use it. */ + +(function($) { // Hide scope, no $ conflict + +$.svg.addExtension('plot', SVGPlot); + +/* Extension point for SVG plotting. + Access through svg.plot. */ +function SVGPlot(wrapper) { + this._wrapper = wrapper; // The attached SVG wrapper object + this._drawNow = false; // True for immediate update, false to wait for redraw call + // The plot title and settings + this._title = {value: '', offset: 25, settings: {textAnchor: 'middle'}}; + this._area = [0.1, 0.1, 0.8, 0.9]; // The chart area: left, top, right, bottom, + // > 1 in pixels, <= 1 as proportion + this._areaFormat = {fill: 'none', stroke: 'black'}; // The formatting for the plot area + this._gridlines = []; // The formatting of the x- and y-gridlines + this._equalXY = true; // True for equal-sized x- and y-units, false to fill available space + this._functions = []; // The functions to be plotted, each is an object + this._onstatus = null; // The callback function for status updates + this._uuid = new Date().getTime(); + this._plotCont = this._wrapper.svg(0, 0, 0, 0, {class_: 'svg-plot'}); // The main container for the plot + + this.xAxis = new SVGPlotAxis(this); // The main x-axis + this.xAxis.title('X', 20); + this.yAxis = new SVGPlotAxis(this); // The main y-axis + this.yAxis.title('Y', 20); + this.legend = new SVGPlotLegend(this); // The plot legend + this._drawNow = true; +} + +$.extend(SVGPlot.prototype, { + + /* Useful indexes. */ + X: 0, + Y: 1, + W: 2, + H: 3, + L: 0, + T: 1, + R: 2, + B: 3, + + /* Set or retrieve the container for the plot. + @param cont (SVG element) the container for the plot + @return (SVGPlot) this plot object or + (SVG element) the current container (if no parameters) */ + container: function(cont) { + if (arguments.length == 0) { + return this._plotCont; + } + this._plotCont = cont; + return this; + }, + + /* Set or retrieve the main plotting area. + @param left (number) > 1 is pixels, <= 1 is proportion of width or + (number[4]) for left, top, right, bottom + @param top (number) > 1 is pixels, <= 1 is proportion of height + @param right (number) > 1 is pixels, <= 1 is proportion of width + @param bottom (number) > 1 is pixels, <= 1 is proportion of height + @return (SVGPlot) this plot object or + (number[4]) the plotting area: left, top, right, bottom (if no parameters) */ + area: function(left, top, right, bottom) { + if (arguments.length == 0) { + return this._area; + } + this._area = (isArray(left) ? left : [left, top, right, bottom]); + this._drawPlot(); + return this; + }, + + /* Set or retrieve the background of the plot area. + @param fill (string) how to fill the area background + @param stroke (string) the colour of the outline (optional) + @param settings (object) additional formatting for the area background (optional) + @return (SVGPlot) this plot object or + (object) the area format (if no parameters) */ + format: function(fill, stroke, settings) { + if (arguments.length == 0) { + return this._areaFormat; + } + if (typeof stroke == 'object') { + settings = stroke; + stroke = null; + } + this._areaFormat = $.extend({fill: fill}, + (stroke ? {stroke: stroke} : {}), settings || {}); + this._drawPlot(); + return this; + }, + + /* Set or retrieve the gridlines formatting for the plot area. + @param xSettings (string) the colour of the gridlines along the x-axis, or + (object) formatting for the gridlines along the x-axis, or + null for none + @param ySettings (string) the colour of the gridlines along the y-axis, or + (object) formatting for the gridlines along the y-axis, or + null for none + @return (SVGPlot) this plot object or + (object[2]) the gridlines formatting (if no parameters) */ + gridlines: function(xSettings, ySettings) { + if (arguments.length == 0) { + return this._gridlines; + } + this._gridlines = [(typeof xSettings == 'string' ? {stroke: xSettings} : xSettings), + (typeof ySettings == 'string' ? {stroke: ySettings} : ySettings)]; + if (this._gridlines[0] == null && this._gridlines[1] == null) { + this._gridlines = []; + } + this._drawPlot(); + return this; + }, + + /* Set or retrieve the equality of the x- and y-axes. + @param value (boolean) true for equal x- and y-units, false to fill the available space + @return (SVGPlot) this plot object or + (boolean) the current setting (if no parameters) */ + equalXY: function(value) { + if (arguments.length == 0) { + return this._equalXY; + } + this._equalXY = value; + return this; + }, + + /* Set or retrieve the title of the plot and its formatting. + @param value (string) the title + @param offset (number) the vertical positioning of the title + > 1 is pixels, <= 1 is proportion of width (optional) + @param colour (string) the colour of the title (optional) + @param settings (object) formatting for the title (optional) + @return (SVGPlot) this plot object or + (object) value, offset, and settings for the title (if no parameters) */ + title: function(value, offset, colour, settings) { + if (arguments.length == 0) { + return this._title; + } + if (typeof offset != 'number') { + settings = colour; + colour = offset; + offset = null; + } + if (typeof colour != 'string') { + settings = colour; + colour = null; + } + this._title = {value: value, offset: offset || this._title.offset, + settings: $.extend({textAnchor: 'middle'}, + (colour ? {fill: colour} : {}), settings || {})}; + this._drawPlot(); + return this; + }, + + /* Add a function to be plotted on the plot. + @param name (string) the name of this series (optional) + @param fn (function) the function to be plotted + @param range (number[2]) the range of values to plot (optional) + @param points (number) the number of points to plot within this range (optional) + @param stroke (string) the colour of the plotted lines (optional) + @param strokeWidth (number) the width of the plotted lines (optional) + @param settings (object) additional settings for the plotted values (optional) + @return (SVGPlot) this plot object */ + addFunction: function(name, fn, range, points, stroke, strokeWidth, settings) { + this._functions.push(new SVGPlotFunction( + this, name, fn, range, points, stroke, strokeWidth, settings)); + this._drawPlot(); + return this; + }, + + /* Retrieve the function wrappers. + @param i (number) the function index (optional) + @return (SVGPlotFunction) the specified function or + (SVGPlotFunction[]) the list of functions */ + functions: function(i) { + return (arguments.length > 0 ? this._functions[i] : null) || this._functions; + }, + + /* Suppress drawing of the plot until redraw() is called. + @return (SVGPlot) this plot object */ + noDraw: function() { + this._drawNow = false; + return this; + }, + + /* Redraw the entire plot with the current settings and values. + @return (SVGPlot) this plot object */ + redraw: function() { + this._drawNow = true; + this._drawPlot(); + return this; + }, + + /* Set the callback function for status updates. + @param onstatus (function) the callback function + @return (SVGPlot) this plot object */ + status: function(onstatus) { + this._onstatus = onstatus; + return this; + }, + + /* Actually draw the plot (if allowed). */ + _drawPlot: function() { + if (!this._drawNow) { + return; + } + while (this._plotCont.firstChild) { + this._plotCont.removeChild(this._plotCont.firstChild); + } + if (!this._plotCont.parent) { + this._wrapper._svg.appendChild(this._plotCont); + } + // Set sizes if not already there + if (!this._plotCont.width) { + this._plotCont.setAttribute('width', + parseInt(this._plotCont.getAttribute('width'), 10) || this._wrapper._width()); + } + else if (this._plotCont.width.baseVal) { + this._plotCont.width.baseVal.value = + this._plotCont.width.baseVal.value || this._wrapper._width(); + } + else { + this._plotCont.width = this._plotCont.width || this._wrapper._width(); + } + if (!this._plotCont.height) { + this._plotCont.setAttribute('height', + parseInt(this._plotCont.getAttribute('height'), 10) || this._wrapper._height()); + } + else if (this._plotCont.height.baseVal) { + this._plotCont.height.baseVal.value = + this._plotCont.height.baseVal.value || this._wrapper._height(); + } + else { + this._plotCont.height = this._plotCont.height || this._wrapper._height(); + } + this._drawChartBackground(); + var dims = this._getDims(); + var clip = this._wrapper.other(this._plotCont, 'clipPath', {id: 'clip' + this._uuid}); + this._wrapper.rect(clip, dims[this.X], dims[this.Y], dims[this.W], dims[this.H]); + this._plot = this._wrapper.group(this._plotCont, + {class_: 'foreground', clipPath: 'url(#clip' + this._uuid + ')'}); + this._drawAxis(true); + this._drawAxis(false); + for (var i = 0; i < this._functions.length; i++) { + this._plotFunction(this._functions[i], i); + } + this._drawTitle(); + this._drawLegend(); + }, + + /* Decode an attribute value. + @param node the node to examine + @param name the attribute name + @return the actual value */ + _getValue: function(node, name) { + return (!node[name] ? parseInt(node.getAttribute(name), 10) : + (node[name].baseVal ? node[name].baseVal.value : node[name])); + }, + + /* Calculate the actual dimensions of the plot area. + @param area (number[4]) the area values to evaluate (optional) + @return (number[4]) an array of dimension values: left, top, width, height */ + _getDims: function(area) { + var otherArea = (area != null); + area = area || this._area; + var availWidth = this._getValue(this._plotCont, 'width'); + var availHeight = this._getValue(this._plotCont, 'height'); + var left = (area[this.L] > 1 ? area[this.L] : availWidth * area[this.L]); + var top = (area[this.T] > 1 ? area[this.T] : availHeight * area[this.T]); + var width = (area[this.R] > 1 ? area[this.R] : availWidth * area[this.R]) - left; + var height = (area[this.B] > 1 ? area[this.B] : availHeight * area[this.B]) - top; + if (this._equalXY && !otherArea) { + var scale = Math.min(width / (this.xAxis._scale.max - this.xAxis._scale.min), + height / (this.yAxis._scale.max - this.yAxis._scale.min)); + width = scale * (this.xAxis._scale.max - this.xAxis._scale.min); + height = scale * (this.yAxis._scale.max - this.yAxis._scale.min); + } + return [left, top, width, height]; + }, + + /* Calculate the scaling factors for the plot area. + @return (number[2]) the x- and y-scaling factors */ + _getScales: function() { + var dims = this._getDims(); + return [dims[this.W] / (this.xAxis._scale.max - this.xAxis._scale.min), + dims[this.H] / (this.yAxis._scale.max - this.yAxis._scale.min)]; + }, + + /* Draw the chart background, including gridlines. + @param noXGrid (boolean) true to suppress the x-gridlines, false to draw them (optional) + @param noYGrid (boolean) true to suppress the y-gridlines, false to draw them (optional) + @return (element) the background group element */ + _drawChartBackground: function(noXGrid, noYGrid) { + var bg = this._wrapper.group(this._plotCont, {class_: 'background'}); + var dims = this._getDims(); + this._wrapper.rect(bg, dims[this.X], dims[this.Y], dims[this.W], dims[this.H], this._areaFormat); + if (this._gridlines[0] && this.yAxis._ticks.major && !noYGrid) { + this._drawGridlines(bg, true, this._gridlines[0], dims); + } + if (this._gridlines[1] && this.xAxis._ticks.major && !noXGrid) { + this._drawGridlines(bg, false, this._gridlines[1], dims); + } + return bg; + }, + + /* Draw one set of gridlines. + @param bg (element) the background group element + @param horiz (boolean) true if horizontal, false if vertical + @param format (object) additional settings for the gridlines */ + _drawGridlines: function(bg, horiz, format, dims) { + var g = this._wrapper.group(bg, format); + var axis = (horiz ? this.yAxis : this.xAxis); + var scales = this._getScales(); + var major = Math.floor(axis._scale.min / axis._ticks.major) * axis._ticks.major; + major += (major <= axis._scale.min ? axis._ticks.major : 0); + while (major < axis._scale.max) { + var v = (horiz ? axis._scale.max - major : major - axis._scale.min) * + scales[horiz ? 1 : 0] + (horiz ? dims[this.Y] : dims[this.X]); + this._wrapper.line(g, (horiz ? dims[this.X] : v), (horiz ? v : dims[this.Y]), + (horiz ? dims[this.X] + dims[this.W] : v), (horiz ? v : dims[this.Y] + dims[this.H])); + major += axis._ticks.major; + } + }, + + /* Draw an axis, its tick marks, and title. + @param horiz (boolean) true for x-axis, false for y-axis */ + _drawAxis: function(horiz) { + var id = (horiz ? 'x' : 'y') + 'Axis'; + var axis = (horiz ? this.xAxis : this.yAxis); + var axis2 = (horiz ? this.yAxis : this.xAxis); + var dims = this._getDims(); + var scales = this._getScales(); + var gl = this._wrapper.group(this._plot, $.extend({class_: id}, axis._lineFormat)); + var gt = this._wrapper.group(this._plot, $.extend({class_: id + 'Labels', + textAnchor: (horiz ? 'middle' : 'end')}, axis._labelFormat)); + var zero = (horiz ? axis2._scale.max : -axis2._scale.min) * + scales[horiz ? 1 : 0] + (horiz ? dims[this.Y] : dims[this.X]); + this._wrapper.line(gl, (horiz ? dims[this.X] : zero), (horiz ? zero : dims[this.Y]), + (horiz ? dims[this.X] + dims[this.W] : zero), + (horiz ? zero : dims[this.Y] + dims[this.H])); + if (axis._ticks.major) { + var size = axis._ticks.size; + var major = Math.floor(axis._scale.min / axis._ticks.major) * axis._ticks.major; + major = (major < axis._scale.min ? major + axis._ticks.major : major); + var minor = (!axis._ticks.minor ? axis._scale.max + 1 : + Math.floor(axis._scale.min / axis._ticks.minor) * axis._ticks.minor); + minor = (minor < axis._scale.min ? minor + axis._ticks.minor : minor); + var offsets = [(axis._ticks.position == 'nw' || axis._ticks.position == 'both' ? -1 : 0), + (axis._ticks.position == 'se' || axis._ticks.position == 'both' ? +1 : 0)]; + while (major <= axis._scale.max || minor <= axis._scale.max) { + var cur = Math.min(major, minor); + var len = (cur == major ? size : size / 2); + var xy = (horiz ? cur - axis._scale.min : axis._scale.max - cur) * + scales[horiz ? 0 : 1] + (horiz ? dims[this.X] : dims[this.Y]); + this._wrapper.line(gl, (horiz ? xy : zero + len * offsets[0]), + (horiz ? zero + len * offsets[0] : xy), + (horiz ? xy : zero + len * offsets[1]), + (horiz ? zero + len * offsets[1] : xy)); + if (cur == major && cur != 0) { + this._wrapper.text(gt, (horiz ? xy : zero - size), + (horiz ? zero - size : xy), '' + cur); + } + major += (cur == major ? axis._ticks.major : 0); + minor += (cur == minor ? axis._ticks.minor : 0); + } + } + if (axis._title) { + if (horiz) { + this._wrapper.text(this._plotCont, dims[this.X] - axis._titleOffset, + zero, axis._title, $.extend({textAnchor: 'end'}, axis._titleFormat || {})); + } + else { + this._wrapper.text(this._plotCont, zero, + dims[this.Y] + dims[this.H] + axis._titleOffset, + axis._title, $.extend({textAnchor : 'middle'}, axis._titleFormat || {})); + } + } + }, + + /* Plot an individual function. */ + _plotFunction: function(fn, cur) { + var dims = this._getDims(); + var scales = this._getScales(); + var path = this._wrapper.createPath(); + var range = fn._range || [this.xAxis._scale.min, this.xAxis._scale.max]; + var xScale = (range[1] - range[0]) / fn._points; + var first = true; + for (var i = 0; i <= fn._points; i++) { + var x = range[0] + i * xScale; + if (x > this.xAxis._scale.max + xScale) { + break; + } + if (x < this.xAxis._scale.min - xScale) { + continue; + } + var px = (x - this.xAxis._scale.min) * scales[0] + dims[this.X]; + var py = dims[this.H] - ((fn._fn(x) - this.yAxis._scale.min) * scales[1]) + dims[this.Y]; + path[(first ? 'move' : 'line') + 'To'](px, py); + first = false; + } + var p = this._wrapper.path(this._plot, path, + $.extend({class_: 'fn' + cur, fill: 'none', stroke: fn._stroke, + strokeWidth: fn._strokeWidth}, fn._settings || {})); + this._showStatus(p, fn._name); + }, + + /* Draw the plot title - centred. */ + _drawTitle: function() { + this._wrapper.text(this._plotCont, this._getValue(this._plotCont, 'width') / 2, + this._title.offset, this._title.value, this._title.settings); + }, + + /* Draw the chart legend. */ + _drawLegend: function() { + if (!this.legend._show) { + return; + } + var g = this._wrapper.group(this._plotCont, {class_: 'legend'}); + var dims = this._getDims(this.legend._area); + this._wrapper.rect(g, dims[this.X], dims[this.Y], dims[this.W], dims[this.H], + this.legend._bgSettings); + var horiz = dims[this.W] > dims[this.H]; + var numFn = this._functions.length; + var offset = (horiz ? dims[this.W] : dims[this.H]) / numFn; + var xBase = dims[this.X] + 5; + var yBase = dims[this.Y] + ((horiz ? dims[this.H] : offset) + this.legend._sampleSize) / 2; + for (var i = 0; i < numFn; i++) { + var fn = this._functions[i]; + this._wrapper.rect(g, xBase + (horiz ? i * offset : 0), + yBase + (horiz ? 0 : i * offset) - this.legend._sampleSize, + this.legend._sampleSize, this.legend._sampleSize, {fill: fn._stroke}); + this._wrapper.text(g, xBase + (horiz ? i * offset : 0) + this.legend._sampleSize + 5, + yBase + (horiz ? 0 : i * offset), fn._name, this.legend._textSettings); + } + }, + + /* Show the current value status on hover. */ + _showStatus: function(elem, label) { + var status = this._onstatus; + if (this._onstatus) { + $(elem).hover(function(evt) { status.apply(this, [label]); }, + function() { status.apply(this, ['']); }); + } + } +}); + +/* Details about each plot function. + @param plot (SVGPlot) the owning plot + @param name (string) the name of this function (optional) + @param fn (function) the function to be plotted + @param range (number[2]) the range of values to be plotted (optional) + @param points (number) the number of points to plot within this range (optional) + @param stroke (string) the colour of the (out)line for the plot (optional) + @param strokeWidth (number) the width of the (out)line for the plot (optional) + @param settings (object) additional formatting settings (optional) + @return (SVGPlotFunction) the new plot function object */ +function SVGPlotFunction(plot, name, fn, range, points, stroke, strokeWidth, settings) { + if (typeof name != 'string') { + settings = strokeWidth; + strokeWidth = stroke; + stroke = points; + points = range; + range = fn; + fn = name; + name = null; + } + if (!isArray(range)) { + settings = strokeWidth; + strokeWidth = stroke; + stroke = points; + points = range; + range = null; + } + if (typeof points != 'number') { + settings = strokeWidth; + strokeWidth = stroke; + stroke = points; + points = null; + } + if (typeof stroke != 'string') { + settings = strokeWidth; + strokeWidth = stroke; + stroke = null; + } + if (typeof strokeWidth != 'number') { + settings = strokeWidth; + strokeWidth = null; + } + this._plot = plot; // The owning plot + this._name = name || ''; // Display name + this._fn = fn || identity; // The actual function: y = fn(x) + this._range = range; // The range of values plotted + this._points = points || 100; // The number of points plotted + this._stroke = stroke || 'black'; // The line colour + this._strokeWidth = strokeWidth || 1; // The line width + this._settings = settings || {}; // Any other settings +} + +$.extend(SVGPlotFunction.prototype, { + + /* Set or retrieve the name for this function. + @param name (string) the function's name + @return (SVGPlotFunction) this plot function object or + (string) the function name (if no parameters) */ + name: function(name) { + if (arguments.length == 0) { + return this._name; + } + this._name = name; + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the function to be plotted. + @param name (string) the function's name (optional) + @param fn (function) the function to be ploted + @return (SVGPlotFunction) this plot function object or + (function) the actual function (if no parameters) */ + fn: function(name, fn) { + if (arguments.length == 0) { + return this._fn; + } + if (typeof name == 'function') { + fn = name; + name = null; + } + this._name = name || this._name; + this._fn = fn; + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the range of values to be plotted. + @param min (number) the minimum value to be plotted + @param max (number) the maximum value to be plotted + @return (SVGPlotFunction) this plot function object or + (number[2]) the value range (if no parameters) */ + range: function(min, max) { + if (arguments.length == 0) { + return this._range; + } + this._range = (min == null ? null : [min, max]); + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the number of points to be plotted. + @param value (number) the number of points to plot + @return (SVGPlotFunction) this plot function object or + (number) the number of points (if no parameters) */ + points: function(value) { + if (arguments.length == 0) { + return this._points; + } + this._points = value; + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the formatting for this function. + @param stroke (string) the (out)line colour + @param strokeWidth (number) the line's width (optional) + @param settings (object) additional formatting settings for the function (optional) + @return (SVGPlotFunction) this plot function object or + (object) formatting settings (if no parameters) */ + format: function(stroke, strokeWidth, settings) { + if (arguments.length == 0) { + return $.extend({stroke: this._stroke, + strokeWidth: this._strokeWidth}, this._settings); + } + if (typeof strokeWidth != 'number') { + settings = strokeWidth; + strokeWidth = null; + } + this._stroke = stroke || this._stroke; + this._strokeWidth = strokeWidth || this._strokeWidth; + $.extend(this._settings, settings || {}); + this._plot._drawPlot(); + return this; + }, + + /* Return to the parent plot. */ + end: function() { + return this._plot; + } +}); + +/* Default function to plot. + @param x (number) the input value + @return (number) the same value */ +function identity(x) { + return x; +} + +/* Details about each plot axis. + @param plot (SVGPlot) the owning plot + @param title (string) the title of the axis + @param min (number) the minimum value displayed on this axis + @param max (number) the maximum value displayed on this axis + @param major (number) the distance between major ticks + @param minor (number) the distance between minor ticks (optional) + @return (SVGPlotAxis) the new axis object */ +function SVGPlotAxis(plot, title, min, max, major, minor) { + this._plot = plot; // The owning plot + this._title = title || ''; // The plot's title + this._titleFormat = {}; // Formatting settings for the title + this._titleOffset = 0; // The offset for positioning the title + this._labelFormat = {}; // Formatting settings for the labels + this._lineFormat = {stroke: 'black', strokeWidth: 1}; // Formatting settings for the axis lines + this._ticks = {major: major || 10, minor: minor || 0, size: 10, position: 'both'}; // Tick mark options + this._scale = {min: min || 0, max: max || 100}; // Axis scale settings + this._crossAt = 0; // Where this axis crosses the other one. */ +} + +$.extend(SVGPlotAxis.prototype, { + + /* Set or retrieve the scale for this axis. + @param min (number) the minimum value shown + @param max (number) the maximum value shown + @return (SVGPlotAxis) this axis object or + (object) min and max values (if no parameters) */ + scale: function(min, max) { + if (arguments.length == 0) { + return this._scale; + } + this._scale.min = min; + this._scale.max = max; + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the ticks for this axis. + @param major (number) the distance between major ticks + @param minor (number) the distance between minor ticks + @param size (number) the length of the major ticks (minor are half) (optional) + @param position (string) the location of the ticks: + 'nw', 'se', 'both' (optional) + @return (SVGPlotAxis) this axis object or + (object) major, minor, size, and position values (if no parameters) */ + ticks: function(major, minor, size, position) { + if (arguments.length == 0) { + return this._ticks; + } + if (typeof size == 'string') { + position = size; + size = null; + } + this._ticks.major = major; + this._ticks.minor = minor; + this._ticks.size = size || this._ticks.size; + this._ticks.position = position || this._ticks.position; + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the title for this axis. + @param title (string) the title text + @param offset (number) the distance to offset the title position (optional) + @param colour (string) how to colour the title (optional) + @param format (object) formatting settings for the title (optional) + @return (SVGPlotAxis) this axis object or + (object) title, offset, and format values (if no parameters) */ + title: function(title, offset, colour, format) { + if (arguments.length == 0) { + return {title: this._title, offset: this._titleOffset, format: this._titleFormat}; + } + if (typeof offset != 'number') { + format = colour; + colour = offset; + offset = null; + } + if (typeof colour != 'string') { + format = colour; + colour = null; + } + this._title = title; + this._titleOffset = (offset != null ? offset : this._titleOffset); + if (colour || format) { + this._titleFormat = $.extend(format || {}, (colour ? {fill: colour} : {})); + } + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the label format for this axis. + @param colour (string) how to colour the labels (optional) + @param format (object) formatting settings for the labels (optional) + @return (SVGPlotAxis) this axis object or + (object) format values (if no parameters) */ + format: function(colour, format) { + if (arguments.length == 0) { + return this._labelFormat; + } + if (typeof colour != 'string') { + format = colour; + colour = null; + } + this._labelFormat = $.extend(format || {}, (colour ? {fill: colour} : {})); + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the line formatting for this axis. + @param colour (string) the line's colour + @param width (number) the line's width (optional) + @param settings (object) additional formatting settings for the line (optional) + @return (SVGPlotAxis) this axis object or + (object) line formatting values (if no parameters) */ + line: function(colour, width, settings) { + if (arguments.length == 0) { + return this._lineFormat; + } + if (typeof width != 'number') { + settings = width; + width = null; + } + $.extend(this._lineFormat, {stroke: colour, strokeWidth: + width || this._lineFormat.strokeWidth}, settings || {}); + this._plot._drawPlot(); + return this; + }, + + /* Return to the parent plot. */ + end: function() { + return this._plot; + } +}); + +/* Details about the plot legend. + @param plot (SVGPlot) the owning plot + @param bgSettings (object) additional formatting settings for the legend background (optional) + @param textSettings (object) additional formatting settings for the legend text (optional) + @return (SVGPlotLegend) the new legend object */ +function SVGPlotLegend(plot, bgSettings, textSettings) { + this._plot = plot; // The owning plot + this._show = true; // Show the legend? + this._area = [0.9, 0.1, 1.0, 0.9]; // The legend area: left, top, right, bottom, + // > 1 in pixels, <= 1 as proportion + this._sampleSize = 15; // Size of sample box + this._bgSettings = bgSettings || {stroke: 'gray'}; // Additional formatting settings for the legend background + this._textSettings = textSettings || {}; // Additional formatting settings for the text +} + +$.extend(SVGPlotLegend.prototype, { + + /* Set or retrieve whether the legend should be shown. + @param show (boolean) true to display it, false to hide it + @return (SVGPlotLegend) this legend object or + (boolean) show the legend? (if no parameters) */ + show: function(show) { + if (arguments.length == 0) { + return this._show; + } + this._show = show; + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve the legend area. + @param left (number) > 1 is pixels, <= 1 is proportion of width or + (number[4]) for left, top, right, bottom + @param top (number) > 1 is pixels, <= 1 is proportion of height + @param right (number) > 1 is pixels, <= 1 is proportion of width + @param bottom (number) > 1 is pixels, <= 1 is proportion of height + @return (SVGPlotLegend) this legend object or + (number[4]) the legend area: left, top, right, bottom (if no parameters) */ + area: function(left, top, right, bottom) { + if (arguments.length == 0) { + return this._area; + } + this._area = (isArray(left) ? left : [left, top, right, bottom]); + this._plot._drawPlot(); + return this; + }, + + /* Set or retrieve additional settings for the legend area. + @param sampleSize (number) the size of the sample box to display (optional) + @param bgSettings (object) additional formatting settings for the legend background + @param textSettings (object) additional formatting settings for the legend text (optional) + @return (SVGPlotLegend) this legend object or + (object) bgSettings and textSettings for the legend (if no parameters) */ + settings: function(sampleSize, bgSettings, textSettings) { + if (arguments.length == 0) { + return {sampleSize: this._sampleSize, bgSettings: this._bgSettings, + textSettings: this._textSettings}; + } + if (typeof sampleSize == 'object') { + textSettings = bgSettings; + bgSettings = sampleSize; + sampleSize = null; + } + this._sampleSize = sampleSize || this._sampleSize; + this._bgSettings = bgSettings; + this._textSettings = textSettings || this._textSettings; + this._plot._drawPlot(); + return this; + }, + + /* Return to the parent plot. */ + end: function() { + return this._plot; + } +}); + +//============================================================================== + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && a.constructor == Array); +} + +})(jQuery)
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/lion.svg Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,161 @@ +<?xml version="1.0"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" + "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg xmlns="http://www.w3.org/2000/svg" + xmlns:xlink="http://www.w3.org/1999/xlink" + width="15cm" height="15cm"> + <g transform="translate(100,10)"> + <polygon fill="#f2cc99" + points=" 69,18 82,8 99,3 118,5 135,12 149,21 156,13 165,9 177,13 183,28 180,50 164,91 155,107 154,114 151,121 141,127 139,136 155,206 157,251 126,342 133,357 128,376 83,376 75,368 67,350 61,350 53,369 4,369 2,361 5,354 12,342 16,321 4,257 4,244 7,218 9,179 26,127 43,93 32,77 30,70 24,67 16,49 17,35 18,23 30,12 40,7 53,7 62,12"/> + <polygon fill="#e5b27f" + points=" 142,79 136,74 138,82 133,78 133,84 127,78 128,85 124,80 125,87 119,82 119,90 125,99 125,96 128,100 128,94 131,98 132,93 135,97 136,93 138,97 139,94 141,98 143,94 144,85"/> + <polygon fill="#eb8080" + points=" 127,101 132,100 137,99 144,101 143,105 135,110"/> + <polygon fill="#f2cc99" + points=" 178,229 157,248 139,296 126,349 137,356 158,357 183,342 212,332 235,288 235,261 228,252 212,250 188,251"/> + <g fill="#9c826b"> + <polygon points=" 56,229 48,241 48,250 57,281 63,325 71,338 81,315 76,321 79,311 83,301 75,308 80,298 73,303 76,296 71,298 74,292 69,293 74,284 78,278 71,278 74,274 68,273 70,268 66,267 68,261 60,266 62,259 65,253 57,258 59,251 55,254 55,248 60,237 54,240 58,234 54,236"/> + <polygon points=" 74,363 79,368 81,368 85,362 89,363 92,370 96,373 101,372 108,361 110,371 113,373 116,371 120,358 122,363 123,371 126,371 129,367 132,357 135,361 130,376 127,377 94,378 84,376 76,371"/> + <polygon points=" 212,250 219,251 228,258 236,270 235,287 225,304 205,332 177,343 171,352 158,357 166,352 168,346 168,339 165,333 155,327 155,323 161,320 165,316 169,316 167,312 171,313 168,308 173,309 170,306 177,306 175,308 177,311 174,311 176,316 171,315 174,319 168,320 168,323 175,327 179,332 183,326 184,332 189,323 190,328 194,320 194,325 199,316 201,320 204,313 206,316 208,310 211,305 219,298 226,288 229,279 228,266 224,259 217,253"/> + <polygon points=" 151,205 151,238 149,252 141,268 128,282 121,301 130,300 126,313 118,324 116,337 120,346 133,352 133,340 137,333 145,329 156,327 153,319 153,291 157,271 170,259 178,277 193,250 174,216"/> + <polygon points=" 78,127 90,142 95,155 108,164 125,167 139,175 150,206 152,191 141,140 121,148 100,136"/> + <polygon points=" 21,58 35,63 38,68 32,69 42,74 40,79 47,80 54,83 45,94 34,81 32,73 24,66"/> + <polygon points=" 71,34 67,34 66,27 59,24 54,17 48,17 39,22 30,26 28,31 31,39 38,46 29,45 36,54 41,61 41,70 50,69 54,71 55,58 67,52 76,43 76,39 68,44"/> + <polygon points=" 139,74 141,83 143,89 144,104 148,104 155,106 154,86 157,77 155,72 150,77 144,77"/> + <polygon points=" 105,44 102,53 108,58 111,62 112,55"/> + <polygon points=" 141,48 141,54 144,58 139,62 137,66 136,59 137,52"/> + <polygon points=" 98,135 104,130 105,134 108,132 108,135 112,134 113,137 116,136 116,139 119,139 124,141 128,140 133,138 140,133 139,140 126,146 104,144"/> + <polygon points=" 97,116 103,119 103,116 111,118 116,117 122,114 127,107 135,111 142,107 141,114 145,118 149,121 145,125 140,124 127,121 113,125 100,124"/> + <polygon points=" 147,33 152,35 157,34 153,31 160,31 156,28 161,28 159,24 163,25 163,21 165,22 170,23 167,17 172,21 174,18 175,23 176,22 177,28 177,33 174,37 176,39 174,44 171,49 168,53 164,57 159,68 156,70 154,60 150,51 146,43 144,35"/> + <polygon points=" 85,72 89,74 93,75 100,76 105,75 102,79 94,79 88,76"/> + <polygon points=" 86,214 79,221 76,232 82,225 78,239 82,234 78,245 81,243 79,255 84,250 84,267 87,254 90,271 90,257 95,271 93,256 95,249 92,252 93,243 89,253 89,241 86,250 87,236 83,245 87,231 82,231 90,219 84,221"/> + </g> + <g fill="#ffcc7f"> + <polygon points=" 93,68 96,72 100,73 106,72 108,66 105,63 100,62"/> + <polygon points=" 144,64 142,68 142,73 146,74 150,73 154,64 149,62"/> + </g> + <g fill="#9c826b"> + <polygon points=" 57,91 42,111 52,105 41,117 53,112 46,120 53,116 50,124 57,119 55,127 61,122 60,130 67,126 66,134 71,129 72,136 77,130 76,137 80,133 82,138 86,135 96,135 94,129 86,124 83,117 77,123 79,117 73,120 75,112 68,116 71,111 65,114 69,107 63,110 68,102 61,107 66,98 61,103 63,97 57,99"/> + <polygon points=" 83,79 76,79 67,82 75,83 65,88 76,87 65,92 76,91 68,96 77,95 70,99 80,98 72,104 80,102 76,108 85,103 92,101 87,98 93,96 86,94 91,93 85,91 93,89 99,89 105,93 107,85 102,82 92,80"/> + <polygon points=" 109,77 111,83 109,89 113,94 117,90 117,81 114,78"/> + <polygon points=" 122,128 127,126 134,127 136,129 134,130 130,128 124,129"/> + <polygon points=" 78,27 82,32 80,33 82,36 78,37 82,40 78,42 81,46 76,47 78,49 74,50 82,52 87,50 83,48 91,46 86,45 91,42 88,40 92,37 86,34 90,31 86,29 89,26"/> + <polygon points=" 82,17 92,20 79,21 90,25 81,25 94,28 93,26 101,30 101,26 107,33 108,28 111,40 113,34 115,45 117,39 119,54 121,46 124,58 126,47 129,59 130,49 134,58 133,44 137,48 133,37 137,40 133,32 126,20 135,26 132,19 138,23 135,17 142,18 132,11 116,6 94,6 78,11 92,12 80,14 90,16"/> + <polygon points=" 142,234 132,227 124,223 115,220 110,225 118,224 127,229 135,236 122,234 115,237 113,242 121,238 139,243 121,245 111,254 95,254 102,244 104,235 110,229 100,231 104,224 113,216 122,215 132,217 141,224 145,230 149,240"/> + <polygon points=" 115,252 125,248 137,249 143,258 134,255 125,254"/> + <polygon points=" 114,212 130,213 140,219 147,225 144,214 137,209 128,207"/> + <polygon points=" 102,263 108,258 117,257 131,258 116,260 109,265"/> + <polygon points=" 51,241 35,224 40,238 23,224 31,242 19,239 28,247 17,246 25,250 37,254 39,263 44,271 47,294 48,317 51,328 60,351 60,323 53,262 47,246"/> + <polygon points=" 2,364 9,367 14,366 18,355 20,364 26,366 31,357 35,364 39,364 42,357 47,363 53,360 59,357 54,369 7,373"/> + <polygon points=" 7,349 19,345 25,339 18,341 23,333 28,326 23,326 27,320 23,316 25,311 20,298 15,277 12,264 9,249 10,223 3,248 5,261 15,307 17,326 11,343"/> + <polygon points=" 11,226 15,231 25,236 18,227"/> + <polygon points=" 13,214 19,217 32,227 23,214 16,208 15,190 24,148 31,121 24,137 14,170 8,189"/> + <polygon points=" 202,254 195,258 199,260 193,263 197,263 190,268 196,268 191,273 188,282 200,272 194,272 201,266 197,265 204,262 200,258 204,256"/> + </g> + <g fill="#845433"> + <polygon points=" 151,213 165,212 179,225 189,246 187,262 179,275 176,263 177,247 171,233 163,230 165,251 157,264 146,298 145,321 133,326 143,285 154,260 153,240"/> + <polygon points=" 91,132 95,145 97,154 104,148 107,155 109,150 111,158 115,152 118,159 120,153 125,161 126,155 133,164 132,154 137,163 137,152 142,163 147,186 152,192 148,167 141,143 124,145 105,143"/> + </g> + <g fill="#9c826b"> + <polygon points=" 31,57 23,52 26,51 20,44 23,42 21,36 22,29 25,23 24,32 30,43 26,41 30,50 26,48"/> + <polygon points=" 147,21 149,28 155,21 161,16 167,14 175,15 173,11 161,9"/> + <polygon points=" 181,39 175,51 169,57 171,65 165,68 165,75 160,76 162,91 171,71 180,51"/> + <polygon points=" 132,346 139,348 141,346 142,341 147,342 143,355 133,350"/> + <polygon points=" 146,355 151,352 155,348 157,343 160,349 151,356 147,357"/> + <polygon points=" 99,266 100,281 94,305 86,322 78,332 72,346 73,331 91,291"/> + <polygon points=" 20,347 32,342 45,340 54,345 45,350 42,353 38,350 31,353 29,356 23,350 19,353 15,349"/> + <polygon points=" 78,344 86,344 92,349 88,358 84,352"/> + <polygon points=" 93,347 104,344 117,345 124,354 121,357 116,351 112,351 108,355 102,351"/> + </g> + <g fill="#000000"> + <polygon points=" 105,12 111,18 113,24 113,29 119,34 116,23 112,16"/> + <polygon points=" 122,27 125,34 127,43 128,34 125,29"/> + <polygon points=" 115,13 122,19 122,15 113,10"/> + </g> + <g fill="#ffe5b2"> + <polygon points=" 116,172 107,182 98,193 98,183 90,199 89,189 84,207 88,206 87,215 95,206 93,219 91,230 98,216 97,226 104,214 112,209 104,208 113,202 126,200 139,207 132,198 142,203 134,192 142,195 134,187 140,185 130,181 136,177 126,177 125,171 116,180"/> + <polygon points=" 74,220 67,230 67,221 59,235 63,233 60,248 70,232 65,249 71,243 67,256 73,250 69,262 73,259 71,267 76,262 72,271 78,270 76,275 82,274 78,290 86,279 86,289 92,274 88,275 87,264 82,270 82,258 77,257 78,247 73,246 77,233 72,236"/> + <polygon points=" 133,230 147,242 148,250 145,254 138,247 129,246 142,245 138,241 128,237 137,238"/> + <polygon points=" 133,261 125,261 116,263 111,267 125,265"/> + <polygon points=" 121,271 109,273 103,279 99,305 92,316 85,327 83,335 89,340 97,341 94,336 101,336 96,331 103,330 97,327 108,325 99,322 109,321 100,318 110,317 105,314 110,312 107,310 113,308 105,306 114,303 105,301 115,298 107,295 115,294 108,293 117,291 109,289 117,286 109,286 118,283 112,281 118,279 114,278 119,276 115,274"/> + <polygon points=" 79,364 74,359 74,353 76,347 80,351 83,356 82,360"/> + <polygon points=" 91,363 93,356 97,353 103,355 105,360 103,366 99,371 94,368"/> + <polygon points=" 110,355 114,353 118,357 117,363 113,369 111,362"/> + <polygon points=" 126,354 123,358 124,367 126,369 129,361 129,357"/> + <polygon points=" 30,154 24,166 20,182 23,194 29,208 37,218 41,210 41,223 46,214 46,227 52,216 52,227 61,216 59,225 68,213 73,219 70,207 77,212 69,200 77,202 70,194 78,197 68,187 76,182 64,182 58,175 58,185 53,177 50,186 46,171 44,182 39,167 36,172 36,162 30,166"/> + <polygon points=" 44,130 41,137 45,136 43,150 48,142 48,157 53,150 52,164 60,156 61,169 64,165 66,175 70,167 74,176 77,168 80,183 85,172 90,182 93,174 98,181 99,173 104,175 105,169 114,168 102,163 95,157 94,166 90,154 87,162 82,149 75,159 72,148 68,155 67,143 62,148 62,138 58,145 56,133 52,142 52,128 49,134 47,125"/> + <polygon points=" 13,216 19,219 36,231 22,223 16,222 22,227 12,224 13,220 16,220"/> + <polygon points=" 10,231 14,236 25,239 27,237 19,234"/> + <polygon points=" 9,245 14,242 25,245 13,245"/> + <polygon points=" 33,255 26,253 18,254 25,256 18,258 27,260 18,263 27,265 19,267 29,270 21,272 29,276 21,278 30,281 22,283 31,287 24,288 32,292 23,293 34,298 26,299 37,303 32,305 39,309 33,309 39,314 34,314 40,318 34,317 40,321 34,321 41,326 33,326 40,330 33,332 39,333 33,337 42,337 54,341 49,337 52,335 47,330 50,330 45,325 49,325 45,321 48,321 45,316 46,306 45,286 43,274 36,261"/> + <polygon points=" 7,358 9,351 14,351 17,359 11,364"/> + <polygon points=" 44,354 49,351 52,355 49,361"/> + <polygon points=" 32,357 37,353 40,358 36,361"/> + <polygon points=" 139,334 145,330 154,330 158,334 154,341 152,348 145,350 149,340 147,336 141,339 139,345 136,342 136,339"/> + <polygon points=" 208,259 215,259 212,255 220,259 224,263 225,274 224,283 220,292 208,300 206,308 203,304 199,315 197,309 195,318 193,313 190,322 190,316 185,325 182,318 180,325 172,321 178,320 176,313 186,312 180,307 188,307 184,303 191,302 186,299 195,294 187,290 197,288 192,286 201,283 194,280 203,277 198,275 207,271 200,269 209,265 204,265 212,262"/> + <polygon points=" 106,126 106,131 109,132 111,134 115,132 115,135 119,133 118,137 123,137 128,137 133,134 136,130 136,127 132,124 118,128 112,128 106,126 106,126 106,126"/> + <polygon points=" 107,114 101,110 98,102 105,97 111,98 119,102 121,108 118,112 113,115"/> + <polygon points=" 148,106 145,110 146,116 150,118 152,111 151,107"/> + <polygon points=" 80,55 70,52 75,58 63,57 72,61 57,61 67,66 57,67 62,69 54,71 61,73 54,77 63,78 53,85 60,84 56,90 69,84 63,82 75,76 70,75 77,72 72,71 78,69 72,66 81,67 78,64 82,63 80,60 86,62"/> + <polygon points=" 87,56 91,52 96,50 102,56 98,56 92,60"/> + <polygon points=" 85,68 89,73 98,76 106,74 96,73 91,70"/> + <polygon points=" 115,57 114,64 111,64 115,75 122,81 122,74 126,79 126,74 131,78 130,72 133,77 131,68 126,61 119,57"/> + <polygon points=" 145,48 143,53 147,59 151,59 150,55"/> + <polygon points=" 26,22 34,15 43,10 52,10 59,16 47,15 32,22"/> + <polygon points=" 160,19 152,26 149,34 154,33 152,30 157,30 155,26 158,27 157,23 161,23"/> + </g> + <g fill="#000000"> + <polygon points=" 98,117 105,122 109,122 105,117 113,120 121,120 130,112 128,108 123,103 123,99 128,101 132,106 135,109 142,105 142,101 145,101 145,91 148,101 145,105 136,112 135,116 143,124 148,120 150,122 142,128 133,122 121,125 112,126 103,125 100,129 96,124"/> + <polygon points=" 146,118 152,118 152,115 149,115"/> + <polygon points=" 148,112 154,111 154,109 149,109"/> + <polygon points=" 106,112 108,115 114,116 118,114"/> + <polygon points=" 108,108 111,110 116,110 119,108"/> + <polygon points=" 106,104 109,105 117,106 115,104"/> + <polygon points=" 50,25 41,26 34,33 39,43 49,58 36,51 47,68 55,69 54,59 61,57 74,46 60,52 67,42 57,48 61,40 54,45 60,36 59,29 48,38 52,30 47,32"/> + <polygon points=" 147,34 152,41 155,49 161,53 157,47 164,47 158,43 168,44 159,40 164,37 169,37 164,33 169,34 165,28 170,30 170,25 173,29 175,27 176,32 173,36 175,39 172,42 172,46 168,49 170,55 162,57 158,63 155,58 153,50 149,46"/> + <polygon points=" 155,71 159,80 157,93 157,102 155,108 150,101 149,93 154,101 152,91 151,83 155,79"/> + <polygon points=" 112,78 115,81 114,91 112,87 113,82"/> + <polygon points=" 78,28 64,17 58,11 47,9 36,10 28,16 21,26 18,41 20,51 23,61 33,65 28,68 37,74 36,81 43,87 48,90 43,100 40,98 39,90 31,80 30,72 22,71 17,61 14,46 16,28 23,17 33,9 45,6 54,6 65,12"/> + <polygon points=" 67,18 76,9 87,5 101,2 118,3 135,8 149,20 149,26 144,19 132,12 121,9 105,7 89,8 76,14 70,20"/> + <polygon points=" 56,98 48,106 56,103 47,112 56,110 52,115 57,113 52,121 62,115 58,123 65,119 63,125 69,121 68,127 74,125 74,129 79,128 83,132 94,135 93,129 85,127 81,122 76,126 75,121 71,124 71,117 66,121 66,117 62,117 64,112 60,113 60,110 57,111 61,105 57,107 60,101 55,102"/> + <polygon points=" 101,132 103,138 106,134 106,139 112,136 111,142 115,139 114,143 119,142 125,145 131,142 135,138 140,134 140,129 143,135 145,149 150,171 149,184 145,165 141,150 136,147 132,151 131,149 126,152 125,150 121,152 117,148 111,152 110,148 105,149 104,145 98,150 96,138 94,132 94,130 98,132"/> + <polygon points=" 41,94 32,110 23,132 12,163 6,190 7,217 5,236 3,247 9,230 12,211 12,185 18,160 26,134 35,110 43,99"/> + <polygon points=" 32,246 41,250 50,257 52,267 53,295 53,323 59,350 54,363 51,365 44,366 42,360 40,372 54,372 59,366 62,353 71,352 75,335 73,330 66,318 68,302 64,294 67,288 63,286 63,279 59,275 58,267 56,262 50,247 42,235 44,246 32,236 35,244"/> + <polygon points=" 134,324 146,320 159,322 173,327 179,337 179,349 172,355 158,357 170,350 174,343 170,333 163,328 152,326 134,329"/> + <polygon points=" 173,339 183,334 184,338 191,329 194,332 199,323 202,325 206,318 209,320 213,309 221,303 228,296 232,289 234,279 233,269 230,262 225,256 219,253 208,252 198,252 210,249 223,250 232,257 237,265 238,277 238,291 232,305 221,323 218,335 212,342 200,349 178,348"/> + <polygon points=" 165,296 158,301 156,310 156,323 162,324 159,318 162,308 162,304"/> + <polygon points=" 99,252 105,244 107,234 115,228 121,228 131,235 122,233 113,235 109,246 121,239 133,243 121,243 110,251"/> + <polygon points=" 117,252 124,247 134,249 136,253 126,252"/> + <polygon points=" 117,218 132,224 144,233 140,225 132,219 117,218 117,218 117,218"/> + <polygon points=" 122,212 134,214 143,221 141,213 132,210"/> + <polygon points=" 69,352 70,363 76,373 86,378 97,379 108,379 120,377 128,378 132,373 135,361 133,358 132,366 127,375 121,374 121,362 119,367 117,374 110,376 110,362 107,357 106,371 104,375 97,376 90,375 90,368 86,362 83,364 86,369 85,373 78,370 73,362 71,351"/> + <polygon points=" 100,360 96,363 99,369 102,364"/> + <polygon points=" 115,360 112,363 114,369 117,364"/> + <polygon points=" 127,362 125,364 126,369 128,365"/> + <polygon points=" 5,255 7,276 11,304 15,320 13,334 6,348 2,353 0,363 5,372 12,374 25,372 38,372 44,369 42,367 36,368 31,369 30,360 27,368 20,370 16,361 15,368 10,369 3,366 3,359 6,352 11,348 17,331 19,316 12,291 9,274"/> + <polygon points=" 10,358 7,362 10,366 11,362"/> + <polygon points=" 25,357 22,360 24,366 27,360"/> + <polygon points=" 37,357 34,361 36,365 38,361"/> + <polygon points=" 49,356 46,359 47,364 50,360"/> + <polygon points=" 130,101 132,102 135,101 139,102 143,103 142,101 137,100 133,100"/> + <polygon points=" 106,48 105,52 108,56 109,52"/> + <polygon points=" 139,52 139,56 140,60 142,58 141,56"/> + <polygon points=" 25,349 29,351 30,355 33,350 37,348 42,351 45,347 49,345 44,343 36,345"/> + <polygon points=" 98,347 105,351 107,354 109,349 115,349 120,353 118,349 113,346 104,346"/> + <polygon points=" 83,348 87,352 87,357 89,351 87,348"/> + <polygon points=" 155,107 163,107 170,107 186,108 175,109 155,109"/> + <polygon points=" 153,114 162,113 175,112 192,114 173,114 154,115"/> + <polygon points=" 152,118 164,120 180,123 197,129 169,123 151,120"/> + <polygon points=" 68,109 87,106 107,106 106,108 88,108"/> + <polygon points=" 105,111 95,112 79,114 71,116 85,115 102,113"/> + <polygon points=" 108,101 98,99 87,99 78,99 93,100 105,102"/> + <polygon points=" 85,63 91,63 97,60 104,60 108,62 111,69 112,75 110,74 108,71 103,73 106,69 105,65 103,64 103,67 102,70 99,70 97,66 94,67 97,72 88,67 84,66"/> + <polygon points=" 140,74 141,66 144,61 150,61 156,62 153,70 150,73 152,65 150,65 151,68 149,71 146,71 144,66 143,70 143,74"/> + <polygon points=" 146,20 156,11 163,9 172,9 178,14 182,18 184,32 182,42 182,52 177,58 176,67 171,76 165,90 157,105 160,92 164,85 168,78 167,73 173,66 172,62 175,59 174,55 177,53 180,46 181,29 179,21 173,13 166,11 159,13 153,18 148,23"/> + <polygon points=" 150,187 148,211 150,233 153,247 148,267 135,283 125,299 136,292 131,313 122,328 122,345 129,352 133,359 133,367 137,359 148,356 140,350 131,347 129,340 132,332 140,328 137,322 140,304 154,265 157,244 155,223 161,220 175,229 186,247 185,260 176,275 178,287 185,277 188,261 196,253 189,236 174,213"/> + <polygon points=" 147,338 142,341 143,345 141,354 147,343"/> + <polygon points=" 157,342 156,349 150,356 157,353 163,346 162,342"/> + <polygon points=" 99,265 96,284 92,299 73,339 73,333 87,300"/> + </g> + </g> +</svg>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/svg/svgBasics.html Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,74 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN" + "http://www.w3.org/TR/html4/strict.dtd"> +<html> +<head> +<meta http-equiv="Content-Type" content="text/html;charset=utf-8" /> +<title>jQuery SVG Basics</title> +<style type="text/css"> +@import "jquery.svg.css"; + +#svgbasics { width: 400px; height: 300px; border: 1px solid #484; } +</style> +<script type="text/javascript" src="../jquery-1.4.4.js"></script> +<script type="text/javascript" src="jquery.svg.js"></script> +<script type="text/javascript"> +$(function() { + $('#svgbasics').svg({onLoad: drawInitial}); + $('button').click(drawShape); +}); + +function drawInitial(svg) { + svg.circle(75, 75, 50, {fill: 'none', stroke: 'red', 'stroke-width': 3}); + var g = svg.group({stroke: 'black', 'stroke-width': 2}); + svg.line(g, 15, 75, 135, 75); + svg.line(g, 75, 15, 75, 135); +} + +var colours = ['purple', 'red', 'orange', 'yellow', 'lime', 'green', 'blue', 'navy', 'black']; + +function drawShape() { + var shape = this.id; + var svg = $('#svgbasics').svg('get'); + if (shape == 'rect') { + svg.rect(random(300), random(200), random(100) + 100, random(100) + 100, + {fill: colours[random(9)], stroke: colours[random(9)], + 'stroke-width': random(5) + 1}); + } + else if (shape == 'line') { + svg.line(random(400), random(300), random(400), random(300), + {stroke: colours[random(9)], 'stroke-width': random(5) + 1}); + } + else if (shape == 'circle') { + svg.circle(random(300) + 50, random(200) + 50, random(80) + 20, + {fill: colours[random(9)], stroke: colours[random(9)], + 'stroke-width': random(5) + 1}); + } + else if (shape == 'ellipse') { + svg.ellipse(random(300) + 50, random(200) + 50, random(80) + 20, random(80) + 20, + {fill: colours[random(9)], stroke: colours[random(9)], + 'stroke-width': random(5) + 1}); + } + else if (shape == 'clear') { + svg.clear(); + } +} + +function random(range) { + return Math.floor(Math.random() * range); +} +</script> +</head> +<body> +<h1>jQuery SVG Basics</h1> +<p>This page demonstrates the very basics of the <a href="http://keith-wood.name/svg.html">jQuery SVG plugin</a>. + It contains the minimum requirements for using the plugin and + can be used as the basis for your own experimentation.</p> +<p>The page creates an SVG document in the area below and draws an initial display. + The buttons then add randomly sized and coloured shapes on demand.</p> +<p>For more detail see the <a href="http://keith-wood.name/svgRef.html">documentation reference</a> page.</p> +<div id="svgbasics"></div> +<p><button id="rect">Add rectangle</button> <button id="line">Add line</button> + <button id="circle">Add circle</button> <button id="ellipse">Add ellipse</button> + <button id="clear">Clear</button></p> +</body> +</html>
Binary file client/digitallibrary/jquery/ui/images/ui-bg_highlight-soft_75_cccccc_1x100.png has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery-test-embedded.SLIDER.html Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,117 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <title>Digilib jQuery Test: embedded</title> + + <style type="text/css"> + body { + background: silver; + } + + div.digilib { + /* padding for buttons and bird-div */ + padding-right: 18px; + padding-bottom: 100px; + /* width: 220px; */ + } + + td { + vertical-align: top; + } + + #debug { + background-color: beige; + position: absolute; + top: 400px; + padding: 0px 10px; + font-family: Arial; + font-size: 9pt; + } + + div._log { + color: grey; + } + + div._debug { + color: darkgreen; + } + + div._error { + color: red; + } + + div#test:hover { + background-color: cornsilk; + } + + </style> + + <script type="text/javascript" src="jquery-1.4.4.js"></script> + + <script type="text/javascript" src="jquery.ui.core.js"></script> + <script type="text/javascript" src="jquery.ui.mouse.js"></script> + <script type="text/javascript" src="jquery.ui.button.js"></script> + <script type="text/javascript" src="jquery.ui.draggable.js"></script> + <script type="text/javascript" src="jquery.ui.position.js"></script> + <script type="text/javascript" src="jquery.ui.resizable.js"></script> + <script type="text/javascript" src="jquery.ui.widget.js"></script> + <script type="text/javascript" src="jquery.ui.dialog.js"></script> + <script type="text/javascript" src="jquery.ui.slider.js"></script> + + <script type="text/javascript" src="jquery.digilib.js"></script> + <link rel="stylesheet" type="text/css" href="jquery.digilib.css" /> + + + <script type="text/javascript"> + $(document).ready(function(){ + $('div.digilib').digilib({ + interactionMode : 'embedded', + birdDivWidth : 100, + birdDivHeight : 100 + }); + + $('div.digilib').each(function(){ + console.log($(this).data('digilib').settings); + }); + + }); + + </script> + </head> + + <body> + <table> + <tr> + <td> + <div id="digilib-1" class="digilib single"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/&pn=1" /> + </div> + </td> + + <td> + <div id="digilib-2" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/ferrara" /> + </div> + </td> + + <td> + <div id="digilib-3" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/weide" /> + </div> + </td> + + <td> + <div id="digilib-4" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/HansHolbein-NikolausKratzer" /> + </div> + </td> + </tr> + </table> + <div id="debug">DEBUG</div> + <div id="test"> + <img id="test" src="img/black-glass-16.png"></img> + <img id="test2" src="img/black-glass-32.png"></img> + </div> + </body> +</html> +
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery-test-full.SLIDER.html Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,51 @@ +<?xml version="1.0" ?> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <title>Digilib jQuery Test: fullscreen</title> + + <style type="text/css"> + body { + background: silver; + } + + </style> + + <script type="text/javascript" src="jquery-1.4.4.js"></script> + + <script type="text/javascript" src="jquery.ui.core.js"></script> + <script type="text/javascript" src="jquery.ui.widget.js"></script> + <script type="text/javascript" src="jquery.ui.mouse.js"></script> + <script type="text/javascript" src="jquery.ui.button.js"></script> + <script type="text/javascript" src="jquery.ui.draggable.js"></script> + <script type="text/javascript" src="jquery.ui.position.js"></script> + <script type="text/javascript" src="jquery.ui.resizable.js"></script> + <script type="text/javascript" src="jquery.ui.dialog.js"></script> + <script type="text/javascript" src="jquery.ui.slider.js"></script> + + <script type="text/javascript" src="dlGeometry.js"></script> + <script type="text/javascript" src="jquery.cookie.js"></script> + <script type="text/javascript" src="jquery.digilib.js"></script> + <link rel="stylesheet" type="text/css" href="jquery.digilib.css" /> + <link rel="stylesheet" type="text/css" href="jquery-ui-1.8.9.custom.css" /> + + <script type="text/javascript"> + $(document).ready(function(){ + var opts = { + interactionMode : 'fullscreen', + scalerBaseUrl : 'http://digilib.biblhertz.it/digilib04/servlet/Scaler' + }; + $('div.digilib').digilib(opts); + }); + + </script> + </head> + + <body> + + <div id="digilib-1" class="digilib"> + <img src="http://digilib.biblhertz.it/digilib04/servlet/Scaler?dw=200&dh=200&fn=/digisprint/jquery/FransHals-WillemVanHeythuysen" /> + </div> + </body> +</html> +
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery-ui-1.8.9.custom.css Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,573 @@ +/* + * jQuery UI CSS Framework 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* + * jQuery UI Resizable 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.9 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.digilib.SLIDER.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,1613 @@ +/* Copyright (c) 2011 Martin Raspe, Robert Casties + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU Lesser General Public License as published by +the Free Software Foundation, either version 2 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU Lesser General Public License for more details. + +You should have received a copy of the GNU Lesser General Public License +along with this program. If not, see <http://www.gnu.org/licenses/>. + +Authors: + Martin Raspe, Robert Casties, 11.1.2011 +*/ + +/** + * digilib jQuery plugin +**/ + + +/* jslint browser: true, debug: true, forin: true +*/ + +// fallback for console.log calls +if (typeof(console) === 'undefined') { + var console = { + log : function(){}, + debug : function(){}, + error : function(){} + }; + var customConsole = true; +} + +(function($) { + var buttons = { + reference : { + onclick : "reference", + tooltip : "get a reference URL", + img : "reference.png" + }, + zoomin : { + onclick : ["zoomBy", 1.4], + tooltip : "zoom in", + img : "zoom-in.png" + }, + zoomout : { + onclick : ["zoomBy", 0.7], + tooltip : "zoom out", + img : "zoom-out.png" + }, + zoomarea : { + onclick : "zoomArea", + tooltip : "zoom area", + img : "zoom-area.png" + }, + zoomfull : { + onclick : "zoomFull", + tooltip : "view the whole image", + img : "zoom-full.png" + }, + pagewidth : { + onclick : ["zoomFull", "width"], + tooltip : "page width", + img : "pagewidth.png" + }, + back : { + onclick : ["gotoPage", "-1"], + tooltip : "goto previous image", + img : "back.png" + }, + fwd : { + onclick : ["gotoPage", "+1"], + tooltip : "goto next image", + img : "fwd.png" + }, + page : { + onclick : "gotoPage", + tooltip : "goto image number", + img : "page.png" + }, + bird : { + onclick : "showBirdDiv", + tooltip : "show bird's eye view", + img : "birds-eye.png" + }, + help : { + onclick : "showAboutDiv", + tooltip : "about Digilib", + img : "help.png" + }, + reset : { + onclick : "reset", + tooltip : "reset image", + img : "reset.png" + }, + mark : { + onclick : "setMark", + tooltip : "set a mark", + img : "mark.png" + }, + delmark : { + onclick : "removeMark", + tooltip : "delete the last mark", + img : "delmark.png" + }, + hmir : { + onclick : ["mirror", "h"], + tooltip : "mirror horizontally", + img : "mirror-horizontal.png" + }, + vmir : { + onclick : ["mirror", "v"], + tooltip : "mirror vertically", + img : "mirror-vertical.png" + }, + rot : { + onclick : "rotate", + tooltip : "rotate image", + img : "rotate.png" + }, + brgt : { + onclick : "brightness", + tooltip : "set brightness", + img : "brightness.png" + }, + cont : { + onclick : "contrast", + tooltip : "set contrast", + img : "contrast.png" + }, + rgb : { + onclick : "javascript:setParamWin('rgb', '...')", + tooltip : "set rgb values", + img : "rgb.png" + }, + quality : { + onclick : "setQuality", + tooltip : "set image quality", + img : "quality.png" + }, + size : { + onclick : "javascript:toggleSizeMenu()", + tooltip : "set page size", + img : "size.png" + }, + calibrationx : { + onclick : "javascript:calibrate('x')", + tooltip : "calibrate screen x-ratio", + img : "calibration-x.png" + }, + scale : { + onclick : "javascript:toggleScaleMenu()", + tooltip : "change image scale", + img : "original-size.png" + }, + toggleoptions : { + onclick : "moreButtons", + tooltip : "more options", + img : "options.png" + }, + moreoptions : { + onclick : ["moreButtons", "+1"], + tooltip : "more options", + img : "options.png" + }, + lessoptions : { + onclick : ["moreButtons", "-1"], + tooltip : "less options", + img : "options.png" + }, + SEP : { + img : "sep.png" + } + }; + + var defaults = { + // version of this script + 'version' : 'jquery.digilib.js 0.9', + // logo url + 'logoUrl' : '../img/digilib-logo-text1.png', + // homepage url (behind logo) + 'homeUrl' : 'http://digilib.berlios.de', + // base URL to digilib viewer (for reference URLs) + 'digilibBaseUrl' : null, + // base URL to Scaler servlet + 'scalerBaseUrl' : null, + // list of Scaler parameters + 'scalerParamNames' : ['fn','pn','dw','dh','ww','wh','wx','wy','ws','mo', + 'rot','cont','brgt','rgbm','rgba','ddpi','ddpix','ddpiy'], + // Scaler parameter defaults + 'pn' : 1, + 'ww' : 1.0, + 'wh' : 1.0, + 'wx' : 0.0, + 'wy' : 0.0, + 'ws' : 1.0, + 'mo' : '', + 'rot' : 0, + 'cont' : 0, + 'brgt' : 0, + 'rgbm' : '0/0/0', + 'rgba' : '0/0/0', + 'ddpi' : null, + 'ddpix' : null, + 'ddpiy' : null, + // list of digilib parameters + 'digilibParamNames' : ['fn','pn','ww','wh','wx','wy','ws','mo','rot','cont','brgt','rgbm','rgba','mk','clop'], + // digilib parameter defaults + 'mk' : '', + 'clop' : '', + // mode of operation: + // fullscreen = take parameters from page URL, keep state in page URL + // embedded = take parameters from Javascript options, keep state inside object + 'interactionMode' : 'fullscreen', + // buttons + 'buttons' : buttons, + // defaults for digilib buttons + 'buttonSettings' : { + 'fullscreen' : { + // path to button images (must end with a slash) + 'imagePath' : 'img/fullscreen/', + 'standardSet' : ["reference","zoomin","zoomout","zoomarea","zoomfull","pagewidth","back","fwd","page","bird","help","reset","toggleoptions"], + 'specialSet' : ["mark","delmark","hmir","vmir","rot","brgt","cont","rgb","quality","size","calibrationx","scale","toggleoptions"], + 'buttonSets' : ['standardSet', 'specialSet'] + }, + 'embedded' : { + 'imagePath' : 'img/embedded/16/', + 'standardSet' : ["reference","zoomin","zoomout","zoomarea","zoomfull","bird","help","reset","toggleoptions"], + 'specialSet' : ["mark","delmark","hmir","vmir","rot","brgt","cont","rgb","quality","toggleoptions"], + 'buttonSets' : ['standardSet', 'specialSet'] + } + }, + // number of visible button groups + 'visibleButtonSets' : 1, + // is birdView shown? + 'isBirdDivVisible' : false, + // dimensions of bird's eye div + 'birdDivWidth' : 200, + 'birdDivHeight' : 200, + // parameters used by bird's eye div + 'birdDivParams' : ['fn','pn','dw','dh'], + // style of the zoom area indicator in the bird's eye div + 'birdIndicatorStyle' : {'border' : '2px solid #ff0000' }, + // style of zoom area "rubber band" + 'zoomrectStyle' : {'border' : '2px solid #ff0000' }, + // is the "about" window shown? + 'isAboutDivVisible' : false, + // maximum width of background image for drag-scroll + 'maxBgSize' : 10000 + + }; + + // affine geometry classes + var geom = dlGeometry(); + + var FULL_AREA = geom.rectangle(0, 0, 1, 1); + + var actions = { + // init: digilib initialization + init : function(options) { + // settings for this digilib instance are merged from defaults and options + var settings = $.extend({}, defaults, options); + var isFullscreen = settings.interactionMode === 'fullscreen'; + var queryParams = {}; + if (isFullscreen) { + queryParams = parseQueryParams(); + // check scalerBaseUrl + if (settings.scalerBaseUrl == null) { + // try the host this came from + var h = window.location.host; + if (window.location.host) { + var url = window.location.href; + // assume the page lives in [webapp]/jquery/ + var pos = url.indexOf('jquery/'); + if (pos > 0) { + settings.scalerBaseUrl = url.substring(0, pos) + 'servlet/Scaler'; + } + } + } + } + return this.each(function() { + var $elem = $(this); + var data = $elem.data('digilib'); + var params, elemSettings; + // if the plugin hasn't been initialized yet + if (!data) { + // merge query parameters + if (isFullscreen) { + params = queryParams; + } else { + params = parseImgParams($elem); + if (jQuery.cookie) { + // retrieve params from cookie + var ck = "digilib-embed:fn:" + escape(params.fn) + ":pn:" + (params.pn || '1'); + var cs = jQuery.cookie(ck); + console.debug("get cookie=", ck, " value=", cs); + if (cs) { + var cp = parseQueryString(cs); + // ignore fn and pn from cookie TODO: should we keep pn? + delete cp.fn; + delete cp.pn; + jQuery.extend(params, cp); + } + } + } + // store $(this) element in the settings + elemSettings = jQuery.extend({}, settings, params); + data = { + $elem : $elem, + settings : elemSettings, + queryParams : params + }; + // store in data element + $elem.data('digilib', data); + } + unpackParams(data); + // check if browser knows *background-size + for (var bs in {'':1, '-moz-':1, '-webkit-':1, '-o-':1}) { + if ($elem.css(bs+'background-size')) { + data.hasBgSize = true; + data.bgSizeName = bs+'background-size'; + break; + } + } + // check digilib base URL + if (elemSettings.digilibBaseUrl == null) { + if (isFullscreen) { + // take current host + var url = window.location.toString(); + var pos = url.indexOf('?'); + elemSettings.digilibBaseUrl = url.substring(0, pos); + } else { + var url = elemSettings.scalerBaseUrl; + if (url) { + // build it from scaler URL + var bp = url.indexOf('/servlet/Scaler'); + elemSettings.digilibBaseUrl = url.substring(0, bp) + '/digilib.jsp'; + } + } + } + // create HTML structure for scaler + setupScalerDiv(data); + // add buttons + for (var i = 0; i < elemSettings.visibleButtonSets; ++i) { + showButtons(data, true, i); + } + // bird's eye view creation + if (elemSettings.isBirdDivVisible) { + setupBirdDiv(data); + data.$birdDiv.show(); + } + // about window creation - TODO: could be deferred? restrict to only one item? + setupAboutDiv(data); + // drag zoom area around in scaler div + setupZoomDrag(data); + // dialog for brightness, rotate etc. + setupDialogDiv(data); + }); + }, + + // destroy: clean up digilib + destroy : function(data) { + return this.each(function(){ + var $elem = $(this); + $(window).unbind('.digilib'); // unbind all digilibs(?) + data.digilib.remove(); + $elem.removeData('digilib'); + }); + }, + + // show or hide the 'about' window + showAboutDiv : function(data, show) { + data.settings.isAboutDivVisible = showDiv(data.settings.isAboutDivVisible, data.$aboutDiv, show); + }, + + // event handler: toggles the visibility of the bird's eye window + showBirdDiv : function (data, show) { + var settings = data.settings; + if (data.$birdDiv == null) { + // no bird div -> create + setupBirdDiv(data); + } + settings.isBirdDivVisible = showDiv(settings.isBirdDivVisible, data.$birdDiv, show); + updateBirdDiv(data); + storeOptions(data); + // data.$birdImg.triggerHandler('load'); // TODO: we shouldn't do that + }, + + // goto given page nr (+/-: relative) + gotoPage : function (data, pageNr) { + var settings = data.settings; + var oldpn = settings.pn; + if (pageNr == null) { + pageNr = window.prompt("Goto page number", oldpn); + } + var pn = setNumValue(settings, "pn", pageNr); + if (pn == null) return false; // nothing happened + if (pn < 1) { + alert("no such page (page number too low)"); + settings.pn = oldpn; + return false; + } + if (settings.pt) { + if (pn > settings.pt) { + alert("no such page (page number too high)"); + settings.pn = oldpn; + return false; + } + } + // reset mk and others(?) + data.marks = []; + data.zoomArea = FULL_AREA; + // then reload + redisplay(data); + }, + + // zoom by a given factor + zoomBy : function (data, factor) { + zoomBy(data, factor); + }, + + // zoom interactively + zoomArea : function (data) { + zoomArea(data); + }, + + // zoom out to full page + zoomFull : function (data, mode) { + data.zoomArea = FULL_AREA; + if (mode === 'width') { + data.dlOpts.fitwidth = 1; + delete data.dlOpts.fitheight; + } else if (mode === 'height') { + data.dlOpts.fitheight = 1; + delete data.dlOpts.fitwidth; + } else { + delete data.dlOpts.fitwidth; + delete data.dlOpts.fitheight; + } + redisplay(data); + }, + + // set a mark by clicking (or giving a position) + setMark : function (data, mpos) { + if (mpos == null) { + // interactive + setMark(data); + } else { + // use position + data.marks.push(pos); + redisplay(data); + } + }, + + // remove the last mark + removeMark : function (data) { + data.marks.pop(); + redisplay(data); + }, + + // mirror the image + mirror : function (data, mode) { + var flags = data.scalerFlags; + if (mode === 'h') { + if (flags.hmir) { + delete flags.hmir; + } else { + flags.hmir = 1; + } + } else { + if (flags.vmir) { + delete flags.vmir; + } else { + flags.vmir = 1; + } + } + redisplay(data); + }, + + // rotate the image + rotate : function (data, angle) { + var rot = data.settings.rot; + if (angle == null) { + // angle = window.prompt("Rotation angle:", rot); + var $slider = data.$slider; + $slider.slider('enable'); + var $dialog = data.$dialog; + $dialog.text('Set the slider'); + $dialog.dialog('option', { + 'title' : 'set rotation angle', + }); + $dialog.dialog('open'); + } + //data.settings.rot = angle; + //redisplay(data); + }, + + // change brightness + brightness : function (data, factor) { + var brgt = data.settings.brgt; + if (factor == null) { + factor = window.prompt("Brightness (-255..255)", brgt); + } + data.settings.brgt = factor; + redisplay(data); + }, + + // change contrast + contrast : function (data, factor) { + var cont = data.settings.cont; + if (factor == null) { + factor = window.prompt("Contrast (-8, 8)", cont); + } + data.settings.cont = factor; + redisplay(data); + }, + + // display more (or less) button sets + moreButtons : function (data, more) { + var settings = data.settings; + if (more == null) { + // toggle more or less (only works for 2 sets) + var maxbtns = settings.buttonSettings[settings.interactionMode].buttonSets.length; + if (settings.visibleButtonSets >= maxbtns) { + more = '-1'; + } else { + more = '+1'; + } + } + if (more === '-1') { + // remove set + var setIdx = settings.visibleButtonSets - 1; + if (showButtons(data, false, setIdx, true)) { + settings.visibleButtonSets--; + } + } else { + // add set + var setIdx = settings.visibleButtonSets; + if (showButtons(data, true, setIdx, true)) { + settings.visibleButtonSets++; + } + } + // persist setting + storeOptions(data); + }, + + // reset image parameters to defaults + reset : function (data) { + var settings = data.settings; + var paramNames = settings.digilibParamNames; + var params = data.queryParams; + // delete all digilib parameters + for (var i = 0; i < paramNames.length; i++) { + var paramName = paramNames[i]; + delete settings[paramName]; + } + settings.fn = params.fn || ''; // no default defined + settings.pn = params.pn || defaults.pn; + settings.dw = params.dw; + settings.dh = params.dh; + settings.isBirdDivVisible = false; + settings.visibleButtonSets = 1; + // resets zoomArea, marks, scalerflags + data.zoomArea = FULL_AREA; + data.marks = []; + data.scalerFlags = {}; + delete data.dlOpts.fitwidth; + delete data.dlOpts.fitheight; + redisplay(data); + }, + + // presents a reference url (returns value if noprompt) + reference : function (data, noprompt) { + var settings = data.settings; + var url = getDigilibUrl(data); + if (noprompt == null) { + window.prompt("URL reference to the current view", url); + } + return url; + }, + + // set image quality + setQuality : function (data, qual) { + var oldq = getQuality(data); + if (qual == null) { + qual = window.prompt("Image quality (0..2)", oldq); + } + qual = parseInt(qual, 10); + if (qual >= 0 && qual <= 2) { + setQuality(data, qual); + redisplay(data); + } + } + }; + + // returns parameters from page url + var parseQueryParams = function() { + return parseQueryString(window.location.search.slice(1)); + }; + + // returns parameters from embedded img-element + var parseImgParams = function($elem) { + var src = $elem.find('img').first().attr('src'); + if (!src) return null; + var pos = src.indexOf('?'); + var query = (pos < 0) ? '' : src.substring(pos + 1); + var scalerUrl = src.substring(0, pos); + var params = parseQueryString(query); + params.scalerBaseUrl = scalerUrl; + return params; + }; + + // parses query parameter string into parameter object + var parseQueryString = function(query) { + var params = {}; + if (query == null) return params; + var pairs = query.split("&"); + //var keys = []; + for (var i = 0; i < pairs.length; i++) { + var pair = pairs[i].split("="); + if (pair.length === 2) { + params[pair[0]] = pair[1]; + //keys.push(pair[0]); + } + } + return params; + }; + + // returns a query string from key names from a parameter hash (ignoring if the same value is in defaults) + var getParamString = function (settings, keys, defaults) { + var paramString = ''; + var nx = false; + for (i = 0; i < keys.length; ++i) { + var key = keys[i]; + if ((settings[key] != null) && ((defaults == null) || (settings[key] != defaults[key]))) { + // first param gets no '&' + if (nx) { + paramString += '&'; + } else { + nx = true; + } + // add parm=val + paramString += key + '=' + settings[key]; + } + } + return paramString; + }; + + // returns URL and query string for Scaler + var getScalerUrl = function (data) { + packParams(data); + var settings = data.settings; + if (settings.scalerBaseUrl == null) { + alert("ERROR: URL of digilib Scaler servlet missing!"); + } + var keys = settings.scalerParamNames; + var queryString = getParamString(settings, keys, defaults); + var url = settings.scalerBaseUrl + '?' + queryString; + return url; + }; + + // returns URL for bird's eye view image + var getBirdImgUrl = function (data, moreParams) { + var settings = data.settings; + var birdDivOptions = { + dw : settings.birdDivWidth, + dh : settings.birdDivHeight + }; + var birdSettings = jQuery.extend({}, settings, birdDivOptions); + // use only the relevant parameters + if (moreParams == null) { + var params = getParamString(birdSettings, settings.birdDivParams, defaults); + } else { + var params = getParamString(birdSettings, + settings.birdDivParams.concat(moreParams), defaults); + } + var url = settings.scalerBaseUrl + '?' + params; + return url; + }; + + // returns URL and query string for current digilib + var getDigilibUrl = function (data) { + packParams(data); + var settings = data.settings; + var queryString = getParamString(settings, settings.digilibParamNames, defaults); + return settings.digilibBaseUrl + '?' + queryString; + }; + + // processes some parameters into objects and stuff + var unpackParams = function (data) { + var settings = data.settings; + // zoom area + var zoomArea = geom.rectangle(settings.wx, settings.wy, settings.ww, settings.wh); + data.zoomArea = zoomArea; + // marks + var marks = []; + if (settings.mk) { + var mk = settings.mk; + if (mk.indexOf(";") >= 0) { + var pa = mk.split(";"); // old format with ";" + } else { + var pa = mk.split(","); // new format + } + for (var i = 0; i < pa.length ; i++) { + var pos = pa[i].split("/"); + if (pos.length > 1) { + marks.push(geom.position(pos[0], pos[1])); + } + } + } + data.marks = marks; + // mo (Scaler flags) + var flags = {}; + if (settings.mo) { + var pa = settings.mo.split(","); + for (var i = 0; i < pa.length ; i++) { + flags[pa[i]] = pa[i]; + } + } + data.scalerFlags = flags; + retrieveOptions(data); + }; + + // put objects back into parameters + var packParams = function (data) { + var settings = data.settings; + // zoom area + if (data.zoomArea) { + settings.wx = cropFloat(data.zoomArea.x); + settings.wy = cropFloat(data.zoomArea.y); + settings.ww = cropFloat(data.zoomArea.width); + settings.wh = cropFloat(data.zoomArea.height); + } + // marks + if (data.marks) { + settings.mk = ''; + for (var i = 0; i < data.marks.length; i++) { + if (i) { + settings.mk += ','; + } + settings.mk += cropFloat(data.marks[i].x).toString() + + '/' + cropFloat(data.marks[i].y).toString(); + } + } + // Scaler flags + if (data.scalerFlags) { + var mo = ''; + for (var f in data.scalerFlags) { + if (mo) { + mo += ','; + } + mo += f; + } + settings.mo = mo; + } + // user interface options + storeOptions(data); + }; + + var storeOptions = function (data) { + // save digilib options in cookie + var settings = data.settings; + if (data.dlOpts) { + // save digilib settings in options + data.dlOpts.birdview = settings.isBirdDivVisible ? 1 : 0; + data.dlOpts.buttons = settings.visibleButtonSets; + var clop = ''; + for (var o in data.dlOpts) { + if (clop) { + clop += '&'; + } + clop += o + '=' + data.dlOpts[o]; + } + if (jQuery.cookie) { + var ck = "digilib:fn:" + escape(settings.fn) + ":pn:" + settings.pn; + console.debug("set cookie=", ck, " value=", clop); + jQuery.cookie(ck, clop); + } + } + if (settings.interactionMode !== 'fullscreen' && jQuery.cookie) { + // store normal parameters in cookie for embedded mode + var qs = getParamString(settings, settings.digilibParamNames, defaults); + var ck = "digilib-embed:fn:" + escape(settings.fn) + ":pn:" + settings.pn; + console.debug("set cookie=", ck, " value=", qs); + jQuery.cookie(ck, qs); + } + }; + + var retrieveOptions = function (data) { + // clop (digilib options) + var opts = {}; + var settings = data.settings; + if (jQuery.cookie) { + // read from cookie + var ck = "digilib:fn:" + escape(settings.fn) + ":pn:" + settings.pn; + var cp = jQuery.cookie(ck); + console.debug("get cookie=", ck, " value=", cp); + // in query string format + opts = parseQueryString(cp); + } + data.dlOpts = opts; + // birdview option + if (opts.birdview != null) { + settings.isBirdDivVisible = opts.birdview === '1'; + } + // visible button sets + if (opts.buttons != null) { + settings.visibleButtonSets = opts.buttons; + } + }; + + // (re)load the img from a new scaler URL + var redisplay = function (data) { + var settings = data.settings; + if (settings.interactionMode === 'fullscreen') { + // update location.href (browser URL) in fullscreen mode + var url = getDigilibUrl(data); + var history = window.history; + if (typeof(history.pushState) === 'function') { + console.debug("we could modify history, but we don't..."); + } + window.location = url; + } else { + // embedded mode -- just change img src + var url = getScalerUrl(data); + data.$img.attr('src', url); + // redisplay bird img + updateBirdDiv(data); + } + }; + + // returns maximum size for scaler img in fullscreen mode + var getFullscreenImgSize = function($elem) { + var $win = $(window); + var winH = $win.height(); + var winW = $win.width(); + // TODO: account for borders? + return geom.size(winW, winH); + }; + + // creates HTML structure for digilib in elem + var setupScalerDiv = function (data) { + var settings = data.settings; + var $elem = data.$elem; + $elem.addClass('digilib'); + var $img; + var scalerUrl; + if (settings.interactionMode === 'fullscreen') { + // fullscreen + $elem.addClass('dl_fullscreen'); + var imgSize = getFullscreenImgSize($elem); + // fitwidth/height omits destination height/width + if (data.dlOpts.fitheight == null) { + settings.dw = imgSize.width; + } + if (data.dlOpts.fitwidth == null) { + settings.dh = imgSize.height; + } + scalerUrl = getScalerUrl(data); + $img = $('<img/>'); + } else { + // embedded mode -- try to keep img tag + $elem.addClass('dl_embedded'); + scalerUrl = getScalerUrl(data); + $img = $elem.find('img'); + if ($img.length > 0) { + oldUrl = $img.attr('src'); + if (oldUrl === scalerUrl) { + console.debug("img detach:", $img); + $img.detach(); + } else { + $img = $('<img/>'); + } + } else { + $img = $('<img/>'); + } + } + // create new html + $elem.empty(); // TODO: should we keep stuff for customization? + var $scaler = $('<div class="scaler"/>'); + $elem.append($scaler); + $scaler.append($img); + $img.addClass('pic'); + data.$scaler = $scaler; + data.$img = $img; + // setup image load handler before setting the src attribute (IE bug) + $img.load(scalerImgLoadedHandler(data)); + $img.attr('src', scalerUrl); + }; + + // creates HTML structure for buttons in elem + var createButtons = function (data, buttonSetIdx) { + var $elem = data.$elem; + var settings = data.settings; + var mode = settings.interactionMode; + var buttonSettings = settings.buttonSettings[mode]; + var buttonGroup = buttonSettings.buttonSets[buttonSetIdx]; + if (buttonGroup == null) { + // no buttons here + return; + } + var $buttonsDiv = $('<div class="buttons"/>'); + var buttonNames = buttonSettings[buttonGroup]; + for (var i = 0; i < buttonNames.length; i++) { + var buttonName = buttonNames[i]; + var buttonConfig = settings.buttons[buttonName]; + // construct the button html + var $button = $('<div class="button"></div>'); + var $a = $('<a/>'); + var $img = $('<img class="button"/>'); + $buttonsDiv.append($button); + $button.append($a); + $a.append($img); + // add attributes and bindings + $button.attr('title', buttonConfig.tooltip); + $button.addClass('button-' + buttonName); + // create handler for the buttons + $a.bind('click.digilib', (function () { + // we create a new closure to capture the value of action + var action = buttonConfig.onclick; + if ($.isArray(action)) { + // the handler function calls digilib with action and parameters + return function (evt) { + console.debug('click action=', action, ' evt=', evt); + $elem.digilib.apply($elem, action); + return false; + }; + } else { + // the handler function calls digilib with action + return function (evt) { + console.debug('click action=', action, ' evt=', evt); + $elem.digilib(action); + return false; + }; + } + })()); + $img.attr('src', buttonSettings.imagePath + buttonConfig.img); + } + // make buttons div scroll if too large for window + if ($buttonsDiv.height() > $(window).height() - 10) { + $buttonsDiv.css('position', 'absolute'); + } + // buttons hidden at first + $buttonsDiv.hide(); + $elem.append($buttonsDiv); + if (data.$buttonSets == null) { + // first button set + data.$buttonSets = [$buttonsDiv]; + } else { + $elem.append($buttonsDiv); + data.$buttonSets[buttonSetIdx] = $buttonsDiv; + } + return $buttonsDiv; + }; + + // creates HTML structure for the bird's eye view in elem + var setupBirdDiv = function (data) { + var $elem = data.$elem; + // the bird's eye div + var $birdDiv = $('<div class="birdview" style="display:none"/>'); + // the detail indicator frame + var $birdZoom = $('<div class="birdzoom" style="display:none; background-color:transparent;"/>'); + // the small image + var $birdImg = $('<img class="birdimg"/>'); + data.$birdDiv = $birdDiv; + data.$birdZoom = $birdZoom; + data.$birdImg = $birdImg; + $elem.append($birdDiv); + $birdDiv.append($birdZoom); + $birdDiv.append($birdImg); + $birdZoom.css(data.settings.birdIndicatorStyle); + var birdUrl = getBirdImgUrl(data); + $birdImg.load(birdImgLoadedHandler(data)); + $birdImg.attr('src', birdUrl); + }; + + // update bird's eye view + var updateBirdDiv = function (data) { + if (!data.settings.isBirdDivVisible) return; + var $birdImg = data.$birdImg; + var oldsrc = $birdImg.attr('src'); + var newsrc = getBirdImgUrl(data); + if (oldsrc !== newsrc) { + $birdImg.attr('src', newsrc); + // onload handler re-renders + } else { + // re-render + renderBirdArea(data); + // enable click and drag + setupBirdDrag(data); + } + }; + + // creates HTML structure for the dialog + var setupDialogDiv = function (data) { + var $elem = data.$elem; + var settings = data.settings; + var $dialogDiv = $('<div/>'); + var $sliderDiv = $('<div/>'); + $dialogDiv.append($sliderDiv); + $dialogDiv.dialog({ + 'autoOpen' : false, + 'buttons': { + "Ok": function() { + $(this).dialog("close"); + }, + "Cancel": function() { + $(this).dialog("close"); + } + } + }); + $sliderDiv.slider({ + 'range' : true, + 'min' : 0, + 'max' : 500, + 'values' : [ 75, 300 ] + }); + data.$dialog = $dialogDiv; + data.$slider = $sliderDiv; + }; + + // creates HTML structure for the about view in elem + var setupAboutDiv = function (data) { + var $elem = data.$elem; + var settings = data.settings; + var $aboutDiv = $('<div class="about" style="display:none"/>'); + var $header = $('<p>Digilib Graphic Viewer</p>'); + var $link = $('<a/>'); + var $logo = $('<img class="logo" title="digilib"/>'); + var $content = $('<p/>'); + $elem.append($aboutDiv); + $aboutDiv.append($header); + $aboutDiv.append($link); + $aboutDiv.append($content); + $link.append($logo); + $logo.attr('src', settings.logoUrl); + $link.attr('href', settings.homeUrl); + $content.text('Version: ' + settings.version); + // click hides + $aboutDiv.bind('click.digilib', function () { + settings.isAboutDivVisible = showDiv(settings.isAboutDivVisible, $aboutDiv, 0); + return false; + }); + data.$aboutDiv = $aboutDiv; + }; + + // shows some window e.g. 'about' (toggle visibility if show is null) + var showDiv = function (isVisible, $div, show) { + if (show == null) { + // toggle visibility + isVisible = !isVisible; + } else { + // set visibility + isVisible = show; + } + if (isVisible) { + $div.fadeIn(); + } else { + $div.fadeOut(); + } + return isVisible; + }; + + // display more (or less) button sets + var showButtons = function (data, more, setIdx, animated) { + var atime = animated ? 'fast': 0; + if (more) { + // add set + var $otherSets = data.$elem.find('div.buttons:visible'); + var $set; + if (data.$buttonSets && data.$buttonSets[setIdx]) { + // set exists + $set = data.$buttonSets[setIdx]; + } else { + $set = createButtons(data, setIdx); + } + if ($set == null) return false; + var btnWidth = $set.width(); + // move remaining sets left and show new set + if ($otherSets.length > 0) { + $otherSets.animate({right : '+='+btnWidth+'px'}, atime, + function () {$set.show();}); + } else { + $set.show(); + } + } else { + // remove set + var $set = data.$buttonSets[setIdx]; + if ($set == null) return false; + var btnWidth = $set.width(); + // hide last set + $set.hide(); + // take remaining sets and move right + var $otherSets = data.$elem.find('div.buttons:visible'); + $otherSets.animate({right : '-='+btnWidth+'px'}, atime); + } + return true; + }; + + // create Transform from area and $img + var getImgTrafo = function ($img, area, rot, hmir, vmir) { + var picrect = geom.rectangle($img); + var trafo = geom.transform(); + // move zoom area offset to center + trafo.concat(trafo.getTranslation(geom.position(-area.x, -area.y))); + // scale zoom area size to [1,1] + trafo.concat(trafo.getScale(geom.size(1/area.width, 1/area.height))); + // rotate and mirror (around transformed image center i.e. [0.5,0.5]) + if (rot || hmir || vmir) { + // move [0.5,0.5] to center + trafo.concat(trafo.getTranslation(geom.position(-0.5, -0.5))); + if (hmir) { + // mirror about center + trafo.concat(trafo.getMirror('y')); + } + if (vmir) { + // mirror about center + trafo.concat(trafo.getMirror('x')); + } + if (rot) { + // rotate around center + trafo.concat(trafo.getRotation(parseFloat(rot))); + } + // move back + trafo.concat(trafo.getTranslation(geom.position(0.5, 0.5))); + } + // scale to screen position and size + trafo.concat(trafo.getScale(picrect)); + trafo.concat(trafo.getTranslation(picrect)); + return trafo; + }; + + // returns function for load event of scaler img + var scalerImgLoadedHandler = function (data) { + return function () { + var $img = $(this); + var $scaler = data.$scaler; + // create Transform from current area and picsize + data.imgTrafo = getImgTrafo($img, data.zoomArea, + data.settings.rot, data.scalerFlags.hmir, data.scalerFlags.vmir); + console.debug("imgTrafo=", data.imgTrafo); + // adjust scaler div size + var imgRect = geom.rectangle($img); + console.debug("imgrect=", imgRect); + imgRect.adjustDiv($scaler); + // show image in case it was hidden (for example in zoomDrag) + $img.css('visibility', 'visible'); + $scaler.css({'opacity' : '1', 'background-image' : 'none'}); + // display marks + renderMarks(data); + // enable drag-to-scroll + setupZoomDrag(data); + // TODO: digilib.showArrows(); // show arrow overlays for zoom navigation + }; + }; + + // returns function for load event of bird's eye view img + var birdImgLoadedHandler = function (data) { + return function () { + var $img = $(this); + console.debug("birdimg loaded! this=", this, " data=", data); + // create Transform from current area and picsize + data.birdTrafo = getImgTrafo($img, FULL_AREA); + // display red indicator around zoomarea + renderBirdArea(data); + // enable click and drag + setupBirdDrag(data); + }; + }; + + // place marks on the image + var renderMarks = function (data) { + var $elem = data.$elem; + var marks = data.marks; + // clear marks + $elem.find('div.mark').remove(); + for (var i = 0; i < marks.length; i++) { + var mark = marks[i]; + if (data.zoomArea.containsPosition(mark)) { + var mpos = data.imgTrafo.transform(mark); + console.debug("renderMarks: mpos=",mpos); + // create mark + var html = '<div class="mark">'+(i+1)+'</div>'; + var $mark = $(html); + $elem.append($mark); + mpos.adjustDiv($mark); + } + } + }; + + // show zoom area indicator on bird's eye view + var renderBirdArea = function (data) { + var $birdZoom = data.$birdZoom; + var zoomArea = data.zoomArea; + var normalSize = isFullArea(zoomArea); + if (normalSize) { + $birdZoom.hide(); + return; + } else { + $birdZoom.show(); + } + // position may have changed + data.birdTrafo = getImgTrafo(data.$birdImg, FULL_AREA); + var zoomRect = data.birdTrafo.transform(zoomArea); + // acount for border width + zoomRect.addPosition({x : -2, y : -2}); + if (data.settings.interactionMode === 'fullscreen') { + // no animation for fullscreen + zoomRect.adjustDiv($birdZoom); + } else { + // nice animation for embedded mode :-) + // correct offsetParent because animate doesn't use offset + var ppos = $birdZoom.offsetParent().offset(); + var dest = { + left : (zoomRect.x - ppos.left) + 'px', + top : (zoomRect.y - ppos.top) + 'px', + width : zoomRect.width, + height : zoomRect.height}; + $birdZoom.animate(dest); + } + }; + + // zooms by the given factor + var zoomBy = function(data, factor) { + var area = data.zoomArea; + var newarea = area.copy(); + // scale + newarea.width /= factor; + newarea.height /= factor; + // and recenter + newarea.x -= 0.5 * (newarea.width - area.width); + newarea.y -= 0.5 * (newarea.height - area.height); + newarea = FULL_AREA.fit(newarea); + data.zoomArea = newarea; + redisplay(data); + }; + + // add a mark where clicked + var setMark = function (data) { + var $scaler = data.$scaler; + // unbind other handler + $scaler.unbind(".dlZoomDrag"); + // start event capturing + $scaler.one('mousedown.dlSetMark', function (evt) { + // event handler adding a new mark + console.log("setmark at=", evt); + var mpos = geom.position(evt); + var pos = data.imgTrafo.invtransform(mpos); + data.marks.push(pos); + redisplay(data); + return false; + }); + }; + + // zoom to the area around two clicked points + var zoomArea = function(data) { + $elem = data.$elem; + $scaler = data.$scaler; + var pt1, pt2; + var $zoomDiv = $('<div class="zoomrect" style="display:none"/>'); + $elem.append($zoomDiv); + $zoomDiv.css(data.settings.zoomrectStyle); + var picRect = geom.rectangle($scaler); + // FIX ME: is there a way to query the border width from CSS info? + // rect.x -= 2; // account for overlay borders + // rect.y -= 2; + + var zoomStart = function (evt) { + pt1 = geom.position(evt); + // setup and show zoom div + pt1.adjustDiv($zoomDiv); + $zoomDiv.width(0).height(0); + $zoomDiv.show(); + // register events + $elem.bind("mousemove.dlZoomArea", zoomMove); + $elem.bind("mouseup.dlZoomArea", zoomEnd); + return false; + }; + + // mouse move handler + var zoomMove = function (evt) { + pt2 = geom.position(evt); + var rect = geom.rectangle(pt1, pt2); + rect.clipTo(picRect); + // update zoom div + rect.adjustDiv($zoomDiv); + return false; + }; + + // mouseup handler: end moving + var zoomEnd = function (evt) { + pt2 = geom.position(evt); + // assume a click and continue if the area is too small + var clickRect = geom.rectangle(pt1, pt2); + if (clickRect.getArea() <= 5) return false; + // hide zoom div + $zoomDiv.remove(); + // unregister events + $elem.unbind("mousemove.dlZoomArea", zoomMove); + $elem.unbind("mouseup.dlZoomArea", zoomEnd); + // clip and transform + clickRect.clipTo(picRect); + var area = data.imgTrafo.invtransform(clickRect); + data.zoomArea = area; + // zoomed is always fit + data.settings.ws = 1; + delete data.dlOpts.fitwidth; + delete data.dlOpts.fitheight; + redisplay(data); + return false; + }; + + // clear old handler (also ZoomDrag) + $scaler.unbind('.dlZoomArea'); + $scaler.unbind(".dlZoomDrag"); + $elem.unbind('.dlZoomArea'); + // bind start zoom handler + $scaler.one('mousedown.dlZoomArea', zoomStart); + }; + + // bird's eye view zoom area click and drag handler + var setupBirdDrag = function(data) { + var $birdImg = data.$birdImg; + var $birdZoom = data.$birdZoom; + var $document = $(document); + var $scaler = data.$scaler; + var startPos, newRect, birdImgRect, birdZoomRect, fullRect, scalerPos; + + // mousedown handler: start dragging bird zoom to a new position + var birdZoomStartDrag = function(evt) { + startPos = geom.position(evt); + // position may have changed + data.birdTrafo = getImgTrafo($birdImg, FULL_AREA); + birdImgRect = geom.rectangle($birdImg); + birdZoomRect = geom.rectangle($birdZoom); + scalerPos = geom.position($scaler); + newRect = null; + fullRect = setZoomBG(data); // setup zoom background image + $document.bind("mousemove.dlBirdMove", birdZoomMove); + $document.bind("mouseup.dlBirdMove", birdZoomEndDrag); + return false; + }; + + // mousemove handler: drag + var birdZoomMove = function(evt) { + var pos = geom.position(evt); + var delta = startPos.delta(pos); + // move birdZoom div, keeping size + newRect = birdZoomRect.copy(); + newRect.addPosition(delta); + newRect.stayInside(birdImgRect); + // reflect birdview zoom position in scaler image + var area = data.birdTrafo.invtransform(newRect); + var imgArea = data.imgTrafo.transform(area); + var offset = imgArea.getPosition().neg(); + offset.add(scalerPos); + console.log('offset', offset); + if (fullRect) { + var bgPos = fullRect.getPosition().add(offset); + } else { + var bgPos = offset; + } + // move the background image to the new position + data.$scaler.css({ + 'background-position' : bgPos.x + "px " + bgPos.y + "px" + }); + // acount for border width + newRect.addPosition({x : -2, y : -2}); + newRect.adjustDiv($birdZoom); + return false; + }; + + // mouseup handler: reload page + var birdZoomEndDrag = function(evt) { + var settings = data.settings; + $document.unbind("mousemove.dlBirdMove", birdZoomMove); + $document.unbind("mouseup.dlBirdMove", birdZoomEndDrag); + if (newRect == null) { + // no movement happened - set center to click position + startPos = birdZoomRect.getCenter(); + birdZoomMove(evt); + } + // ugly, but needed to prevent double border width compensation + newRect.addPosition({x : +2, y : +2}); + var newArea = data.birdTrafo.invtransform(newRect); + data.zoomArea = newArea; + redisplay(data); + return false; + }; + + // clear old handler + $document.unbind(".dlBirdMove"); + $birdImg.unbind(".dlBirdMove"); + $birdZoom.unbind(".dlBirdMove"); + if (! isFullArea(data.zoomArea)) { + // set new handler + $birdImg.bind("mousedown.dlBirdMove", birdZoomStartDrag); + $birdZoom.bind("mousedown.dlBirdMove", birdZoomStartDrag); + } + }; + + // move bird zoom indicator to reflect zoomed detail area + var setBirdZoom = function(data, rect) { + var part = data.imgTrafo.invtransform(rect); + // area = FULL_AREA.fit(part); // no, we want to see where we transcend the borders + birdTrafo = getImgTrafo(data.$birdImg, FULL_AREA); + var birdRect = birdTrafo.transform(part); + // acount for border width + birdRect.addPosition({x : -2, y : -2}); + birdRect.adjustDiv(data.$birdZoom); + }; + + // set zoom background + var setZoomBG = function(data) { + var $scaler = data.$scaler; + var $img = data.$img; + var fullRect = null; + // hide the scaler img, show background of div instead + $img.css('visibility', 'hidden'); + var scalerCss = { + 'background-image' : 'url(' + $img.attr('src') + ')', + 'background-repeat' : 'no-repeat', + 'background-position' : 'left top', + 'opacity' : '0.5', + 'cursor' : 'move' + }; + if (data.hasBgSize) { + // full-size background using CSS3-background-size + fullRect = data.imgTrafo.transform(FULL_AREA); + if (fullRect.height < data.settings.maxBgSize && fullRect.width < data.settings.maxBgSize) { + // correct offset because background is relative + var scalerPos = geom.position($scaler); + fullRect.addPosition(scalerPos.neg()); + var url = getBirdImgUrl(data, ['rot', 'mo']); + scalerCss['background-image'] = 'url(' + url + ')'; + scalerCss[data.bgSizeName] = fullRect.width + 'px ' + fullRect.height + 'px'; + scalerCss['background-position'] = fullRect.x + 'px '+ fullRect.y + 'px'; + } else { + // too big + fullRect = null; + } + } + $scaler.css(scalerCss); + // isBgReady = true; + return fullRect; + }; + + // setup handlers for dragging the zoomed image + var setupZoomDrag = function(data) { + var startPos, delta, fullRect; + var $document = $(document); + var $elem = data.$elem; + var $scaler = data.$scaler; + var $img = data.$img; + + // drag the image and load a new detail on mouse up + var dragStart = function (evt) { + console.debug("dragstart at=",evt); + // don't start dragging if not zoomed + if (isFullArea(data.zoomArea)) return false; + startPos = geom.position(evt); + delta = null; + // set low res background immediately on mousedown + fullRect = setZoomBG(data); + $document.bind("mousemove.dlZoomDrag", dragMove); + $document.bind("mouseup.dlZoomDrag", dragEnd); + return false; + }; + + // mousemove handler: drag zoomed image + var dragMove = function (evt) { + var pos = geom.position(evt); + delta = startPos.delta(pos); + if (fullRect) { + var bgPos = fullRect.getPosition().add(delta); + } else { + var bgPos = delta; + } + // move the background image to the new position + $scaler.css({ + 'background-position' : bgPos.x + "px " + bgPos.y + "px" + }); + // set birdview indicator to reflect new zoom position + var za = geom.rectangle($img); + za.addPosition(delta.neg()); + setBirdZoom(data, za); + return false; + }; + + // mouseup handler: reload zoomed image in new position + var dragEnd = function (evt) { + $scaler.css('cursor', 'auto'); + $document.unbind("mousemove.dlZoomDrag", dragMove); + $document.unbind("mouseup.dlZoomDrag", dragEnd); + if (delta == null || delta.distance() < 2) { + // no movement + $img.css('visibility', 'visible'); + $scaler.css({'opacity' : '1', 'background-image' : 'none'}); + return false; + } + // get old zoom area (screen coordinates) + var za = geom.rectangle($img); + // move + za.addPosition(delta.neg()); + // transform back + var newArea = data.imgTrafo.invtransform(za); + data.zoomArea = FULL_AREA.fit(newArea); + redisplay(data); + return false; + }; + + // clear old handler + $document.unbind(".dlZoomDrag"); + $scaler.unbind(".dlZoomDrag"); + if (! isFullArea(data.zoomArea)) { + // set handler + $scaler.bind("mousedown.dlZoomDrag", dragStart); + } + }; + + // get image quality as a number (0..2) + var getQuality = function (data) { + var flags = data.scalerFlags; + var q = flags.q2 || flags.q1 || 'q0'; // assume q0 as default + return parseInt(q[1], 10); + }; + + // set image quality as a number (0..2) + var setQuality = function (data, qual) { + var flags = data.scalerFlags; + // clear flags + for (var i = 0; i < 3; ++i) { + delete flags['q'+i]; + } + flags['q'+qual] = 'q'+qual; + }; + + // sets a key to a value (relative values with +/- if relative=true) + var setNumValue = function(settings, key, value) { + if (value == null) return null; + if (isNumber(value)) { + settings[key] = value; + return value; + } + var sign = value[0]; + if (sign === '+' || sign === '-') { + if (settings[key] == null) { + // this isn't perfect but still... + settings[key] = 0; + } + settings[key] = parseFloat(settings[key]) + parseFloat(value); + } else { + settings[key] = value; + } + return settings[key]; + }; + + // auxiliary function (from old dllib.js) + var isFullArea = function(area) { + return (area.width === 1.0) && (area.height === 1.0); + }; + + // auxiliary function (from Douglas Crockford, A.10) + var isNumber = function isNumber(value) { + return typeof value === 'number' && isFinite(value); + }; + + // auxiliary function to crop senseless precision + var cropFloat = function (x) { + return parseInt(10000 * x, 10) / 10000; + }; + + // fallback for console.log calls + if (customConsole) { + var logFunction = function(type) { + return function(){ + var $debug = $('#debug'); // debug div + if (!$debug) return; + var args = Array.prototype.slice.call(arguments); + var argtext = args.join(' '); + var $logDiv = $('<div/>'); + $logDiv.addClass(type); + $logDiv.text(argtext); + $debug.append($logDiv); + }; + }; + console.log = logFunction('_log'); + console.debug = logFunction('_debug'); + console.error = logFunction('_error'); + } + + // hook plugin into jquery + $.fn.digilib = function(action) { + if (actions[action]) { + // call action on this with the remaining arguments (inserting data as first argument) + var $elem = $(this); + var data = $elem.data('digilib'); + var args = Array.prototype.slice.call(arguments, 1); + args.unshift(data); + return actions[action].apply(this, args); + } else if (typeof(action) === 'object' || !action) { + // call init on this + return actions.init.apply(this, arguments); + } else { + $.error('action ' + action + ' does not exist on jQuery.digilib'); + } + }; + +})(jQuery); \ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.button.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,373 @@ +/* + * jQuery UI Button 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function( event ) { + $( ":ui-button", event.target.form ).each(function() { + var inst = $( this ).data( "button" ); + setTimeout(function() { + inst.refresh(); + }, 1 ); + }); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.attr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + $( this ).addClass( focusClass ); + }) + .bind( "blur.button", function() { + $( this ).removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + self.refresh(); + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", true ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else { + if ( this.element.is(":radio") ) { + this.type = "radio"; + } else { + if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + } + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + this.buttonElement = this.element.parents().last() + .find( "label[for=" + this.element.attr("id") + "]" ); + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.attr( "disabled", true ); + } else { + this.element.removeAttr( "disabled" ); + } + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary; + if ( icons.primary || icons.secondary ) { + buttonElement.addClass( "ui-button-text-icon" + + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + if ( !this.options.text ) { + buttonElement + .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ) + .removeClass( "ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary" ); + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonElement.addClass( "ui-button-text-only" ); + } + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) );
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.core.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,308 @@ +/*! + * jQuery UI 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.9", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + var nodeName = element.nodeName.toLowerCase(), + tabIndex = $.attr( element, "tabindex" ); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || !isNaN( tabIndex ) + : !isNaN( tabIndex )) + // the element and all of its ancestors must be visible + && visible( element ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ); + return ( isNaN( tabIndex ) || tabIndex >= 0 ) && $( element ).is( ":focusable" ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery );
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.dialog.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,857 @@ +/* + * jQuery UI Dialog 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .attr( props, true ) + .unbind('click') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.9", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery));
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.draggable.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,797 @@ +/* + * jQuery UI Draggable 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue if helper is set to "original" + if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + (o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.9" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.mouse.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,151 @@ +/*! + * jQuery UI Mouse 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + // TODO: figure out why we have to use originalEvent + event.originalEvent = event.originalEvent || {}; + if (event.originalEvent.mouseHandled) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + event.originalEvent.mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.position.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,252 @@ +/* + * jQuery UI Position 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery ));
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.resizable.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,812 @@ +/* + * jQuery UI Resizable 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (data.height) data.width = (csize.height * this.aspectRatio); + else if (data.width) data.height = (csize.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.9" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.slider.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,682 @@ +/* + * jQuery UI Slider 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + if ( o.disabled ) { + this.element.addClass( "ui-slider-disabled ui-disabled" ); + } + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + this.range = $( "<div></div>" ); + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } else { + this.range = $( "<div></div>" ); + } + + this.range + .appendTo( this.element ) + .addClass( "ui-slider-range" ); + + if ( o.range === "min" || o.range === "max" ) { + this.range.addClass( "ui-slider-range-" + o.range ); + } + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + this.range.addClass( "ui-widget-header" ); + } + + if ( $( ".ui-slider-handle", this.element ).length === 0 ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + + if ( o.values && o.values.length ) { + while ( $(".ui-slider-handle", this.element).length < o.values.length ) { + $( "<a href='#'></a>" ) + .appendTo( this.element ) + .addClass( "ui-slider-handle" ); + } + } + + this.handles = $( ".ui-slider-handle", this.element ) + .addClass( "ui-state-default" + + " ui-corner-all" ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.attr( "disabled", "disabled" ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.removeAttr( "disabled" ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step; + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.9" +}); + +}(jQuery));
--- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/client/digitallibrary/jquery/ui/jquery.ui.widget.js Mon Feb 07 09:12:47 2011 +0100 @@ -0,0 +1,262 @@ +/*! + * jQuery UI Widget 1.8.9 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery );
--- a/servlet/src/digilib/io/DocuDirCache.java Tue Jan 11 21:08:12 2011 +0100 +++ b/servlet/src/digilib/io/DocuDirCache.java Mon Feb 07 09:12:47 2011 +0100 @@ -104,6 +104,7 @@ */ public void put(DocuDirectory newdir) { String s = newdir.getDirName(); + logger.debug("DocuDirCache.put for "+s+" in "+this); if (map.containsKey(s)) { logger.warn("Duplicate key in DocuDirCache.put -- ignoring!"); } else { @@ -117,7 +118,7 @@ * * @param newDir */ - public synchronized void putDir(DocuDirectory newDir) { + public void putDir(DocuDirectory newDir) { put(newDir); String parent = FileOps.parent(newDir.getDirName()); if (parent != "") {
--- a/servlet/src/digilib/servlet/Scaler.java Tue Jan 11 21:08:12 2011 +0100 +++ b/servlet/src/digilib/servlet/Scaler.java Mon Feb 07 09:12:47 2011 +0100 @@ -126,20 +126,17 @@ * * @see javax.servlet.http.HttpServlet#getLastModified(javax.servlet.http.HttpServletRequest) */ - protected long getLastModified(HttpServletRequest request) { + public long getLastModified(HttpServletRequest request) { accountlog.debug("GetLastModified from " + request.getRemoteAddr() + " for " + request.getQueryString()); long mtime = -1; // create new request DigilibRequest dlReq = new DigilibRequest(request); - // find the file(set) - DocuDirent f = dirCache.getFile(dlReq.getFilePath(), - dlReq.getAsInt("pn"), FileClass.IMAGE); - // find the requested file - if (f != null) { - DocuDirectory dd = (DocuDirectory) f.getParent(); + DocuDirectory dd = dirCache.getDirectory(dlReq.getFilePath()); + if (dd != null) { mtime = dd.getDirMTime() / 1000 * 1000; } + logger.debug(" returns "+mtime); return mtime; } @@ -161,7 +158,19 @@ } - /** Service this request using the response. + protected void doHead(HttpServletRequest req, HttpServletResponse resp) + throws ServletException, IOException { + logger.debug("HEAD from "+req.getRemoteAddr()); + super.doHead(req, resp); + } + + protected void doOptions(HttpServletRequest req, HttpServletResponse resp) + throws ServletException, IOException { + logger.debug("OPTIONS from "+req.getRemoteAddr()); + super.doOptions(req, resp); + } + + /** Service this request using the response. * @param request * @param response * @throws ServletException